summaryrefslogtreecommitdiffstats
diff options
context:
space:
mode:
authorAlan Mishchenko <alanmi@berkeley.edu>2014-09-16 11:56:40 -0700
committerAlan Mishchenko <alanmi@berkeley.edu>2014-09-16 11:56:40 -0700
commit1d5cb52e4ab8649c7f02bddea086bbf57c9d3c20 (patch)
tree4ecce5c18aa6b37a4d5fa423a1c9a47ac3a321e2
parent61e58b2d56245ec74d968d181d2535ad2029d71d (diff)
downloadabc-1d5cb52e4ab8649c7f02bddea086bbf57c9d3c20.tar.gz
abc-1d5cb52e4ab8649c7f02bddea086bbf57c9d3c20.tar.bz2
abc-1d5cb52e4ab8649c7f02bddea086bbf57c9d3c20.zip
Improvements to Boolean matching.
-rw-r--r--src/map/if/ifTune.c755
-rw-r--r--src/misc/util/utilTruth.h14
2 files changed, 568 insertions, 201 deletions
diff --git a/src/map/if/ifTune.c b/src/map/if/ifTune.c
index 223882b8..d21ebad0 100644
--- a/src/map/if/ifTune.c
+++ b/src/map/if/ifTune.c
@@ -23,12 +23,17 @@
#include "sat/bsat/satStore.h"
#include "sat/cnf/cnf.h"
#include "misc/extra/extra.h"
+#include "bool/kit/kit.h"
ABC_NAMESPACE_IMPL_START
////////////////////////////////////////////////////////////////////////
/// DECLARATIONS ///
////////////////////////////////////////////////////////////////////////
+
+#define IFN_INS 11
+#define IFN_WRD (IFN_INS > 6 ? 1 << (IFN_INS-6) : 1)
+#define IFN_PAR 1024
// network types
typedef enum {
@@ -41,10 +46,119 @@ typedef enum {
IF_DSD_PRIME // 6: PRIME
} If_DsdType_t;
+// object types
+static char * Ifn_Symbs[16] = {
+ NULL, // 0: unknown
+ "const", // 1: constant
+ "var", // 2: variable
+ "()", // 3: AND
+ "[]", // 4: XOR
+ "<>", // 5: MUX
+ "{}" // 6: PRIME
+};
+
+typedef struct Ift_Obj_t_ Ift_Obj_t;
+typedef struct Ift_Ntk_t_ Ift_Ntk_t;
+
+struct Ift_Obj_t_
+{
+ unsigned Type : 3; // node type
+ unsigned nFanins : 5; // fanin counter
+ unsigned iFirst : 8; // first parameter
+ unsigned Var : 16; // current variable
+ int Fanins[IFN_INS]; // fanin IDs
+};
+struct Ift_Ntk_t_
+{
+ // cell structure
+ int nInps; // inputs
+ int nObjs; // objects
+ Ift_Obj_t Nodes[2*IFN_INS]; // nodes
+ // constraints
+ int pConstr[IFN_INS]; // constraint pairs
+ int nConstr; // number of pairs
+ // user data
+ int nVars; // variables
+ int nWords; // truth table words
+ int nParsVNum; // selection parameters per variable
+ int nParsVIni; // first selection parameter
+ int nPars; // total parameters
+ word * pTruth; // user truth table
+ // matching procedures
+ int Values[IFN_PAR]; // variable values
+ word pTtElems[IFN_INS*IFN_WRD]; // elementary truth tables
+ word pTtObjs[2*IFN_INS*IFN_WRD]; // object truth tables
+};
+
+static inline word * Ift_ElemTruth( Ift_Ntk_t * p, int i ) { return p->pTtElems + i * Abc_TtWordNum(p->nInps); }
+static inline word * Ift_ObjTruth( Ift_Ntk_t * p, int i ) { return p->pTtObjs + i * p->nWords; }
+
+// variable ordering
+// - primary inputs [0; p->nInps)
+// - internal nodes [p->nInps; p->nObjs)
+// - configuration params [p->nObjs; p->nParsVIni)
+// - variable selection params [p->nParsVIni; p->pPars)
+
////////////////////////////////////////////////////////////////////////
/// FUNCTION DEFINITIONS ///
////////////////////////////////////////////////////////////////////////
-
+
+/**Function*************************************************************
+
+ Synopsis [Prepare network to check the given function.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+int Ifn_Prepare( Ift_Ntk_t * p, word * pTruth, int nVars )
+{
+ int i, fVerbose = 0;
+ assert( nVars <= p->nInps );
+ p->pTruth = pTruth;
+ p->nVars = nVars;
+ p->nWords = Abc_TtWordNum(nVars);
+ p->nPars = p->nObjs;
+ for ( i = p->nInps; i < p->nObjs; i++ )
+ {
+ if ( p->Nodes[i].Type != IF_DSD_PRIME )
+ continue;
+ p->Nodes[i].iFirst = p->nPars;
+ p->nPars += (1 << p->Nodes[i].nFanins);
+ if ( fVerbose )
+ printf( "Node %d Start %d Vars %d\n", i, p->Nodes[i].iFirst, (1 << p->Nodes[i].nFanins) );
+ }
+ if ( fVerbose )
+ printf( "Groups start %d\n", p->nPars );
+ p->nParsVIni = p->nPars;
+ p->nParsVNum = Abc_Base2Log(nVars);
+ p->nPars += p->nParsVNum * p->nInps;
+ assert( p->nPars <= IFN_PAR );
+ memset( p->Values, 0xFF, sizeof(int) * p->nPars );
+ return p->nPars;
+}
+void Ifn_NtkPrint( Ift_Ntk_t * p )
+{
+ int i, k;
+ if ( p == NULL )
+ printf( "String is empty.\n" );
+ if ( p == NULL )
+ return;
+ for ( i = p->nInps; i < p->nObjs; i++ )
+ {
+ printf( "%c=", 'a'+i );
+ printf( "%c", Ifn_Symbs[p->Nodes[i].Type][0] );
+ for ( k = 0; k < (int)p->Nodes[i].nFanins; k++ )
+ printf( "%c", 'a'+p->Nodes[i].Fanins[k] );
+ printf( "%c", Ifn_Symbs[p->Nodes[i].Type][1] );
+ printf( ";" );
+ }
+ printf( "\n" );
+}
+
/**Function*************************************************************
Synopsis []
@@ -56,7 +170,7 @@ typedef enum {
SeeAlso []
***********************************************************************/
-int If_ManStrCheck( char * pStr, int * pnVars, int * pnObjs )
+int Ifn_ManStrCheck( char * pStr, int * pnInps, int * pnObjs )
{
int i, Marks[32] = {0}, MaxVar = 0, MaxDef = 0, RetValue = 1;
for ( i = 0; pStr[i]; i++ )
@@ -110,141 +224,207 @@ int If_ManStrCheck( char * pStr, int * pnVars, int * pnObjs )
printf( "String \"%s\" has no definition for internal variable (%c).\n", pStr, 'a' + i ), RetValue = 0;
if ( !RetValue )
return 0;
- *pnVars = MaxVar;
+ *pnInps = MaxVar;
*pnObjs = MaxDef;
return 1;
}
-int If_ManStrParse( char * pStr, int nVars, int nObjs, int * pTypes, int * pnFans, int ppFans[][6], int * pFirsts, int * pnSatVars )
+Ift_Ntk_t * Ifn_ManStrParse( char * pStr )
{
- int i, k, n, f, nPars = nVars;
- char Next = 0;
- assert( nVars < nObjs );
- for ( i = nVars; i < nObjs; i++ )
+ int i, k, n, f, nFans, iFan;
+ static Ift_Ntk_t P, * p = &P;
+ memset( p, 0, sizeof(Ift_Ntk_t) );
+ if ( !Ifn_ManStrCheck(pStr, &p->nInps, &p->nObjs) )
+ return NULL;
+ if ( p->nInps > IFN_INS )
{
+ printf( "The number of variables (%d) exceeds predefined limit (%d). Recompile with different value of IFN_INS.\n", p->nInps, IFN_INS );
+ return NULL;
+ }
+ assert( p->nInps > 1 && p->nInps < p->nObjs && p->nInps <= IFN_INS && p->nObjs < 2*IFN_INS );
+ for ( i = p->nInps; i < p->nObjs; i++ )
+ {
+ char Next = 0;
for ( k = 0; pStr[k]; k++ )
if ( pStr[k] == 'a' + i && pStr[k+1] == '=' )
break;
- assert( pStr[k] );
+ if ( pStr[k] == 0 )
+ {
+ printf( "Cannot find definition of signal %c.\n", 'a' + i );
+ return NULL;
+ }
if ( pStr[k+2] == '(' )
- pTypes[i] = IF_DSD_AND, Next = ')';
+ p->Nodes[i].Type = IF_DSD_AND, Next = ')';
else if ( pStr[k+2] == '[' )
- pTypes[i] = IF_DSD_XOR, Next = ']';
+ p->Nodes[i].Type = IF_DSD_XOR, Next = ']';
else if ( pStr[k+2] == '<' )
- pTypes[i] = IF_DSD_MUX, Next = '>';
+ p->Nodes[i].Type = IF_DSD_MUX, Next = '>';
else if ( pStr[k+2] == '{' )
- pTypes[i] = IF_DSD_PRIME, Next = '}';
- else assert( 0 );
+ p->Nodes[i].Type = IF_DSD_PRIME, Next = '}';
+ else
+ {
+ printf( "Cannot find openning operation symbol in the defition of of signal %c.\n", 'a' + i );
+ return NULL;
+ }
for ( n = k + 3; pStr[n]; n++ )
if ( pStr[n] == Next )
break;
- assert( pStr[k] );
- pnFans[i] = n - k - 3;
- assert( pnFans[i] > 0 && pnFans[i] <= 6 );
- for ( f = 0; f < pnFans[i]; f++ )
+ if ( pStr[n] == 0 )
{
- ppFans[i][f] = pStr[k + 3 + f] - 'a';
- assert( ppFans[i][k] < i );
- if ( ppFans[i][f] < 0 || ppFans[i][f] >= nObjs )
- printf( "Error!\n" );
+ printf( "Cannot find closing operation symbol in the defition of of signal %c.\n", 'a' + i );
+ return NULL;
}
- if ( pTypes[i] != IF_DSD_PRIME )
- continue;
- pFirsts[i] = nPars;
- nPars += (1 << pnFans[i]);
+ nFans = n - k - 3;
+ if ( nFans < 1 || nFans > 8 )
+ {
+ printf( "Cannot find matching operation symbol in the defition of of signal %c.\n", 'a' + i );
+ return NULL;
+ }
+ for ( f = 0; f < nFans; f++ )
+ {
+ iFan = pStr[k + 3 + f] - 'a';
+ if ( iFan < 0 || iFan >= i )
+ {
+ printf( "Fanin number %d is signal %d is out of range.\n", f, 'a' + i );
+ return NULL;
+ }
+ p->Nodes[i].Fanins[f] = iFan;
+ }
+ p->Nodes[i].nFanins = nFans;
}
- *pnSatVars = nPars;
- return 1;
+ // truth tables
+ Abc_TtElemInit2( p->pTtElems, p->nInps );
+/*
+ // constraints
+ p->nConstr = 5;
+ p->pConstr[0] = (0 << 16) | 1;
+
+ p->pConstr[1] = (2 << 16) | 3;
+ p->pConstr[2] = (3 << 16) | 4;
+
+ p->pConstr[3] = (6 << 16) | 7;
+ p->pConstr[4] = (7 << 16) | 8;
+*/
+ return p;
}
-Gia_Man_t * If_ManStrFindModel( int nVars, int nObjs, int nSatVars, int * pTypes, int * pnFans, int ppFans[][6], int * pFirsts )
+
+/**Function*************************************************************
+
+ Synopsis [Derive truth table given the configulation values.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+word * Ift_NtkDeriveTruth( Ift_Ntk_t * p, int * pValues )
{
- Gia_Man_t * pNew, * pTemp;
- int * pVarsPar, * pVarsObj;
- int i, k, n, Step, iLit, nMints, nPars = 0;
- pNew = Gia_ManStart( 1000 );
- pNew->pName = Abc_UtilStrsav( "model" );
- Gia_ManHashStart( pNew );
- pVarsPar = ABC_ALLOC( int, nSatVars );
- pVarsObj = ABC_ALLOC( int, nObjs );
- for ( i = 0; i < nSatVars; i++ )
- pVarsPar[i] = Gia_ManAppendCi(pNew);
- for ( i = 0; i < nVars; i++ )
- pVarsObj[i] = pVarsPar[nSatVars - nVars + i];
- for ( i = nVars; i < nObjs; i++ )
+ int i, v, f, iVar, iStart;
+ // elementary variables
+ for ( i = 0; i < p->nInps; i++ )
{
- if ( pTypes[i] == IF_DSD_AND )
+ // find variable
+ iStart = p->nParsVIni + i * p->nParsVNum;
+ for ( v = iVar = 0; v < p->nParsVNum; v++ )
+ if ( p->Values[iStart+v] )
+ iVar += (1 << v);
+ // assign variable
+ Abc_TtCopy( Ift_ObjTruth(p, i), Ift_ElemTruth(p, iVar), p->nWords, 0 );
+ }
+ // internal variables
+ for ( i = p->nInps; i < p->nObjs; i++ )
+ {
+ int nFans = p->Nodes[i].nFanins;
+ int * pFans = p->Nodes[i].Fanins;
+ word * pTruth = Ift_ObjTruth( p, i );
+ if ( p->Nodes[i].Type == IF_DSD_AND )
{
- iLit = 1;
- for ( k = 0; k < pnFans[i]; k++ )
- iLit = Gia_ManHashAnd( pNew, iLit, pVarsObj[ppFans[i][k]] );
- pVarsObj[i] = iLit;
+ Abc_TtFill( pTruth, p->nWords );
+ for ( f = 0; f < nFans; f++ )
+ Abc_TtAnd( pTruth, pTruth, Ift_ObjTruth(p, pFans[f]), p->nWords, 0 );
}
- else if ( pTypes[i] == IF_DSD_XOR )
+ else if ( p->Nodes[i].Type == IF_DSD_XOR )
{
- iLit = 0;
- for ( k = 0; k < pnFans[i]; k++ )
- iLit = Gia_ManHashXor( pNew, iLit, pVarsObj[ppFans[i][k]] );
- pVarsObj[i] = iLit;
+ Abc_TtClear( pTruth, p->nWords );
+ for ( f = 0; f < nFans; f++ )
+ Abc_TtXor( pTruth, pTruth, Ift_ObjTruth(p, pFans[f]), p->nWords, 0 );
}
- else if ( pTypes[i] == IF_DSD_MUX )
+ else if ( p->Nodes[i].Type == IF_DSD_MUX )
{
- assert( pnFans[i] == 3 );
- pVarsObj[i] = Gia_ManHashMux( pNew, pVarsObj[ppFans[i][0]], pVarsObj[ppFans[i][1]], pVarsObj[ppFans[i][2]] );
+ assert( nFans == 3 );
+ Abc_TtMux( pTruth, Ift_ObjTruth(p, pFans[0]), Ift_ObjTruth(p, pFans[1]), Ift_ObjTruth(p, pFans[2]), p->nWords );
}
- else if ( pTypes[i] == IF_DSD_PRIME )
+ else if ( p->Nodes[i].Type == IF_DSD_PRIME )
{
- int pVarsData[64];
- assert( pnFans[i] >= 1 && pnFans[i] <= 6 );
- nMints = (1 << pnFans[i]);
- for ( k = 0; k < nMints; k++ )
- pVarsData[k] = pVarsPar[nPars++];
- for ( Step = 1, k = 0; k < pnFans[i]; k++, Step <<= 1 )
- for ( n = 0; n < nMints; n += Step << 1 )
- pVarsData[n] = Gia_ManHashMux( pNew, pVarsObj[ppFans[i][k]], pVarsData[n+Step], pVarsData[n] );
- assert( Step == nMints );
- pVarsObj[i] = pVarsData[0];
+ int nValues = (1 << nFans);
+ word * pTemp = Ift_ObjTruth(p, p->nObjs);
+ Abc_TtClear( pTruth, p->nWords );
+ for ( v = 0; v < nValues; v++ )
+ {
+ if ( pValues[p->Nodes[i].iFirst + v] == 0 )
+ continue;
+ Abc_TtFill( pTemp, p->nWords );
+ for ( f = 0; f < nFans; f++ )
+ if ( (v >> f) & 1 )
+ Abc_TtAnd( pTemp, pTemp, Ift_ObjTruth(p, pFans[f]), p->nWords, 0 );
+ else
+ Abc_TtSharp( pTemp, pTemp, Ift_ObjTruth(p, pFans[f]), p->nWords );
+ Abc_TtOr( pTruth, pTruth, pTemp, p->nWords );
+ }
}
else assert( 0 );
+//Dau_DsdPrintFromTruth( pTruth, p->nVars );
}
- assert( nPars + nVars == nSatVars );
- Gia_ManAppendCo( pNew, pVarsObj[nObjs-1] );
- pNew = Gia_ManCleanup( pTemp = pNew );
- Gia_ManStop( pTemp );
- ABC_FREE( pVarsPar );
- ABC_FREE( pVarsObj );
- assert( Gia_ManPiNum(pNew) == nSatVars );
- assert( Gia_ManPoNum(pNew) == 1 );
- return pNew;
+ return Ift_ObjTruth(p, p->nObjs-1);
}
-Gia_Man_t * If_ManStrFindCofactors( int nPars, Gia_Man_t * p )
+
+/**Function*************************************************************
+
+ Synopsis [Compute more or equal]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+void Ift_TtComparisonConstr( word * pTruth, int nVars, int fMore, int fEqual )
{
- Gia_Man_t * pNew, * pTemp;
- Gia_Obj_t * pObj;
- int i, m, nMints = 1 << (Gia_ManCiNum(p) - nPars);
- pNew = Gia_ManStart( Gia_ManObjNum(p) );
- pNew->pName = Abc_UtilStrsav( p->pName );
- Gia_ManHashAlloc( pNew );
- Gia_ManConst0(p)->Value = 0;
- Gia_ManForEachCi( p, pObj, i )
- if ( i < nPars )
- pObj->Value = Gia_ManAppendCi( pNew );
- for ( m = 0; m < nMints; m++ )
+ word Cond[4], Equa[4], Temp[4];
+ word s_TtElems[8][4] = {
+ ABC_CONST(0xAAAAAAAAAAAAAAAA),ABC_CONST(0xAAAAAAAAAAAAAAAA),ABC_CONST(0xAAAAAAAAAAAAAAAA),ABC_CONST(0xAAAAAAAAAAAAAAAA),
+ ABC_CONST(0xCCCCCCCCCCCCCCCC),ABC_CONST(0xCCCCCCCCCCCCCCCC),ABC_CONST(0xCCCCCCCCCCCCCCCC),ABC_CONST(0xCCCCCCCCCCCCCCCC),
+ ABC_CONST(0xF0F0F0F0F0F0F0F0),ABC_CONST(0xF0F0F0F0F0F0F0F0),ABC_CONST(0xF0F0F0F0F0F0F0F0),ABC_CONST(0xF0F0F0F0F0F0F0F0),
+ ABC_CONST(0xFF00FF00FF00FF00),ABC_CONST(0xFF00FF00FF00FF00),ABC_CONST(0xFF00FF00FF00FF00),ABC_CONST(0xFF00FF00FF00FF00),
+ ABC_CONST(0xFFFF0000FFFF0000),ABC_CONST(0xFFFF0000FFFF0000),ABC_CONST(0xFFFF0000FFFF0000),ABC_CONST(0xFFFF0000FFFF0000),
+ ABC_CONST(0xFFFFFFFF00000000),ABC_CONST(0xFFFFFFFF00000000),ABC_CONST(0xFFFFFFFF00000000),ABC_CONST(0xFFFFFFFF00000000),
+ ABC_CONST(0x0000000000000000),ABC_CONST(0xFFFFFFFFFFFFFFFF),ABC_CONST(0x0000000000000000),ABC_CONST(0xFFFFFFFFFFFFFFFF),
+ ABC_CONST(0x0000000000000000),ABC_CONST(0x0000000000000000),ABC_CONST(0xFFFFFFFFFFFFFFFF),ABC_CONST(0xFFFFFFFFFFFFFFFF)
+ };
+ int i, nWords = Abc_TtWordNum(2*nVars);
+ assert( nVars > 0 && nVars <= 4 );
+ Abc_TtClear( pTruth, nWords );
+ Abc_TtFill( Equa, nWords );
+ for ( i = nVars - 1; i >= 0; i-- )
{
- Gia_ManForEachCi( p, pObj, i )
- if ( i >= nPars )
- pObj->Value = ((m >> (i - nPars)) & 1);
- Gia_ManForEachAnd( p, pObj, i )
- pObj->Value = Gia_ManHashAnd( pNew, Gia_ObjFanin0Copy(pObj), Gia_ObjFanin1Copy(pObj) );
- Gia_ManForEachPo( p, pObj, i )
- pObj->Value = Gia_ManAppendCo( pNew, Gia_ObjFanin0Copy(pObj) );
+ if ( fMore )
+ Abc_TtSharp( Cond, s_TtElems[2*i+1], s_TtElems[2*i+0], nWords );
+ else
+ Abc_TtSharp( Cond, s_TtElems[2*i+0], s_TtElems[2*i+1], nWords );
+ Abc_TtAnd( Temp, Equa, Cond, nWords, 0 );
+ Abc_TtOr( pTruth, pTruth, Temp, nWords );
+ Abc_TtXor( Temp, s_TtElems[2*i+0], s_TtElems[2*i+1], nWords, 1 );
+ Abc_TtAnd( Equa, Equa, Temp, nWords, 0 );
}
- pNew = Gia_ManCleanup( pTemp = pNew );
- Gia_ManStop( pTemp );
- return pNew;
+ if ( fEqual )
+ Abc_TtNot( pTruth, nWords );
}
/**Function*************************************************************
- Synopsis []
+ Synopsis [Adds parameter constraints.]
Description []
@@ -253,70 +433,86 @@ Gia_Man_t * If_ManStrFindCofactors( int nPars, Gia_Man_t * p )
SeeAlso []
***********************************************************************/
-static inline Cnf_Dat_t * Cnf_DeriveGiaRemapped( Gia_Man_t * p )
+void Ift_AddClause( sat_solver * pSat, int * pBeg, int * pEnd )
{
- Cnf_Dat_t * pCnf;
- Aig_Man_t * pAig = Gia_ManToAigSimple( p );
- pAig->nRegs = 0;
- pCnf = Cnf_Derive( pAig, Aig_ManCoNum(pAig) );
- Aig_ManStop( pAig );
- return pCnf;
+ int fVerbose = 0;
+ int RetValue = sat_solver_addclause( pSat, pBeg, pEnd );
+ if ( fVerbose )
+ {
+ for ( ; pBeg < pEnd; pBeg++ )
+ printf( "%c%d ", Abc_LitIsCompl(*pBeg) ? '-':'+', Abc_Lit2Var(*pBeg) );
+ printf( "\n" );
+ }
+ assert( RetValue );
}
-sat_solver * If_ManStrFindSolver( Gia_Man_t * p, Vec_Int_t ** pvPiVars, Vec_Int_t ** pvPoVars )
+void Ift_NtkAddConstrOne( sat_solver * pSat, Vec_Int_t * vCover, int * pVars, int nVars )
{
- sat_solver * pSat;
- Gia_Obj_t * pObj;
- Cnf_Dat_t * pCnf;
- int i;
- pCnf = Cnf_DeriveGiaRemapped( p );
- // start the SAT solver
- pSat = sat_solver_new();
- sat_solver_setnvars( pSat, pCnf->nVars );
- // add timeframe clauses
- for ( i = 0; i < pCnf->nClauses; i++ )
- if ( !sat_solver_addclause( pSat, pCnf->pClauses[i], pCnf->pClauses[i+1] ) )
- assert( 0 );
- // inputs/outputs
- *pvPiVars = Vec_IntAlloc( Gia_ManPiNum(p) );
- Gia_ManForEachCi( p, pObj, i )
- Vec_IntPush( *pvPiVars, pCnf->pVarNums[Gia_ObjId(p, pObj)] );
- *pvPoVars = Vec_IntAlloc( Gia_ManPoNum(p) );
- Gia_ManForEachCo( p, pObj, i )
- Vec_IntPush( *pvPoVars, pCnf->pVarNums[Gia_ObjId(p, pObj)] );
- Cnf_DataFree( pCnf );
- return pSat;
+ int k, c, Cube, Literal, nLits, pLits[IFN_INS];
+ Vec_IntForEachEntry( vCover, Cube, c )
+ {
+ nLits = 0;
+ for ( k = 0; k < nVars; k++ )
+ {
+ Literal = 3 & (Cube >> (k << 1));
+ if ( Literal == 1 ) // '0' -> pos lit
+ pLits[nLits++] = Abc_Var2Lit(pVars[k], 0);
+ else if ( Literal == 2 ) // '1' -> neg lit
+ pLits[nLits++] = Abc_Var2Lit(pVars[k], 1);
+ else if ( Literal != 0 )
+ assert( 0 );
+ }
+ Ift_AddClause( pSat, pLits, pLits + nLits );
+ }
}
-
-sat_solver * If_ManSatBuild( char * pStr, Vec_Int_t ** pvPiVars, Vec_Int_t ** pvPoVars )
+void Ift_NtkAddConstraints( Ift_Ntk_t * p, sat_solver * pSat )
{
- int nVars, nObjs, nSatVars;
- int pTypes[32] = {0};
- int pnFans[32] = {0};
- int ppFans[32][6] = {{0}};
- int pFirsts[32] = {0};
- Gia_Man_t * p1, * p2;
- sat_solver * pSat = NULL;
- *pvPiVars = *pvPoVars = NULL;
- if ( !If_ManStrCheck(pStr, &nVars, &nObjs) )
- return NULL;
- if ( !If_ManStrParse(pStr, nVars, nObjs, pTypes, pnFans, ppFans, pFirsts, &nSatVars) )
- return NULL;
- p1 = If_ManStrFindModel(nVars, nObjs, nSatVars, pTypes, pnFans, ppFans, pFirsts);
- if ( p1 == NULL )
- return NULL;
-// Gia_AigerWrite( p1, "satbuild.aig", 0, 0 );
- p2 = If_ManStrFindCofactors( nSatVars - nVars, p1 );
- Gia_ManStop( p1 );
- if ( p2 == NULL )
- return NULL;
-// Gia_AigerWrite( p2, "satbuild2.aig", 0, 0 );
- pSat = If_ManStrFindSolver( p2, pvPiVars, pvPoVars );
- Gia_ManStop( p2 );
- return pSat;
+ int fAddConstr = 0;
+ Vec_Int_t * vCover = Vec_IntAlloc( 0 );
+ word uTruth = Abc_Tt6Stretch( ~Abc_Tt6Mask(p->nVars), p->nParsVNum );
+ assert( p->nParsVNum <= 4 );
+ if ( uTruth )
+ {
+ int i, k, pVars[IFN_INS];
+ int RetValue = Kit_TruthIsop( (unsigned *)&uTruth, p->nParsVNum, vCover, 0 );
+ assert( RetValue == 0 );
+// Dau_DsdPrintFromTruth( &uTruth, p->nParsVNum );
+ // add capacity constraints
+ for ( i = 0; i < p->nInps; i++ )
+ {
+ for ( k = 0; k < p->nParsVNum; k++ )
+ pVars[k] = p->nParsVIni + i * p->nParsVNum + k;
+ Ift_NtkAddConstrOne( pSat, vCover, pVars, p->nParsVNum );
+ }
+ }
+ // ordering constraints
+ if ( fAddConstr && p->nConstr )
+ {
+ word pTruth[4];
+ int i, k, RetValue, pVars[2*IFN_INS];
+ int fForceDiff = (p->nVars == p->nInps);
+ Ift_TtComparisonConstr( pTruth, p->nParsVNum, fForceDiff, fForceDiff );
+ RetValue = Kit_TruthIsop( (unsigned *)pTruth, 2*p->nParsVNum, vCover, 0 );
+ assert( RetValue == 0 );
+// Kit_TruthIsopPrintCover( vCover, 2*p->nParsVNum, 0 );
+ for ( i = 0; i < p->nConstr; i++ )
+ {
+ int iVar1 = p->pConstr[i] >> 16;
+ int iVar2 = p->pConstr[i] & 0xFFFF;
+ for ( k = 0; k < p->nParsVNum; k++ )
+ {
+ pVars[2*k+0] = p->nParsVIni + iVar1 * p->nParsVNum + k;
+ pVars[2*k+1] = p->nParsVIni + iVar2 * p->nParsVNum + k;
+ }
+ Ift_NtkAddConstrOne( pSat, vCover, pVars, 2*p->nParsVNum );
+// printf( "added constraint with %d clauses for %d and %d\n", Vec_IntSize(vCover), iVar1, iVar2 );
+ }
+ }
+ Vec_IntFree( vCover );
}
+
/**Function*************************************************************
- Synopsis []
+ Synopsis [Derive clauses given variable assignment.]
Description []
@@ -325,70 +521,227 @@ sat_solver * If_ManSatBuild( char * pStr, Vec_Int_t ** pvPiVars, Vec_Int_t ** pv
SeeAlso []
***********************************************************************/
-void If_ManSatPrintPerm( char * pPerms, int nVars )
+int Ift_NtkAddClauses( Ift_Ntk_t * p, int * pValues, sat_solver * pSat )
{
- int i;
- for ( i = 0; i < nVars; i++ )
- printf( "%c", 'a' + pPerms[i] );
- printf( "\n" );
-}
-int If_ManSatCheckOne( sat_solver * pSat, Vec_Int_t * vPoVars, word * pTruth, int nVars, int * pPerm, int nVarsAll, Vec_Int_t * vLits )
-{
- int v, Value, m, mNew, nMints = (1 << nVars);
- assert( (1 << nVarsAll) == Vec_IntSize(vPoVars) );
- assert( nMints <= Vec_IntSize(vPoVars) );
- // remap minterms
- Vec_IntFill( vLits, Vec_IntSize(vPoVars), -1 );
- for ( m = 0; m < nMints; m++ )
+ int i, f, v, nLits, pLits[IFN_INS+2], pLits2[IFN_INS+2];
+ // assign new variables
+ int nSatVars = sat_solver_nvars(pSat);
+ for ( i = 0; i < p->nObjs-1; i++ )
+ p->Nodes[i].Var = nSatVars++;
+ p->Nodes[p->nObjs-1].Var = -ABC_INFINITY;
+ sat_solver_setnvars( pSat, nSatVars );
+ // verify variable values
+ for ( i = 0; i < p->nVars; i++ )
+ assert( pValues[i] != -1 );
+ for ( i = p->nVars; i < p->nObjs-1; i++ )
+ assert( pValues[i] == -1 );
+ assert( pValues[p->nObjs-1] != -1 );
+ // internal variables
+//printf( "\n" );
+ for ( i = 0; i < p->nInps; i++ )
{
- mNew = 0;
- for ( v = 0; v < nVarsAll; v++ )
+ int iParStart = p->nParsVIni + i * p->nParsVNum;
+ for ( v = 0; v < p->nVars; v++ )
{
- assert( pPerm[v] < nVars );
- if ( ((m >> pPerm[v]) & 1) )
- mNew |= (1 << v);
+ // add output literal
+ pLits[0] = Abc_Var2Lit( p->Nodes[i].Var, pValues[v]==0 );
+ // add clause literals
+ for ( f = 0; f < p->nParsVNum; f++ )
+ pLits[f+1] = Abc_Var2Lit( iParStart + f, (v >> f) & 1 );
+ Ift_AddClause( pSat, pLits, pLits+p->nParsVNum+1 );
}
- assert( Vec_IntEntry(vLits, mNew) == -1 );
- Vec_IntWriteEntry( vLits, mNew, Abc_TtGetBit(pTruth, m) );
}
- // find assumptions
- v = 0;
- Vec_IntForEachEntry( vLits, Value, m )
- if ( Value >= 0 )
- Vec_IntWriteEntry( vLits, v++, Abc_Var2Lit(Vec_IntEntry(vPoVars, m), !Value) );
- Vec_IntShrink( vLits, v );
- // run SAT solver
- Value = sat_solver_solve( pSat, Vec_IntArray(vLits), Vec_IntArray(vLits) + Vec_IntSize(vLits), 0, 0, 0, 0 );
- return (int)(Value == l_True);
+//printf( "\n" );
+ for ( i = p->nInps; i < p->nObjs; i++ )
+ {
+ int nFans = p->Nodes[i].nFanins;
+ int * pFans = p->Nodes[i].Fanins;
+ if ( p->Nodes[i].Type == IF_DSD_AND )
+ {
+ nLits = 0;
+ pLits[nLits++] = Abc_Var2Lit( p->Nodes[i].Var, 0 );
+ for ( f = 0; f < nFans; f++ )
+ {
+ pLits[nLits++] = Abc_Var2Lit( p->Nodes[pFans[f]].Var, 1 );
+ // add small clause
+ pLits2[0] = Abc_Var2Lit( p->Nodes[i].Var, 1 );
+ pLits2[1] = Abc_Var2Lit( p->Nodes[pFans[f]].Var, 0 );
+ Ift_AddClause( pSat, pLits2, pLits2 + 2 );
+ }
+ // add big clause
+ Ift_AddClause( pSat, pLits, pLits + nLits );
+ }
+ else if ( p->Nodes[i].Type == IF_DSD_XOR )
+ {
+ assert( 0 );
+ }
+ else if ( p->Nodes[i].Type == IF_DSD_MUX )
+ {
+ assert( 0 );
+ }
+ else if ( p->Nodes[i].Type == IF_DSD_PRIME )
+ {
+ int nValues = (1 << nFans);
+ int iParStart = p->Nodes[i].iFirst;
+ for ( v = 0; v < nValues; v++ )
+ {
+ nLits = 0;
+ if ( pValues[i] == -1 )
+ {
+ pLits[nLits] = Abc_Var2Lit( p->Nodes[i].Var, 0 );
+ pLits2[nLits] = Abc_Var2Lit( p->Nodes[i].Var, 1 );
+ nLits++;
+ }
+ for ( f = 0; f < nFans; f++, nLits++ )
+ pLits[nLits] = pLits2[nLits] = Abc_Var2Lit( p->Nodes[pFans[f]].Var, (v >> f) & 1 );
+ pLits[nLits] = Abc_Var2Lit( iParStart + v, 1 );
+ pLits2[nLits] = Abc_Var2Lit( iParStart + v, 0 );
+ nLits++;
+ if ( pValues[i] != 0 )
+ Ift_AddClause( pSat, pLits2, pLits2 + nLits );
+ if ( pValues[i] != 1 )
+ Ift_AddClause( pSat, pLits, pLits + nLits );
+ }
+ }
+ else assert( 0 );
+//printf( "\n" );
+ }
+ return 1;
}
-void If_ManSatDeriveOne( sat_solver * pSat, Vec_Int_t * vPiVars, Vec_Int_t * vValues )
+
+/**Function*************************************************************
+
+ Synopsis [Returns the minterm number for which there is a mismatch.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+void Ift_SatPrintStatus( sat_solver * p, int Iter, int status, int iMint, int Value, abctime clk )
{
- int i, iVar;
- Vec_IntClear( vValues );
- Vec_IntForEachEntry( vPiVars, iVar, i )
- Vec_IntPush( vValues, sat_solver_var_value(pSat, iVar) );
+ printf( "Iter = %5d ", Iter );
+ printf( "Mint = %5d ", iMint );
+ printf( "Value = %2d ", Value );
+ printf( "Var = %6d ", sat_solver_nvars(p) );
+ printf( "Cla = %6d ", sat_solver_nclauses(p) );
+ printf( "Conf = %6d ", sat_solver_nconflicts(p) );
+ if ( status == l_False )
+ printf( "status = unsat" );
+ else if ( status == l_True )
+ printf( "status = sat " );
+ else
+ printf( "status = undec" );
+ Abc_PrintTime( 1, "", clk );
}
-int If_ManSatCheckAll_int( sat_solver * pSat, Vec_Int_t * vPoVars, word * pTruth, int nVars, Vec_Int_t * vLits, char ** pPerms, int nPerms )
+void Ift_SatPrintConfig( Ift_Ntk_t * p, sat_solver * pSat )
{
- int pPerm[IF_MAX_FUNC_LUTSIZE];
- int p, i;
- for ( p = 0; p < nPerms; p++ )
+ int v;
+ for ( v = p->nObjs; v < p->nPars; v++ )
{
- for ( i = 0; i < nVars; i++ )
- pPerm[i] = (int)pPerms[p][i];
- if ( If_ManSatCheckOne(pSat, vPoVars, pTruth, nVars, pPerm, nVars, vLits) )
- return p;
+ if ( v >= p->nParsVIni && (v - p->nParsVIni) % p->nParsVNum == 0 )
+ printf( " %d=", (v - p->nParsVIni) / p->nParsVNum );
+ printf( "%d", sat_solver_var_value(pSat, v) );
}
- return -1;
+ printf( "\n" );
}
-int If_ManSatCheckAll( sat_solver * pSat, Vec_Int_t * vPoVars, word * pTruth, int nVars, Vec_Int_t * vLits, char ** pPerms, int nPerms )
+
+int Ift_NtkMatch( Ift_Ntk_t * p, word * pTruth, int nVars, int fVerbose )
{
+ word * pTruth1;
+ int RetValue = 0;
+ int nIterMax = (1<<nVars);
+ int i, v, status, iMint = 0;
abctime clk = Abc_Clock();
- int RetValue = If_ManSatCheckAll_int( pSat, vPoVars, pTruth, nVars, vLits, pPerms, nPerms );
- Abc_PrintTime( 1, "Time", Abc_Clock() - clk );
+// abctime clkTru = 0, clkSat = 0, clk2;
+ sat_solver * pSat = sat_solver_new();
+ Ifn_Prepare( p, pTruth, nVars );
+ sat_solver_setnvars( pSat, p->nPars );
+ Ift_NtkAddConstraints( p, pSat );
+ if ( fVerbose )
+ Ift_SatPrintStatus( pSat, 0, l_True, -1, -1, Abc_Clock() - clk );
+ for ( i = 0; i < nIterMax; i++ )
+ {
+ // get variable assignment
+ for ( v = 0; v < p->nObjs; v++ )
+ p->Values[v] = v < p->nVars ? (iMint >> v) & 1 : -1;
+ p->Values[p->nObjs-1] = Abc_TtGetBit( pTruth, iMint );
+ // derive clauses
+ if ( !Ift_NtkAddClauses( p, p->Values, pSat ) )
+ break;
+ // find assignment of parameters
+// clk2 = Abc_Clock();
+ status = sat_solver_solve( pSat, NULL, NULL, 0, 0, 0, 0 );
+// clkSat += Abc_Clock() - clk2;
+ if ( fVerbose )
+ Ift_SatPrintStatus( pSat, i+1, status, iMint, p->Values[p->nObjs-1], Abc_Clock() - clk );
+ if ( status == l_False )
+ break;
+ assert( status == l_True );
+ // collect assignment
+ for ( v = p->nObjs; v < p->nPars; v++ )
+ p->Values[v] = sat_solver_var_value(pSat, v);
+ // find truth table
+// clk2 = Abc_Clock();
+ pTruth1 = Ift_NtkDeriveTruth( p, p->Values );
+// clkTru += Abc_Clock() - clk2;
+ Abc_TtXor( pTruth1, pTruth1, p->pTruth, p->nWords, 0 );
+ // find mismatch if present
+ iMint = Abc_TtFindFirstBit( pTruth1, p->nVars );
+ if ( iMint == -1 )
+ {
+ Ift_SatPrintConfig( p, pSat );
+ RetValue = 1;
+ break;
+ }
+ }
+ assert( i < nIterMax );
+ sat_solver_delete( pSat );
+ printf( "Matching = %d Iters = %d. ", RetValue, i );
+// Abc_PrintTime( 1, "Time", Abc_Clock() - clk );
+// Abc_PrintTime( 1, "Sat", clkSat );
+// Abc_PrintTime( 1, "Tru", clkTru );
return RetValue;
}
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+void Ifn_NtkRead()
+{
+ int RetValue;
+ int nVars = 9;
+// int nVars = 8;
+// int nVars = 3;
+// word * pTruth = Dau_DsdToTruth( "(abcdefghi)", nVars );
+ word * pTruth = Dau_DsdToTruth( "1008{(1008{(ab)cde}f)ghi}", nVars );
+// word * pTruth = Dau_DsdToTruth( "18{(1008{(ab)cde}f)gh}", nVars );
+// word * pTruth = Dau_DsdToTruth( "1008{(1008{[ab]cde}f)ghi}", nVars );
+// word * pTruth = Dau_DsdToTruth( "(abcd)", nVars );
+// word * pTruth = Dau_DsdToTruth( "(abc)", nVars );
+// char * pStr = "e={abc};f={ed};";
+// char * pStr = "d={ab};e={cd};";
+ char * pStr = "j=(ab);k={jcde};l=(kf);m={lghi};";
+// char * pStr = "i={abc};j={ide};k={ifg};l={jkh};";
+// char * pStr = "h={abcde};i={abcdf};j=<ghi>;";
+// char * pStr = "g=<abc>;h=<ade>;i={fgh};";
+ Ift_Ntk_t * p = Ifn_ManStrParse( pStr );
+ Ifn_NtkPrint( p );
+ Dau_DsdPrintFromTruth( pTruth, nVars );
+ // get the given function
+ RetValue = Ift_NtkMatch( p, pTruth, nVars, 1 );
+}
+
////////////////////////////////////////////////////////////////////////
/// END OF FILE ///
////////////////////////////////////////////////////////////////////////
diff --git a/src/misc/util/utilTruth.h b/src/misc/util/utilTruth.h
index 8468ffcc..98883748 100644
--- a/src/misc/util/utilTruth.h
+++ b/src/misc/util/utilTruth.h
@@ -341,6 +341,20 @@ static inline void Abc_TtElemInit( word ** pTtElems, int nVars )
for ( k = 0; k < nWords; k++ )
pTtElems[i][k] = (k & (1 << (i-6))) ? ~(word)0 : 0;
}
+static inline void Abc_TtElemInit2( word * pTtElems, int nVars )
+{
+ int i, k, nWords = Abc_TtWordNum( nVars );
+ for ( i = 0; i < nVars; i++ )
+ {
+ word * pTruth = pTtElems + i * nWords;
+ if ( i < 6 )
+ for ( k = 0; k < nWords; k++ )
+ pTruth[k] = s_Truths6[i];
+ else
+ for ( k = 0; k < nWords; k++ )
+ pTruth[k] = (k & (1 << (i-6))) ? ~(word)0 : 0;
+ }
+}
/**Function*************************************************************