summaryrefslogtreecommitdiffstats
path: root/src/aig
diff options
context:
space:
mode:
authorAlan Mishchenko <alanmi@berkeley.edu>2013-06-04 21:04:56 -0500
committerAlan Mishchenko <alanmi@berkeley.edu>2013-06-04 21:04:56 -0500
commit8108655263fb5167840cea12c069ff64676ee996 (patch)
treed1d5e8f3983f8a4098568f363acc946b6e52a673 /src/aig
parent90a88462c4140aad870ad7ab4c23e953131afdfd (diff)
downloadabc-8108655263fb5167840cea12c069ff64676ee996.tar.gz
abc-8108655263fb5167840cea12c069ff64676ee996.tar.bz2
abc-8108655263fb5167840cea12c069ff64676ee996.zip
Integrating new MFS package with GIA manager.
Diffstat (limited to 'src/aig')
-rw-r--r--src/aig/gia/gia.h1
-rw-r--r--src/aig/gia/giaMfs.c389
-rw-r--r--src/aig/gia/giaTruth.c55
-rw-r--r--src/aig/gia/module.make1
4 files changed, 438 insertions, 8 deletions
diff --git a/src/aig/gia/gia.h b/src/aig/gia/gia.h
index d09129a5..f0769e79 100644
--- a/src/aig/gia/gia.h
+++ b/src/aig/gia/gia.h
@@ -1112,6 +1112,7 @@ extern int Gia_ManVerifyWithBoxes( Gia_Man_t * pGia, void * pPar
extern void * Gia_ManUpdateTimMan( Gia_Man_t * p, Vec_Int_t * vBoxPres );
extern Gia_Man_t * Gia_ManUpdateExtraAig( void * pTime, Gia_Man_t * pAig, Vec_Int_t * vBoxPres );
/*=== giaTruth.c ===========================================================*/
+extern word Gia_ObjComputeTruthTable6Lut( Gia_Man_t * p, int iObj, Vec_Wrd_t * vTemp );
extern word Gia_ObjComputeTruthTable6( Gia_Man_t * p, Gia_Obj_t * pObj, Vec_Int_t * vSupp, Vec_Wrd_t * vTruths );
extern int Gia_ObjCollectInternal( Gia_Man_t * p, Gia_Obj_t * pObj );
extern word * Gia_ObjComputeTruthTable( Gia_Man_t * p, Gia_Obj_t * pObj );
diff --git a/src/aig/gia/giaMfs.c b/src/aig/gia/giaMfs.c
new file mode 100644
index 00000000..aebbb58e
--- /dev/null
+++ b/src/aig/gia/giaMfs.c
@@ -0,0 +1,389 @@
+/**CFile****************************************************************
+
+ FileName [giaMfs.c]
+
+ SystemName [ABC: Logic synthesis and verification system.]
+
+ PackageName [Scalable AIG package.]
+
+ Synopsis [Interface with the MFS package.]
+
+ Author [Alan Mishchenko]
+
+ Affiliation [UC Berkeley]
+
+ Date [Ver. 1.0. Started - June 20, 2005.]
+
+ Revision [$Id: giaMfs.c,v 1.00 2005/06/20 00:00:00 alanmi Exp $]
+
+***********************************************************************/
+
+#include "gia.h"
+#include "bool/kit/kit.h"
+#include "opt/sfm/sfm.h"
+#include "misc/tim/tim.h"
+
+ABC_NAMESPACE_IMPL_START
+
+
+////////////////////////////////////////////////////////////////////////
+/// DECLARATIONS ///
+////////////////////////////////////////////////////////////////////////
+
+static word s_ElemVar = ABC_CONST(0xAAAAAAAAAAAAAAAA);
+static word s_ElemVar2 = ABC_CONST(0xCCCCCCCCCCCCCCCC);
+
+extern int Kit_TruthToGia( Gia_Man_t * pMan, unsigned * pTruth, int nVars, Vec_Int_t * vMemory, Vec_Int_t * vLeaves, int fHash );
+
+////////////////////////////////////////////////////////////////////////
+/// FUNCTION DEFINITIONS ///
+////////////////////////////////////////////////////////////////////////
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+void Gia_ManExtractMfs_rec( Gia_Man_t * p, int iObj, Vec_Int_t * vId2Mfs, Vec_Wec_t * vFanins, Vec_Str_t * vFixed, Vec_Wrd_t * vTruths, Vec_Wrd_t * vTruthsTemp )
+{
+ Vec_Int_t * vArray;
+ int i, Fanin;
+ Gia_Obj_t * pObj = Gia_ManObj( p, iObj );
+ assert( Gia_ObjIsLut(p, iObj) );
+ if ( !~pObj->Value )
+ return;
+ Gia_LutForEachFanin( p, iObj, Fanin, i )
+ Gia_ManExtractMfs_rec( p, Fanin, vId2Mfs, vFanins, vFixed, vTruths, vTruthsTemp );
+ pObj->Value = Vec_WecSize(vFanins);
+ vArray = Vec_WecPushLevel( vFanins );
+ Vec_IntGrow( vArray, Gia_ObjLutSize(p, iObj) );
+ Gia_LutForEachFanin( p, iObj, Fanin, i )
+ Vec_IntPush( vArray, Gia_ManObj(p, Fanin)->Value );
+ Vec_StrPush( vFixed, (char)0 );
+ Vec_WrdPush( vTruths, Gia_ObjComputeTruthTable6Lut(p, iObj, vTruthsTemp) );
+ Vec_IntWriteEntry( vId2Mfs, iObj, pObj->Value );
+}
+void Gia_ManExtractMfs_rec2( Gia_Man_t * p, int iObj, Vec_Int_t * vId2Mfs, Vec_Wec_t * vFanins, Vec_Str_t * vFixed, Vec_Wrd_t * vTruths )
+{
+ Vec_Int_t * vArray;
+ Gia_Obj_t * pObj = Gia_ManObj( p, iObj );
+ if ( Gia_ObjIsTravIdCurrent(p, pObj) )
+ return;
+ Gia_ObjSetTravIdCurrent(p, pObj);
+ assert( Gia_ObjIsAnd(pObj) );
+ Gia_ManExtractMfs_rec2( p, Gia_ObjFaninId0(pObj, iObj), vId2Mfs, vFanins, vFixed, vTruths );
+ Gia_ManExtractMfs_rec2( p, Gia_ObjFaninId1(pObj, iObj), vId2Mfs, vFanins, vFixed, vTruths );
+ pObj->Value = Vec_WecSize(vFanins);
+ vArray = Vec_WecPushLevel( vFanins );
+ Vec_IntGrow( vArray, 2 );
+ Vec_IntPush( vArray, Gia_ObjFanin0(pObj)->Value );
+ Vec_IntPush( vArray, Gia_ObjFanin1(pObj)->Value );
+ Vec_StrPush( vFixed, (char)1 );
+ Vec_WrdPush( vTruths, (Gia_ObjFaninC0(pObj) ? ~s_ElemVar : s_ElemVar) & (Gia_ObjFaninC1(pObj) ? ~s_ElemVar2 : s_ElemVar2) );
+ Vec_IntWriteEntry( vId2Mfs, iObj, pObj->Value );
+}
+Sfm_Ntk_t * Gia_ManExtractMfs( Gia_Man_t * p, Gia_Man_t * pBoxes, Vec_Int_t ** pvId2Mfs )
+{
+ Tim_Man_t * pManTime = (Tim_Man_t *)p->pManTime;
+ Vec_Int_t * vPoNodes;
+ Vec_Int_t * vId2Mfs;
+ Vec_Wec_t * vFanins;
+ Vec_Str_t * vFixed;
+ Vec_Wrd_t * vTruths, * vTruthsTemp;
+ Vec_Int_t * vArray;
+ Gia_Obj_t * pObj, * pObjBox;
+ int i, k, nRealPis, nRealPos, nPiNum, nPoNum, curCi, curCo;
+ assert( pManTime == NULL || Tim_ManCiNum(pManTime) == Gia_ManCiNum(p) );
+ assert( pManTime == NULL || Tim_ManCoNum(pManTime) == Gia_ManCoNum(p) );
+ // get the real number of PIs and POs
+ nRealPis = pManTime ? Tim_ManPiNum(pManTime) : Gia_ManCiNum(p);
+ nRealPos = pManTime ? Tim_ManPoNum(pManTime) : Gia_ManCoNum(p);
+ // create mapping from GIA into MFS
+ vId2Mfs = Vec_IntStartFull( Gia_ManObjNum(p) );
+ // collect PO nodes
+ vPoNodes = Vec_IntAlloc( 1000 );
+ // create the arrays
+ vFanins = Vec_WecAlloc( 1000 );
+ vFixed = Vec_StrAlloc( 1000 );
+ vTruths = Vec_WrdAlloc( 1000 );
+ vTruthsTemp = Vec_WrdStart( Gia_ManObjNum(p) );
+ // assign MFS ids to primary inputs
+ Gia_ManFillValue( p );
+ for ( i = 0; i < nRealPis; i++ )
+ {
+ pObj = Gia_ManPi( p, i );
+ pObj->Value = Vec_WecSize(vFanins);
+ Vec_WecPushLevel( vFanins );
+ Vec_StrPush( vFixed, (char)0 );
+ Vec_WrdPush( vTruths, (word)0 );
+ Vec_IntWriteEntry( vId2Mfs, Gia_ObjId(p, pObj), pObj->Value );
+ }
+ // assign MFS ids to black box outputs
+ curCi = nRealPis;
+ curCo = 0;
+ if ( pManTime )
+ for ( i = 0; i < Tim_ManBoxNum(pManTime); i++ )
+ {
+ if ( !Tim_ManBoxIsBlack(pManTime, i) )
+ {
+ // collect POs
+ for ( k = 0; k < Tim_ManBoxInputNum(pManTime, i); k++ )
+ {
+ pObj = Gia_ManPo( p, curCo + k );
+ Vec_IntPush( vPoNodes, Gia_ObjId(p, pObj) );
+ }
+ // assign values to the PIs
+ for ( k = 0; k < Tim_ManBoxOutputNum(pManTime, i); k++ )
+ {
+ pObj = Gia_ManPi( p, curCi + k );
+ pObj->Value = Vec_WecSize(vFanins);
+ Vec_WecPushLevel( vFanins );
+ Vec_StrPush( vFixed, (char)1 );
+ Vec_WrdPush( vTruths, (word)0 );
+ Vec_IntWriteEntry( vId2Mfs, Gia_ObjId(p, pObj), pObj->Value );
+ }
+ }
+ curCo += Tim_ManBoxInputNum(pManTime, i);
+ curCi += Tim_ManBoxOutputNum(pManTime, i);
+ }
+ // collect POs
+// for ( i = Tim_ManCoNum(pManTime) - Tim_ManPoNum(pManTime); i < Tim_ManCoNum(pManTime); i++ )
+ for ( i = Gia_ManCoNum(p) - nRealPos; i < Gia_ManCoNum(p); i++ )
+ {
+ pObj = Gia_ManPo( p, i );
+ Vec_IntPush( vPoNodes, Gia_ObjId(p, pObj) );
+ }
+ curCo += nRealPos;
+ // verify counts
+ assert( curCi == Gia_ManPiNum(p) );
+ assert( curCo == Gia_ManPoNum(p) );
+ // remeber the end of PIs
+ nPiNum = Vec_WecSize(vFanins);
+ nPoNum = Vec_IntSize(vPoNodes);
+ // assign value to constant node
+ pObj = Gia_ManConst0(p);
+ Vec_IntWriteEntry( vId2Mfs, Gia_ObjId(p, pObj), Vec_WecSize(vFanins) );
+ pObj->Value = Vec_WecSize(vFanins);
+ Vec_WecPushLevel( vFanins );
+ Vec_StrPush( vFixed, (char)0 );
+ Vec_WrdPush( vTruths, (word)0 );
+ Vec_IntWriteEntry( vId2Mfs, Gia_ObjId(p, pObj), pObj->Value );
+ // create internal nodes
+ curCi = nRealPis;
+ curCo = 0;
+ if ( pManTime )
+ for ( i = 0; i < Tim_ManBoxNum(pManTime); i++ )
+ {
+ // recursively add for box inputs
+ Gia_ManIncrementTravId( pBoxes );
+ for ( k = 0; k < Tim_ManBoxInputNum(pManTime, i); k++ )
+ {
+ // build logic
+ pObj = Gia_ManPo( p, curCo + k );
+ Gia_ManExtractMfs_rec( p, Gia_ObjFaninId0p(p, pObj), vId2Mfs, vFanins, vFixed, vTruths, vTruthsTemp );
+ // add buffer/inverter
+ pObj->Value = Vec_WecSize(vFanins);
+ vArray = Vec_WecPushLevel( vFanins );
+ Vec_IntGrow( vArray, 1 );
+ assert( !~Gia_ObjFanin0(pObj)->Value );
+ Vec_IntPush( vArray, Gia_ObjFanin0(pObj)->Value );
+ Vec_StrPush( vFixed, (char)0 );
+ Vec_WrdPush( vTruths, Gia_ObjFaninC0(pObj) ? ~s_ElemVar : s_ElemVar );
+ Vec_IntWriteEntry( vId2Mfs, Gia_ObjId(p, pObj), pObj->Value );
+ // transfer to the PI
+ pObjBox = Gia_ManPi( pBoxes, k );
+ pObjBox->Value = pObj->Value;
+ Gia_ObjSetTravIdCurrent( pBoxes, pObjBox );
+ }
+ if ( !Tim_ManBoxIsBlack(pManTime, i) )
+ {
+ pObjBox = Gia_ManConst0(pBoxes);
+ pObjBox->Value = Vec_WecSize(vFanins);
+ Vec_WecPushLevel( vFanins );
+ Vec_StrPush( vFixed, (char)0 );
+ Vec_WrdPush( vTruths, (word)0 );
+ Gia_ObjSetTravIdCurrent( pBoxes, pObjBox );
+ // add internal nodes and transfer
+ for ( k = 0; k < Tim_ManBoxOutputNum(pManTime, i); k++ )
+ {
+ // build logic
+ pObjBox = Gia_ManPo( pBoxes, curCi - Tim_ManPiNum(pManTime) + k );
+ Gia_ManExtractMfs_rec2( pBoxes, Gia_ObjFaninId0p(pBoxes, pObjBox), vId2Mfs, vFanins, vFixed, vTruths );
+ // add buffer/inverter
+ vArray = Vec_WecPushLevel( vFanins );
+ Vec_IntGrow( vArray, 1 );
+ assert( !~Gia_ObjFanin0(pObjBox)->Value );
+ Vec_IntPush( vArray, Gia_ObjFanin0(pObjBox)->Value );
+ Vec_StrPush( vFixed, (char)1 );
+ Vec_WrdPush( vTruths, Gia_ObjFaninC0(pObjBox) ? ~s_ElemVar : s_ElemVar );
+ // transfer to the PI
+ pObj = Gia_ManPi( p, curCi + k );
+ pObj->Value = pObjBox->Value;
+ }
+ }
+ curCo += Tim_ManBoxInputNum(pManTime, i);
+ curCi += Tim_ManBoxOutputNum(pManTime, i);
+ }
+ // create POs with buffers
+ Gia_ManForEachObjVec( vPoNodes, p, pObj, i )
+ {
+ Gia_ManExtractMfs_rec( p, Gia_ObjFaninId0p(p, pObj), vId2Mfs, vFanins, vFixed, vTruths, vTruthsTemp );
+ pObj->Value = Vec_WecSize(vFanins);
+ // add buffer/inverter
+ vArray = Vec_WecPushLevel( vFanins );
+ Vec_IntGrow( vArray, 1 );
+ assert( !~Gia_ObjFanin0(pObj)->Value );
+ Vec_IntPush( vArray, Gia_ObjFanin0(pObj)->Value );
+ Vec_StrPush( vFixed, (char)0 );
+ Vec_WrdPush( vTruths, Gia_ObjFaninC0(pObj) ? ~s_ElemVar : s_ElemVar );
+ Vec_IntWriteEntry( vId2Mfs, Gia_ObjId(p, pObj), pObj->Value );
+ }
+ Vec_IntFree( vPoNodes );
+ Vec_WrdFree( vTruthsTemp );
+ *pvId2Mfs = vId2Mfs;
+ return Sfm_NtkConstruct( vFanins, nPiNum, nPoNum, vFixed, vTruths );
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+Gia_Man_t * Gia_ManInsertMfs( Gia_Man_t * p, Sfm_Ntk_t * pNtk, Vec_Int_t * vId2Mfs )
+{
+ Gia_Man_t * pNew;
+ Gia_Obj_t * pObj;
+ Vec_Int_t * vMfsTopo, * vMfs2New, * vArray, * vCover;
+ int i, k, Fanin, iMfsId, iLitNew;
+ word * pTruth;
+ // collect MFS nodes in the topo order
+ vMfsTopo = Sfm_NtkDfs( pNtk );
+ // create mapping from MFS to new GIA literals
+ vMfs2New = Vec_IntStartFull( Vec_IntCap(vMfsTopo) );
+ // start new GIA
+ pNew = Gia_ManStart( Gia_ManObjNum(p) );
+ pNew->pName = Abc_UtilStrsav( p->pName );
+ pNew->pSpec = Abc_UtilStrsav( p->pSpec );
+ // map primary inputs
+ Gia_ManForEachCi( p, pObj, i )
+ {
+ iMfsId = Vec_IntEntry( vId2Mfs, Gia_ObjId(p, pObj) );
+ assert( iMfsId >= 0 );
+ Vec_IntWriteEntry( vMfs2New, iMfsId, Gia_ManAppendCi(pNew) );
+ }
+ // map internal nodes
+ vCover = Vec_IntAlloc( 1 << 16 );
+ Vec_IntForEachEntry( vMfsTopo, iMfsId, i )
+ {
+ assert( Sfm_NodeReadUsed(pNtk, iMfsId) );
+ pTruth = Sfm_NodeReadTruth( pNtk, iMfsId );
+ if ( pTruth[0] == 0 || ~pTruth[0] == 0 )
+ {
+ Vec_IntWriteEntry( vMfs2New, iMfsId, 0 );
+ continue;
+ }
+ vArray = Sfm_NodeReadFanins( pNtk, iMfsId ); // belongs to pNtk
+ Vec_IntForEachEntry( vArray, Fanin, k )
+ {
+ iLitNew = Vec_IntEntry( vMfs2New, Fanin );
+ assert( iLitNew >= 0 );
+ Vec_IntWriteEntry( vArray, k, iLitNew );
+ }
+ // derive new function
+ iLitNew = Kit_TruthToGia( pNew, (unsigned *)pTruth, Vec_IntSize(vArray), vCover, vArray, 0 );
+ Vec_IntWriteEntry( vMfs2New, iMfsId, iLitNew );
+ }
+ Vec_IntFree( vCover );
+ // map output nodes
+ Gia_ManForEachCo( p, pObj, i )
+ {
+ iMfsId = Vec_IntEntry( vId2Mfs, Gia_ObjId(p, pObj) );
+ assert( iMfsId >= 0 );
+ vArray = Sfm_NodeReadFanins( pNtk, iMfsId ); // belongs to pNtk
+ assert( Vec_IntSize(vArray) == 1 );
+ // get the fanin
+ iLitNew = Vec_IntEntry( vMfs2New, Vec_IntEntry(vArray, 0) );
+ assert( iLitNew >= 0 );
+ // create CO
+ assert( pTruth[0] == s_ElemVar || ~pTruth[0] == s_ElemVar );
+ Gia_ManAppendCo( pNew, Abc_LitNotCond(iLitNew, (int)(pTruth[0] != s_ElemVar)) );
+ }
+ Vec_IntFree( vMfs2New );
+ Vec_IntFree( vMfsTopo );
+ return pNew;
+}
+
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+Gia_Man_t * Gia_ManPerformMfs( Gia_Man_t * p, Sfm_Par_t * pPars )
+{
+ Sfm_Ntk_t * pNtk;
+ Vec_Int_t * vId2Mfs;
+ Gia_Man_t * pNew;
+ int nFaninMax, nNodes;
+ assert( Gia_ManRegNum(p) == 0 );
+ assert( p->vMapping != NULL );
+ if ( p->pManTime != NULL && p->pAigExtra == NULL )
+ {
+ Abc_Print( 1, "Timing manager is given but there is no GIA of boxes.\n" );
+ return NULL;
+ }
+ // count fanouts
+ nFaninMax = Gia_ManLutSizeMax( p );
+ if ( nFaninMax > 6 )
+ {
+ Abc_Print( 1, "Currently \"&mfs\" cannot process the network containing nodes with more than 6 fanins.\n" );
+ return NULL;
+ }
+ // collect information
+ pNtk = Gia_ManExtractMfs( p, p->pAigExtra, &vId2Mfs );
+ // perform optimization
+ nNodes = Sfm_NtkPerform( pNtk, pPars );
+ // call the fast extract procedure
+ if ( nNodes == 0 )
+ {
+ Abc_Print( 1, "The network is not changed by \"&mfs\".\n" );
+ pNew = Gia_ManDup( p );
+ pNew->vMapping = Vec_IntDup( p->vMapping );
+ }
+ else
+ {
+ pNew = Gia_ManInsertMfs( p, pNtk, vId2Mfs );
+ if( pPars->fVerbose )
+ Abc_Print( 1, "The network has %d nodes changed by \"&mfs\".\n", nNodes );
+ }
+ Vec_IntFree( vId2Mfs );
+ Sfm_NtkFree( pNtk );
+ return pNew;
+}
+
+
+////////////////////////////////////////////////////////////////////////
+/// END OF FILE ///
+////////////////////////////////////////////////////////////////////////
+
+
+ABC_NAMESPACE_IMPL_END
+
diff --git a/src/aig/gia/giaTruth.c b/src/aig/gia/giaTruth.c
index 26a380d7..f8a9e043 100644
--- a/src/aig/gia/giaTruth.c
+++ b/src/aig/gia/giaTruth.c
@@ -27,6 +27,15 @@ ABC_NAMESPACE_IMPL_START
/// DECLARATIONS ///
////////////////////////////////////////////////////////////////////////
+static word s_Truth6[6] = {
+ ABC_CONST(0xAAAAAAAAAAAAAAAA),
+ ABC_CONST(0xCCCCCCCCCCCCCCCC),
+ ABC_CONST(0xF0F0F0F0F0F0F0F0),
+ ABC_CONST(0xFF00FF00FF00FF00),
+ ABC_CONST(0xFFFF0000FFFF0000),
+ ABC_CONST(0xFFFFFFFF00000000)
+};
+
static inline word * Gla_ObjTruthElem( Gia_Man_t * p, int i ) { return (word *)Vec_PtrEntry( p->vTtInputs, i ); }
static inline word * Gla_ObjTruthNode( Gia_Man_t * p, Gia_Obj_t * pObj ) { return Vec_WrdArray(p->vTtMemory) + p->nTtWords * Gia_ObjNum(p, pObj); }
static inline word * Gla_ObjTruthFree1( Gia_Man_t * p ) { return Vec_WrdArray(p->vTtMemory) + p->nTtWords * 254; }
@@ -40,6 +49,44 @@ static inline word * Gla_ObjTruthDup( Gia_Man_t * p, word * pDst, word * pSrc, i
/**Function*************************************************************
+ Synopsis [Computes truth table of a 6-LUT.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+void Gia_ObjComputeTruthTable6Lut_rec( Gia_Man_t * p, int iObj, Vec_Wrd_t * vTemp )
+{
+ word uTruth0, uTruth1;
+ Gia_Obj_t * pObj = Gia_ManObj( p, iObj );
+ if ( !Gia_ObjIsAnd(pObj) )
+ return;
+ Gia_ObjComputeTruthTable6Lut_rec( p, Gia_ObjFaninId0p(p, pObj), vTemp );
+ Gia_ObjComputeTruthTable6Lut_rec( p, Gia_ObjFaninId1p(p, pObj), vTemp );
+ uTruth0 = Vec_WrdEntry( vTemp, Gia_ObjFanin0(pObj)->Value );
+ uTruth0 = Gia_ObjFaninC0(pObj) ? ~uTruth0 : uTruth0;
+ uTruth1 = Vec_WrdEntry( vTemp, Gia_ObjFanin1(pObj)->Value );
+ uTruth1 = Gia_ObjFaninC1(pObj) ? ~uTruth1 : uTruth1;
+ Vec_WrdWriteEntry( vTemp, iObj, uTruth0 & uTruth1 );
+}
+word Gia_ObjComputeTruthTable6Lut( Gia_Man_t * p, int iObj, Vec_Wrd_t * vTemp )
+{
+ Gia_Obj_t * pObj = Gia_ManObj( p, iObj );
+ int i, Fanin;
+ assert( Vec_WrdSize(vTemp) == Gia_ManObjNum(p) );
+ assert( Gia_ObjIsLut(p, iObj) );
+ Gia_LutForEachFanin( p, iObj, Fanin, i )
+ Vec_WrdWriteEntry( vTemp, Fanin, s_Truth6[i] );
+ assert( i <= 6 );
+ Gia_ObjComputeTruthTable6Lut_rec( p, iObj, vTemp );
+ return Vec_WrdEntry( vTemp, iObj );
+}
+
+/**Function*************************************************************
+
Synopsis [Computes truth table up to 6 inputs.]
Description []
@@ -68,14 +115,6 @@ void Gia_ObjComputeTruthTable6_rec( Gia_Man_t * p, Gia_Obj_t * pObj, Vec_Wrd_t *
}
word Gia_ObjComputeTruthTable6( Gia_Man_t * p, Gia_Obj_t * pObj, Vec_Int_t * vSupp, Vec_Wrd_t * vTruths )
{
- static word s_Truth6[6] = {
- ABC_CONST(0xAAAAAAAAAAAAAAAA),
- ABC_CONST(0xCCCCCCCCCCCCCCCC),
- ABC_CONST(0xF0F0F0F0F0F0F0F0),
- ABC_CONST(0xFF00FF00FF00FF00),
- ABC_CONST(0xFFFF0000FFFF0000),
- ABC_CONST(0xFFFFFFFF00000000)
- };
Gia_Obj_t * pLeaf;
int i;
assert( Vec_IntSize(vSupp) <= 6 );
diff --git a/src/aig/gia/module.make b/src/aig/gia/module.make
index 34985059..8cdbe137 100644
--- a/src/aig/gia/module.make
+++ b/src/aig/gia/module.make
@@ -28,6 +28,7 @@ SRC += src/aig/gia/giaAig.c \
src/aig/gia/giaIso2.c \
src/aig/gia/giaMan.c \
src/aig/gia/giaMem.c \
+ src/aig/gia/giaMfs.c \
src/aig/gia/giaMini.c \
src/aig/gia/giaMuxes.c \
src/aig/gia/giaPat.c \