summaryrefslogtreecommitdiffstats
path: root/src/base/abci
diff options
context:
space:
mode:
authorAlan Mishchenko <alanmi@berkeley.edu>2021-05-16 20:33:53 -0700
committerAlan Mishchenko <alanmi@berkeley.edu>2021-05-16 20:33:53 -0700
commit0ce11851bcb364abfd5d65685ab779faed4398ec (patch)
tree6f27c9298744dddc0964cd609e9f1353d608a6ac /src/base/abci
parent610a3d3fc2a7e593c52a2532dc31d67cbd8af6ce (diff)
downloadabc-0ce11851bcb364abfd5d65685ab779faed4398ec.tar.gz
abc-0ce11851bcb364abfd5d65685ab779faed4398ec.tar.bz2
abc-0ce11851bcb364abfd5d65685ab779faed4398ec.zip
Updating LUT synthesis code.
Diffstat (limited to 'src/base/abci')
-rw-r--r--src/base/abci/abc.c229
-rw-r--r--src/base/abci/abcLut.c158
-rw-r--r--src/base/abci/abcNtbdd.c2
3 files changed, 344 insertions, 45 deletions
diff --git a/src/base/abci/abc.c b/src/base/abci/abc.c
index 84734e6f..ab80eef3 100644
--- a/src/base/abci/abc.c
+++ b/src/base/abci/abc.c
@@ -485,8 +485,9 @@ static int Abc_CommandAbc9Of ( Abc_Frame_t * pAbc, int argc, cha
static int Abc_CommandAbc9Pack ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9Edge ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9SatLut ( Abc_Frame_t * pAbc, int argc, char ** argv );
-static int Abc_CommandAbc9MinLut ( Abc_Frame_t * pAbc, int argc, char ** argv );
-static int Abc_CommandAbc9MinSim ( Abc_Frame_t * pAbc, int argc, char ** argv );
+static int Abc_CommandAbc9LNetSim ( Abc_Frame_t * pAbc, int argc, char ** argv );
+static int Abc_CommandAbc9LNetOpt ( Abc_Frame_t * pAbc, int argc, char ** argv );
+static int Abc_CommandAbc9LNetMap ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9Unmap ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9Struct ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9Trace ( Abc_Frame_t * pAbc, int argc, char ** argv );
@@ -1210,8 +1211,9 @@ void Abc_Init( Abc_Frame_t * pAbc )
Cmd_CommandAdd( pAbc, "ABC9", "&pack", Abc_CommandAbc9Pack, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&edge", Abc_CommandAbc9Edge, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&satlut", Abc_CommandAbc9SatLut, 0 );
- Cmd_CommandAdd( pAbc, "ABC9", "&minlut", Abc_CommandAbc9MinLut, 0 );
- Cmd_CommandAdd( pAbc, "ABC9", "&minsim", Abc_CommandAbc9MinSim, 0 );
+ Cmd_CommandAdd( pAbc, "ABC9", "&lnetsim", Abc_CommandAbc9LNetSim, 0 );
+ Cmd_CommandAdd( pAbc, "ABC9", "&lnetopt", Abc_CommandAbc9LNetOpt, 0 );
+ Cmd_CommandAdd( pAbc, "ABC9", "&lnetmap", Abc_CommandAbc9LNetMap, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&unmap", Abc_CommandAbc9Unmap, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&struct", Abc_CommandAbc9Struct, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&trace", Abc_CommandAbc9Trace, 0 );
@@ -10411,7 +10413,7 @@ int Abc_CommandPutOnTop( Abc_Frame_t * pAbc, int argc, char ** argv )
{
extern Abc_Ntk_t * Abc_NtkPutOnTop( Abc_Ntk_t * pNtk, Abc_Ntk_t * pNtk2 );
- Abc_Ntk_t * pNtk, * pNtk2, * pNtkRes;
+ Abc_Ntk_t * pNtk, * pNtk2, * pNtkRes = NULL;
char * FileName;
int fComb = 0;
int c;
@@ -10431,6 +10433,39 @@ int Abc_CommandPutOnTop( Abc_Frame_t * pAbc, int argc, char ** argv )
}
}
+ if ( argc > globalUtilOptind + 1 )
+ {
+ Abc_Ntk_t * pStrash;
+ for ( c = 1; c < argc; c++ )
+ {
+ Abc_Ntk_t * pTemp, * pLogic = Io_Read( argv[c], Io_ReadFileType(argv[c]), 1, 0 );
+ if ( pLogic == NULL )
+ return 1;
+ if ( Abc_NtkIsStrash(pLogic) )
+ {
+ pLogic = Abc_NtkToLogic( pTemp = pLogic );
+ Abc_NtkDelete( pTemp );
+ }
+ if ( pLogic == NULL )
+ return 1;
+ if ( pNtkRes == NULL )
+ pNtkRes = pLogic;
+ else
+ {
+ pNtkRes = Abc_NtkPutOnTop( pTemp = pNtkRes, pLogic );
+ Abc_NtkDelete( pTemp );
+ Abc_NtkDelete( pLogic );
+ if ( pNtkRes == NULL )
+ return 1;
+ }
+ }
+ assert( Abc_NtkIsLogic(pNtkRes) );
+ pStrash = Abc_NtkStrash( pNtkRes, 1, 1, 0 );
+ Abc_FrameReplaceCurrentNetwork( pAbc, pStrash );
+ Abc_NtkDelete( pNtkRes );
+ return 0;
+ }
+
// get the second network
if ( argc != globalUtilOptind + 1 )
{
@@ -10492,6 +10527,7 @@ usage:
Abc_Print( -2, "\t connects PIs of network in <file> to POs of current network\n" );
Abc_Print( -2, "\t-h : print the command usage\n");
Abc_Print( -2, "\t<file> : file name with the second network\n");
+ Abc_Print( -2, "\t : (given several files, all networks are stacked on top of each other)\n");
return 1;
}
@@ -14054,6 +14090,12 @@ int Abc_CommandTest( Abc_Frame_t * pAbc, int argc, char ** argv )
//Dau_NetworkEnumTest();
//Extra_SimulationTest( nDivMax, nNumOnes, fNewOrder );
//Mnist_ExperimentWithScaling( nDecMax );
+ if ( Abc_FrameReadNtk(pAbc) )
+ {
+ extern Abc_Ntk_t * Abc_NtkSpecialMapping( Abc_Ntk_t * pNtk, int fVerbose );
+ Abc_Ntk_t * pNtkRes = Abc_NtkSpecialMapping( Abc_FrameReadNtk(pAbc), 0 );
+ Abc_FrameReplaceCurrentNetwork( pAbc, pNtkRes );
+ }
return 0;
usage:
Abc_Print( -2, "usage: test [-CKDNM] [-aovwh] <file_name>\n" );
@@ -40838,15 +40880,12 @@ usage:
SeeAlso []
***********************************************************************/
-int Abc_CommandAbc9MinLut( Abc_Frame_t * pAbc, int argc, char ** argv )
+int Abc_CommandAbc9LNetSim( Abc_Frame_t * pAbc, int argc, char ** argv )
{
- extern Gia_Man_t * Gia_ManSimInfoSynth( Gia_Man_t * p, char * pFileName, int nIns, int nOuts, int LutSize, int Thresh, int fVerbose );
- //extern Gia_Man_t * Gia_ManPerformMinLut( Gia_Man_t * p, int GroupSize, int LutSize, int fVerbose );
- Gia_Man_t * pTemp;
- char * pFileName = NULL;
- int c, nIns = 6, nOuts = 2, LutSize = 6, Limit = -1, fVerbose = 0;
+ extern void Gia_ManSimInfoPassTest( Gia_Man_t * p, char * pFileName, char * pFileName2, int fCompare );
+ int c, nIns = 6, nOuts = 2, fCompare = 0, fVerbose = 0;
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "IOKLvh" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "IOcvh" ) ) != EOF )
{
switch ( c )
{
@@ -40868,19 +40907,94 @@ int Abc_CommandAbc9MinLut( Abc_Frame_t * pAbc, int argc, char ** argv )
nOuts = atoi(argv[globalUtilOptind]);
globalUtilOptind++;
break;
- case 'K':
+ case 'c':
+ fCompare ^= 1;
+ break;
+ case 'v':
+ fVerbose ^= 1;
+ break;
+ case 'h':
+ default:
+ goto usage;
+ }
+ }
+ if ( argc == globalUtilOptind + 3 )
+ {
+ extern void Gia_ManSimInfoTransform( char * pFileName, char * pFileOut1, char * pFileOut2, int nIns, int nOuts );
+ Gia_ManSimInfoTransform( argv[globalUtilOptind], argv[globalUtilOptind+1], argv[globalUtilOptind+2], nIns, nOuts );
+ return 0;
+ }
+ if ( pAbc->pGia == NULL )
+ {
+ Abc_Print( -1, "Empty GIA network.\n" );
+ return 1;
+ }
+ if ( argc != globalUtilOptind + 2 )
+ {
+ Abc_Print( -1, "Expecting two file names on the command line.\n" );
+ return 1;
+ }
+ Gia_ManSimInfoPassTest( pAbc->pGia, argv[globalUtilOptind], argv[globalUtilOptind+1], fCompare );
+ return 0;
+
+usage:
+ Abc_Print( -2, "usage: &lnetsim [-IO num] [-cvh] <file> <file2> <file3>\n" );
+ Abc_Print( -2, "\t performs specialized AIG simulation\n" );
+ Abc_Print( -2, "\t-I num : the input support size [default = %d]\n", nIns );
+ Abc_Print( -2, "\t-O num : the output group size [default = %d]\n", nOuts );
+ Abc_Print( -2, "\t-c : toggles comparing simulation patterns [default = %s]\n", fCompare? "yes": "no" );
+ Abc_Print( -2, "\t-v : toggles verbose output [default = %s]\n", fVerbose? "yes": "no" );
+ Abc_Print( -2, "\t-h : prints the command usage\n");
+ Abc_Print( -2, "\t<file> : file name with simulation information\n");
+ Abc_Print( -2, "\t<file2> : file name with simulation information\n");
+ Abc_Print( -2, "\t<file3> : file name with simulation information (optional)\n");
+ return 1;
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+int Abc_CommandAbc9LNetOpt( Abc_Frame_t * pAbc, int argc, char ** argv )
+{
+ extern Gia_Man_t * Gia_ManPerformLNetOpt( Gia_Man_t * p, char * pFileName, int nIns, int nOuts, int Thresh, int fVerbose );
+ Gia_Man_t * pTemp;
+ char * pFileName = NULL;
+ int c, nIns = 6, nOuts = 2, Limit = 0, fVerbose = 0;
+ Extra_UtilGetoptReset();
+ while ( ( c = Extra_UtilGetopt( argc, argv, "IORvh" ) ) != EOF )
+ {
+ switch ( c )
+ {
+ case 'I':
if ( globalUtilOptind >= argc )
{
- Abc_Print( -1, "Command line switch \"-K\" should be followed by a positive integer.\n" );
+ Abc_Print( -1, "Command line switch \"-I\" should be followed by a positive integer.\n" );
goto usage;
}
- LutSize = atoi(argv[globalUtilOptind]);
+ nIns = atoi(argv[globalUtilOptind]);
globalUtilOptind++;
break;
- case 'L':
+ case 'O':
if ( globalUtilOptind >= argc )
{
- Abc_Print( -1, "Command line switch \"-L\" should be followed by a positive integer.\n" );
+ Abc_Print( -1, "Command line switch \"-O\" should be followed by a positive integer.\n" );
+ goto usage;
+ }
+ nOuts = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ break;
+ case 'R':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-R\" should be followed by a positive integer.\n" );
goto usage;
}
Limit = atoi(argv[globalUtilOptind]);
@@ -40894,6 +41008,10 @@ int Abc_CommandAbc9MinLut( Abc_Frame_t * pAbc, int argc, char ** argv )
goto usage;
}
}
+ if ( argc > globalUtilOptind + 1 )
+ {
+ return 0;
+ }
if ( pAbc->pGia == NULL )
{
Abc_Print( -1, "Empty GIA network.\n" );
@@ -40910,20 +41028,17 @@ int Abc_CommandAbc9MinLut( Abc_Frame_t * pAbc, int argc, char ** argv )
fclose( pFile );
pFileName = argv[globalUtilOptind];
}
- //pTemp = Gia_ManPerformMinLut( pAbc->pGia, GroupSize, LutSize, fVerbose );
- //Abc_FrameUpdateGia( pAbc, pTemp );
- pTemp = Gia_ManSimInfoSynth( pAbc->pGia, pFileName, nIns, nOuts, LutSize, Limit, fVerbose );
+ pTemp = Gia_ManPerformLNetOpt( pAbc->pGia, pFileName, nIns, nOuts, Limit, fVerbose );
Abc_FrameUpdateGia( pAbc, pTemp );
return 0;
usage:
- Abc_Print( -2, "usage: &minlut [-IOKL num] [-vh] <file>\n" );
- Abc_Print( -2, "\t performs specialized LUT mapping\n" );
- Abc_Print( -2, "\t-I num : the input support size [default = %d]\n", nIns );
- Abc_Print( -2, "\t-O num : the output group size [default = %d]\n", nOuts );
- Abc_Print( -2, "\t-K num : the LUT size for mapping [default = %d]\n", LutSize );
- Abc_Print( -2, "\t-L num : patterns count after this limit [default = %d]\n", Limit );
- Abc_Print( -2, "\t-v : toggles verbose output [default = %s]\n", fVerbose? "yes": "no" );
+ Abc_Print( -2, "usage: &lnetopt [-IOR num] [-vh] <file>\n" );
+ Abc_Print( -2, "\t performs specialized AIG optimization\n" );
+ Abc_Print( -2, "\t-I num : the input support size [default = %d]\n", nIns );
+ Abc_Print( -2, "\t-O num : the output group size [default = %d]\n", nOuts );
+ Abc_Print( -2, "\t-R num : patterns are cares starting this value [default = %d]\n", Limit );
+ Abc_Print( -2, "\t-v : toggles verbose output [default = %s]\n", fVerbose? "yes": "no" );
Abc_Print( -2, "\t-h : prints the command usage\n");
Abc_Print( -2, "\t<file> : file name with simulation information\n");
return 1;
@@ -40940,17 +41055,37 @@ usage:
SeeAlso []
***********************************************************************/
-int Abc_CommandAbc9MinSim( Abc_Frame_t * pAbc, int argc, char ** argv )
+int Abc_CommandAbc9LNetMap( Abc_Frame_t * pAbc, int argc, char ** argv )
{
- extern void Gia_ManSimInfoPassTest( Gia_Man_t * p, char * pFileName, char * pFileName2, int fCompare );
- int c, fCompare = 0, fVerbose = 0;
+ extern Abc_Ntk_t * Gia_ManPerformLNetMap( Gia_Man_t * p, int GroupSize, int fUseFixed, int fVerbose );
+ Abc_Ntk_t * pTemp;
+ char * pFileName = NULL;
+ int c, nIns = 6, nOuts = 2, fUseFixed = 0, fVerbose = 0;
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "cvh" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "IOfvh" ) ) != EOF )
{
switch ( c )
{
- case 'c':
- fCompare ^= 1;
+ case 'I':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-I\" should be followed by a positive integer.\n" );
+ goto usage;
+ }
+ nIns = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ break;
+ case 'O':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-O\" should be followed by a positive integer.\n" );
+ goto usage;
+ }
+ nOuts = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ break;
+ case 'f':
+ fUseFixed ^= 1;
break;
case 'v':
fVerbose ^= 1;
@@ -40965,22 +41100,30 @@ int Abc_CommandAbc9MinSim( Abc_Frame_t * pAbc, int argc, char ** argv )
Abc_Print( -1, "Empty GIA network.\n" );
return 1;
}
- if ( argc != globalUtilOptind + 2 )
+ if ( argc == globalUtilOptind + 1 )
{
- Abc_Print( -1, "Expecting two file names on the command line.\n" );
- return 1;
+ FILE * pFile = fopen( argv[globalUtilOptind], "rb" );
+ if ( pFile == NULL )
+ {
+ Abc_Print( -1, "Abc_CommandAbc9BCore(): Cannot open file \"%s\" for writing the proof.\n", argv[globalUtilOptind] );
+ return 0;
+ }
+ fclose( pFile );
+ pFileName = argv[globalUtilOptind];
}
- Gia_ManSimInfoPassTest( pAbc->pGia, argv[globalUtilOptind], argv[globalUtilOptind+1], fCompare );
+ pTemp = Gia_ManPerformLNetMap( pAbc->pGia, nOuts, fUseFixed, fVerbose );
+ Abc_FrameReplaceCurrentNetwork( pAbc, pTemp );
return 0;
usage:
- Abc_Print( -2, "usage: &minsim [-cvh] <file> <file2>\n" );
- Abc_Print( -2, "\t performs specialized AIG simulation\n" );
- Abc_Print( -2, "\t-c : toggles comparing simulation patterns [default = %s]\n", fCompare? "yes": "no" );
- Abc_Print( -2, "\t-v : toggles verbose output [default = %s]\n", fVerbose? "yes": "no" );
+ Abc_Print( -2, "usage: &lnetmap [-IO num] [-fvh] <file>\n" );
+ Abc_Print( -2, "\t performs specialized LUT mapping\n" );
+ Abc_Print( -2, "\t-I num : the input support size [default = %d]\n", nIns );
+ Abc_Print( -2, "\t-O num : the output group size [default = %d]\n", nOuts );
+ Abc_Print( -2, "\t-f : toggles using fixed primitives [default = %s]\n", fUseFixed? "yes": "no" );
+ Abc_Print( -2, "\t-v : toggles verbose output [default = %s]\n", fVerbose? "yes": "no" );
Abc_Print( -2, "\t-h : prints the command usage\n");
Abc_Print( -2, "\t<file> : file name with simulation information\n");
- Abc_Print( -2, "\t<file2> : file name with simulation information\n");
return 1;
}
@@ -48562,7 +48705,6 @@ usage:
***********************************************************************/
int Abc_CommandAbc9Test( Abc_Frame_t * pAbc, int argc, char ** argv )
{
- extern void Gia_ManSimInfoTryTest( Gia_Man_t * p, int fSmall );
extern void Gia_RsbEnumerateWindows( Gia_Man_t * p, int nInputsMax, int nLevelsMax );
extern int Gia_ManSumTotalOfSupportSizes( Gia_Man_t * p );
int c, fVerbose = 0;
@@ -48626,7 +48768,6 @@ int Abc_CommandAbc9Test( Abc_Frame_t * pAbc, int argc, char ** argv )
// return 1;
// }
// Abc_FrameUpdateGia( pAbc, Abc_Procedure(pAbc->pGia) );
- Gia_ManSimInfoTryTest( pAbc->pGia, fSwitch );
// printf( "AIG in \"%s\" has the sum of output support sizes equal to %d.\n", pAbc->pGia->pSpec, Gia_ManSumTotalOfSupportSizes(pAbc->pGia) );
return 0;
usage:
diff --git a/src/base/abci/abcLut.c b/src/base/abci/abcLut.c
index edc2b7de..8dc84ba0 100644
--- a/src/base/abci/abcLut.c
+++ b/src/base/abci/abcLut.c
@@ -783,6 +783,164 @@ int Abc_NodeDecomposeStep( Abc_ManScl_t * p )
return 1;
}
+/**Function*************************************************************
+
+ Synopsis [Performs specialized mapping.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+static word s__Truths6[6] = {
+ ABC_CONST(0xAAAAAAAAAAAAAAAA),
+ ABC_CONST(0xCCCCCCCCCCCCCCCC),
+ ABC_CONST(0xF0F0F0F0F0F0F0F0),
+ ABC_CONST(0xFF00FF00FF00FF00),
+ ABC_CONST(0xFFFF0000FFFF0000),
+ ABC_CONST(0xFFFFFFFF00000000)
+};
+word Abc_ObjComputeTruth( Abc_Obj_t * pObj, Vec_Int_t * vSupp )
+{
+ int Index; word t0, t1, tc;
+ assert( Vec_IntSize(vSupp) <= 6 );
+ if ( (Index = Vec_IntFind(vSupp, Abc_ObjId(pObj))) >= 0 )
+ return s__Truths6[Index];
+ assert( Abc_ObjIsNode(pObj) );
+ if ( Abc_ObjFaninNum(pObj) == 0 )
+ return Abc_NodeIsConst0(pObj) ? (word)0 : ~(word)0;
+ assert( Abc_ObjFaninNum(pObj) == 3 );
+ t0 = Abc_ObjComputeTruth( Abc_ObjFanin(pObj, 2), vSupp );
+ t1 = Abc_ObjComputeTruth( Abc_ObjFanin(pObj, 1), vSupp );
+ tc = Abc_ObjComputeTruth( Abc_ObjFanin(pObj, 0), vSupp );
+ return (tc & t1) | (~tc & t0);
+}
+Abc_Obj_t * Abc_NtkSpecialMap_rec( Abc_Ntk_t * pNew, Abc_Obj_t * pObj, Vec_Wec_t * vSupps, Vec_Int_t * vCover )
+{
+ if ( pObj->pCopy )
+ return pObj->pCopy;
+ if ( Abc_ObjFaninNum(pObj) == 0 )
+ return NULL;
+ assert( Abc_ObjFaninNum(pObj) == 3 );
+ if ( pObj->fMarkA || pObj->fMarkB )
+ {
+ Abc_Obj_t * pFan0 = Abc_NtkSpecialMap_rec( pNew, Abc_ObjFanin(pObj, 2), vSupps, vCover );
+ Abc_Obj_t * pFan1 = Abc_NtkSpecialMap_rec( pNew, Abc_ObjFanin(pObj, 1), vSupps, vCover );
+ Abc_Obj_t * pFanC = Abc_NtkSpecialMap_rec( pNew, Abc_ObjFanin(pObj, 0), vSupps, vCover );
+ if ( pFan0 == NULL )
+ pFan0 = Abc_NodeIsConst0(Abc_ObjFanin(pObj, 2)) ? Abc_NtkCreateNodeConst0(pNew) : Abc_NtkCreateNodeConst1(pNew);
+ if ( pFan1 == NULL )
+ pFan1 = Abc_NodeIsConst0(Abc_ObjFanin(pObj, 1)) ? Abc_NtkCreateNodeConst0(pNew) : Abc_NtkCreateNodeConst1(pNew);
+ pObj->pCopy = Abc_NtkCreateNodeMux( pNew, pFanC, pFan1, pFan0 );
+ pObj->pCopy->fMarkA = pObj->fMarkA;
+ pObj->pCopy->fMarkB = pObj->fMarkB;
+ }
+ else
+ {
+ Abc_Obj_t * pTemp; int i; word Truth;
+ Vec_Int_t * vSupp = Vec_WecEntry( vSupps, Abc_ObjId(pObj) );
+ Abc_NtkForEachObjVec( vSupp, pObj->pNtk, pTemp, i )
+ Abc_NtkSpecialMap_rec( pNew, pTemp, vSupps, vCover );
+ pObj->pCopy = Abc_NtkCreateNode( pNew );
+ Abc_NtkForEachObjVec( vSupp, pObj->pNtk, pTemp, i )
+ Abc_ObjAddFanin( pObj->pCopy, pTemp->pCopy );
+ Truth = Abc_ObjComputeTruth( pObj, vSupp );
+ pObj->pCopy->pData = Abc_SopCreateFromTruthIsop( (Mem_Flex_t *)pNew->pManFunc, Vec_IntSize(vSupp), &Truth, vCover );
+ assert( Abc_SopGetVarNum((char *)pObj->pCopy->pData) == Vec_IntSize(vSupp) );
+ }
+ return pObj->pCopy;
+}
+Abc_Ntk_t * Abc_NtkSpecialMapping( Abc_Ntk_t * pNtk, int fVerbose )
+{
+ Abc_Ntk_t * pNtkNew;
+ Vec_Int_t * vCover = Vec_IntAlloc( 1 << 16 );
+ Vec_Wec_t * vSupps = Vec_WecStart( Abc_NtkObjNumMax(pNtk) );
+ Abc_Obj_t * pObj, * pFan0, * pFan1, * pFanC; int i, Count[2] = {0};
+ Abc_NtkForEachCi( pNtk, pObj, i )
+ Vec_IntPush( Vec_WecEntry(vSupps, i), i );
+ Abc_NtkForEachNode( pNtk, pObj, i )
+ {
+ Vec_Int_t * vSupp = Vec_WecEntry(vSupps, i);
+ if ( Abc_ObjFaninNum(pObj) == 0 )
+ continue;
+ assert( Abc_ObjFaninNum(pObj) == 3 );
+ pFan0 = Abc_ObjFanin( pObj, 2 );
+ pFan1 = Abc_ObjFanin( pObj, 1 );
+ pFanC = Abc_ObjFanin0( pObj );
+ assert( Abc_ObjIsCi(pFanC) );
+ if ( pFan0->fMarkA && pFan1->fMarkA )
+ {
+ pObj->fMarkB = 1;
+ Vec_IntPush( vSupp, Abc_ObjId(pObj) );
+ continue;
+ }
+ Vec_IntTwoMerge2( Vec_WecEntry(vSupps, Abc_ObjId(pFan0)), Vec_WecEntry(vSupps, Abc_ObjId(pFan1)), vSupp );
+ assert( Vec_IntFind(vSupp, Abc_ObjId(pFanC)) == -1 );
+ Vec_IntPushOrder( vSupp, Abc_ObjId(pFanC) );
+ if ( Vec_IntSize(vSupp) <= 6 )
+ continue;
+ Vec_IntClear( vSupp );
+ if ( !pFan0->fMarkA && !pFan1->fMarkA )
+ {
+ pObj->fMarkA = 1;
+ Vec_IntPush( vSupp, Abc_ObjId(pObj) );
+ }
+ else
+ {
+ Vec_IntPushOrder( vSupp, Abc_ObjId(pFan0) );
+ Vec_IntPushOrder( vSupp, Abc_ObjId(pFan1) );
+ Vec_IntPushOrder( vSupp, Abc_ObjId(pFanC) );
+ }
+ }
+
+ if ( fVerbose )
+ Abc_NtkForEachNode( pNtk, pObj, i )
+ {
+ printf( "Node %4d : ", i );
+ if ( pObj->fMarkA )
+ printf( " MarkA " );
+ else
+ printf( " " );
+ if ( pObj->fMarkB )
+ printf( " MarkB " );
+ else
+ printf( " " );
+ Vec_IntPrint( Vec_WecEntry(vSupps, i) );
+ }
+
+ Abc_NtkCleanCopy( pNtk );
+ pNtkNew = Abc_NtkStartFrom( pNtk, ABC_NTK_LOGIC, ABC_FUNC_SOP );
+ Abc_NtkForEachCo( pNtk, pObj, i )
+ if ( Abc_ObjFaninNum(Abc_ObjFanin0(pObj)) == 0 )
+ Abc_ObjFanin0(pObj)->pCopy = Abc_NodeIsConst0(Abc_ObjFanin0(pObj)) ? Abc_NtkCreateNodeConst0(pNtkNew) : Abc_NtkCreateNodeConst1(pNtkNew);
+ else
+ Abc_NtkSpecialMap_rec( pNtkNew, Abc_ObjFanin0(pObj), vSupps, vCover );
+ Abc_NtkFinalize( pNtk, pNtkNew );
+ Abc_NtkCleanMarkAB( pNtk );
+ Vec_WecFree( vSupps );
+ Vec_IntFree( vCover );
+
+ Abc_NtkForEachNode( pNtkNew, pObj, i )
+ {
+ Count[0] += pObj->fMarkA,
+ Count[1] += pObj->fMarkB;
+ pObj->fPersist = pObj->fMarkA | pObj->fMarkB;
+ pObj->fMarkA = pObj->fMarkB = 0;
+ }
+ //printf( "Total = %3d. Nodes = %3d. MarkA = %3d. MarkB = %3d.\n", Abc_NtkNodeNum(pNtkNew),
+ // Abc_NtkNodeNum(pNtkNew) - Count[0] - Count[1], Count[0], Count[1] );
+
+ if ( !Abc_NtkCheck( pNtkNew ) )
+ {
+ printf( "Abc_NtkSpecialMapping: The network check has failed.\n" );
+ Abc_NtkDelete( pNtkNew );
+ return NULL;
+ }
+ return pNtkNew;
+}
+
////////////////////////////////////////////////////////////////////////
/// END OF FILE ///
////////////////////////////////////////////////////////////////////////
diff --git a/src/base/abci/abcNtbdd.c b/src/base/abci/abcNtbdd.c
index 3c28ce4f..cbf4bbb8 100644
--- a/src/base/abci/abcNtbdd.c
+++ b/src/base/abci/abcNtbdd.c
@@ -274,7 +274,7 @@ int Abc_NtkBddToMuxesPerformGlo( Abc_Ntk_t * pNtk, Abc_Ntk_t * pNtkNew, int Limi
Abc_Obj_t * pObj, * pObjNew; int i;
st__table * tBdd2Node;
assert( Abc_NtkIsStrash(pNtk) );
- dd = (DdManager *)Abc_NtkBuildGlobalBdds( pNtk, Limit, 1, 1, fReorder, 0 );
+ dd = (DdManager *)Abc_NtkBuildGlobalBdds( pNtk, Limit, 1, fReorder, 0, 0 );
if ( dd == NULL )
{
printf( "Construction of global BDDs has failed.\n" );