Major rehash of the CBA code.

1 files changed, 404 insertions, 0 deletions

diff --git a/src/base/cba/cbaPtr.c b/src/base/cba/cbaPtr.c
new file mode 100644
index 00000000..d9b00ec0
--- /dev/null
+++ b/src/base/cba/cbaPtr.c
@@ -0,0 +1,404 @@
+/**CFile****************************************************************
+
+  FileName    [cbaPtr.c]
+
+  SystemName  [ABC: Logic synthesis and verification system.]
+
+  PackageName [Hierarchical word-level netlist.]
+
+  Synopsis    [Simple interface with external tools.]
+
+  Author      [Alan Mishchenko]
+  
+  Affiliation [UC Berkeley]
+
+  Date        [Ver. 1.0. Started - November 29, 2014.]
+
+  Revision    [$Id: cbaPtr.c,v 1.00 2014/11/29 00:00:00 alanmi Exp $]
+
+***********************************************************************/
+
+#include "base/abc/abc.h"
+#include "base/main/mainInt.h"
+#include "map/mio/mio.h"
+
+ABC_NAMESPACE_IMPL_START
+
+////////////////////////////////////////////////////////////////////////
+///                        DECLARATIONS                              ///
+////////////////////////////////////////////////////////////////////////
+
+/*
+design = array containing design name (as the first entry in the array) followed by pointers to modules
+module = array containing module name (as the first entry in the array) followed by pointers to 6 arrays: 
+         {array of input names; array of output names; array of nodes; array of boxes, 
+          array of floating-point input-arrival times; array of floating-point output-required times}
+node   = array containing output name, followed by node type, followed by input names
+box    = array containing model name, instance name, followed by pairs of formal/actual names for each port
+
+  Comments:
+  - in describing boxes
+     - input formal/actual name pairs should be listed before output name pairs
+     - the order of formal names should be the same as the order of inputs/outputs in the module description
+     - all formal names present in the module description should be listed
+     - if an input pin is not driven or an output pin has no fanout, the actual pin name is NULL
+     - word-level formal name "a" is written as bit-level names (a[0]. a[1], etc) ordered LSB to MSB
+  - primitive names should be given as char*-strings in description of nodes and boxes
+  - primitive modules should not be written, but the list of primitives and formal names should be provided
+  - constant 0/1 nets can be specified as char*-strings "NetConst0" and "NetConst1".
+  - arrays of input-arrival/output-required times in the module description are optional
+*/
+
+// elementary gates
+typedef enum { 
+    PTR_GATE_NONE = 0,
+    PTR_GATE_C0,         // Const0T
+    PTR_GATE_C1,         // Const1T   
+    PTR_GATE_BUF,        // BufT  
+    PTR_GATE_INV,        // InvT  
+    PTR_GATE_AND,        // AndT  
+    PTR_GATE_NAND,       // NandT 
+    PTR_GATE_OR,         // OrT   
+    PTR_GATE_NOR,        // NorT  
+    PTR_GATE_XOR,        // XorT  
+    PTR_GATE_XNOR,       // XnorT 
+    PTR_GATE_UNKNOWN
+} Ptr_ObjType_t; 
+
+////////////////////////////////////////////////////////////////////////
+///                     FUNCTION DEFINITIONS                         ///
+////////////////////////////////////////////////////////////////////////
+
+/**Function*************************************************************
+
+  Synopsis    [Free Ptr.]
+
+  Description []
+               
+  SideEffects []
+
+  SeeAlso     []
+
+***********************************************************************/
+void Cba_PtrFreeNtk( Vec_Ptr_t * vNtk )
+{
+    Vec_PtrFree( (Vec_Ptr_t *)Vec_PtrEntry(vNtk, 1) );
+    Vec_PtrFree( (Vec_Ptr_t *)Vec_PtrEntry(vNtk, 2) );
+    Vec_VecFree( (Vec_Vec_t *)Vec_PtrEntry(vNtk, 3) );
+    Vec_VecFree( (Vec_Vec_t *)Vec_PtrEntry(vNtk, 4) );
+    if ( Vec_PtrSize(vNtk) > 5 )
+        Vec_FltFree( (Vec_Flt_t *)Vec_PtrEntry(vNtk, 5) );
+    if ( Vec_PtrSize(vNtk) > 6 )
+        Vec_FltFree( (Vec_Flt_t *)Vec_PtrEntry(vNtk, 6) );
+    Vec_PtrFree( vNtk );
+}
+void Cba_PtrFree( Vec_Ptr_t * vDes )
+{
+    Vec_Ptr_t * vNtk; int i;
+    if ( !vDes ) return;
+    Vec_PtrForEachEntryStart( Vec_Ptr_t *, vDes, vNtk, i, 1 )
+        Cba_PtrFreeNtk( vNtk );
+    Vec_PtrFree( vDes );
+}
+
+/**Function*************************************************************
+
+  Synopsis    [Count memory used by Ptr.]
+
+  Description []
+               
+  SideEffects []
+
+  SeeAlso     []
+
+***********************************************************************/
+int Cba_PtrMemoryArray( Vec_Ptr_t * vArray )
+{
+    return (int)Vec_PtrMemory(vArray);
+}
+int Cba_PtrMemoryArrayArray( Vec_Ptr_t * vArrayArray )
+{
+    Vec_Ptr_t * vArray; int i, nBytes = 0;
+    Vec_PtrForEachEntry( Vec_Ptr_t *, vArrayArray, vArray, i )
+        nBytes += Cba_PtrMemoryArray(vArray);
+    return nBytes;
+}
+int Cba_PtrMemoryNtk( Vec_Ptr_t * vNtk )
+{
+    int nBytes = (int)Vec_PtrMemory(vNtk);
+    nBytes += Cba_PtrMemoryArray( (Vec_Ptr_t *)Vec_PtrEntry(vNtk, 1) );
+    nBytes += Cba_PtrMemoryArray( (Vec_Ptr_t *)Vec_PtrEntry(vNtk, 2) );
+    nBytes += Cba_PtrMemoryArrayArray( (Vec_Ptr_t *)Vec_PtrEntry(vNtk, 3) );
+    nBytes += Cba_PtrMemoryArrayArray( (Vec_Ptr_t *)Vec_PtrEntry(vNtk, 4) );
+    return nBytes;
+}
+int Cba_PtrMemory( Vec_Ptr_t * vDes )
+{
+    Vec_Ptr_t * vNtk; int i, nBytes = (int)Vec_PtrMemory(vDes);
+    Vec_PtrForEachEntryStart( Vec_Ptr_t *, vDes, vNtk, i, 1 )
+        nBytes += Cba_PtrMemoryNtk(vNtk);
+    return nBytes;
+}
+
+/**Function*************************************************************
+
+  Synopsis    [Dumping Ptr into a BLIF file.]
+
+  Description []
+               
+  SideEffects []
+
+  SeeAlso     []
+
+***********************************************************************/
+void Cba_PtrDumpSignalsBlif( FILE * pFile, Vec_Ptr_t * vSigs, int fSkipLastComma )
+{
+    char * pSig; int i;
+    Vec_PtrForEachEntry( char *, vSigs, pSig, i )
+        fprintf( pFile, " %s", pSig );
+}
+void Cba_PtrDumpBoxBlif( FILE * pFile, Vec_Ptr_t * vBox )
+{
+    char * pName; int i;
+    fprintf( pFile, ".subckt" );
+    fprintf( pFile, " %s", (char *)Vec_PtrEntry(vBox, 0) );
+    //fprintf( pFile, " %s", (char *)Vec_PtrEntry(vBox, 1) ); // do not write intance name in BLIF
+    Vec_PtrForEachEntryStart( char *, vBox, pName, i, 2 )
+        fprintf( pFile, " %s=%s", pName, (char *)Vec_PtrEntry(vBox, i+1) ), i++;
+    fprintf( pFile, "\n" );
+}
+void Cba_PtrDumpBoxesBlif( FILE * pFile, Vec_Ptr_t * vBoxes )
+{
+    Vec_Ptr_t * vBox; int i;
+    Vec_PtrForEachEntry( Vec_Ptr_t *, vBoxes, vBox, i )
+        Cba_PtrDumpBoxBlif( pFile, vBox );
+}
+void Cba_PtrDumpModuleBlif( FILE * pFile, Vec_Ptr_t * vNtk )
+{
+    fprintf( pFile, ".model %s\n", (char *)Vec_PtrEntry(vNtk, 0) );
+    fprintf( pFile, ".inputs" );
+    Cba_PtrDumpSignalsBlif( pFile, (Vec_Ptr_t *)Vec_PtrEntry(vNtk, 1), 0 );
+    fprintf( pFile, "\n" );
+    fprintf( pFile, ".outputs" );
+    Cba_PtrDumpSignalsBlif( pFile, (Vec_Ptr_t *)Vec_PtrEntry(vNtk, 2), 1 );
+    fprintf( pFile, "\n" );
+    assert( Vec_PtrSize((Vec_Ptr_t *)Vec_PtrEntry(vNtk, 3)) == 0 ); // no nodes; only boxes
+    Cba_PtrDumpBoxesBlif( pFile, (Vec_Ptr_t *)Vec_PtrEntry(vNtk, 4) );
+    fprintf( pFile, ".end\n\n" );
+}
+void Cba_PtrDumpBlif( char * pFileName, Vec_Ptr_t * vDes )
+{
+    FILE * pFile;
+    Vec_Ptr_t * vNtk; int i;
+    pFile = fopen( pFileName, "wb" );
+    if ( pFile == NULL )
+    {
+        printf( "Cannot open output file \"%s\".\n", pFileName );
+        return;
+    }
+    fprintf( pFile, "// Design \"%s\" written by ABC on %s\n\n", (char *)Vec_PtrEntry(vDes, 0), Extra_TimeStamp() );
+    Vec_PtrForEachEntryStart( Vec_Ptr_t *, vDes, vNtk, i, 1 )
+        Cba_PtrDumpModuleBlif( pFile, vNtk );
+    fclose( pFile );
+}
+
+
+/**Function*************************************************************
+
+  Synopsis    [Collect elementary gates from the library.]
+
+  Description []
+               
+  SideEffects []
+
+  SeeAlso     []
+
+***********************************************************************/
+void Cba_ManCollectGateNameOne( Mio_Library_t * pLib, Ptr_ObjType_t Type, word Truth, Vec_Ptr_t * vGateNames )
+{
+    Mio_Gate_t * pGate = Mio_LibraryReadGateByTruth( pLib, Truth );
+    if ( pGate != NULL )
+        Vec_PtrWriteEntry( vGateNames, Type, Mio_GateReadName(pGate) );
+}
+Vec_Ptr_t * Cba_ManCollectGateNamesByTruth( Mio_Library_t * pLib )
+{
+    static word uTruth, uTruths6[3] = {
+        ABC_CONST(0xAAAAAAAAAAAAAAAA),
+        ABC_CONST(0xCCCCCCCCCCCCCCCC),
+        ABC_CONST(0xF0F0F0F0F0F0F0F0),
+    };
+    Vec_Ptr_t * vGateNames = Vec_PtrStart( PTR_GATE_UNKNOWN );
+    Cba_ManCollectGateNameOne( pLib, PTR_GATE_C0,              0,                 vGateNames );
+    Cba_ManCollectGateNameOne( pLib, PTR_GATE_C1,       ~(word)0,                 vGateNames );
+    Cba_ManCollectGateNameOne( pLib, PTR_GATE_BUF,    uTruths6[0],                vGateNames );
+    Cba_ManCollectGateNameOne( pLib, PTR_GATE_INV,   ~uTruths6[0],                vGateNames );
+    Cba_ManCollectGateNameOne( pLib, PTR_GATE_AND,   (uTruths6[0] & uTruths6[1]), vGateNames );
+    Cba_ManCollectGateNameOne( pLib, PTR_GATE_NAND, ~(uTruths6[0] & uTruths6[1]), vGateNames );
+    Cba_ManCollectGateNameOne( pLib, PTR_GATE_OR,    (uTruths6[0] | uTruths6[1]), vGateNames );
+    Cba_ManCollectGateNameOne( pLib, PTR_GATE_NOR,  ~(uTruths6[0] | uTruths6[1]), vGateNames );
+    Cba_ManCollectGateNameOne( pLib, PTR_GATE_XOR,   (uTruths6[0] ^ uTruths6[1]), vGateNames );
+    Cba_ManCollectGateNameOne( pLib, PTR_GATE_XNOR, ~(uTruths6[0] ^ uTruths6[1]), vGateNames );
+    return vGateNames;
+}
+
+/**Function*************************************************************
+
+  Synopsis    [This procedure transforms tech-ind Ptr into mapped Ptr.]
+
+  Description []
+               
+  SideEffects []
+
+  SeeAlso     []
+
+***********************************************************************/
+void Cba_PtrUpdateBox( Vec_Ptr_t * vBox, Vec_Ptr_t * vGatesNames )
+{
+    Mio_Gate_t * pGate;  Mio_Pin_t * pPin; int i = 1;
+    Mio_Library_t * pLib = (Mio_Library_t *)Abc_FrameReadLibGen( Abc_FrameGetGlobalFrame() );
+    // update gate name
+    char * pNameNew, * pName = (char *)Vec_PtrEntry(vBox, 0);
+    if ( !strcmp(pName, "Const0T") )
+        pNameNew = (char *)Vec_PtrEntry(vGatesNames, PTR_GATE_C0);
+    else if ( !strcmp(pName, "Const1T") )
+        pNameNew = (char *)Vec_PtrEntry(vGatesNames, PTR_GATE_C1);
+    else if ( !strcmp(pName, "BufT") )
+        pNameNew = (char *)Vec_PtrEntry(vGatesNames, PTR_GATE_BUF);
+    else if ( !strcmp(pName, "InvT") )
+        pNameNew = (char *)Vec_PtrEntry(vGatesNames, PTR_GATE_INV);
+    else if ( !strcmp(pName, "AndT") )
+        pNameNew = (char *)Vec_PtrEntry(vGatesNames, PTR_GATE_AND);
+    else if ( !strcmp(pName, "NandT") )
+        pNameNew = (char *)Vec_PtrEntry(vGatesNames, PTR_GATE_NAND);
+    else if ( !strcmp(pName, "OrT") )
+        pNameNew = (char *)Vec_PtrEntry(vGatesNames, PTR_GATE_OR);
+    else if ( !strcmp(pName, "NorT") )
+        pNameNew = (char *)Vec_PtrEntry(vGatesNames, PTR_GATE_NOR);
+    else if ( !strcmp(pName, "XorT") )
+        pNameNew = (char *)Vec_PtrEntry(vGatesNames, PTR_GATE_XOR);
+    else if ( !strcmp(pName, "XnorT") )
+        pNameNew = (char *)Vec_PtrEntry(vGatesNames, PTR_GATE_XNOR);
+    else // user hierarchy
+        return;
+    ABC_FREE( pName );
+    Vec_PtrWriteEntry( vBox, 0, Abc_UtilStrsav(pNameNew) );
+    // remove instance name
+    pName = (char *)Vec_PtrEntry(vBox, 1);
+    ABC_FREE( pName );
+    Vec_PtrWriteEntry( vBox, 1, NULL );
+    // update formal input names
+    pGate = Mio_LibraryReadGateByName( pLib, pNameNew, NULL );
+    Mio_GateForEachPin( pGate, pPin )
+    {
+        pName = (char *)Vec_PtrEntry( vBox, 2 * i );
+        ABC_FREE( pName );
+        pNameNew = Mio_PinReadName(pPin);
+        Vec_PtrWriteEntry( vBox, 2 * i++, Abc_UtilStrsav(pNameNew) );
+    }
+    // update output name
+    pName = (char *)Vec_PtrEntry( vBox, 2 * i );
+    pNameNew = Mio_GateReadOutName(pGate);
+    Vec_PtrWriteEntry( vBox, 2 * i++, Abc_UtilStrsav(pNameNew) );
+    assert( 2 * i == Vec_PtrSize(vBox) );
+}
+Vec_Ptr_t * Cba_PtrTransformSigs( Vec_Ptr_t * vSig )
+{
+    char * pName; int i;
+    Vec_Ptr_t * vNew = Vec_PtrAllocExact( Vec_PtrSize(vSig) );
+    Vec_PtrForEachEntry( char *, vSig, pName, i )
+        Vec_PtrPush( vNew, Abc_UtilStrsav(pName) );
+    return vNew;
+}
+Vec_Ptr_t * Cba_PtrTransformBox( Vec_Ptr_t * vBox, Vec_Ptr_t * vGatesNames )
+{
+    char * pName; int i;
+    Vec_Ptr_t * vNew = Vec_PtrAllocExact( Vec_PtrSize(vBox) );
+    Vec_PtrForEachEntry( char *, vBox, pName, i )
+        Vec_PtrPush( vNew, Abc_UtilStrsav(pName) );
+    if ( vGatesNames )
+        Cba_PtrUpdateBox( vNew, vGatesNames );
+    return vNew;
+}
+Vec_Ptr_t * Cba_PtrTransformBoxes( Vec_Ptr_t * vBoxes, Vec_Ptr_t * vGatesNames )
+{
+    Vec_Ptr_t * vBox; int i;
+    Vec_Ptr_t * vNew = Vec_PtrAllocExact( Vec_PtrSize(vBoxes) );
+    Vec_PtrForEachEntry( Vec_Ptr_t *, vBoxes, vBox, i )
+        Vec_PtrPush( vNew, Cba_PtrTransformBox(vBox, vGatesNames) );
+    return vNew;
+}
+Vec_Ptr_t * Cba_PtrTransformNtk( Vec_Ptr_t * vNtk, Vec_Ptr_t * vGatesNames )
+{
+    char * pName = (char *)Vec_PtrEntry(vNtk, 0);
+    Vec_Ptr_t * vInputs  = (Vec_Ptr_t *)Vec_PtrEntry(vNtk, 1);
+    Vec_Ptr_t * vOutputs = (Vec_Ptr_t *)Vec_PtrEntry(vNtk, 2);
+    Vec_Ptr_t * vBoxes   = (Vec_Ptr_t *)Vec_PtrEntry(vNtk, 4);
+    Vec_Ptr_t * vNew     = Vec_PtrAllocExact( Vec_PtrSize(vNtk) );
+    Vec_PtrPush( vNew, Abc_UtilStrsav(pName) );
+    Vec_PtrPush( vNew, Cba_PtrTransformSigs(vInputs) );
+    Vec_PtrPush( vNew, Cba_PtrTransformSigs(vOutputs) );
+    Vec_PtrPush( vNew, Vec_PtrAllocExact(0) );
+    Vec_PtrPush( vNew, Cba_PtrTransformBoxes(vBoxes, vGatesNames) );
+    return vNew;
+}
+Vec_Ptr_t * Cba_PtrTransformTest( Vec_Ptr_t * vDes )
+{
+    Mio_Library_t * pLib;
+    Vec_Ptr_t * vGatesNames;
+    Vec_Ptr_t * vNtk, * vNew; int i;
+    // dump BLIF before transformation
+    Cba_PtrDumpBlif( "test1.blif", vDes );
+    if ( Abc_FrameGetGlobalFrame() == NULL )
+    {
+        printf( "ABC framework is not started.\n" );
+        return NULL;
+    }
+    pLib = (Mio_Library_t *)Abc_FrameReadLibGen( Abc_FrameGetGlobalFrame() );
+    if ( pLib == NULL )
+    {
+        printf( "Standard cell library is not entered.\n" );
+        return NULL;
+    }
+    vGatesNames = Cba_ManCollectGateNamesByTruth( pLib );
+    // transform
+    vNew = Vec_PtrAllocExact( Vec_PtrSize(vDes) );
+    Vec_PtrPush( vNew, Abc_UtilStrsav((char *)Vec_PtrEntry(vDes, 0)) );
+    Vec_PtrForEachEntryStart( Vec_Ptr_t *, vDes, vNtk, i, 1 )
+        Vec_PtrPush( vNew, Cba_PtrTransformNtk(vNtk, vGatesNames) );
+    // dump BLIF after transformation
+    Cba_PtrDumpBlif( "test2.blif", vNew );
+    Vec_PtrFree( vGatesNames );
+    return vNew;
+}
+
+/**Function*************************************************************
+
+  Synopsis    [Test the testing procedure.]
+
+  Description []
+               
+  SideEffects []
+
+  SeeAlso     []
+
+***********************************************************************/
+
+void Cba_PtrTransformTestTest()
+{
+    char * pFileName = "c/hie/dump/1/netlist_1.v";
+    Abc_Ntk_t * pNtk = Io_ReadNetlist( pFileName, Io_ReadFileType(pFileName), 0 );
+    extern Vec_Ptr_t * Ptr_AbcDeriveDes( Abc_Ntk_t * pNtk );
+    Vec_Ptr_t * vDes = Ptr_AbcDeriveDes( pNtk );
+    Vec_Ptr_t * vNew = Cba_PtrTransformTest( vDes );
+    Cba_PtrFree( vDes );
+    Cba_PtrFree( vNew );
+}
+
+
+////////////////////////////////////////////////////////////////////////
+///                       END OF FILE                                ///
+////////////////////////////////////////////////////////////////////////
+
+
+ABC_NAMESPACE_IMPL_END
+