summaryrefslogtreecommitdiffstats
path: root/src/base
diff options
context:
space:
mode:
authorMiodrag Milanovic <mmicko@gmail.com>2021-11-12 12:31:29 +0100
committerMiodrag Milanovic <mmicko@gmail.com>2021-11-12 12:31:29 +0100
commitd2d6bbd9f86f61fc9b5cc7d703e1386bbd6ad6a2 (patch)
tree071fb2118c158c748ff9969ef250affe7b9a3561 /src/base
parent4f5f73d18b137930fb3048c0b385c82fa078db38 (diff)
parent9b245d9f6910c048e9bbcf95ee5dee46f2f24f2c (diff)
downloadabc-d2d6bbd9f86f61fc9b5cc7d703e1386bbd6ad6a2.tar.gz
abc-d2d6bbd9f86f61fc9b5cc7d703e1386bbd6ad6a2.tar.bz2
abc-d2d6bbd9f86f61fc9b5cc7d703e1386bbd6ad6a2.zip
Merge remote-tracking branch 'upstream/master' into yosys-experimental
Diffstat (limited to 'src/base')
-rw-r--r--src/base/abc/abc.h7
-rw-r--r--src/base/abc/abcCheck.c4
-rw-r--r--src/base/abc/abcDfs.c4
-rw-r--r--src/base/abc/abcFanOrder.c4
-rw-r--r--src/base/abc/abcFunc.c13
-rw-r--r--src/base/abc/abcHie.c2
-rw-r--r--src/base/abc/abcHieNew.c4
-rw-r--r--src/base/abc/abcLatch.c15
-rw-r--r--src/base/abc/abcMinBase.c57
-rw-r--r--src/base/abc/abcNames.c11
-rw-r--r--src/base/abc/abcNtk.c9
-rw-r--r--src/base/abc/abcObj.c1
-rw-r--r--src/base/abc/abcShow.c6
-rw-r--r--src/base/abc/abcUtil.c11
-rw-r--r--src/base/abci/abc.c2113
-rw-r--r--src/base/abci/abcBalance.c2
-rw-r--r--src/base/abci/abcCollapse.c15
-rw-r--r--src/base/abci/abcDar.c39
-rw-r--r--src/base/abci/abcDress2.c29
-rw-r--r--src/base/abci/abcEspresso.c2
-rw-r--r--src/base/abci/abcExtract.c17
-rw-r--r--src/base/abci/abcFx.c2
-rw-r--r--src/base/abci/abcFxu.c2
-rw-r--r--src/base/abci/abcIf.c6
-rw-r--r--src/base/abci/abcIvy.c6
-rw-r--r--src/base/abci/abcLut.c160
-rw-r--r--src/base/abci/abcLutmin.c4
-rw-r--r--src/base/abci/abcMap.c6
-rw-r--r--src/base/abci/abcMffc.c2
-rw-r--r--src/base/abci/abcMiter.c4
-rw-r--r--src/base/abci/abcNpnSave.c2
-rw-r--r--src/base/abci/abcNtbdd.c42
-rw-r--r--src/base/abci/abcPrint.c11
-rw-r--r--src/base/abci/abcProve.c2
-rw-r--r--src/base/abci/abcReorder.c2
-rw-r--r--src/base/abci/abcStrash.c90
-rw-r--r--src/base/abci/abcSweep.c6
-rw-r--r--src/base/abci/abcTiming.c60
-rw-r--r--src/base/abci/abcUnreach.c2
-rw-r--r--src/base/abci/abcVerify.c3
-rw-r--r--src/base/acb/acb.h6
-rw-r--r--src/base/acb/acbFunc.c475
-rw-r--r--src/base/acb/acbTest.c611
-rw-r--r--src/base/acb/acbUtil.c300
-rw-r--r--src/base/cba/cbaNtk.c2
-rw-r--r--src/base/cmd/cmdHist.c3
-rw-r--r--src/base/io/io.c110
-rw-r--r--src/base/io/ioReadAiger.c9
-rw-r--r--src/base/io/ioReadBench.c4
-rw-r--r--src/base/io/ioReadBlif.c19
-rw-r--r--src/base/io/ioReadBlifMv.c9
-rw-r--r--src/base/io/ioUtil.c56
-rw-r--r--src/base/io/ioWriteBench.c2
-rw-r--r--src/base/io/ioWriteDot.c4
-rw-r--r--src/base/io/ioWriteVerilog.c256
-rw-r--r--src/base/main/abcapis.h3
-rw-r--r--src/base/main/main.h5
-rw-r--r--src/base/main/mainFrame.c8
-rw-r--r--src/base/main/mainInit.c5
-rw-r--r--src/base/main/mainInt.h2
-rw-r--r--src/base/main/mainUtils.c7
-rw-r--r--src/base/wlc/wlc.c440
-rw-r--r--src/base/wlc/wlc.h2
-rw-r--r--src/base/wlc/wlcAbc.c14
-rw-r--r--src/base/wlc/wlcAbs.c8
-rw-r--r--src/base/wlc/wlcBlast.c120
-rw-r--r--src/base/wlc/wlcCom.c61
-rw-r--r--src/base/wlc/wlcNdr.c15
-rw-r--r--src/base/wln/wln.h2
-rw-r--r--src/base/wln/wlnNdr.c10
-rw-r--r--src/base/wln/wlnRetime.c57
71 files changed, 4864 insertions, 538 deletions
diff --git a/src/base/abc/abc.h b/src/base/abc/abc.h
index 312354da..e7f6c0ad 100644
--- a/src/base/abc/abc.h
+++ b/src/base/abc/abc.h
@@ -600,7 +600,7 @@ extern ABC_DLL int Abc_NtkCheckUniqueCiNames( Abc_Ntk_t * pNtk );
extern ABC_DLL int Abc_NtkCheckUniqueCoNames( Abc_Ntk_t * pNtk );
extern ABC_DLL int Abc_NtkCheckUniqueCioNames( Abc_Ntk_t * pNtk );
/*=== abcCollapse.c ==========================================================*/
-extern ABC_DLL Abc_Ntk_t * Abc_NtkCollapse( Abc_Ntk_t * pNtk, int fBddSizeMax, int fDualRail, int fReorder, int fReverse, int fVerbose );
+extern ABC_DLL Abc_Ntk_t * Abc_NtkCollapse( Abc_Ntk_t * pNtk, int fBddSizeMax, int fDualRail, int fReorder, int fReverse, int fDumpOrder, int fVerbose );
extern ABC_DLL Abc_Ntk_t * Abc_NtkCollapseSat( Abc_Ntk_t * pNtk, int nCubeLim, int nBTLimit, int nCostMax, int fCanon, int fReverse, int fCnfShared, int fVerbose );
extern ABC_DLL Gia_Man_t * Abc_NtkClpGia( Abc_Ntk_t * pNtk );
/*=== abcCut.c ==========================================================*/
@@ -671,7 +671,7 @@ extern ABC_DLL Abc_Ntk_t * Abc_NtkFraigRestore( int nPatsRand, int nPatsD
extern ABC_DLL void Abc_NtkFraigStoreClean();
/*=== abcFunc.c ==========================================================*/
extern ABC_DLL int Abc_NtkSopToBdd( Abc_Ntk_t * pNtk );
-extern ABC_DLL int Abc_NtkBddToSop( Abc_Ntk_t * pNtk, int fMode, int nCubeLimit );
+extern ABC_DLL int Abc_NtkBddToSop( Abc_Ntk_t * pNtk, int fMode, int nCubeLimit, int fCubeSort );
extern ABC_DLL void Abc_NodeBddToCnf( Abc_Obj_t * pNode, Mem_Flex_t * pMmMan, Vec_Str_t * vCube, int fAllPrimes, char ** ppSop0, char ** ppSop1 );
extern ABC_DLL void Abc_NtkLogicMakeDirectSops( Abc_Ntk_t * pNtk );
extern ABC_DLL int Abc_NtkSopToAig( Abc_Ntk_t * pNtk );
@@ -752,6 +752,7 @@ extern ABC_DLL void Abc_NtkAddDummyPiNames( Abc_Ntk_t * pNtk );
extern ABC_DLL void Abc_NtkAddDummyPoNames( Abc_Ntk_t * pNtk );
extern ABC_DLL void Abc_NtkAddDummyBoxNames( Abc_Ntk_t * pNtk );
extern ABC_DLL void Abc_NtkShortNames( Abc_Ntk_t * pNtk );
+extern ABC_DLL void Abc_NtkCleanNames( Abc_Ntk_t * pNtk );
extern ABC_DLL void Abc_NtkStartNameIds( Abc_Ntk_t * p );
extern ABC_DLL void Abc_NtkTransferNameIds( Abc_Ntk_t * p, Abc_Ntk_t * pNew );
extern ABC_DLL void Abc_NtkUpdateNameIds( Abc_Ntk_t * p );
@@ -761,7 +762,7 @@ extern ABC_DLL Abc_Ntk_t * Abc_NtkToNetlist( Abc_Ntk_t * pNtk );
extern ABC_DLL Abc_Ntk_t * Abc_NtkToNetlistBench( Abc_Ntk_t * pNtk );
/*=== abcNtbdd.c ==========================================================*/
extern ABC_DLL Abc_Ntk_t * Abc_NtkDeriveFromBdd( void * dd, void * bFunc, char * pNamePo, Vec_Ptr_t * vNamesPi );
-extern ABC_DLL Abc_Ntk_t * Abc_NtkBddToMuxes( Abc_Ntk_t * pNtk, int fGlobal, int Limit );
+extern ABC_DLL Abc_Ntk_t * Abc_NtkBddToMuxes( Abc_Ntk_t * pNtk, int fGlobal, int Limit, int fUseAdd );
extern ABC_DLL void * Abc_NtkBuildGlobalBdds( Abc_Ntk_t * pNtk, int fBddSizeMax, int fDropInternal, int fReorder, int fReverse, int fVerbose );
extern ABC_DLL void * Abc_NtkFreeGlobalBdds( Abc_Ntk_t * pNtk, int fFreeMan );
extern ABC_DLL int Abc_NtkSizeOfGlobalBdds( Abc_Ntk_t * pNtk );
diff --git a/src/base/abc/abcCheck.c b/src/base/abc/abcCheck.c
index 3e978bf0..a7448530 100644
--- a/src/base/abc/abcCheck.c
+++ b/src/base/abc/abcCheck.c
@@ -865,7 +865,7 @@ int Abc_NtkCheckUniqueCiNames( Abc_Ntk_t * pNtk )
vNames = Vec_PtrAlloc( Abc_NtkCiNum(pNtk) );
Abc_NtkForEachCi( pNtk, pObj, i )
Vec_PtrPush( vNames, Abc_ObjName(pObj) );
- Vec_PtrSort( vNames, (int (*)())Abc_NtkNamesCompare );
+ Vec_PtrSort( vNames, (int (*)(const void *, const void *))Abc_NtkNamesCompare );
for ( i = 1; i < Abc_NtkCiNum(pNtk); i++ )
if ( !strcmp( (const char *)Vec_PtrEntry(vNames,i-1), (const char *)Vec_PtrEntry(vNames,i) ) )
{
@@ -896,7 +896,7 @@ int Abc_NtkCheckUniqueCoNames( Abc_Ntk_t * pNtk )
vNames = Vec_PtrAlloc( Abc_NtkCoNum(pNtk) );
Abc_NtkForEachCo( pNtk, pObj, i )
Vec_PtrPush( vNames, Abc_ObjName(pObj) );
- Vec_PtrSort( vNames, (int (*)())Abc_NtkNamesCompare );
+ Vec_PtrSort( vNames, (int (*)(const void *, const void *))Abc_NtkNamesCompare );
for ( i = 1; i < Abc_NtkCoNum(pNtk); i++ )
{
// printf( "%s\n", Vec_PtrEntry(vNames,i) );
diff --git a/src/base/abc/abcDfs.c b/src/base/abc/abcDfs.c
index 731d35f5..a1345db8 100644
--- a/src/base/abc/abcDfs.c
+++ b/src/base/abc/abcDfs.c
@@ -897,9 +897,9 @@ Vec_Ptr_t * Abc_NtkNodeSupport( Abc_Ntk_t * pNtk, Abc_Obj_t ** ppNodes, int nNod
vNodes = Vec_PtrAlloc( 100 );
// go through the PO nodes and call for each of them
for ( i = 0; i < nNodes; i++ )
- if ( Abc_ObjIsCo(ppNodes[i]) )
+ if ( Abc_ObjIsCo(ppNodes[i]) && Abc_ObjFaninNum(Abc_ObjFanin0(ppNodes[i])) != 0 )
Abc_NtkNodeSupport_rec( Abc_ObjFanin0(ppNodes[i]), vNodes );
- else
+ else if ( !Abc_ObjIsCo(ppNodes[i]) && Abc_ObjFaninNum(ppNodes[i]) != 0 )
Abc_NtkNodeSupport_rec( ppNodes[i], vNodes );
return vNodes;
}
diff --git a/src/base/abc/abcFanOrder.c b/src/base/abc/abcFanOrder.c
index 12df7d85..949170aa 100644
--- a/src/base/abc/abcFanOrder.c
+++ b/src/base/abc/abcFanOrder.c
@@ -476,9 +476,9 @@ void Abc_NodeSortCubes( Abc_Obj_t * pNode, Vec_Ptr_t * vCubes, Vec_Str_t * vStor
Vec_PtrPush( vCubes, pCube );
}
if ( fWeight )
- Vec_PtrSort( vCubes, (int (*)())Abc_NodeCompareCubes2 );
+ Vec_PtrSort( vCubes, (int (*)(const void *, const void *))Abc_NodeCompareCubes2 );
else
- Vec_PtrSort( vCubes, (int (*)())Abc_NodeCompareCubes1 );
+ Vec_PtrSort( vCubes, (int (*)(const void *, const void *))Abc_NodeCompareCubes1 );
Vec_StrGrow( vStore, Vec_PtrSize(vCubes) * (nVars + 3) );
pPivot = Vec_StrArray( vStore );
Vec_PtrForEachEntry( char *, vCubes, pCube, i )
diff --git a/src/base/abc/abcFunc.c b/src/base/abc/abcFunc.c
index 8f68d4be..84ecf7bf 100644
--- a/src/base/abc/abcFunc.c
+++ b/src/base/abc/abcFunc.c
@@ -356,7 +356,7 @@ char * Abc_ConvertBddToSop( Mem_Flex_t * pMan, DdManager * dd, DdNode * bFuncOn,
SeeAlso []
***********************************************************************/
-int Abc_NtkBddToSop( Abc_Ntk_t * pNtk, int fMode, int nCubeLimit )
+int Abc_NtkBddToSop( Abc_Ntk_t * pNtk, int fMode, int nCubeLimit, int fCubeSort )
{
Vec_Int_t * vGuide;
Vec_Str_t * vCube;
@@ -445,6 +445,7 @@ int Abc_NtkBddToSop( Abc_Ntk_t * pNtk, int fMode, int nCubeLimit )
Extra_StopManager( dd );
// reorder fanins and cubes to make SOPs more human-readable
+ if ( fCubeSort )
Abc_NtkSortSops( pNtk );
return 1;
}
@@ -788,7 +789,7 @@ DdNode * Abc_ConvertAigToBdd( DdManager * dd, Hop_Obj_t * pRoot )
#else
int Abc_NtkSopToBdd( Abc_Ntk_t * pNtk ) { return 1; }
-int Abc_NtkBddToSop( Abc_Ntk_t * pNtk, int fMode, int nCubeLimit ) { return 1; }
+int Abc_NtkBddToSop( Abc_Ntk_t * pNtk, int fMode, int nCubeLimit, int fCubeSort ) { return 1; }
void Abc_NodeBddToCnf( Abc_Obj_t * pNode, Mem_Flex_t * pMmMan, Vec_Str_t * vCube, int fAllPrimes, char ** ppSop0, char ** ppSop1 ) {}
void Abc_NtkLogicMakeDirectSops( Abc_Ntk_t * pNtk ) {}
int Abc_NtkAigToBdd( Abc_Ntk_t * pNtk ) { return 1; }
@@ -1178,17 +1179,17 @@ int Abc_NtkToSop( Abc_Ntk_t * pNtk, int fMode, int nCubeLimit )
return 1;
if ( !Abc_NtkSopToBdd(pNtk) )
return 0;
- return Abc_NtkBddToSop(pNtk, fMode, nCubeLimit);
+ return Abc_NtkBddToSop(pNtk, fMode, nCubeLimit, 1);
}
if ( Abc_NtkHasMapping(pNtk) )
return Abc_NtkMapToSop(pNtk);
if ( Abc_NtkHasBdd(pNtk) )
- return Abc_NtkBddToSop(pNtk, fMode, nCubeLimit);
+ return Abc_NtkBddToSop(pNtk, fMode, nCubeLimit, 1);
if ( Abc_NtkHasAig(pNtk) )
{
if ( !Abc_NtkAigToBdd(pNtk) )
return 0;
- return Abc_NtkBddToSop(pNtk, fMode, nCubeLimit);
+ return Abc_NtkBddToSop(pNtk, fMode, nCubeLimit, 1);
}
assert( 0 );
return 0;
@@ -1253,7 +1254,7 @@ int Abc_NtkToAig( Abc_Ntk_t * pNtk )
}
if ( Abc_NtkHasBdd(pNtk) )
{
- if ( !Abc_NtkBddToSop(pNtk, -1, ABC_INFINITY) )
+ if ( !Abc_NtkBddToSop(pNtk, -1, ABC_INFINITY, 1) )
return 0;
return Abc_NtkSopToAig(pNtk);
}
diff --git a/src/base/abc/abcHie.c b/src/base/abc/abcHie.c
index 8397301f..bd08c35d 100644
--- a/src/base/abc/abcHie.c
+++ b/src/base/abc/abcHie.c
@@ -442,7 +442,7 @@ void Abc_NtkPrintBoxInfo( Abc_Ntk_t * pNtk )
}
// sort models by name
vMods = pNtk->pDesign->vModules;
- Vec_PtrSort( vMods, (int(*)())Abc_NtkCompareNames );
+ Vec_PtrSort( vMods, (int(*)(const void *, const void *))Abc_NtkCompareNames );
// Vec_PtrForEachEntry( Abc_Ntk_t *, vMods, pModel, i )
// printf( "%s\n", Abc_NtkName(pModel) );
diff --git a/src/base/abc/abcHieNew.c b/src/base/abc/abcHieNew.c
index 0f191707..54a61609 100644
--- a/src/base/abc/abcHieNew.c
+++ b/src/base/abc/abcHieNew.c
@@ -558,7 +558,7 @@ void Au_ManPrintBoxInfo( Au_Ntk_t * pNtk )
vMods->nSize--;
vMods->pArray++;
// sort models by name
- Vec_PtrSort( vMods, (int(*)())Au_NtkCompareNames );
+ Vec_PtrSort( vMods, (int(*)(const void *, const void *))Au_NtkCompareNames );
// swap the first model
Num = Vec_PtrFind( vMods, pNtk );
assert( Num >= 0 && Num < Vec_PtrSize(vMods) );
@@ -643,7 +643,7 @@ void Au_ManPrintBoxInfoSorted( Au_Ntk_t * pNtk )
vMods->pArray--;
vMods->nSize++;
- Vec_PtrSort( vModsNew, (int(*)())Au_NtkCompareSign );
+ Vec_PtrSort( vModsNew, (int(*)(const void *, const void *))Au_NtkCompareSign );
Vec_PtrForEachEntryStart( Au_Ntk_t *, vModsNew, pModel, i, 1 )
{
printf( "MODULE " );
diff --git a/src/base/abc/abcLatch.c b/src/base/abc/abcLatch.c
index fcace105..d8432382 100644
--- a/src/base/abc/abcLatch.c
+++ b/src/base/abc/abcLatch.c
@@ -148,7 +148,7 @@ int Abc_NtkRemoveSelfFeedLatches( Abc_Ntk_t * pNtk )
void Abc_NtkLatchPipe( Abc_Ntk_t * pNtk, int nLatches )
{
Vec_Ptr_t * vNodes;
- Abc_Obj_t * pObj, * pLatch, * pFanin, * pFanout;
+ Abc_Obj_t * pObj, * pFanin, * pFanout;
int i, k, nTotal, nDigits;
if ( nLatches < 1 )
return;
@@ -157,18 +157,9 @@ void Abc_NtkLatchPipe( Abc_Ntk_t * pNtk, int nLatches )
vNodes = Vec_PtrAlloc( 100 );
Abc_NtkForEachPi( pNtk, pObj, i )
{
- // remember current fanins of the PI
Abc_NodeCollectFanouts( pObj, vNodes );
- // create the latches
- for ( pFanin = pObj, k = 0; k < nLatches; k++, pFanin = pLatch )
- {
- pLatch = Abc_NtkCreateLatch( pNtk );
- Abc_ObjAddFanin( pLatch, pFanin );
- Abc_LatchSetInitDc( pLatch );
- // create the name of the new latch
- Abc_ObjAssignName( pLatch, Abc_ObjNameDummy("LL", i*nLatches + k, nDigits), NULL );
- }
- // patch the PI fanouts
+ for ( pFanin = pObj, k = 0; k < nLatches; k++ )
+ pFanin = Abc_NtkAddLatch( pNtk, pFanin, ABC_INIT_ZERO );
Vec_PtrForEachEntry( Abc_Obj_t *, vNodes, pFanout, k )
Abc_ObjPatchFanin( pFanout, pObj, pFanin );
}
diff --git a/src/base/abc/abcMinBase.c b/src/base/abc/abcMinBase.c
index 22d1e285..3f441e99 100644
--- a/src/base/abc/abcMinBase.c
+++ b/src/base/abc/abcMinBase.c
@@ -72,7 +72,7 @@ int Abc_NtkMinimumBase( Abc_Ntk_t * pNtk )
SeeAlso []
***********************************************************************/
-int Abc_NodeMinimumBase( Abc_Obj_t * pNode )
+int Abc_NodeMinimumBase_buggy( Abc_Obj_t * pNode )
{
Vec_Str_t * vSupport;
Vec_Ptr_t * vFanins;
@@ -107,6 +107,55 @@ int Abc_NodeMinimumBase( Abc_Obj_t * pNode )
return 1;
}
+int Abc_NodeMinimumBase( Abc_Obj_t * pNode )
+{
+ DdManager * dd = (DdManager *)pNode->pNtk->pManFunc;
+ DdNode * bTemp, ** pbVars;
+ Vec_Str_t * vSupport;
+ int i, nVars, j, iFanin, iFanin2, k = 0;
+
+ assert( Abc_NtkIsBddLogic(pNode->pNtk) );
+ assert( Abc_ObjIsNode(pNode) );
+
+ // compute support
+ vSupport = Vec_StrAlloc( 10 );
+ nVars = Abc_NodeSupport( Cudd_Regular(pNode->pData), vSupport, Abc_ObjFaninNum(pNode) );
+ if ( nVars == Abc_ObjFaninNum(pNode) )
+ {
+ Vec_StrFree( vSupport );
+ return 0;
+ }
+
+ // remove unused fanins
+ pbVars = ABC_CALLOC( DdNode *, Abc_ObjFaninNum(pNode) );
+ Vec_IntForEachEntry( &pNode->vFanins, iFanin, i )
+ {
+ Abc_Obj_t * pFanin = Abc_NtkObj( pNode->pNtk, iFanin );
+ if ( !Vec_StrEntry(vSupport, i) )
+ {
+ if ( !Vec_IntRemove( &pFanin->vFanouts, pNode->Id ) )
+ printf( "The obj %d is not found among the fanouts of obj %d ...\n", pNode->Id, iFanin );
+ continue;
+ }
+ Vec_IntForEachEntryStop( &pNode->vFanins, iFanin2, j, k )
+ if ( iFanin == iFanin2 )
+ break;
+ if ( j == k )
+ Vec_IntWriteEntry( &pNode->vFanins, k++, iFanin );
+ else if ( !Vec_IntRemove( &pFanin->vFanouts, pNode->Id ) )
+ printf( "The obj %d is not found among the fanouts of obj %d ...\n", pNode->Id, iFanin );
+ pbVars[i] = Cudd_bddIthVar( dd, j );
+ }
+ Vec_IntShrink( &pNode->vFanins, k );
+
+ // update the function of the node
+ pNode->pData = Cudd_bddVectorCompose( dd, bTemp = (DdNode *)pNode->pData, pbVars ); Cudd_Ref( (DdNode *)pNode->pData );
+ Cudd_RecursiveDeref( dd, bTemp );
+ Vec_StrFree( vSupport );
+ ABC_FREE( pbVars );
+ return 1;
+}
+
/**Function*************************************************************
Synopsis [Makes nodes of the network fanin-dup-free.]
@@ -447,7 +496,7 @@ int Abc_NtkEliminate( Abc_Ntk_t * pNtk, int nMaxSize, int fReverse, int fVerbose
return 0;
}
// prepare nodes for sweeping
- Abc_NtkRemoveDupFanins( pNtk );
+ //Abc_NtkRemoveDupFanins( pNtk );
Abc_NtkMinimumBase( pNtk );
Abc_NtkCleanup( pNtk, 0 );
// get the nodes in the given order
@@ -703,7 +752,7 @@ void Abc_ObjSortInReverseOrder( Abc_Ntk_t * pNtk, Vec_Ptr_t * vNodes )
vOrder = Abc_NtkDfsReverse( pNtk );
Vec_PtrForEachEntry( Abc_Obj_t *, vOrder, pNode, i )
pNode->iTemp = i;
- Vec_PtrSort( vNodes, (int (*)())Abc_ObjCompareByNumber );
+ Vec_PtrSort( vNodes, (int (*)(const void *, const void *))Abc_ObjCompareByNumber );
Vec_PtrForEachEntry( Abc_Obj_t *, vOrder, pNode, i )
pNode->iTemp = 0;
Vec_PtrFree( vOrder );
@@ -740,7 +789,7 @@ int Abc_NtkEliminateSpecial( Abc_Ntk_t * pNtk, int nMaxSize, int fVerbose )
}
// prepare nodes for sweeping
- Abc_NtkRemoveDupFanins( pNtk );
+ //Abc_NtkRemoveDupFanins( pNtk );
Abc_NtkMinimumBase( pNtk );
Abc_NtkCleanup( pNtk, 0 );
diff --git a/src/base/abc/abcNames.c b/src/base/abc/abcNames.c
index fe9b3dca..dec5f01e 100644
--- a/src/base/abc/abcNames.c
+++ b/src/base/abc/abcNames.c
@@ -606,6 +606,17 @@ void Abc_NtkShortNames( Abc_Ntk_t * pNtk )
Abc_NtkAddDummyPoNames( pNtk );
Abc_NtkAddDummyBoxNames( pNtk );
}
+void Abc_NtkCleanNames( Abc_Ntk_t * pNtk )
+{
+ Abc_Obj_t * pObj; int i;
+ Nm_Man_t * pManName = Nm_ManCreate( Abc_NtkCiNum(pNtk) + Abc_NtkCoNum(pNtk) + Abc_NtkBoxNum(pNtk) );
+ Abc_NtkForEachCi( pNtk, pObj, i )
+ Nm_ManStoreIdName( pManName, pObj->Id, pObj->Type, Abc_ObjName(pObj), NULL );
+ Abc_NtkForEachCo( pNtk, pObj, i )
+ Nm_ManStoreIdName( pManName, pObj->Id, pObj->Type, Abc_ObjName(pObj), NULL );
+ Nm_ManFree( pNtk->pManName );
+ pNtk->pManName = pManName;
+}
/**Function*************************************************************
diff --git a/src/base/abc/abcNtk.c b/src/base/abc/abcNtk.c
index 7c54f3c4..f8e40b41 100644
--- a/src/base/abc/abcNtk.c
+++ b/src/base/abc/abcNtk.c
@@ -1286,6 +1286,7 @@ void Abc_NtkDelete( Abc_Ntk_t * pNtk )
Abc_Obj_t * pObj;
void * pAttrMan;
int TotalMemory, i;
+ int fWarning = 0;
// int LargePiece = (4 << ABC_NUM_STEPS);
if ( pNtk == NULL )
return;
@@ -1310,9 +1311,11 @@ void Abc_NtkDelete( Abc_Ntk_t * pNtk )
// ABC_FREE( pObj->vFanouts.pArray );
// these flags should be always zero
// if this is not true, something is wrong somewhere
- assert( pObj->fMarkA == 0 );
- assert( pObj->fMarkB == 0 );
- assert( pObj->fMarkC == 0 );
+// assert( pObj->fMarkA == 0 );
+// assert( pObj->fMarkB == 0 );
+// assert( pObj->fMarkC == 0 );
+ if ( !fWarning && (pObj->fMarkA || pObj->fMarkB || pObj->fMarkC) )
+ { printf( "Flags A, B, or C are not zero.\n" ), fWarning = 1; }
}
// free the nodes
if ( pNtk->pMmStep == NULL )
diff --git a/src/base/abc/abcObj.c b/src/base/abc/abcObj.c
index 533f1f73..65ea91dc 100644
--- a/src/base/abc/abcObj.c
+++ b/src/base/abc/abcObj.c
@@ -393,6 +393,7 @@ Abc_Obj_t * Abc_NtkDupObj( Abc_Ntk_t * pNtkNew, Abc_Obj_t * pObj, int fCopyName
}
else if ( Abc_ObjIsLatch(pObj) ) // copy the reset value
pObjNew->pData = pObj->pData;
+ pObjNew->fPersist = pObj->fPersist;
// transfer HAIG
// pObjNew->pEquiv = pObj->pEquiv;
// remember the new node in the old node
diff --git a/src/base/abc/abcShow.c b/src/base/abc/abcShow.c
index 7df1e323..dd8e9efe 100644
--- a/src/base/abc/abcShow.c
+++ b/src/base/abc/abcShow.c
@@ -121,7 +121,7 @@ void Abc_NodeShowBdd( Abc_Obj_t * pNode, int fCompl )
// visualize the file
Abc_ShowFile( FileNameDot );
}
-void Abc_NtkShowBdd( Abc_Ntk_t * pNtk, int fCompl )
+void Abc_NtkShowBdd( Abc_Ntk_t * pNtk, int fCompl, int fReorder )
{
char FileNameDot[200];
char ** ppNamesIn, ** ppNamesOut;
@@ -131,7 +131,7 @@ void Abc_NtkShowBdd( Abc_Ntk_t * pNtk, int fCompl )
FILE * pFile;
assert( Abc_NtkIsStrash(pNtk) );
- dd = (DdManager *)Abc_NtkBuildGlobalBdds( pNtk, 10000000, 1, 1, 0, 0 );
+ dd = (DdManager *)Abc_NtkBuildGlobalBdds( pNtk, 10000000, 1, fReorder, 0, 0 );
if ( dd == NULL )
{
printf( "Construction of global BDDs has failed.\n" );
@@ -186,7 +186,7 @@ void Abc_NtkShowBdd( Abc_Ntk_t * pNtk, int fCompl )
#else
void Abc_NodeShowBdd( Abc_Obj_t * pNode, int fCompl ) {}
-void Abc_NtkShowBdd( Abc_Ntk_t * pNtk, int fCompl ) {}
+void Abc_NtkShowBdd( Abc_Ntk_t * pNtk, int fCompl, int fReorder ) {}
#endif
/**Function*************************************************************
diff --git a/src/base/abc/abcUtil.c b/src/base/abc/abcUtil.c
index 1f0c9725..29753210 100644
--- a/src/base/abc/abcUtil.c
+++ b/src/base/abc/abcUtil.c
@@ -3122,7 +3122,10 @@ Vec_Wec_t * Abc_SopSynthesize( Vec_Ptr_t * vSops )
Abc_Obj_t * pObj, * pFanin;
int i, k, iNode = 0;
Abc_FrameReplaceCurrentNetwork( Abc_FrameReadGlobalFrame(), pNtk );
- Cmd_CommandExecute( Abc_FrameGetGlobalFrame(), "fx; strash; balance; dc2; map -a" );
+ //Cmd_CommandExecute( Abc_FrameGetGlobalFrame(), "fx; strash; balance; dc2; map -a" );
+ Abc_FrameSetBatchMode( 1 );
+ Cmd_CommandExecute( Abc_FrameGetGlobalFrame(), "st; collapse; sop; fx; strash; &get; &ps; &deepsyn -I 4 -J 50 -T 5 -S 111 -t; &ps; &put; map -a" );
+ Abc_FrameSetBatchMode( 0 );
pNtkNew = Abc_FrameReadNtk( Abc_FrameReadGlobalFrame() );
vRes = Vec_WecStart( Abc_NtkPiNum(pNtkNew) + Abc_NtkNodeNum(pNtkNew) + Abc_NtkPoNum(pNtkNew) );
Abc_NtkForEachPi( pNtkNew, pObj, i )
@@ -3149,7 +3152,9 @@ Vec_Wec_t * Abc_GiaSynthesize( Vec_Ptr_t * vGias, Gia_Man_t * pMulti )
Abc_Obj_t * pObj, * pFanin;
int i, k, iNode = 0;
Abc_FrameReplaceCurrentNetwork( Abc_FrameReadGlobalFrame(), pNtk );
- Cmd_CommandExecute( Abc_FrameGetGlobalFrame(), "compress2rs; dch; map -a; strash; compress2rs; dch; map -a; strash; compress2rs; dch; map -a" );
+ Abc_FrameSetBatchMode( 1 );
+ Cmd_CommandExecute( Abc_FrameGetGlobalFrame(), "clp; sop; fx; strash; compress2rs; dch; map -a; strash; compress2rs; dch; map -a" );
+ Abc_FrameSetBatchMode( 0 );
pNtkNew = Abc_FrameReadNtk( Abc_FrameReadGlobalFrame() );
vRes = Vec_WecStart( Abc_NtkPiNum(pNtkNew) + Abc_NtkNodeNum(pNtkNew) + Abc_NtkPoNum(pNtkNew) );
Abc_NtkForEachPi( pNtkNew, pObj, i )
@@ -3253,9 +3258,11 @@ Gia_Man_t * Abc_SopSynthesizeOne( char * pSop, int fClp )
pNtk = Abc_NtkCreateFromSops( "top", vSops );
Vec_PtrFree( vSops );
Abc_FrameReplaceCurrentNetwork( Abc_FrameReadGlobalFrame(), pNtk );
+ Abc_FrameSetBatchMode( 1 );
if ( fClp )
Cmd_CommandExecute( Abc_FrameGetGlobalFrame(), "clp; sop" );
Cmd_CommandExecute( Abc_FrameGetGlobalFrame(), "fx; strash; balance; dc2" );
+ Abc_FrameSetBatchMode( 0 );
pNtkNew = Abc_FrameReadNtk( Abc_FrameReadGlobalFrame() );
return Abc_NtkStrashToGia( pNtkNew );
}
diff --git a/src/base/abci/abc.c b/src/base/abci/abc.c
index 85053e18..29732bc6 100644
--- a/src/base/abci/abc.c
+++ b/src/base/abci/abc.c
@@ -86,7 +86,9 @@ static int Abc_CommandPrintMffc ( Abc_Frame_t * pAbc, int argc, cha
static int Abc_CommandPrintFactor ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandPrintLevel ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandPrintSupport ( Abc_Frame_t * pAbc, int argc, char ** argv );
+#ifdef ABC_USE_CUDD
static int Abc_CommandPrintMint ( Abc_Frame_t * pAbc, int argc, char ** argv );
+#endif
static int Abc_CommandPrintSymms ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandPrintUnate ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandPrintAuto ( Abc_Frame_t * pAbc, int argc, char ** argv );
@@ -138,7 +140,6 @@ static int Abc_CommandTestRPO ( Abc_Frame_t * pAbc, int argc, cha
static int Abc_CommandTestTruth ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandRunEco ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandRunGen ( Abc_Frame_t * pAbc, int argc, char ** argv );
-static int Abc_CommandRunSim ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandRunTest ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandRewrite ( Abc_Frame_t * pAbc, int argc, char ** argv );
@@ -193,6 +194,7 @@ static int Abc_CommandCone ( Abc_Frame_t * pAbc, int argc, cha
static int Abc_CommandNode ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandCof ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandTopmost ( Abc_Frame_t * pAbc, int argc, char ** argv );
+static int Abc_CommandBottommost ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandTopAnd ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandTrim ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandShortNames ( Abc_Frame_t * pAbc, int argc, char ** argv );
@@ -378,6 +380,7 @@ static int Abc_CommandAbcLoad ( Abc_Frame_t * pAbc, int argc, cha
static int Abc_CommandAbc9Get ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9Put ( Abc_Frame_t * pAbc, int argc, char ** argv );
+static int Abc_CommandAbc9MoveNames ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9Save ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9Save2 ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9SaveAig ( Abc_Frame_t * pAbc, int argc, char ** argv );
@@ -399,6 +402,7 @@ static int Abc_CommandAbc9Status ( Abc_Frame_t * pAbc, int argc, cha
static int Abc_CommandAbc9MuxProfile ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9MuxPos ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9MuxStr ( Abc_Frame_t * pAbc, int argc, char ** argv );
+static int Abc_CommandAbc9MuxDec ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9PrintTruth ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9Unate ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9Rex2Gia ( Abc_Frame_t * pAbc, int argc, char ** argv );
@@ -412,9 +416,11 @@ static int Abc_CommandAbc9Cof ( Abc_Frame_t * pAbc, int argc, cha
static int Abc_CommandAbc9Trim ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9Dfs ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9Sim ( Abc_Frame_t * pAbc, int argc, char ** argv );
+static int Abc_CommandAbc9Sim2 ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9Sim3 ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9MLGen ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9MLTest ( Abc_Frame_t * pAbc, int argc, char ** argv );
+static int Abc_CommandAbc9Iwls21Test ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9ReadSim ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9WriteSim ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9PrintSim ( Abc_Frame_t * pAbc, int argc, char ** argv );
@@ -435,8 +441,11 @@ static int Abc_CommandAbc9Dsd ( Abc_Frame_t * pAbc, int argc, cha
static int Abc_CommandAbc9Bidec ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9Shrink ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9Fx ( Abc_Frame_t * pAbc, int argc, char ** argv );
+static int Abc_CommandAbc9Extract ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9Balance ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9BalanceLut ( Abc_Frame_t * pAbc, int argc, char ** argv );
+static int Abc_CommandAbc9Resub ( Abc_Frame_t * pAbc, int argc, char ** argv );
+static int Abc_CommandAbc9Reshape ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9Syn2 ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9Syn3 ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9Syn4 ( Abc_Frame_t * pAbc, int argc, char ** argv );
@@ -482,6 +491,11 @@ static int Abc_CommandAbc9Of ( Abc_Frame_t * pAbc, int argc, cha
static int Abc_CommandAbc9Pack ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9Edge ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9SatLut ( Abc_Frame_t * pAbc, int argc, char ** argv );
+static int Abc_CommandAbc9LNetRead ( Abc_Frame_t * pAbc, int argc, char ** argv );
+static int Abc_CommandAbc9LNetSim ( Abc_Frame_t * pAbc, int argc, char ** argv );
+static int Abc_CommandAbc9LNetEval ( Abc_Frame_t * pAbc, int argc, char ** argv );
+static int Abc_CommandAbc9LNetOpt ( Abc_Frame_t * pAbc, int argc, char ** argv );
+static int Abc_CommandAbc9LNetMap ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9Unmap ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9Struct ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9Trace ( Abc_Frame_t * pAbc, int argc, char ** argv );
@@ -503,6 +517,7 @@ static int Abc_CommandAbc9Mesh ( Abc_Frame_t * pAbc, int argc, cha
static int Abc_CommandAbc9Iso ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9IsoNpn ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9IsoSt ( Abc_Frame_t * pAbc, int argc, char ** argv );
+static int Abc_CommandAbc9Compare ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9CexInfo ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9Cycle ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9Cone ( Abc_Frame_t * pAbc, int argc, char ** argv );
@@ -540,6 +555,7 @@ static int Abc_CommandAbc9Exorcism ( Abc_Frame_t * pAbc, int argc, cha
static int Abc_CommandAbc9Mfs ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9Mfsd ( Abc_Frame_t * pAbc, int argc, char ** argv );
static int Abc_CommandAbc9DeepSyn ( Abc_Frame_t * pAbc, int argc, char ** argv );
+static int Abc_CommandAbc9StochSyn ( Abc_Frame_t * pAbc, int argc, char ** argv );
//static int Abc_CommandAbc9PoPart2 ( Abc_Frame_t * pAbc, int argc, char ** argv );
//static int Abc_CommandAbc9CexCut ( Abc_Frame_t * pAbc, int argc, char ** argv );
//static int Abc_CommandAbc9CexMerge ( Abc_Frame_t * pAbc, int argc, char ** argv );
@@ -572,6 +588,9 @@ extern int Abc_CommandNChooseK ( Abc_Frame_t * pAbc, int argc, cha
extern Aig_Man_t * Abc_NtkToDar( Abc_Ntk_t * pNtk, int fExors, int fRegisters );
extern Abc_Ntk_t * Abc_NtkFromAigPhase( Aig_Man_t * pMan );
+extern Vec_Ptr_t * Abc_NtkCollectCiNames( Abc_Ntk_t * pNtk );
+extern Vec_Ptr_t * Abc_NtkCollectCoNames( Abc_Ntk_t * pNtk );
+
////////////////////////////////////////////////////////////////////////
/// FUNCTION DEFINITIONS ///
////////////////////////////////////////////////////////////////////////
@@ -754,6 +773,11 @@ void Abc_FrameUpdateGia( Abc_Frame_t * pAbc, Gia_Man_t * pNew )
pNew->vNamesOut = pAbc->pGia->vNamesOut;
pAbc->pGia->vNamesOut = NULL;
}
+ if (!pNew->vNamesNode && pAbc->pGia && pAbc->pGia->vNamesNode && Gia_ManObjNum(pNew) == Vec_PtrSize(pAbc->pGia->vNamesNode))
+ {
+ pNew->vNamesNode = pAbc->pGia->vNamesNode;
+ pAbc->pGia->vNamesNode = NULL;
+ }
// update
if ( pAbc->pGia2 )
Gia_ManStop( pAbc->pGia2 );
@@ -806,7 +830,9 @@ void Abc_Init( Abc_Frame_t * pAbc )
Cmd_CommandAdd( pAbc, "Printing", "print_factor", Abc_CommandPrintFactor, 0 );
Cmd_CommandAdd( pAbc, "Printing", "print_level", Abc_CommandPrintLevel, 0 );
Cmd_CommandAdd( pAbc, "Printing", "print_supp", Abc_CommandPrintSupport, 0 );
+#ifdef ABC_USE_CUDD
Cmd_CommandAdd( pAbc, "Printing", "print_mint", Abc_CommandPrintMint, 0 );
+#endif
Cmd_CommandAdd( pAbc, "Printing", "print_symm", Abc_CommandPrintSymms, 0 );
Cmd_CommandAdd( pAbc, "Printing", "print_unate", Abc_CommandPrintUnate, 0 );
Cmd_CommandAdd( pAbc, "Printing", "print_auto", Abc_CommandPrintAuto, 0 );
@@ -858,8 +884,7 @@ void Abc_Init( Abc_Frame_t * pAbc )
Cmd_CommandAdd( pAbc, "Synthesis", "testtruth", Abc_CommandTestTruth, 0 );
Cmd_CommandAdd( pAbc, "Synthesis", "runeco", Abc_CommandRunEco, 0 );
Cmd_CommandAdd( pAbc, "Synthesis", "rungen", Abc_CommandRunGen, 0 );
- Cmd_CommandAdd( pAbc, "Synthesis", "runsim", Abc_CommandRunSim, 0 );
- Cmd_CommandAdd( pAbc, "Synthesis", "runtest", Abc_CommandRunTest, 0 );
+ Cmd_CommandAdd( pAbc, "Synthesis", "xec", Abc_CommandRunTest, 0 );
Cmd_CommandAdd( pAbc, "Synthesis", "rewrite", Abc_CommandRewrite, 1 );
Cmd_CommandAdd( pAbc, "Synthesis", "refactor", Abc_CommandRefactor, 1 );
@@ -914,6 +939,7 @@ void Abc_Init( Abc_Frame_t * pAbc )
Cmd_CommandAdd( pAbc, "Various", "node", Abc_CommandNode, 1 );
Cmd_CommandAdd( pAbc, "Various", "cof", Abc_CommandCof, 1 );
Cmd_CommandAdd( pAbc, "Various", "topmost", Abc_CommandTopmost, 1 );
+ Cmd_CommandAdd( pAbc, "Various", "bottommost", Abc_CommandBottommost, 1 );
Cmd_CommandAdd( pAbc, "Various", "topand", Abc_CommandTopAnd, 1 );
Cmd_CommandAdd( pAbc, "Various", "trim", Abc_CommandTrim, 1 );
Cmd_CommandAdd( pAbc, "Various", "short_names", Abc_CommandShortNames, 0 );
@@ -1013,7 +1039,7 @@ void Abc_Init( Abc_Frame_t * pAbc )
Cmd_CommandAdd( pAbc, "Sequential", "zero", Abc_CommandZero, 1 );
Cmd_CommandAdd( pAbc, "Sequential", "undc", Abc_CommandUndc, 1 );
Cmd_CommandAdd( pAbc, "Sequential", "onehot", Abc_CommandOneHot, 1 );
-// Cmd_CommandAdd( pAbc, "Sequential", "pipe", Abc_CommandPipe, 1 );
+ Cmd_CommandAdd( pAbc, "Sequential", "pipe", Abc_CommandPipe, 1 );
Cmd_CommandAdd( pAbc, "Sequential", "retime", Abc_CommandRetime, 1 );
Cmd_CommandAdd( pAbc, "Sequential", "dretime", Abc_CommandDRetime, 1 );
Cmd_CommandAdd( pAbc, "Sequential", "fretime", Abc_CommandFlowRetime, 1 );
@@ -1095,6 +1121,7 @@ void Abc_Init( Abc_Frame_t * pAbc )
Cmd_CommandAdd( pAbc, "ABC9", "&get", Abc_CommandAbc9Get, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&put", Abc_CommandAbc9Put, 0 );
+ Cmd_CommandAdd( pAbc, "ABC9", "&move_names", Abc_CommandAbc9MoveNames, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&save", Abc_CommandAbc9Save, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&save2", Abc_CommandAbc9Save2, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&saveaig", Abc_CommandAbc9SaveAig, 0 );
@@ -1118,6 +1145,7 @@ void Abc_Init( Abc_Frame_t * pAbc )
Cmd_CommandAdd( pAbc, "ABC9", "&profile", Abc_CommandAbc9MuxProfile, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&muxpos", Abc_CommandAbc9MuxPos, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&muxstr", Abc_CommandAbc9MuxStr, 0 );
+ Cmd_CommandAdd( pAbc, "ABC9", "&muxdec", Abc_CommandAbc9MuxDec, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&print_truth", Abc_CommandAbc9PrintTruth, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&unate", Abc_CommandAbc9Unate, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&rex2gia", Abc_CommandAbc9Rex2Gia, 0 );
@@ -1131,9 +1159,11 @@ void Abc_Init( Abc_Frame_t * pAbc )
Cmd_CommandAdd( pAbc, "ABC9", "&trim", Abc_CommandAbc9Trim, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&dfs", Abc_CommandAbc9Dfs, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&sim", Abc_CommandAbc9Sim, 0 );
+ Cmd_CommandAdd( pAbc, "ABC9", "&sim2", Abc_CommandAbc9Sim2, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&sim3", Abc_CommandAbc9Sim3, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&mlgen", Abc_CommandAbc9MLGen, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&mltest", Abc_CommandAbc9MLTest, 0 );
+ Cmd_CommandAdd( pAbc, "ABC9", "&iwls21test", Abc_CommandAbc9Iwls21Test, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&sim_read", Abc_CommandAbc9ReadSim, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&sim_write", Abc_CommandAbc9WriteSim, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&sim_print", Abc_CommandAbc9PrintSim, 0 );
@@ -1154,8 +1184,11 @@ void Abc_Init( Abc_Frame_t * pAbc )
Cmd_CommandAdd( pAbc, "ABC9", "&bidec", Abc_CommandAbc9Bidec, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&shrink", Abc_CommandAbc9Shrink, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&fx", Abc_CommandAbc9Fx, 0 );
+ Cmd_CommandAdd( pAbc, "ABC9", "&extract", Abc_CommandAbc9Extract, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&b", Abc_CommandAbc9Balance, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&blut", Abc_CommandAbc9BalanceLut, 0 );
+ Cmd_CommandAdd( pAbc, "ABC9", "&resub", Abc_CommandAbc9Resub, 0 );
+ Cmd_CommandAdd( pAbc, "ABC9", "&reshape", Abc_CommandAbc9Reshape, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&syn2", Abc_CommandAbc9Syn2, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&syn3", Abc_CommandAbc9Syn3, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&syn4", Abc_CommandAbc9Syn4, 0 );
@@ -1201,6 +1234,11 @@ void Abc_Init( Abc_Frame_t * pAbc )
Cmd_CommandAdd( pAbc, "ABC9", "&pack", Abc_CommandAbc9Pack, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&edge", Abc_CommandAbc9Edge, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&satlut", Abc_CommandAbc9SatLut, 0 );
+ Cmd_CommandAdd( pAbc, "ABC9", "&lnetread", Abc_CommandAbc9LNetRead, 0 );
+ Cmd_CommandAdd( pAbc, "ABC9", "&lnetsim", Abc_CommandAbc9LNetSim, 0 );
+ Cmd_CommandAdd( pAbc, "ABC9", "&lneteval", Abc_CommandAbc9LNetEval, 0 );
+ Cmd_CommandAdd( pAbc, "ABC9", "&lnetopt", Abc_CommandAbc9LNetOpt, 0 );
+ Cmd_CommandAdd( pAbc, "ABC9", "&lnetmap", Abc_CommandAbc9LNetMap, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&unmap", Abc_CommandAbc9Unmap, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&struct", Abc_CommandAbc9Struct, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&trace", Abc_CommandAbc9Trace, 0 );
@@ -1222,6 +1260,7 @@ void Abc_Init( Abc_Frame_t * pAbc )
Cmd_CommandAdd( pAbc, "ABC9", "&iso", Abc_CommandAbc9Iso, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&isonpn", Abc_CommandAbc9IsoNpn, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&isost", Abc_CommandAbc9IsoSt, 0 );
+ Cmd_CommandAdd( pAbc, "ABC9", "&compare", Abc_CommandAbc9Compare, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&cexinfo", Abc_CommandAbc9CexInfo, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&cycle", Abc_CommandAbc9Cycle, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&cone", Abc_CommandAbc9Cone, 0 );
@@ -1259,6 +1298,7 @@ void Abc_Init( Abc_Frame_t * pAbc )
Cmd_CommandAdd( pAbc, "ABC9", "&mfs", Abc_CommandAbc9Mfs, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&mfsd", Abc_CommandAbc9Mfsd, 0 );
Cmd_CommandAdd( pAbc, "ABC9", "&deepsyn", Abc_CommandAbc9DeepSyn, 0 );
+ Cmd_CommandAdd( pAbc, "ABC9", "&stochsyn", Abc_CommandAbc9StochSyn, 0 );
// Cmd_CommandAdd( pAbc, "ABC9", "&popart2", Abc_CommandAbc9PoPart2, 0 );
// Cmd_CommandAdd( pAbc, "ABC9", "&cexcut", Abc_CommandAbc9CexCut, 0 );
// Cmd_CommandAdd( pAbc, "ABC9", "&cexmerge", Abc_CommandAbc9CexMerge, 0 );
@@ -2075,6 +2115,7 @@ usage:
SeeAlso []
***********************************************************************/
+#ifdef ABC_USE_CUDD
int Abc_CommandPrintMint( Abc_Frame_t * pAbc, int argc, char ** argv )
{
Abc_Ntk_t * pNtk = Abc_FrameReadNtk(pAbc);
@@ -2113,6 +2154,7 @@ int Abc_CommandPrintMint( Abc_Frame_t * pAbc, int argc, char ** argv )
Abc_Print( -1, "This command works only for logic networks with local functions represented by BDDs.\n" );
return 1;
}
+
Abc_NtkForEachNode( pNtk, pObj, c )
printf( "ObjId %3d : SuppSize = %5d MintCount = %32.0f\n", c, Abc_ObjFaninNum(pObj),
Cudd_CountMinterm((DdManager *)pNtk->pManFunc, (DdNode *)pObj->pData, Abc_ObjFaninNum(pObj)) );
@@ -2125,6 +2167,7 @@ usage:
Abc_Print( -2, "\t-h : print the command usage\n");
return 1;
}
+#endif
/**Function*************************************************************
@@ -3152,13 +3195,13 @@ int Abc_CommandShowBdd( Abc_Frame_t * pAbc, int argc, char ** argv )
{
Abc_Ntk_t * pNtk = Abc_FrameReadNtk(pAbc);
Abc_Obj_t * pNode;
- int c, fCompl = 0, fGlobal = 0;
+ int c, fCompl = 0, fGlobal = 0, fReorder = 1;
extern void Abc_NodeShowBdd( Abc_Obj_t * pNode, int fCompl );
- extern void Abc_NtkShowBdd( Abc_Ntk_t * pNtk, int fCompl );
+ extern void Abc_NtkShowBdd( Abc_Ntk_t * pNtk, int fCompl, int fReorder );
// set defaults
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "cgh" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "cgrh" ) ) != EOF )
{
switch ( c )
{
@@ -3168,6 +3211,9 @@ int Abc_CommandShowBdd( Abc_Frame_t * pAbc, int argc, char ** argv )
case 'g':
fGlobal ^= 1;
break;
+ case 'r':
+ fReorder ^= 1;
+ break;
case 'h':
goto usage;
default:
@@ -3184,7 +3230,7 @@ int Abc_CommandShowBdd( Abc_Frame_t * pAbc, int argc, char ** argv )
if ( fGlobal )
{
Abc_Ntk_t * pTemp = Abc_NtkIsStrash(pNtk) ? pNtk : Abc_NtkStrash(pNtk, 0, 0, 0);
- Abc_NtkShowBdd( pTemp, fCompl );
+ Abc_NtkShowBdd( pTemp, fCompl, fReorder );
if ( pTemp != pNtk )
Abc_NtkDelete( pTemp );
return 0;
@@ -3222,7 +3268,7 @@ int Abc_CommandShowBdd( Abc_Frame_t * pAbc, int argc, char ** argv )
return 0;
usage:
- Abc_Print( -2, "usage: show_bdd [-cgh] <node>\n" );
+ Abc_Print( -2, "usage: show_bdd [-cgrh] <node>\n" );
Abc_Print( -2, " uses DOT and GSVIEW to visualize the global BDDs of primary outputs\n" );
Abc_Print( -2, " in terms of primary inputs or the local BDD of a node in terms of its fanins\n" );
#ifdef WIN32
@@ -3232,6 +3278,7 @@ usage:
Abc_Print( -2, "\t<node>: (optional) the node to consider [default = the driver of the first PO]\n");
Abc_Print( -2, "\t-c : toggle visualizing BDD with complemented edges [default = %s].\n", fCompl? "yes": "no" );
Abc_Print( -2, "\t-g : toggle visualizing the global BDDs of primary outputs [default = %s].\n", fGlobal? "yes": "no" );
+ Abc_Print( -2, "\t-r : toggles dynamic variable reordering [default = %s]\n", fReorder? "yes": "no" );
Abc_Print( -2, "\t-h : print the command usage\n");
return 1;
}
@@ -3353,6 +3400,7 @@ int Abc_CommandCollapse( Abc_Frame_t * pAbc, int argc, char ** argv )
int fDualRail;
int fReorder;
int fReverse;
+ int fDumpOrder;
int c;
char * pLogFileName = NULL;
pNtk = Abc_FrameReadNtk(pAbc);
@@ -3362,9 +3410,10 @@ int Abc_CommandCollapse( Abc_Frame_t * pAbc, int argc, char ** argv )
fReorder = 1;
fReverse = 0;
fDualRail = 0;
+ fDumpOrder = 0;
fBddSizeMax = ABC_INFINITY;
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "BLrodvh" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "BLrodxvh" ) ) != EOF )
{
switch ( c )
{
@@ -3397,6 +3446,9 @@ int Abc_CommandCollapse( Abc_Frame_t * pAbc, int argc, char ** argv )
case 'd':
fDualRail ^= 1;
break;
+ case 'x':
+ fDumpOrder ^= 1;
+ break;
case 'v':
fVerbose ^= 1;
break;
@@ -3421,11 +3473,11 @@ int Abc_CommandCollapse( Abc_Frame_t * pAbc, int argc, char ** argv )
// get the new network
if ( Abc_NtkIsStrash(pNtk) )
- pNtkRes = Abc_NtkCollapse( pNtk, fBddSizeMax, fDualRail, fReorder, fReverse, fVerbose );
+ pNtkRes = Abc_NtkCollapse( pNtk, fBddSizeMax, fDualRail, fReorder, fReverse, fDumpOrder, fVerbose );
else
{
pNtk = Abc_NtkStrash( pNtk, 0, 0, 0 );
- pNtkRes = Abc_NtkCollapse( pNtk, fBddSizeMax, fDualRail, fReorder, fReverse, fVerbose );
+ pNtkRes = Abc_NtkCollapse( pNtk, fBddSizeMax, fDualRail, fReorder, fReverse, fDumpOrder, fVerbose );
Abc_NtkDelete( pNtk );
}
if ( pNtkRes == NULL )
@@ -3448,13 +3500,14 @@ int Abc_CommandCollapse( Abc_Frame_t * pAbc, int argc, char ** argv )
return 0;
usage:
- Abc_Print( -2, "usage: collapse [-B <num>] [-L file] [-rodvh]\n" );
+ Abc_Print( -2, "usage: collapse [-B <num>] [-L file] [-rodxvh]\n" );
Abc_Print( -2, "\t collapses the network by constructing global BDDs\n" );
Abc_Print( -2, "\t-B <num>: limit on live BDD nodes during collapsing [default = %d]\n", fBddSizeMax );
Abc_Print( -2, "\t-L file : the log file name [default = %s]\n", pLogFileName ? pLogFileName : "no logging" );
Abc_Print( -2, "\t-r : toggles dynamic variable reordering [default = %s]\n", fReorder? "yes": "no" );
Abc_Print( -2, "\t-o : toggles reverse variable ordering [default = %s]\n", fReverse? "yes": "no" );
Abc_Print( -2, "\t-d : toggles dual-rail collapsing mode [default = %s]\n", fDualRail? "yes": "no" );
+ Abc_Print( -2, "\t-x : toggles dumping file \"order.txt\" with variable order [default = %s]\n", fDumpOrder? "yes": "no" );
Abc_Print( -2, "\t-v : print verbose information [default = %s]\n", fVerbose? "yes": "no" );
Abc_Print( -2, "\t-h : print the command usage\n");
return 1;
@@ -5417,7 +5470,7 @@ int Abc_CommandMfs2( Abc_Frame_t * pAbc, int argc, char ** argv )
// set defaults
Sfm_ParSetDefault( pPars );
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "WFDMLCZNIdaeijvwh" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "WFDMLCZNIdaeijlvwh" ) ) != EOF )
{
switch ( c )
{
@@ -5535,6 +5588,9 @@ int Abc_CommandMfs2( Abc_Frame_t * pAbc, int argc, char ** argv )
case 'j':
fUseAllFfs ^= 1;
break;
+ case 'l':
+ pPars->fUseDcs ^= 1;
+ break;
case 'v':
pPars->fVerbose ^= 1;
break;
@@ -5606,7 +5662,7 @@ int Abc_CommandMfs2( Abc_Frame_t * pAbc, int argc, char ** argv )
return 0;
usage:
- Abc_Print( -2, "usage: mfs2 [-WFDMLCZNI <num>] [-daeijvwh]\n" );
+ Abc_Print( -2, "usage: mfs2 [-WFDMLCZNI <num>] [-daeijlvwh]\n" );
Abc_Print( -2, "\t performs don't-care-based optimization of logic networks\n" );
Abc_Print( -2, "\t-W <num> : the number of levels in the TFO cone (0 <= num) [default = %d]\n", pPars->nTfoLevMax );
Abc_Print( -2, "\t-F <num> : the max number of fanouts to skip (1 <= num) [default = %d]\n", pPars->nFanoutMax );
@@ -5622,6 +5678,7 @@ usage:
Abc_Print( -2, "\t-i : toggle using inductive don't-cares [default = %s]\n", fIndDCs? "yes": "no" );
Abc_Print( -2, "\t-j : toggle using all flops when \"-i\" is enabled [default = %s]\n", fUseAllFfs? "yes": "no" );
Abc_Print( -2, "\t-I : the number of additional frames inserted [default = %d]\n", nFramesAdd );
+ Abc_Print( -2, "\t-l : toggle deriving don't-cares [default = %s]\n", pPars->fUseDcs? "yes": "no" );
Abc_Print( -2, "\t-v : toggle printing optimization summary [default = %s]\n", pPars->fVerbose? "yes": "no" );
Abc_Print( -2, "\t-w : toggle printing detailed stats for each node [default = %s]\n", pPars->fVeryVerbose? "yes": "no" );
Abc_Print( -2, "\t-h : print the command usage\n");
@@ -7051,20 +7108,37 @@ usage:
***********************************************************************/
int Abc_CommandRunEco( Abc_Frame_t * pAbc, int argc, char ** argv )
{
- extern void Acb_NtkRunEco( char * pFileNames[4], int fCheck, int fRandom, int fVerbose, int fVeryVerbose );
+ extern void Acb_NtkRunEco( char * pFileNames[4], int nTimeout, int fCheck, int fRandom, int fInputs, int fUnitW, int fVerbose, int fVeryVerbose );
char * pFileNames[4] = {NULL};
- int c, fCheck = 0, fRandom = 0, fVerbose = 0, fVeryVerbose = 0;
+ int c, nTimeout = 0, fCheck = 0, fRandom = 0, fInputs = 0, fUnitW = 0, fVerbose = 0, fVeryVerbose = 0;
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "crvwh" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "Tcriuvwh" ) ) != EOF )
{
switch ( c )
{
+ case 'T':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-T\" should be followed by an integer.\n" );
+ goto usage;
+ }
+ nTimeout = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ if ( nTimeout < 0 )
+ goto usage;
+ break;
case 'c':
fCheck ^= 1;
break;
case 'r':
fRandom ^= 1;
break;
+ case 'i':
+ fInputs ^= 1;
+ break;
+ case 'u':
+ fUnitW ^= 1;
+ break;
case 'v':
fVerbose ^= 1;
break;
@@ -7096,11 +7170,11 @@ int Abc_CommandRunEco( Abc_Frame_t * pAbc, int argc, char ** argv )
fclose( pFile );
pFileNames[c] = argv[globalUtilOptind+c];
}
- Acb_NtkRunEco( pFileNames, fCheck, fRandom, fVerbose, fVeryVerbose );
+ Acb_NtkRunEco( pFileNames, nTimeout, fCheck, fRandom, fInputs, fUnitW, fVerbose, fVeryVerbose );
return 0;
usage:
- Abc_Print( -2, "usage: runeco [-crvwh] <implementation> <specification> <weights>\n" );
+ Abc_Print( -2, "usage: runeco [-T num] [-criuvwh] <implementation> <specification> <weights>\n" );
Abc_Print( -2, "\t performs computation of patch functions during ECO,\n" );
Abc_Print( -2, "\t as described in the following paper: A. Q. Dao et al\n" );
Abc_Print( -2, "\t \"Efficient computation of ECO patch functions\", Proc. DAC\'18\n" );
@@ -7108,8 +7182,11 @@ usage:
Abc_Print( -2, "\t (currently only applicable to benchmarks from 2017 ICCAD CAD competition\n" );
Abc_Print( -2, "\t http://cad-contest-2017.el.cycu.edu.tw/Problem_A/default.html as follows:\n" );
Abc_Print( -2, "\t \"runeco unit1/F.v unit1/G.v unit1/weight.txt; cec -n out.v unit1/G.v\")\n" );
+ Abc_Print( -2, "\t-T num : the timeout in seconds [default = %d]\n", nTimeout );
Abc_Print( -2, "\t-c : toggle checking that the problem has a solution [default = %s]\n", fCheck? "yes": "no" );
Abc_Print( -2, "\t-r : toggle using random permutation of support variables [default = %s]\n", fRandom? "yes": "no" );
+ Abc_Print( -2, "\t-i : toggle using primary inputs as support variables [default = %s]\n", fInputs? "yes": "no" );
+ Abc_Print( -2, "\t-u : toggle using unit weights [default = %s]\n", fUnitW? "yes": "no" );
Abc_Print( -2, "\t-v : toggle printing verbose information [default = %s]\n", fVerbose? "yes": "no" );
Abc_Print( -2, "\t-w : toggle printing more verbose information [default = %s]\n", fVeryVerbose? "yes": "no" );
Abc_Print( -2, "\t-h : print the command usage\n");
@@ -7176,139 +7253,6 @@ usage:
SeeAlso []
***********************************************************************/
-int Abc_CommandRunSim( Abc_Frame_t * pAbc, int argc, char ** argv )
-{
- extern void Acb_NtkRunSim( char * pFileName[4], int nWords, int nBeam, int LevL, int LevU, int fOrder, int fFancy, int fUseBuf, int fRandom, int fUseWeights, int fVerbose, int fVeryVerbose );
- char * pFileNames[4] = {NULL, NULL, "out.v", NULL};
- int c, nWords = 8, nBeam = 4, LevL = -1, LevU = -1, fOrder = 0, fFancy = 0, fUseBuf = 0, fRandom = 0, fUseWeights = 0, fVerbose = 0, fVeryVerbose = 0;
- Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "WBLUofbruvwh" ) ) != EOF )
- {
- switch ( c )
- {
- case 'W':
- if ( globalUtilOptind >= argc )
- {
- Abc_Print( -1, "Command line switch \"-W\" should be followed by an integer.\n" );
- goto usage;
- }
- nWords = atoi(argv[globalUtilOptind]);
- globalUtilOptind++;
- if ( nWords < 0 )
- goto usage;
- break;
- case 'B':
- if ( globalUtilOptind >= argc )
- {
- Abc_Print( -1, "Command line switch \"-B\" should be followed by an integer.\n" );
- goto usage;
- }
- nBeam = atoi(argv[globalUtilOptind]);
- globalUtilOptind++;
- if ( nBeam < 0 )
- goto usage;
- break;
- case 'L':
- if ( globalUtilOptind >= argc )
- {
- Abc_Print( -1, "Command line switch \"-L\" should be followed by an integer.\n" );
- goto usage;
- }
- LevL = atoi(argv[globalUtilOptind]);
- globalUtilOptind++;
- if ( LevL < 0 )
- goto usage;
- break;
- case 'U':
- if ( globalUtilOptind >= argc )
- {
- Abc_Print( -1, "Command line switch \"-U\" should be followed by an integer.\n" );
- goto usage;
- }
- LevU = atoi(argv[globalUtilOptind]);
- globalUtilOptind++;
- if ( LevU < 0 )
- goto usage;
- break;
- case 'o':
- fOrder ^= 1;
- break;
- case 'f':
- fFancy ^= 1;
- break;
- case 'b':
- fUseBuf ^= 1;
- break;
- case 'r':
- fRandom ^= 1;
- break;
- case 'u':
- fUseWeights ^= 1;
- break;
- case 'v':
- fVerbose ^= 1;
- break;
- case 'w':
- fVeryVerbose ^= 1;
- break;
- case 'h':
- goto usage;
- default:
- goto usage;
- }
- }
- if ( argc - globalUtilOptind < 2 || argc - globalUtilOptind > 4 )
- {
- Abc_Print( 1, "Expecting two or three file names on the command line.\n" );
- goto usage;
- }
- Gia_ManRandom(1);
- for ( c = 0; c < argc - globalUtilOptind; c++ )
- pFileNames[c] = argv[globalUtilOptind+c];
- for ( c = 0; c < argc - globalUtilOptind - 1; c++ )
- {
- FILE * pFile = fopen( pFileNames[c], "rb" );
- if ( pFile == NULL )
- {
- printf( "Cannot open input file \"%s\".\n", pFileNames[c] );
- return 0;
- }
- else
- fclose( pFile );
- }
- Acb_NtkRunSim( pFileNames, nWords, nBeam, LevL, LevU, fOrder, fFancy, fUseBuf, fRandom, fUseWeights, fVerbose, fVeryVerbose );
- return 0;
-
-usage:
- Abc_Print( -2, "usage: runsim [-WBLU] [-ofbruvwh] [-N <num>] <file1> <file2> <file3>\n" );
- Abc_Print( -2, "\t experimental simulation command\n" );
- Abc_Print( -2, "\t-W <num> : the number of words of simulation info [default = %d]\n", nWords );
- Abc_Print( -2, "\t-B <num> : the beam width parameter [default = %d]\n", nBeam );
- Abc_Print( -2, "\t-L <num> : the lower bound on level [default = %d]\n", LevL );
- Abc_Print( -2, "\t-U <num> : the upper bound on level [default = %d]\n", LevU );
- Abc_Print( -2, "\t-o : toggle using a different node ordering [default = %s]\n", fOrder? "yes": "no" );
- Abc_Print( -2, "\t-f : toggle using experimental feature [default = %s]\n", fFancy? "yes": "no" );
- Abc_Print( -2, "\t-b : toggle using buffers [default = %s]\n", fUseBuf? "yes": "no" );
- Abc_Print( -2, "\t-r : toggle using random permutation of support variables [default = %s]\n", fRandom? "yes": "no" );
- Abc_Print( -2, "\t-u : toggle using topological info to select support variables [default = %s]\n", fUseWeights? "yes": "no" );
- Abc_Print( -2, "\t-v : toggle printing verbose information [default = %s]\n", fVerbose? "yes": "no" );
- Abc_Print( -2, "\t-w : toggle printing more verbose information [default = %s]\n", fVeryVerbose? "yes": "no" );
- Abc_Print( -2, "\t-h : print the command usage\n");
- return 1;
-}
-
-
-/**Function*************************************************************
-
- Synopsis []
-
- Description []
-
- SideEffects []
-
- SeeAlso []
-
-***********************************************************************/
int Abc_CommandRunTest( Abc_Frame_t * pAbc, int argc, char ** argv )
{
extern void Acb_NtkRunTest( char * pFileNames[4], int fFancy, int fVerbose );
@@ -7342,8 +7286,8 @@ int Abc_CommandRunTest( Abc_Frame_t * pAbc, int argc, char ** argv )
return 0;
usage:
- Abc_Print( -2, "usage: runtest [-fvh] <file1> <file2>\n" );
- Abc_Print( -2, "\t experimental simulation command\n" );
+ Abc_Print( -2, "usage: xec [-fvh] <file1> <file2>\n" );
+ Abc_Print( -2, "\t combinational equivalence checking with x-values\n" );
Abc_Print( -2, "\t-f : toggle using experimental feature [default = %s]\n", fFancy? "yes": "no" );
Abc_Print( -2, "\t-v : toggle printing verbose information [default = %s]\n", fVerbose? "yes": "no" );
Abc_Print( -2, "\t-h : print the command usage\n");
@@ -10353,7 +10297,7 @@ int Abc_CommandPutOnTop( Abc_Frame_t * pAbc, int argc, char ** argv )
{
extern Abc_Ntk_t * Abc_NtkPutOnTop( Abc_Ntk_t * pNtk, Abc_Ntk_t * pNtk2 );
- Abc_Ntk_t * pNtk, * pNtk2, * pNtkRes;
+ Abc_Ntk_t * pNtk, * pNtk2, * pNtkRes = NULL;
char * FileName;
int fComb = 0;
int c;
@@ -10373,6 +10317,36 @@ int Abc_CommandPutOnTop( Abc_Frame_t * pAbc, int argc, char ** argv )
}
}
+ if ( argc > globalUtilOptind + 1 )
+ {
+ for ( c = 1; c < argc; c++ )
+ {
+ Abc_Ntk_t * pTemp, * pLogic = Io_Read( argv[c], Io_ReadFileType(argv[c]), 1, 0 );
+ if ( pLogic == NULL )
+ return 1;
+ if ( Abc_NtkIsStrash(pLogic) )
+ {
+ pLogic = Abc_NtkToLogic( pTemp = pLogic );
+ Abc_NtkDelete( pTemp );
+ }
+ if ( pLogic == NULL )
+ return 1;
+ if ( pNtkRes == NULL )
+ pNtkRes = pLogic;
+ else
+ {
+ pNtkRes = Abc_NtkPutOnTop( pTemp = pNtkRes, pLogic );
+ Abc_NtkDelete( pTemp );
+ Abc_NtkDelete( pLogic );
+ if ( pNtkRes == NULL )
+ return 1;
+ }
+ }
+ assert( Abc_NtkIsLogic(pNtkRes) );
+ Abc_FrameReplaceCurrentNetwork( pAbc, pNtkRes );
+ return 0;
+ }
+
// get the second network
if ( argc != globalUtilOptind + 1 )
{
@@ -10415,7 +10389,15 @@ int Abc_CommandPutOnTop( Abc_Frame_t * pAbc, int argc, char ** argv )
}
// get the new network
- pNtkRes = Abc_NtkPutOnTop( pNtk, pNtk2 );
+ if ( Abc_NtkIsLogic(pNtk2) )
+ pNtkRes = Abc_NtkPutOnTop( pNtk, pNtk2 );
+ else if ( Abc_NtkIsStrash(pNtk2) )
+ {
+ Abc_Ntk_t * pLogic = Abc_NtkToLogic( pNtk2 );
+ pNtkRes = Abc_NtkPutOnTop( pNtk, pLogic );
+ Abc_NtkDelete( pLogic );
+ }
+ else assert( 0 );
Abc_NtkDelete( pNtk2 );
// replace the current network
Abc_FrameReplaceCurrentNetwork( pAbc, pNtkRes );
@@ -10426,6 +10408,7 @@ usage:
Abc_Print( -2, "\t connects PIs of network in <file> to POs of current network\n" );
Abc_Print( -2, "\t-h : print the command usage\n");
Abc_Print( -2, "\t<file> : file name with the second network\n");
+ Abc_Print( -2, "\t : (given several files, all networks are stacked on top of each other)\n");
return 1;
}
@@ -10640,11 +10623,11 @@ usage:
int Abc_CommandSop( Abc_Frame_t * pAbc, int argc, char ** argv )
{
Abc_Ntk_t * pNtk = Abc_FrameReadNtk(pAbc);
- int c, fMode = -1, nCubeLimit = 1000000;
+ int c, fCubeSort = 1, fMode = -1, nCubeLimit = 1000000;
// set defaults
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "Cdnh" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "Csdnh" ) ) != EOF )
{
switch ( c )
{
@@ -10659,6 +10642,9 @@ int Abc_CommandSop( Abc_Frame_t * pAbc, int argc, char ** argv )
if ( nCubeLimit < 0 )
goto usage;
break;
+ case 's':
+ fCubeSort ^= 1;
+ break;
case 'd':
fMode = 1;
break;
@@ -10681,6 +10667,11 @@ int Abc_CommandSop( Abc_Frame_t * pAbc, int argc, char ** argv )
Abc_Print( -1, "Converting to SOP is possible only for logic networks.\n" );
return 1;
}
+ if ( !fCubeSort && Abc_NtkHasBdd(pNtk) && !Abc_NtkBddToSop(pNtk, -1, ABC_INFINITY, 0) )
+ {
+ Abc_Print( -1, "Converting to SOP has failed.\n" );
+ return 0;
+ }
if ( !Abc_NtkToSop(pNtk, fMode, nCubeLimit) )
{
Abc_Print( -1, "Converting to SOP has failed.\n" );
@@ -10689,9 +10680,10 @@ int Abc_CommandSop( Abc_Frame_t * pAbc, int argc, char ** argv )
return 0;
usage:
- Abc_Print( -2, "usage: sop [-C num] [-dnh]\n" );
+ Abc_Print( -2, "usage: sop [-C num] [-sdnh]\n" );
Abc_Print( -2, "\t converts node functions to SOP\n" );
Abc_Print( -2, "\t-C num : the limit on the number of cubes at a node [default = %d]\n", nCubeLimit );
+ Abc_Print( -2, "\t-s : toggles cube sort when converting from BDDs [default = %s]\n", fCubeSort ? "yes": "no" );
Abc_Print( -2, "\t-d : toggles using only positive polarity [default = %s]\n", fMode == 1 ? "yes": "no" );
Abc_Print( -2, "\t-n : toggles using only negative polarity [default = %s]\n", fMode == 0 ? "yes": "no" );
Abc_Print( -2, "\t-h : print the command usage\n");
@@ -11036,11 +11028,11 @@ usage:
int Abc_CommandMuxes( Abc_Frame_t * pAbc, int argc, char ** argv )
{
Abc_Ntk_t * pNtk, * pNtkRes;
- int c, fGlobal = 0, Limit = 1000000;
+ int c, fGlobal = 0, fUseAdd = 0, Limit = 1000000;
pNtk = Abc_FrameReadNtk(pAbc);
// set defaults
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "Bgh" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "Bgah" ) ) != EOF )
{
switch ( c )
{
@@ -11058,6 +11050,9 @@ int Abc_CommandMuxes( Abc_Frame_t * pAbc, int argc, char ** argv )
case 'g':
fGlobal ^= 1;
break;
+ case 'a':
+ fUseAdd ^= 1;
+ break;
case 'h':
goto usage;
default:
@@ -11089,7 +11084,7 @@ int Abc_CommandMuxes( Abc_Frame_t * pAbc, int argc, char ** argv )
}
// get the new network
- pNtkRes = Abc_NtkBddToMuxes( pNtk, fGlobal, Limit );
+ pNtkRes = Abc_NtkBddToMuxes( pNtk, fGlobal, Limit, fUseAdd );
if ( pNtkRes == NULL )
{
Abc_Print( 0, "Converting to MUXes has failed.\n" );
@@ -11100,11 +11095,12 @@ int Abc_CommandMuxes( Abc_Frame_t * pAbc, int argc, char ** argv )
return 0;
usage:
- Abc_Print( -2, "usage: muxes [-B num] [-gh]\n" );
+ Abc_Print( -2, "usage: muxes [-B num] [-gah]\n" );
Abc_Print( -2, "\t converts the current network into a network derived by\n" );
Abc_Print( -2, "\t replacing all nodes by DAGs isomorphic to the local BDDs\n" );
Abc_Print( -2, "\t-B <num>: limit on live BDD nodes during collapsing [default = %d]\n", Limit );
Abc_Print( -2, "\t-g : toggle visualizing the global BDDs of primary outputs [default = %s].\n", fGlobal? "yes": "no" );
+ Abc_Print( -2, "\t-a : toggle using ADDs instead of BDDs [default = %s].\n", fUseAdd? "yes": "no" );
Abc_Print( -2, "\t-h : print the command usage\n");
return 1;
}
@@ -11895,12 +11891,7 @@ int Abc_CommandTopmost( Abc_Frame_t * pAbc, int argc, char ** argv )
if ( Abc_NtkLatchNum(pNtk) > 0 )
{
- Abc_Print( -1, "Currently can only works for combinational circuits.\n" );
- return 0;
- }
- if ( Abc_NtkPoNum(pNtk) != 1 )
- {
- Abc_Print( -1, "Currently expects a single-output miter.\n" );
+ Abc_Print( -1, "Currently only works for combinational circuits.\n" );
return 0;
}
@@ -11934,6 +11925,86 @@ usage:
SeeAlso []
***********************************************************************/
+int Abc_CommandBottommost( Abc_Frame_t * pAbc, int argc, char ** argv )
+{
+ Abc_Ntk_t * pNtk, * pNtkRes;
+ int c, nLevels;
+ extern Abc_Ntk_t * Abc_NtkBottommost( Abc_Ntk_t * pNtk, int nLevels );
+
+ pNtk = Abc_FrameReadNtk(pAbc);
+ // set defaults
+ nLevels = 10;
+ Extra_UtilGetoptReset();
+ while ( ( c = Extra_UtilGetopt( argc, argv, "Nh" ) ) != EOF )
+ {
+ switch ( c )
+ {
+ case 'N':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-N\" should be followed by an integer.\n" );
+ goto usage;
+ }
+ nLevels = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ if ( nLevels < 0 )
+ goto usage;
+ break;
+ case 'h':
+ goto usage;
+ default:
+ goto usage;
+ }
+ }
+
+ if ( pNtk == NULL )
+ {
+ Abc_Print( -1, "Empty network.\n" );
+ return 1;
+ }
+
+ if ( !Abc_NtkIsStrash(pNtk) )
+ {
+ Abc_Print( -1, "Currently only works for structurally hashed circuits.\n" );
+ return 0;
+ }
+
+ if ( Abc_NtkLatchNum(pNtk) > 0 )
+ {
+ Abc_Print( -1, "Currently only works for combinational circuits.\n" );
+ return 0;
+ }
+
+ pNtkRes = Abc_NtkBottommost( pNtk, nLevels );
+ if ( pNtkRes == NULL )
+ {
+ Abc_Print( -1, "The command has failed.\n" );
+ return 1;
+ }
+ // replace the current network
+ Abc_FrameReplaceCurrentNetwork( pAbc, pNtkRes );
+ return 0;
+
+usage:
+ Abc_Print( -2, "usage: bottommost [-N num] [-h]\n" );
+ Abc_Print( -2, "\t replaces the current network by several of its bottommost levels\n" );
+ Abc_Print( -2, "\t-N num : max number of levels [default = %d]\n", nLevels );
+ Abc_Print( -2, "\t-h : print the command usage\n");
+ Abc_Print( -2, "\tname : the node name\n");
+ return 1;
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
int Abc_CommandTopAnd( Abc_Frame_t * pAbc, int argc, char ** argv )
{
Abc_Ntk_t * pNtk, * pNtkRes;
@@ -12085,13 +12156,16 @@ usage:
int Abc_CommandShortNames( Abc_Frame_t * pAbc, int argc, char ** argv )
{
Abc_Ntk_t * pNtk = Abc_FrameReadNtk(pAbc);
- int c;
+ int c, fKeepIo = 0;
// set defaults
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "h" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "kh" ) ) != EOF )
{
switch ( c )
{
+ case 'k':
+ fKeepIo ^= 1;
+ break;
case 'h':
goto usage;
default:
@@ -12104,12 +12178,16 @@ int Abc_CommandShortNames( Abc_Frame_t * pAbc, int argc, char ** argv )
Abc_Print( -1, "Empty network.\n" );
return 1;
}
- Abc_NtkShortNames( pNtk );
+ if ( fKeepIo )
+ Abc_NtkCleanNames( pNtk );
+ else
+ Abc_NtkShortNames( pNtk );
return 0;
usage:
- Abc_Print( -2, "usage: short_names [-h]\n" );
+ Abc_Print( -2, "usage: short_names [-kh]\n" );
Abc_Print( -2, "\t replaces PI/PO/latch names by short char strings\n" );
+ Abc_Print( -2, "\t-k : toggle keeping PI/PO names unchanged [default = %s]\n", fKeepIo? "yes": "no" );
Abc_Print( -2, "\t-h : print the command usage\n");
return 1;
}
@@ -13893,7 +13971,6 @@ int Abc_CommandTest( Abc_Frame_t * pAbc, int argc, char ** argv )
//Dau_NetworkEnumTest();
//Extra_SimulationTest( nDivMax, nNumOnes, fNewOrder );
//Mnist_ExperimentWithScaling( nDecMax );
- Gia_Gen2CodeTest();
return 0;
usage:
Abc_Print( -2, "usage: test [-CKDNM] [-aovwh] <file_name>\n" );
@@ -14913,7 +14990,7 @@ int Abc_CommandDch( Abc_Frame_t * pAbc, int argc, char ** argv )
// set defaults
Dch_ManSetDefaultParams( pPars );
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "WCSsptgcfrvh" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "WCSsptgcfrxvh" ) ) != EOF )
{
switch ( c )
{
@@ -14971,6 +15048,9 @@ int Abc_CommandDch( Abc_Frame_t * pAbc, int argc, char ** argv )
case 'r':
pPars->fSkipRedSupp ^= 1;
break;
+ case 'x':
+ pPars->fUseNew ^= 1;
+ break;
case 'v':
pPars->fVerbose ^= 1;
break;
@@ -15001,7 +15081,7 @@ int Abc_CommandDch( Abc_Frame_t * pAbc, int argc, char ** argv )
return 0;
usage:
- Abc_Print( -2, "usage: dch [-WCS num] [-sptgcfrvh]\n" );
+ Abc_Print( -2, "usage: dch [-WCS num] [-sptgcfrxvh]\n" );
Abc_Print( -2, "\t computes structural choices using a new approach\n" );
Abc_Print( -2, "\t-W num : the max number of simulation words [default = %d]\n", pPars->nWords );
Abc_Print( -2, "\t-C num : the max number of conflicts at a node [default = %d]\n", pPars->nBTLimit );
@@ -15013,6 +15093,7 @@ usage:
Abc_Print( -2, "\t-c : toggle using circuit-based SAT vs. MiniSat [default = %s]\n", pPars->fUseCSat? "yes": "no" );
Abc_Print( -2, "\t-f : toggle using faster logic synthesis [default = %s]\n", pPars->fLightSynth? "yes": "no" );
Abc_Print( -2, "\t-r : toggle skipping choices with redundant support [default = %s]\n", pPars->fSkipRedSupp? "yes": "no" );
+ Abc_Print( -2, "\t-x : toggle using new choice computation [default = %s]\n", pPars->fUseNew? "yes": "no" );
Abc_Print( -2, "\t-v : toggle verbose printout [default = %s]\n", pPars->fVerbose? "yes": "no" );
Abc_Print( -2, "\t-h : print the command usage\n");
return 1;
@@ -15337,7 +15418,7 @@ int Abc_CommandIFraig( Abc_Frame_t * pAbc, int argc, char ** argv )
nPartSize = 0;
nLevelMax = 0;
nConfLimit = 100;
- fDoSparse = 0;
+ fDoSparse = 1;
fProve = 0;
fVerbose = 0;
Extra_UtilGetoptReset();
@@ -20302,9 +20383,15 @@ int Abc_CommandPipe( Abc_Frame_t * pAbc, int argc, char ** argv )
return 1;
}
- if ( Abc_NtkIsComb(pNtk) )
+ if ( !Abc_NtkIsLogic(pNtk) )
{
- Abc_Print( 0, "The current network is combinational.\n" );
+ Abc_Print( 0, "Abc_CommandPipe(): Expecting a logic network (run command \"logic\").\n" );
+ return 0;
+ }
+
+ if ( !Abc_NtkIsComb(pNtk) )
+ {
+ Abc_Print( 0, "Abc_CommandPipe(): Expecting a combinational network.\n" );
return 0;
}
@@ -23540,12 +23627,24 @@ int Abc_CommandPermute( Abc_Frame_t * pAbc, int argc, char ** argv )
int fFlops = 1;
int fNodes = 1;
int fFanout = 0;
+ int Seed = -1;
int c;
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "Fiofnxh" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "SFiofnxh" ) ) != EOF )
{
switch ( c )
{
+ case 'S':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-S\" should be followed by an integer.\n" );
+ goto usage;
+ }
+ Seed = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ if ( Seed < 0 )
+ goto usage;
+ break;
case 'F':
if ( globalUtilOptind >= argc )
{
@@ -23577,6 +23676,8 @@ int Abc_CommandPermute( Abc_Frame_t * pAbc, int argc, char ** argv )
goto usage;
}
}
+ if ( Seed >= 0 )
+ srand( (unsigned)Seed );
if ( pNtk == NULL )
{
Abc_Print( -1, "Empty network.\n" );
@@ -23611,8 +23712,9 @@ int Abc_CommandPermute( Abc_Frame_t * pAbc, int argc, char ** argv )
return 0;
usage:
- Abc_Print( -2, "usage: permute [-iofnxh] [-F filename]\n" );
+ Abc_Print( -2, "usage: permute [-S num] [-iofnxh] [-F filename]\n" );
Abc_Print( -2, "\t performs random permutation of inputs/outputs/flops\n" );
+ Abc_Print( -2, "\t-S num : the random seed to generate permutations (0 <= num < INT_MAX) [default = %d]\n", Seed );
Abc_Print( -2, "\t-i : toggle permuting primary inputs [default = %s]\n", fInputs? "yes": "no" );
Abc_Print( -2, "\t-o : toggle permuting primary outputs [default = %s]\n", fOutputs? "yes": "no" );
Abc_Print( -2, "\t-f : toggle permuting flip-flops [default = %s]\n", fFlops? "yes": "no" );
@@ -29728,8 +29830,10 @@ static inline int Abc_NtkCompareWithBest( Abc_Ntk_t * pBest, Abc_Ntk_t * p,
Abc_NtkPoNum(pBest) != Abc_NtkPoNum(p) ||
Abc_NtkLatchNum(pBest) != Abc_NtkLatchNum(p) ||
strcmp(Abc_NtkName(pBest), Abc_NtkName(p)) ||
- (!fArea && (*pnBestNtkLevels > nNtkLevels || (*pnBestNtkLevels == nNtkLevels && *pnBestNtkDelay > nNtkDelay ))) ||
- ( fArea && (*pnBestNtkNodes > nNtkNodes || (*pnBestNtkNodes == nNtkNodes && *pnBestNtkArea > nNtkArea )))
+// (!fArea && (*pnBestNtkLevels > nNtkLevels || (*pnBestNtkLevels == nNtkLevels && *pnBestNtkDelay > nNtkDelay ))) ||
+// ( fArea && (*pnBestNtkNodes > nNtkNodes || (*pnBestNtkNodes == nNtkNodes && *pnBestNtkArea > nNtkArea )))
+ (!fArea && (*pnBestNtkDelay > nNtkDelay || (*pnBestNtkDelay == nNtkDelay && *pnBestNtkArea > nNtkArea ))) ||
+ ( fArea && (*pnBestNtkArea > nNtkArea || (*pnBestNtkArea == nNtkArea && *pnBestNtkDelay > nNtkDelay )))
)
{
*pnBestNtkArea = nNtkArea;
@@ -29854,18 +29958,22 @@ usage:
int Abc_CommandAbc9Read( Abc_Frame_t * pAbc, int argc, char ** argv )
{
extern void Abc3_ReadShowHie( char * pFileName, int fFlat );
+ extern Gia_Man_t * Gia_MiniAigSuperDerive( char * pFileName, int fVerbose );
+ extern Gia_Man_t * Gia_FileSimpleRead( char * pFileName, int fNames, char * pFileW );
Gia_Man_t * pAig = NULL;
FILE * pFile;
char ** pArgvNew;
char * FileName, * pTemp;
int c, nArgcNew;
int fMiniAig = 0;
+ int fMiniAig2 = 0;
int fMiniLut = 0;
int fVerbose = 0;
int fGiaSimple = 0;
int fSkipStrash = 0;
+ int fNewReader = 0;
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "csmlvh" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "csmnlpvh" ) ) != EOF )
{
switch ( c )
{
@@ -29878,9 +29986,15 @@ int Abc_CommandAbc9Read( Abc_Frame_t * pAbc, int argc, char ** argv )
case 'm':
fMiniAig ^= 1;
break;
+ case 'n':
+ fMiniAig2 ^= 1;
+ break;
case 'l':
fMiniLut ^= 1;
break;
+ case 'p':
+ fNewReader ^= 1;
+ break;
case 'v':
fVerbose ^= 1;
break;
@@ -29912,8 +30026,12 @@ int Abc_CommandAbc9Read( Abc_Frame_t * pAbc, int argc, char ** argv )
}
fclose( pFile );
- if ( fMiniAig )
- pAig = Gia_ManReadMiniAig( FileName );
+ if ( fNewReader )
+ pAig = Gia_FileSimpleRead( FileName, fGiaSimple, NULL );
+ else if ( fMiniAig )
+ pAig = Gia_ManReadMiniAig( FileName, fGiaSimple || fSkipStrash );
+ else if ( fMiniAig2 )
+ pAig = Gia_MiniAigSuperDerive( FileName, fVerbose );
else if ( fMiniLut )
pAig = Gia_ManReadMiniLut( FileName );
// else if ( Extra_FileIsType( FileName, ".v", NULL, NULL ) )
@@ -29925,11 +30043,12 @@ int Abc_CommandAbc9Read( Abc_Frame_t * pAbc, int argc, char ** argv )
return 0;
usage:
- Abc_Print( -2, "usage: &r [-csmlvh] <file>\n" );
+ Abc_Print( -2, "usage: &r [-csmnlvh] <file>\n" );
Abc_Print( -2, "\t reads the current AIG from the AIGER file\n" );
Abc_Print( -2, "\t-c : toggles reading simple AIG [default = %s]\n", fGiaSimple? "yes": "no" );
Abc_Print( -2, "\t-s : toggles structural hashing while reading [default = %s]\n", !fSkipStrash? "yes": "no" );
Abc_Print( -2, "\t-m : toggles reading MiniAIG rather than AIGER file [default = %s]\n", fMiniAig? "yes": "no" );
+ Abc_Print( -2, "\t-n : toggles reading MiniAIG as a set of supergates [default = %s]\n", fMiniAig2? "yes": "no" );
Abc_Print( -2, "\t-l : toggles reading MiniLUT rather than AIGER file [default = %s]\n", fMiniLut? "yes": "no" );
Abc_Print( -2, "\t-v : toggles additional verbose output [default = %s]\n", fVerbose? "yes": "no" );
Abc_Print( -2, "\t-h : print the command usage\n");
@@ -30250,8 +30369,6 @@ usage:
int Abc_CommandAbc9Get( Abc_Frame_t * pAbc, int argc, char ** argv )
{
extern Aig_Man_t * Abc_NtkToDarChoices( Abc_Ntk_t * pNtk );
- extern Vec_Ptr_t * Abc_NtkCollectCiNames( Abc_Ntk_t * pNtk );
- extern Vec_Ptr_t * Abc_NtkCollectCoNames( Abc_Ntk_t * pNtk );
Abc_Ntk_t * pStrash;
Aig_Man_t * pAig;
Gia_Man_t * pGia, * pTemp;
@@ -30419,7 +30536,7 @@ int Abc_CommandAbc9Put( Abc_Frame_t * pAbc, int argc, char ** argv )
else
{
Abc_Ntk_t * pNtkNoCh;
-// Abc_Print( -1, "Transforming AIG with %d choice nodes.\n", Gia_ManEquivCountClasses(pAbc->pGia) );
+ Abc_Print( -1, "Transforming AIG with %d choice nodes.\n", Gia_ManEquivCountClasses(pAbc->pGia) );
// create network without choices
pMan = Gia_ManToAig( pAbc->pGia, 0 );
pNtkNoCh = Abc_NtkFromAigPhase( pMan );
@@ -30463,6 +30580,8 @@ int Abc_CommandAbc9Put( Abc_Frame_t * pAbc, int argc, char ** argv )
}
}
}
+ if ( pAbc->pGia->vNamesNode )
+ Abc_Print( 0, "Internal nodes names are not transferred.\n" );
// decouple CI/CO with the same name
if ( pAbc->pGia->vNamesIn || pAbc->pGia->vNamesOut )
@@ -30503,6 +30622,67 @@ usage:
/**Function*************************************************************
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+int Abc_CommandAbc9MoveNames( Abc_Frame_t * pAbc, int argc, char ** argv )
+{
+ int c, fVerbose = 0;
+ Extra_UtilGetoptReset();
+ while ( ( c = Extra_UtilGetopt( argc, argv, "nvh" ) ) != EOF )
+ {
+ switch ( c )
+ {
+ case 'v':
+ fVerbose ^= 1;
+ break;
+ default:
+ goto usage;
+ }
+ }
+ if ( pAbc->pNtkCur == NULL )
+ {
+ Abc_Print( -1, "There is no current network\n" );
+ return 1;
+ }
+ if ( pAbc->pGia == NULL )
+ {
+ Abc_Print( -1, "There is no current AIG.\n" );
+ return 1;
+ }
+ if ( Gia_ManCiNum(pAbc->pGia) != Abc_NtkCiNum(pAbc->pNtkCur) )
+ {
+ Abc_Print( -1, "The number of CIs does not match.\n" );
+ return 1;
+ }
+ if ( Gia_ManCoNum(pAbc->pGia) != Abc_NtkCoNum(pAbc->pNtkCur) )
+ {
+ Abc_Print( -1, "The number of COs does not match.\n" );
+ return 1;
+ }
+ if ( pAbc->pGia->vNamesIn ) Vec_PtrFreeFree( pAbc->pGia->vNamesIn );
+ if ( pAbc->pGia->vNamesOut ) Vec_PtrFreeFree( pAbc->pGia->vNamesOut );
+ pAbc->pGia->vNamesIn = Abc_NtkCollectCiNames( pAbc->pNtkCur );
+ pAbc->pGia->vNamesOut = Abc_NtkCollectCoNames( pAbc->pNtkCur );
+ return 0;
+
+usage:
+ Abc_Print( -2, "usage: &move_names [-vh]\n" );
+ Abc_Print( -2, "\t move CI/CO names\n" );
+ Abc_Print( -2, "\t-v : toggles additional verbose output [default = %s]\n", fVerbose? "yes": "no" );
+ Abc_Print( -2, "\t-h : print the command usage\n");
+ Abc_Print( -2, "\t<file> : the file name\n");
+ return 1;
+}
+
+/**Function*************************************************************
+
Synopsis [Compares to versions of the design and finds the best.]
Description []
@@ -30919,12 +31099,13 @@ int Abc_CommandAbc9Write( Abc_Frame_t * pAbc, int argc, char ** argv )
int c, nArgcNew;
int fUnique = 0;
int fVerilog = 0;
+ int fVerBufs = 0;
int fMiniAig = 0;
int fMiniLut = 0;
int fWriteNewLine = 0;
int fVerbose = 0;
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "upmlnvh" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "upbmlnvh" ) ) != EOF )
{
switch ( c )
{
@@ -30934,6 +31115,9 @@ int Abc_CommandAbc9Write( Abc_Frame_t * pAbc, int argc, char ** argv )
case 'p':
fVerilog ^= 1;
break;
+ case 'b':
+ fVerBufs ^= 1;
+ break;
case 'm':
fMiniAig ^= 1;
break;
@@ -30972,7 +31156,7 @@ int Abc_CommandAbc9Write( Abc_Frame_t * pAbc, int argc, char ** argv )
Gia_ManStop( pGia );
}
else if ( fVerilog )
- Gia_ManDumpVerilog( pAbc->pGia, pFileName, NULL );
+ Gia_ManDumpVerilog( pAbc->pGia, pFileName, NULL, fVerBufs );
else if ( fMiniAig )
Gia_ManWriteMiniAig( pAbc->pGia, pFileName );
else if ( fMiniLut )
@@ -30982,10 +31166,11 @@ int Abc_CommandAbc9Write( Abc_Frame_t * pAbc, int argc, char ** argv )
return 0;
usage:
- Abc_Print( -2, "usage: &w [-upmlnvh] <file>\n" );
+ Abc_Print( -2, "usage: &w [-upbmlnvh] <file>\n" );
Abc_Print( -2, "\t writes the current AIG into the AIGER file\n" );
Abc_Print( -2, "\t-u : toggle writing canonical AIG structure [default = %s]\n", fUnique? "yes" : "no" );
Abc_Print( -2, "\t-p : toggle writing Verilog with 'and' and 'not' [default = %s]\n", fVerilog? "yes" : "no" );
+ Abc_Print( -2, "\t-b : toggle writing additional buffers in Verilog [default = %s]\n", fVerBufs? "yes" : "no" );
Abc_Print( -2, "\t-m : toggle writing MiniAIG rather than AIGER [default = %s]\n", fMiniAig? "yes" : "no" );
Abc_Print( -2, "\t-l : toggle writing MiniLUT rather than AIGER [default = %s]\n", fMiniLut? "yes" : "no" );
Abc_Print( -2, "\t-n : toggle writing \'\\n\' after \'c\' in the AIGER file [default = %s]\n", fWriteNewLine? "yes": "no" );
@@ -31500,6 +31685,58 @@ usage:
SeeAlso []
***********************************************************************/
+int Abc_CommandAbc9MuxDec( Abc_Frame_t * pAbc, int argc, char ** argv )
+{
+ extern Gia_Man_t * Gia_ManPerformMuxDec( Gia_Man_t * p );
+ Gia_Man_t * pGia;
+ int c, fVerbose = 0;
+ Extra_UtilGetoptReset();
+ while ( ( c = Extra_UtilGetopt( argc, argv, "vh" ) ) != EOF )
+ {
+ switch ( c )
+ {
+ case 'v':
+ fVerbose ^= 1;
+ break;
+ case 'h':
+ goto usage;
+ default:
+ goto usage;
+ }
+ }
+ if ( pAbc->pGia == NULL )
+ {
+ Abc_Print( -1, "Abc_CommandAbc9MuxDec(): There is no AIG.\n" );
+ return 1;
+ }
+ if ( Gia_ManCiNum(pAbc->pGia) <= 6 || Gia_ManCiNum(pAbc->pGia) > 26 )
+ {
+ Abc_Print( -1, "Abc_CommandAbc9MuxDec(): The number of inputs is wrong.\n" );
+ return 1;
+ }
+ pGia = Gia_ManPerformMuxDec( pAbc->pGia );
+ Abc_FrameUpdateGia( pAbc, pGia );
+ return 0;
+
+usage:
+ Abc_Print( -2, "usage: &muxdec [-vh]\n" );
+ Abc_Print( -2, "\t performs restructuring\n" );
+ Abc_Print( -2, "\t-v : toggle verbose output [default = %s]\n", fVerbose? "yes": "no" );
+ Abc_Print( -2, "\t-h : print the command usage\n");
+ return 1;
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
int Abc_CommandAbc9PrintTruth( Abc_Frame_t * pAbc, int argc, char ** argv )
{
extern word Gia_LutComputeTruth6Simple( Gia_Man_t * p, int iPo );
@@ -31902,13 +32139,14 @@ int Abc_CommandAbc9Strash( Abc_Frame_t * pAbc, int argc, char ** argv )
extern Gia_Man_t * Gia_ManDupMuxRestructure( Gia_Man_t * p );
Gia_Man_t * pTemp;
int c, Limit = 2;
+ int Multi = 0;
int fAddStrash = 0;
int fCollapse = 0;
int fAddMuxes = 0;
int fStrMuxes = 0;
int fRehashMap = 0;
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "Lacmrsh" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "LMacmrsh" ) ) != EOF )
{
switch ( c )
{
@@ -31923,6 +32161,17 @@ int Abc_CommandAbc9Strash( Abc_Frame_t * pAbc, int argc, char ** argv )
if ( Limit < 0 )
goto usage;
break;
+ case 'M':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-M\" should be followed by an integer.\n" );
+ goto usage;
+ }
+ Multi = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ if ( Multi <= 0 )
+ goto usage;
+ break;
case 'a':
fAddStrash ^= 1;
break;
@@ -31949,6 +32198,13 @@ int Abc_CommandAbc9Strash( Abc_Frame_t * pAbc, int argc, char ** argv )
Abc_Print( -1, "Abc_CommandAbc9Strash(): There is no AIG.\n" );
return 1;
}
+ if ( Multi > 0 )
+ {
+ extern Gia_Man_t * Gia_ManDupAddPis( Gia_Man_t * p, int nMulti );
+ pTemp = Gia_ManDupAddPis( pAbc->pGia, Multi );
+ Abc_FrameUpdateGia( pAbc, pTemp );
+ return 0;
+ }
if ( fStrMuxes )
{
if ( Gia_ManHasMapping(pAbc->pGia) )
@@ -32016,13 +32272,14 @@ int Abc_CommandAbc9Strash( Abc_Frame_t * pAbc, int argc, char ** argv )
return 0;
usage:
- Abc_Print( -2, "usage: &st [-L num] [-acmrsh]\n" );
+ Abc_Print( -2, "usage: &st [-LM num] [-acmrsh]\n" );
Abc_Print( -2, "\t performs structural hashing\n" );
Abc_Print( -2, "\t-a : toggle additional hashing [default = %s]\n", fAddStrash? "yes": "no" );
Abc_Print( -2, "\t-c : toggle collapsing hierarchical AIG [default = %s]\n", fCollapse? "yes": "no" );
Abc_Print( -2, "\t-m : toggle converting to larger gates [default = %s]\n", fAddMuxes? "yes": "no" );
Abc_Print( -2, "\t-L num : create MUX when sum of refs does not exceed this limit [default = %d]\n", Limit );
Abc_Print( -2, "\t (use L = 1 to create AIG with XORs but without MUXes)\n" );
+ Abc_Print( -2, "\t-M num : create an AIG with additional primary inputs [default = %d]\n", Multi );
Abc_Print( -2, "\t-r : toggle rehashing AIG while preserving mapping [default = %s]\n", fRehashMap? "yes": "no" );
Abc_Print( -2, "\t-s : toggle using MUX restructuring [default = %s]\n", fStrMuxes? "yes": "no" );
Abc_Print( -2, "\t-h : print the command usage\n");
@@ -32139,11 +32396,12 @@ usage:
***********************************************************************/
int Abc_CommandAbc9Cof( Abc_Frame_t * pAbc, int argc, char ** argv )
{
+ extern Gia_Man_t * Gia_ManComputeCofs( Gia_Man_t * p, int nVars );
Gia_Man_t * pTemp;
int c, fVerbose = 0;
- int iVar = 0, nLimFan = 0;
+ int iVar = 0, nLimFan = 0, nVars = 0;
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "VLvh" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "VLNvh" ) ) != EOF )
{
switch ( c )
{
@@ -32169,6 +32427,17 @@ int Abc_CommandAbc9Cof( Abc_Frame_t * pAbc, int argc, char ** argv )
if ( nLimFan < 0 )
goto usage;
break;
+ case 'N':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-N\" should be followed by an integer.\n" );
+ goto usage;
+ }
+ nVars = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ if ( nVars < 0 )
+ goto usage;
+ break;
case 'v':
fVerbose ^= 1;
break;
@@ -32183,15 +32452,21 @@ int Abc_CommandAbc9Cof( Abc_Frame_t * pAbc, int argc, char ** argv )
Abc_Print( -1, "Abc_CommandAbc9Cof(): There is no AIG.\n" );
return 1;
}
- if ( nLimFan )
+ if ( nVars )
+ {
+ Abc_Print( 0, "Cofactoring the last %d inputs.\n", nVars );
+ pTemp = Gia_ManComputeCofs( pAbc->pGia, nVars );
+ Abc_FrameUpdateGia( pAbc, pTemp );
+ }
+ else if ( nLimFan )
{
- Abc_Print( -1, "Cofactoring all variables whose fanout count is higher than %d.\n", nLimFan );
+ Abc_Print( 0, "Cofactoring all variables whose fanout count is higher than %d.\n", nLimFan );
pTemp = Gia_ManDupCofAll( pAbc->pGia, nLimFan, fVerbose );
Abc_FrameUpdateGia( pAbc, pTemp );
}
else if ( iVar )
{
- Abc_Print( -1, "Cofactoring one variable with object ID %d.\n", iVar );
+ Abc_Print( 0, "Cofactoring one variable with object ID %d.\n", iVar );
pTemp = Gia_ManDupCof( pAbc->pGia, iVar );
Abc_FrameUpdateGia( pAbc, pTemp );
}
@@ -32203,10 +32478,11 @@ int Abc_CommandAbc9Cof( Abc_Frame_t * pAbc, int argc, char ** argv )
return 0;
usage:
- Abc_Print( -2, "usage: &cof [-VL num] [-vh]\n" );
+ Abc_Print( -2, "usage: &cof [-VLN num] [-vh]\n" );
Abc_Print( -2, "\t performs cofactoring w.r.t. variable(s)\n" );
Abc_Print( -2, "\t-V num : the zero-based ID of one variable to cofactor [default = %d]\n", iVar );
Abc_Print( -2, "\t-L num : cofactor vars with fanout count higher than this [default = %d]\n", nLimFan );
+ Abc_Print( -2, "\t-N num : cofactoring the given number of last input variables [default = %d]\n", nVars );
Abc_Print( -2, "\t-v : toggle printing verbose information [default = %s]\n", fVerbose? "yes": "no" );
Abc_Print( -2, "\t-h : print the command usage\n");
return 1;
@@ -32232,8 +32508,9 @@ int Abc_CommandAbc9Trim( Abc_Frame_t * pAbc, int argc, char ** argv )
int fTrimCos = 1;
int fDualOut = 0;
int fPoFedByPi = 0;
+ int fPoFedByPo = 0;
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "Viocdh" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "Viocpdh" ) ) != EOF )
{
switch ( c )
{
@@ -32257,6 +32534,9 @@ int Abc_CommandAbc9Trim( Abc_Frame_t * pAbc, int argc, char ** argv )
case 'c':
fPoFedByPi ^= 1;
break;
+ case 'p':
+ fPoFedByPo ^= 1;
+ break;
case 'd':
fDualOut ^= 1;
break;
@@ -32278,16 +32558,23 @@ int Abc_CommandAbc9Trim( Abc_Frame_t * pAbc, int argc, char ** argv )
pTemp = Gia_ManDupTrimmed2( pTemp2 = pTemp );
Gia_ManStop( pTemp2 );
}
+ if ( fPoFedByPo )
+ {
+ extern Gia_Man_t * Gia_ManDupTrimmed3( Gia_Man_t * p );
+ pTemp = Gia_ManDupTrimmed3( pTemp2 = pTemp );
+ Gia_ManStop( pTemp2 );
+ }
Abc_FrameUpdateGia( pAbc, pTemp );
return 0;
usage:
- Abc_Print( -2, "usage: &trim [-V num] [-iocdh]\n" );
+ Abc_Print( -2, "usage: &trim [-V num] [-iocpdh]\n" );
Abc_Print( -2, "\t removes PIs without fanout and PO driven by constants\n" );
Abc_Print( -2, "\t-V num : the value (0 or 1) of POs to remove [default = both]\n" );
Abc_Print( -2, "\t-i : toggle removing PIs [default = %s]\n", fTrimCis? "yes": "no" );
Abc_Print( -2, "\t-o : toggle removing POs [default = %s]\n", fTrimCos? "yes": "no" );
Abc_Print( -2, "\t-c : toggle additionally removing POs fed by PIs [default = %s]\n", fPoFedByPi? "yes": "no" );
+ Abc_Print( -2, "\t-p : toggle additionally removing duplicated POs [default = %s]\n", fPoFedByPo? "yes": "no" );
Abc_Print( -2, "\t-d : toggle using dual-output miter [default = %s]\n", fDualOut? "yes": "no" );
Abc_Print( -2, "\t-h : print the command usage\n");
return 1;
@@ -32309,18 +32596,22 @@ int Abc_CommandAbc9Dfs( Abc_Frame_t * pAbc, int argc, char ** argv )
Gia_Man_t * pTemp;
int c;
int fNormal = 0;
- int fReverse = 0;
+ int fRevFans = 0;
+ int fRevOuts = 0;
int fVerbose = 0;
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "nrvh" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "nfovh" ) ) != EOF )
{
switch ( c )
{
case 'n':
fNormal ^= 1;
break;
- case 'r':
- fReverse ^= 1;
+ case 'f':
+ fRevFans ^= 1;
+ break;
+ case 'o':
+ fRevOuts ^= 1;
break;
case 'v':
fVerbose ^= 1;
@@ -32337,31 +32628,18 @@ int Abc_CommandAbc9Dfs( Abc_Frame_t * pAbc, int argc, char ** argv )
return 1;
}
if ( fNormal )
- {
pTemp = Gia_ManDupOrderAiger( pAbc->pGia );
- if ( fVerbose )
- Abc_Print( -1, "AIG objects are reordered as follows: CIs, ANDs, COs.\n" );
- }
- else if ( fReverse )
- {
- pTemp = Gia_ManDupOrderDfsReverse( pAbc->pGia );
- if ( fVerbose )
- Abc_Print( -1, "AIG objects are reordered in the reserve DFS order.\n" );
- }
- else
- {
- pTemp = Gia_ManDupOrderDfs( pAbc->pGia );
- if ( fVerbose )
- Abc_Print( -1, "AIG objects are reordered in the DFS order.\n" );
- }
+ else
+ pTemp = Gia_ManDupOrderDfsReverse( pAbc->pGia, fRevFans, fRevOuts );
Abc_FrameUpdateGia( pAbc, pTemp );
return 0;
usage:
- Abc_Print( -2, "usage: &dfs [-nrvh]\n" );
+ Abc_Print( -2, "usage: &dfs [-nfovh]\n" );
Abc_Print( -2, "\t orders objects in the DFS order\n" );
Abc_Print( -2, "\t-n : toggle using normalized ordering [default = %s]\n", fNormal? "yes": "no" );
- Abc_Print( -2, "\t-r : toggle using reverse DFS ordering [default = %s]\n", fReverse? "yes": "no" );
+ Abc_Print( -2, "\t-f : toggle using reverse fanin traversal order [default = %s]\n", fRevFans? "yes": "no" );
+ Abc_Print( -2, "\t-o : toggle using reverse output traversal order [default = %s]\n", fRevOuts? "yes": "no" );
Abc_Print( -2, "\t-v : toggle printing verbose information [default = %s]\n", fVerbose? "yes": "no" );
Abc_Print( -2, "\t-h : print the command usage\n");
return 1;
@@ -32514,6 +32792,184 @@ usage:
SeeAlso []
***********************************************************************/
+int Abc_CommandAbc9Sim2( Abc_Frame_t * pAbc, int argc, char ** argv )
+{
+ extern int Gia_ManSimTwo( Gia_Man_t * p0, Gia_Man_t * p1, int nWords, int nRounds, int fVerbose );
+ Gia_Man_t * pGias[2]; FILE * pFile;
+ char ** pArgvNew; int nArgcNew;
+ int c, RetValue = 0, fVerbose = 0, nWords = 16, nRounds = 10, RandSeed = 1, TimeLimit = 0;
+ Extra_UtilGetoptReset();
+ while ( ( c = Extra_UtilGetopt( argc, argv, "WRNTvh" ) ) != EOF )
+ {
+ switch ( c )
+ {
+ case 'W':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-W\" should be followed by an integer.\n" );
+ goto usage;
+ }
+ nWords = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ if ( nWords < 0 )
+ goto usage;
+ break;
+ case 'R':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-R\" should be followed by an integer.\n" );
+ goto usage;
+ }
+ nRounds = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ if ( nRounds < 0 )
+ goto usage;
+ break;
+ case 'N':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-N\" should be followed by an integer.\n" );
+ goto usage;
+ }
+ RandSeed = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ if ( RandSeed < 0 )
+ goto usage;
+ break;
+ case 'T':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-T\" should be followed by an integer.\n" );
+ goto usage;
+ }
+ TimeLimit = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ if ( TimeLimit < 0 )
+ goto usage;
+ break;
+ case 'v':
+ fVerbose ^= 1;
+ break;
+ case 'h':
+ goto usage;
+ default:
+ goto usage;
+ }
+ }
+ pArgvNew = argv + globalUtilOptind;
+ nArgcNew = argc - globalUtilOptind;
+ if ( nArgcNew > 2 )
+ {
+ Abc_Print( -1, "Abc_CommandAbc9Cec(): Wrong number of command-line arguments.\n" );
+ return 1;
+ }
+ if ( nArgcNew == 2 )
+ {
+ char * pFileNames[2] = { pArgvNew[0], pArgvNew[1] }, * pTemp;
+ int n;
+ for ( n = 0; n < 2; n++ )
+ {
+ // fix the wrong symbol
+ for ( pTemp = pFileNames[n]; *pTemp; pTemp++ )
+ if ( *pTemp == '>' )
+ *pTemp = '\\';
+ if ( (pFile = fopen( pFileNames[n], "r" )) == NULL )
+ {
+ Abc_Print( -1, "Cannot open input file \"%s\". ", pFileNames[n] );
+ if ( (pFileNames[n] = Extra_FileGetSimilarName( pFileNames[n], ".aig", NULL, NULL, NULL, NULL )) )
+ Abc_Print( 1, "Did you mean \"%s\"?", pFileNames[n] );
+ Abc_Print( 1, "\n" );
+ return 1;
+ }
+ fclose( pFile );
+ pGias[n] = Gia_AigerRead( pFileNames[n], 0, 0, 0 );
+ if ( pGias[n] == NULL )
+ {
+ Abc_Print( -1, "Reading AIGER from file \"%s\" has failed.\n", pFileNames[n] );
+ return 0;
+ }
+ }
+ }
+ else
+ {
+ char * FileName, * pTemp;
+ if ( pAbc->pGia == NULL )
+ {
+ Abc_Print( -1, "Abc_CommandAbc9Cec(): There is no current AIG.\n" );
+ return 1;
+ }
+ pGias[0] = pAbc->pGia;
+ if ( nArgcNew == 1 )
+ FileName = pArgvNew[0];
+ else
+ {
+ assert( nArgcNew == 0 );
+ if ( pAbc->pGia->pSpec == NULL )
+ {
+ Abc_Print( -1, "File name is not given on the command line.\n" );
+ return 1;
+ }
+ FileName = pAbc->pGia->pSpec;
+ }
+ // fix the wrong symbol
+ for ( pTemp = FileName; *pTemp; pTemp++ )
+ if ( *pTemp == '>' )
+ *pTemp = '\\';
+ if ( (pFile = fopen( FileName, "r" )) == NULL )
+ {
+ Abc_Print( -1, "Cannot open input file \"%s\". ", FileName );
+ if ( (FileName = Extra_FileGetSimilarName( FileName, ".aig", NULL, NULL, NULL, NULL )) )
+ Abc_Print( 1, "Did you mean \"%s\"?", FileName );
+ Abc_Print( 1, "\n" );
+ return 1;
+ }
+ fclose( pFile );
+ pGias[1] = Gia_AigerRead( FileName, 0, 0, 0 );
+ if ( pGias[1] == NULL )
+ {
+ Abc_Print( -1, "Reading AIGER has failed.\n" );
+ return 0;
+ }
+ }
+ if ( Gia_ManCiNum(pGias[0]) != Gia_ManCiNum(pGias[1]) )
+ {
+ Abc_Print( -1, "The number of CIs does not match.\n" );
+ return 1;
+ }
+ if ( Gia_ManCoNum(pGias[0]) != Gia_ManCoNum(pGias[1]) )
+ {
+ Abc_Print( -1, "The number of COs does not match.\n" );
+ return 1;
+ }
+ RetValue = Gia_ManSimTwo( pGias[0], pGias[1], nWords, nRounds, fVerbose );
+ if ( pGias[0] != pAbc->pGia )
+ Gia_ManStopP( &pGias[0] );
+ Gia_ManStopP( &pGias[1] );
+ return 0;
+
+usage:
+ Abc_Print( -2, "usage: &sim2 [-WRNT num] [-vh] <file1.aig> <file2.aig>\n" );
+ Abc_Print( -2, "\t performs random of two circuits\n" );
+ Abc_Print( -2, "\t-W num : the number of words to simulate [default = %d]\n", nWords );
+ Abc_Print( -2, "\t-R num : the number of simulation rounds [default = %d]\n", nRounds );
+ Abc_Print( -2, "\t-N num : random number seed (1 <= num <= 1000) [default = %d]\n", RandSeed );
+ Abc_Print( -2, "\t-T num : approximate runtime limit in seconds [default = %d]\n", TimeLimit );
+ Abc_Print( -2, "\t-v : toggle printing verbose information [default = %s]\n", fVerbose? "yes": "no" );
+ Abc_Print( -2, "\t-h : print the command usage\n");
+ return 1;
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
int Abc_CommandAbc9Sim3( Abc_Frame_t * pAbc, int argc, char ** argv )
{
extern int Ssw_RarSimulateGia( Gia_Man_t * p, Ssw_RarPars_t * pPars );
@@ -32837,9 +33293,108 @@ usage:
SeeAlso []
***********************************************************************/
+int Abc_CommandAbc9Iwls21Test( Abc_Frame_t * pAbc, int argc, char ** argv )
+{
+ extern void Gia_ManTestWordFile( Gia_Man_t * p, char * pFileName, char * pDumpFile, int fVerbose );
+ int c, fVerbose = 0;
+ char * pDumpFile = NULL;
+ char ** pArgvNew;
+ int nArgcNew;
+ Extra_UtilGetoptReset();
+ while ( ( c = Extra_UtilGetopt( argc, argv, "Dvh" ) ) != EOF )
+ {
+ switch ( c )
+ {
+ case 'D':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-D\" should be followed by a file name.\n" );
+ goto usage;
+ }
+ pDumpFile = argv[globalUtilOptind];
+ globalUtilOptind++;
+ break;
+ case 'v':
+ fVerbose ^= 1;
+ break;
+ case 'h':
+ goto usage;
+ default:
+ goto usage;
+ }
+ }
+ pArgvNew = argv + globalUtilOptind;
+ nArgcNew = argc - globalUtilOptind;
+ if ( nArgcNew == 2 )
+ {
+ Gia_Man_t * pAig = Gia_AigerRead( pArgvNew[0], 0, 0, 0 );
+ if ( pAig == NULL )
+ {
+ Abc_Print( -1, "Reading AIGER from file \"%s\" has failed.\n", pArgvNew[0] );
+ return 0;
+ }
+ if ( Gia_ManRegNum(pAig) > 0 )
+ {
+ Abc_Print( -1, "Abc_CommandAbc9Iwls21Test(): This command works only for combinational AIGs.\n" );
+ return 0;
+ }
+ if ( Gia_ManCoNum(pAig) != 10 )
+ {
+ Abc_Print( -1, "Abc_CommandAbc9Iwls21Test(): Expecting an AIG with 10 outputs.\n" );
+ return 0;
+ }
+ Gia_ManTestWordFile( pAig, pArgvNew[1], pDumpFile, fVerbose );
+ Gia_ManStop( pAig );
+ return 0;
+ }
+ if ( pAbc->pGia == NULL )
+ {
+ Abc_Print( -1, "Abc_CommandAbc9Iwls21Test(): There is no AIG.\n" );
+ return 1;
+ }
+ if ( Gia_ManCoNum(pAbc->pGia) != 10 )
+ {
+ Abc_Print( -1, "Abc_CommandAbc9Iwls21Test(): Expecting an AIG with 10 outputs.\n" );
+ return 0;
+ }
+ if ( nArgcNew != 1 )
+ {
+ Abc_Print( -1, "Abc_CommandAbc9Iwls21Test(): Expecting data file name on the command line.\n" );
+ return 0;
+ }
+ if ( Gia_ManRegNum(pAbc->pGia) > 0 )
+ {
+ Abc_Print( -1, "Abc_CommandAbc9Iwls21Test(): This command works only for combinational AIGs.\n" );
+ return 0;
+ }
+ Vec_WrdFreeP( &pAbc->pGia->vSimsPi );
+ Gia_ManTestWordFile( pAbc->pGia, pArgvNew[0], pDumpFile, fVerbose );
+ return 0;
+
+usage:
+ Abc_Print( -2, "usage: &iwls21test [-vh] [-D file] <file1> <file2>\n" );
+ Abc_Print( -2, "\t this command evaluates AIG for 2021 IWLS ML+LS Contest\n" );
+ Abc_Print( -2, "\t-v : toggle printing verbose information [default = %s]\n", fVerbose? "yes": "no" );
+ Abc_Print( -2, "\t-h : print the command usage\n");
+ Abc_Print( -2, "\t-D file : file name to dump statistics [default = none]\n" );
+ Abc_Print( -2, "\tfile1 : file with input AIG (or \"&read <file1.aig>; &iwls21test <file2>\" can be used)\n");
+ Abc_Print( -2, "\tfile2 : file with CIFAR10 image data (https://www.cs.toronto.edu/~kriz/cifar.html)\n");
+ return 1;
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
int Abc_CommandAbc9ReadSim( Abc_Frame_t * pAbc, int argc, char ** argv )
{
- extern Vec_Wrd_t * Gia_ManSimPatRead( char * pFileName );
int c, fOutputs = 0, nWords = 4, fVerbose = 0;
char ** pArgvNew;
int nArgcNew;
@@ -32891,7 +33446,7 @@ int Abc_CommandAbc9ReadSim( Abc_Frame_t * pAbc, int argc, char ** argv )
if ( fOutputs )
{
Vec_WrdFreeP( &pAbc->pGia->vSimsPo );
- pAbc->pGia->vSimsPo = Gia_ManSimPatRead( pArgvNew[0] );
+ pAbc->pGia->vSimsPo = Vec_WrdReadHex( pArgvNew[0], NULL, 1 );
if ( Vec_WrdSize(pAbc->pGia->vSimsPo) % Gia_ManCoNum(pAbc->pGia) != 0 )
{
Vec_WrdFreeP( &pAbc->pGia->vSimsPo );
@@ -32905,7 +33460,7 @@ int Abc_CommandAbc9ReadSim( Abc_Frame_t * pAbc, int argc, char ** argv )
else
{
Vec_WrdFreeP( &pAbc->pGia->vSimsPi );
- pAbc->pGia->vSimsPi = Gia_ManSimPatRead( pArgvNew[0] );
+ pAbc->pGia->vSimsPi = Vec_WrdReadHex( pArgvNew[0], NULL, 1 );
if ( Vec_WrdSize(pAbc->pGia->vSimsPi) % Gia_ManCiNum(pAbc->pGia) != 0 )
{
Vec_WrdFreeP( &pAbc->pGia->vSimsPi );
@@ -32942,7 +33497,6 @@ usage:
***********************************************************************/
int Abc_CommandAbc9WriteSim( Abc_Frame_t * pAbc, int argc, char ** argv )
{
- extern void Gia_ManSimPatWrite( char * pFileName, Vec_Wrd_t * vSimsIn, int nWords );
int c, fOutputs = 0, fVerbose = 0;
char ** pArgvNew;
int nArgcNew;
@@ -32988,12 +33542,12 @@ int Abc_CommandAbc9WriteSim( Abc_Frame_t * pAbc, int argc, char ** argv )
if ( fOutputs )
{
assert( Vec_WrdSize(pAbc->pGia->vSimsPo) % Gia_ManCoNum(pAbc->pGia) == 0 );
- Gia_ManSimPatWrite( pArgvNew[0], pAbc->pGia->vSimsPo, Vec_WrdSize(pAbc->pGia->vSimsPo) / Gia_ManCoNum(pAbc->pGia) );
+ Vec_WrdDumpHex( pArgvNew[0], pAbc->pGia->vSimsPo, Vec_WrdSize(pAbc->pGia->vSimsPo) / Gia_ManCoNum(pAbc->pGia), 1 );
}
else
{
assert( Vec_WrdSize(pAbc->pGia->vSimsPi) % Gia_ManCiNum(pAbc->pGia) == 0 );
- Gia_ManSimPatWrite( pArgvNew[0], pAbc->pGia->vSimsPi, Vec_WrdSize(pAbc->pGia->vSimsPi) / Gia_ManCiNum(pAbc->pGia) );
+ Vec_WrdDumpHex( pArgvNew[0], pAbc->pGia->vSimsPi, Vec_WrdSize(pAbc->pGia->vSimsPi) / Gia_ManCiNum(pAbc->pGia), 1 );
}
return 0;
@@ -34593,6 +35147,72 @@ usage:
SeeAlso []
***********************************************************************/
+int Abc_CommandAbc9Extract( Abc_Frame_t * pAbc, int argc, char ** argv )
+{
+ extern Gia_Man_t * Abc_NtkShareXorGia( Gia_Man_t * p, int nMultiSize, int fAnd, int fVerbose );
+ Gia_Man_t * pTemp;
+ int nMultiSize = 3;
+ int c, fAnds = 0;
+ int fVerbose = 0;
+ Extra_UtilGetoptReset();
+ while ( (c = Extra_UtilGetopt(argc, argv, "Kavh")) != EOF )
+ {
+ switch (c)
+ {
+ case 'K':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-K\" should be followed by an integer.\n" );
+ goto usage;
+ }
+ nMultiSize = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ if ( nMultiSize < 0 )
+ goto usage;
+ break;
+ case 'a':
+ fAnds ^= 1;
+ break;
+ case 'v':
+ fVerbose ^= 1;
+ break;
+ case 'h':
+ goto usage;
+ break;
+ default:
+ goto usage;
+ }
+ }
+ if ( pAbc->pGia == NULL )
+ {
+ Abc_Print( -1, "Abc_CommandAbc9Shrink(): There is no AIG.\n" );
+ return 1;
+ }
+ pTemp = Abc_NtkShareXorGia( pAbc->pGia, nMultiSize, fAnds, fVerbose );
+ Abc_FrameUpdateGia( pAbc, pTemp );
+ return 0;
+
+usage:
+ Abc_Print( -2, "usage: &extract [-K <num>] [-vh]\n");
+ Abc_Print( -2, "\t extract shared logic for XOR-rich circuits\n");
+ Abc_Print( -2, "\t-K <num> : the minimum gate size to consider for extraction [default = %d]\n", nMultiSize );
+ Abc_Print( -2, "\t-a : toogle extracting ANDs instead of XORs [default = %s]\n", fAnds? "yes": "no" );
+ Abc_Print( -2, "\t-v : print verbose information [default = %s]\n", fVerbose? "yes": "no" );
+ Abc_Print( -2, "\t-h : print the command usage\n");
+ return 1;
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
int Abc_CommandAbc9Balance( Abc_Frame_t * pAbc, int argc, char ** argv )
{
Gia_Man_t * pTemp = NULL;
@@ -34780,6 +35400,170 @@ usage:
SeeAlso []
***********************************************************************/
+int Abc_CommandAbc9Resub( Abc_Frame_t * pAbc, int argc, char ** argv )
+{
+ extern Gia_Man_t * Gia_ManResub1( char * pFileName, int nNodes, int nSupp, int nDivs, int iChoice, int fUseXor, int fVerbose, int fVeryVerbose );
+ extern Gia_Man_t * Gia_ManResub2( Gia_Man_t * pGia, int nNodes, int nSupp, int nDivs, int iChoice, int fUseXor, int fVerbose, int fVeryVerbose );
+ Gia_Man_t * pTemp;
+ int nNodes = 0;
+ int nSupp = 0;
+ int nDivs = 0;
+ int c, fVerbose = 0;
+ int fVeryVerbose = 0;
+ Extra_UtilGetoptReset();
+ while ( ( c = Extra_UtilGetopt( argc, argv, "NSDvwh" ) ) != EOF )
+ {
+ switch ( c )
+ {
+ case 'N':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( 1, "Command line switch \"-N\" should be followed by a floating point number.\n" );
+ return 0;
+ }
+ nNodes = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ if ( nNodes < 0 )
+ goto usage;
+ break;
+ case 'S':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( 1, "Command line switch \"-S\" should be followed by a floating point number.\n" );
+ return 0;
+ }
+ nSupp = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ if ( nSupp < 0 )
+ goto usage;
+ break;
+ case 'D':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( 1, "Command line switch \"-D\" should be followed by a floating point number.\n" );
+ return 0;
+ }
+ nDivs = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ if ( nDivs < 0 )
+ goto usage;
+ break;
+ case 'v':
+ fVerbose ^= 1;
+ break;
+ case 'w':
+ fVeryVerbose ^= 1;
+ break;
+ case 'h':
+ goto usage;
+ default:
+ goto usage;
+ }
+ }
+ if ( argc == globalUtilOptind + 1 )
+ {
+ pTemp = Gia_ManResub1( argv[globalUtilOptind], nNodes, nSupp, nDivs, 0, 0, fVerbose, fVeryVerbose );
+ Abc_FrameUpdateGia( pAbc, pTemp );
+ return 0;
+ }
+ if ( pAbc->pGia == NULL )
+ {
+ Abc_Print( -1, "Abc_CommandAbc9Resub(): There is no AIG.\n" );
+ return 1;
+ }
+ pTemp = Gia_ManResub2( pAbc->pGia, nNodes, nSupp, nDivs, 0, 0, fVerbose, fVeryVerbose );
+ Abc_FrameUpdateGia( pAbc, pTemp );
+ return 0;
+
+usage:
+ Abc_Print( -2, "usage: &resub [-NSD num] [-vwh]\n" );
+ Abc_Print( -2, "\t performs AIG resubstitution\n" );
+ Abc_Print( -2, "\t-N num : the limit on added nodes (num >= 0) [default = %d]\n", nNodes );
+ Abc_Print( -2, "\t-S num : the limit on support size (num > 0) [default = %d]\n", nSupp );
+ Abc_Print( -2, "\t-D num : the limit on divisor count (num > 0) [default = %d]\n", nDivs );
+ Abc_Print( -2, "\t-v : toggles printing verbose information [default = %s]\n", fVerbose? "yes": "no" );
+ Abc_Print( -2, "\t-w : toggles printing additional information [default = %s]\n", fVeryVerbose? "yes": "no" );
+ Abc_Print( -2, "\t-h : print the command usage\n");
+ return 1;
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+int Abc_CommandAbc9Reshape( Abc_Frame_t * pAbc, int argc, char ** argv )
+{
+ extern Gia_Man_t * Gia_ManReshape1( Gia_Man_t * pGia, int fUseSimple, int fVerbose, int fVeryVerbose );
+ extern Gia_Man_t * Gia_ManReshape2( Gia_Man_t * pGia, int fUseSimple, int fVerbose, int fVeryVerbose );
+ Gia_Man_t * pTemp;
+ int fUseReshape1 = 0;
+ int fUseSimple = 0;
+ int c, fVerbose = 0;
+ int fVeryVerbose = 0;
+ Extra_UtilGetoptReset();
+ while ( ( c = Extra_UtilGetopt( argc, argv, "asvwh" ) ) != EOF )
+ {
+ switch ( c )
+ {
+ case 'a':
+ fUseReshape1 ^= 1;
+ break;
+ case 's':
+ fUseSimple ^= 1;
+ break;
+ case 'v':
+ fVerbose ^= 1;
+ break;
+ case 'w':
+ fVeryVerbose ^= 1;
+ break;
+ case 'h':
+ goto usage;
+ default:
+ goto usage;
+ }
+ }
+ if ( pAbc->pGia == NULL )
+ {
+ Abc_Print( -1, "Abc_CommandAbc9Resub(): There is no AIG.\n" );
+ return 1;
+ }
+ if ( fUseReshape1 )
+ pTemp = Gia_ManReshape1( pAbc->pGia, fUseSimple, fVerbose, fVeryVerbose );
+ else
+ pTemp = Gia_ManReshape2( pAbc->pGia, fUseSimple, fVerbose, fVeryVerbose );
+ Abc_FrameUpdateGia( pAbc, pTemp );
+ return 0;
+
+usage:
+ Abc_Print( -2, "usage: &reshape [-asvwh]\n" );
+ Abc_Print( -2, "\t performs AIG resubstitution\n" );
+ Abc_Print( -2, "\t-a : toggles selecting the algorithm [default = %s]\n", fUseReshape1? "yes": "no" );
+ Abc_Print( -2, "\t-s : toggles using simple method [default = %s]\n", fUseSimple? "yes": "no" );
+ Abc_Print( -2, "\t-v : toggles printing verbose information [default = %s]\n", fVerbose? "yes": "no" );
+ Abc_Print( -2, "\t-w : toggles printing additional information [default = %s]\n", fVeryVerbose? "yes": "no" );
+ Abc_Print( -2, "\t-h : print the command usage\n");
+ return 1;
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
int Abc_CommandAbc9Syn2( Abc_Frame_t * pAbc, int argc, char ** argv )
{
Gia_Man_t * pTemp;
@@ -35175,6 +35959,7 @@ usage:
***********************************************************************/
int Abc_CommandAbc9Miter( Abc_Frame_t * pAbc, int argc, char ** argv )
{
+ extern Gia_Man_t * Gia_ManPairWiseMiter( Gia_Man_t * p );
FILE * pFile;
Gia_Man_t * pAux;
Gia_Man_t * pSecond;
@@ -35185,13 +35970,14 @@ int Abc_CommandAbc9Miter( Abc_Frame_t * pAbc, int argc, char ** argv )
int nInsDup = 0;
int fDualOut = 0;
int fSeq = 0;
+ int fPairWise= 0;
int fTrans = 0;
int fTransX = 0;
int fConvert = 0;
int fTransZ = 0;
int fVerbose = 0;
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "Idstxyzvh" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "Idsptxyzvh" ) ) != EOF )
{
switch ( c )
{
@@ -35212,6 +35998,9 @@ int Abc_CommandAbc9Miter( Abc_Frame_t * pAbc, int argc, char ** argv )
case 's':
fSeq ^= 1;
break;
+ case 'p':
+ fPairWise ^= 1;
+ break;
case 't':
fTrans ^= 1;
break;
@@ -35233,6 +36022,17 @@ int Abc_CommandAbc9Miter( Abc_Frame_t * pAbc, int argc, char ** argv )
goto usage;
}
}
+ if ( fPairWise )
+ {
+ if ( pAbc->pGia == NULL )
+ {
+ Abc_Print( -1, "Abc_CommandAbc9Miter(): There is no AIG.\n" );
+ return 1;
+ }
+ pAux = Gia_ManPairWiseMiter( pAbc->pGia );
+ Abc_FrameUpdateGia( pAbc, pAux );
+ return 0;
+ }
if ( fTrans || fTransX || fTransZ || fConvert )
{
if ( pAbc->pGia == NULL )
@@ -35306,11 +36106,12 @@ int Abc_CommandAbc9Miter( Abc_Frame_t * pAbc, int argc, char ** argv )
return 0;
usage:
- Abc_Print( -2, "usage: &miter [-I num] [-dstxyzvh] <file>\n" );
+ Abc_Print( -2, "usage: &miter [-I num] [-dsptxyzvh] <file>\n" );
Abc_Print( -2, "\t creates miter of two designs (current AIG vs. <file>)\n" );
Abc_Print( -2, "\t-I num : the number of last PIs to replicate [default = %d]\n", nInsDup );
Abc_Print( -2, "\t-d : toggle creating dual-output miter [default = %s]\n", fDualOut? "yes": "no" );
Abc_Print( -2, "\t-s : toggle creating sequential miter [default = %s]\n", fSeq? "yes": "no" );
+ Abc_Print( -2, "\t-p : toggle creating pair-wise miter [default = %s]\n", fPairWise? "yes": "no" );
Abc_Print( -2, "\t-t : toggle XORing POs of dual-output miter [default = %s]\n", fTrans? "yes": "no" );
Abc_Print( -2, "\t-x : toggle XORing POs of two-word miter [default = %s]\n", fTransX? "yes": "no" );
Abc_Print( -2, "\t-y : toggle convering two-word miter into dual-output miter [default = %s]\n", fConvert? "yes": "no" );
@@ -35872,16 +36673,28 @@ usage:
int Abc_CommandAbc9Sat( Abc_Frame_t * pAbc, int argc, char ** argv )
{
extern Vec_Int_t * Cbs2_ManSolveMiterNc( Gia_Man_t * pAig, int nConfs, Vec_Str_t ** pvStatus, int fVerbose );
+ extern Vec_Int_t * Cbs3_ManSolveMiterNc( Gia_Man_t * pAig, int nConfs, int nRestarts, Vec_Str_t ** pvStatus, int fVerbose );
Cec_ParSat_t ParsSat, * pPars = &ParsSat;
Gia_Man_t * pTemp;
int c;
- int fNewSolver = 0, fCSat = 0;
+ int fNewSolver = 0, fNewSolver2 = 0, fCSat = 0, f0Proved = 0, nRestarts = 1;
Cec_ManSatSetDefaultParams( pPars );
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "CSNanmtcxvh" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "JCRSNanmtcxyzvh" ) ) != EOF )
{
switch ( c )
{
+ case 'J':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-J\" should be followed by an integer.\n" );
+ goto usage;
+ }
+ pPars->SolverType = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ if ( pPars->SolverType < 0 )
+ goto usage;
+ break;
case 'C':
if ( globalUtilOptind >= argc )
{
@@ -35893,6 +36706,17 @@ int Abc_CommandAbc9Sat( Abc_Frame_t * pAbc, int argc, char ** argv )
if ( pPars->nBTLimit < 0 )
goto usage;
break;
+ case 'R':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-R\" should be followed by an integer.\n" );
+ goto usage;
+ }
+ nRestarts = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ if ( nRestarts < 0 )
+ goto usage;
+ break;
case 'S':
if ( globalUtilOptind >= argc )
{
@@ -35933,6 +36757,12 @@ int Abc_CommandAbc9Sat( Abc_Frame_t * pAbc, int argc, char ** argv )
case 'x':
fNewSolver ^= 1;
break;
+ case 'y':
+ fNewSolver2 ^= 1;
+ break;
+ case 'z':
+ f0Proved ^= 1;
+ break;
case 'v':
pPars->fVerbose ^= 1;
break;
@@ -35951,10 +36781,12 @@ int Abc_CommandAbc9Sat( Abc_Frame_t * pAbc, int argc, char ** argv )
Vec_Str_t * vStatus;
if ( fNewSolver )
vCounters = Cbs2_ManSolveMiterNc( pAbc->pGia, pPars->nBTLimit, &vStatus, pPars->fVerbose );
+ else if ( fNewSolver2 )
+ vCounters = Cbs3_ManSolveMiterNc( pAbc->pGia, pPars->nBTLimit, nRestarts, &vStatus, pPars->fVerbose );
else if ( pPars->fLearnCls )
vCounters = Tas_ManSolveMiterNc( pAbc->pGia, pPars->nBTLimit, &vStatus, pPars->fVerbose );
else if ( pPars->fNonChrono )
- vCounters = Cbs_ManSolveMiterNc( pAbc->pGia, pPars->nBTLimit, &vStatus, pPars->fVerbose );
+ vCounters = Cbs_ManSolveMiterNc( pAbc->pGia, pPars->nBTLimit, &vStatus, f0Proved, pPars->fVerbose );
else
vCounters = Cbs_ManSolveMiter( pAbc->pGia, pPars->nBTLimit, &vStatus, pPars->fVerbose );
Vec_IntFree( vCounters );
@@ -35962,7 +36794,7 @@ int Abc_CommandAbc9Sat( Abc_Frame_t * pAbc, int argc, char ** argv )
}
else
{
- pTemp = Cec_ManSatSolving( pAbc->pGia, pPars );
+ pTemp = Cec_ManSatSolving( pAbc->pGia, pPars, f0Proved );
Abc_FrameUpdateGia( pAbc, pTemp );
}
if ( pAbc->pGia->vSeqModelVec )
@@ -35974,9 +36806,11 @@ int Abc_CommandAbc9Sat( Abc_Frame_t * pAbc, int argc, char ** argv )
return 0;
usage:
- Abc_Print( -2, "usage: &sat [-CSN <num>] [-anmctxvh]\n" );
+ Abc_Print( -2, "usage: &sat [-JCRSN <num>] [-anmctxzvh]\n" );
Abc_Print( -2, "\t performs SAT solving for the combinational outputs\n" );
+ Abc_Print( -2, "\t-J num : the SAT solver type [default = %d]\n", pPars->SolverType );
Abc_Print( -2, "\t-C num : the max number of conflicts at a node [default = %d]\n", pPars->nBTLimit );
+ Abc_Print( -2, "\t-R num : the max number of restarts at a node [default = %d]\n", nRestarts );
Abc_Print( -2, "\t-S num : the min number of variables to recycle the solver [default = %d]\n", pPars->nSatVarMax );
Abc_Print( -2, "\t-N num : the min number of calls to recycle the solver [default = %d]\n", pPars->nCallsRecycle );
Abc_Print( -2, "\t-a : toggle solving all outputs and saving counter-examples [default = %s]\n", pPars->fSaveCexes? "yes": "no" );
@@ -35985,6 +36819,8 @@ usage:
Abc_Print( -2, "\t-c : toggle using circuit-based SAT solver [default = %s]\n", fCSat? "yes": "no" );
Abc_Print( -2, "\t-t : toggle using learning in curcuit-based solver [default = %s]\n", pPars->fLearnCls? "yes": "no" );
Abc_Print( -2, "\t-x : toggle using new solver [default = %s]\n", fNewSolver? "yes": "no" );
+ Abc_Print( -2, "\t-y : toggle using new solver [default = %s]\n", fNewSolver2? "yes": "no" );
+ Abc_Print( -2, "\t-z : toggle replacing proved cones by const0 [default = %s]\n", f0Proved? "yes": "no" );
Abc_Print( -2, "\t-v : toggle printing verbose information [default = %s]\n", pPars->fVerbose? "yes": "no" );
Abc_Print( -2, "\t-h : print the command usage\n");
return 1;
@@ -36070,18 +36906,29 @@ usage:
***********************************************************************/
int Abc_CommandAbc9Fraig( Abc_Frame_t * pAbc, int argc, char ** argv )
{
+ extern void Cec4_ManSetParams( Cec_ParFra_t * pPars );
extern Gia_Man_t * Cec2_ManSimulateTest( Gia_Man_t * p, Cec_ParFra_t * pPars );
extern Gia_Man_t * Cec3_ManSimulateTest( Gia_Man_t * p, Cec_ParFra_t * pPars );
- Cec_ParFra_t ParsFra, * pPars = &ParsFra;
- Gia_Man_t * pTemp;
- int c, fUseAlgo = 0, fUseAlgoG = 0;
- Cec_ManFraSetDefaultParams( pPars );
- pPars->fSatSweeping = 1;
+ extern Gia_Man_t * Cec4_ManSimulateTest( Gia_Man_t * p, Cec_ParFra_t * pPars );
+ Cec_ParFra_t ParsFra, * pPars = &ParsFra; Gia_Man_t * pTemp;
+ int c, fUseAlgo = 0, fUseAlgoG = 0, fUseAlgoG2 = 0;
+ Cec4_ManSetParams( pPars );
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "WRILDCrmdckngwvh" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "JWRILDCNPrmdckngxwvh" ) ) != EOF )
{
switch ( c )
{
+ case 'J':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-J\" should be followed by an integer.\n" );
+ goto usage;
+ }
+ pPars->jType = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ if ( pPars->jType < 0 )
+ goto usage;
+ break;
case 'W':
if ( globalUtilOptind >= argc )
{
@@ -36148,6 +36995,28 @@ int Abc_CommandAbc9Fraig( Abc_Frame_t * pAbc, int argc, char ** argv )
if ( pPars->nBTLimit < 0 )
goto usage;
break;
+ case 'N':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-N\" should be followed by an integer.\n" );
+ goto usage;
+ }
+ pPars->nCallsRecycle = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ if ( pPars->nCallsRecycle < 0 )
+ goto usage;
+ break;
+ case 'P':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-P\" should be followed by an integer.\n" );
+ goto usage;
+ }
+ pPars->nGenIters = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ if ( pPars->nGenIters < 0 )
+ goto usage;
+ break;
case 'r':
pPars->fRewriting ^= 1;
break;
@@ -36169,6 +37038,9 @@ int Abc_CommandAbc9Fraig( Abc_Frame_t * pAbc, int argc, char ** argv )
case 'g':
fUseAlgoG ^= 1;
break;
+ case 'x':
+ fUseAlgoG2 ^= 1;
+ break;
case 'w':
pPars->fVeryVerbose ^= 1;
break;
@@ -36188,20 +37060,25 @@ int Abc_CommandAbc9Fraig( Abc_Frame_t * pAbc, int argc, char ** argv )
pTemp = Cec2_ManSimulateTest( pAbc->pGia, pPars );
else if ( fUseAlgoG )
pTemp = Cec3_ManSimulateTest( pAbc->pGia, pPars );
+ else if ( fUseAlgoG2 )
+ pTemp = Cec4_ManSimulateTest( pAbc->pGia, pPars );
else
pTemp = Cec_ManSatSweeping( pAbc->pGia, pPars, 0 );
Abc_FrameUpdateGia( pAbc, pTemp );
return 0;
usage:
- Abc_Print( -2, "usage: &fraig [-WRILDC <num>] [-rmdckngwvh]\n" );
+ Abc_Print( -2, "usage: &fraig [-JWRILDCNP <num>] [-rmdckngwvh]\n" );
Abc_Print( -2, "\t performs combinational SAT sweeping\n" );
+ Abc_Print( -2, "\t-J num : the solver type [default = %d]\n", pPars->jType );
Abc_Print( -2, "\t-W num : the number of simulation words [default = %d]\n", pPars->nWords );
Abc_Print( -2, "\t-R num : the number of simulation rounds [default = %d]\n", pPars->nRounds );
Abc_Print( -2, "\t-I num : the number of sweeping iterations [default = %d]\n", pPars->nItersMax );
Abc_Print( -2, "\t-L num : the max number of levels of nodes to consider [default = %d]\n", pPars->nLevelMax );
Abc_Print( -2, "\t-D num : the max number of steps of speculative reduction [default = %d]\n", pPars->nDepthMax );
Abc_Print( -2, "\t-C num : the max number of conflicts at a node [default = %d]\n", pPars->nBTLimit );
+ Abc_Print( -2, "\t-N num : the min number of calls to recycle the solver [default = %d]\n", pPars->nCallsRecycle );
+ Abc_Print( -2, "\t-P num : the number of pattern generation iterations [default = %d]\n", pPars->nGenIters );
Abc_Print( -2, "\t-r : toggle the use of AIG rewriting [default = %s]\n", pPars->fRewriting? "yes": "no" );
Abc_Print( -2, "\t-m : toggle miter vs. any circuit [default = %s]\n", pPars->fCheckMiter? "miter": "circuit" );
Abc_Print( -2, "\t-d : toggle using double output miters [default = %s]\n", pPars->fDualOut? "yes": "no" );
@@ -36316,8 +37193,9 @@ int Abc_CommandAbc9Srm( Abc_Frame_t * pAbc, int argc, char ** argv )
int fSpeculate = 1;
int fSkipSome = 0;
int fDualOut = 0;
+ int fComb = 0;
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "Adrsfvh" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "Adrsfcvh" ) ) != EOF )
{
switch ( c )
{
@@ -36342,6 +37220,9 @@ int Abc_CommandAbc9Srm( Abc_Frame_t * pAbc, int argc, char ** argv )
case 'f':
fSkipSome ^= 1;
break;
+ case 'c':
+ fComb ^= 1;
+ break;
case 'v':
fVerbose ^= 1;
break;
@@ -36356,6 +37237,16 @@ int Abc_CommandAbc9Srm( Abc_Frame_t * pAbc, int argc, char ** argv )
Abc_Print( -1, "Abc_CommandAbc9Srm(): There is no AIG.\n" );
return 1;
}
+ if ( fComb )
+ {
+ extern int Cec4_ManSimulateOnlyTest( Gia_Man_t * p, int fVerbose );
+ int Result = Cec4_ManSimulateOnlyTest( pAbc->pGia, fVerbose );
+ extern Gia_Man_t * Gia_ManCombSpecReduce( Gia_Man_t * p );
+ pTemp = Gia_ManCombSpecReduce( pAbc->pGia );
+ Abc_FrameUpdateGia( pAbc, pTemp );
+ Result = 0;
+ return 0;
+ }
sprintf(pFileName, "gsrm%s.aig", fSpeculate? "" : "s" );
sprintf(pFileName2, "gsyn%s.aig", fSpeculate? "" : "s" );
pTemp = Gia_ManSpecReduce( pAbc->pGia, fDualOut, fSynthesis, fSpeculate, fSkipSome, fVerbose );
@@ -36388,13 +37279,14 @@ int Abc_CommandAbc9Srm( Abc_Frame_t * pAbc, int argc, char ** argv )
return 0;
usage:
- Abc_Print( -2, "usage: &srm [-A file] [-drsfvh]\n" );
- Abc_Print( -2, "\t writes speculatively reduced model into file \"%s\"\n", pFileName );
+ Abc_Print( -2, "usage: &srm [-A file] [-drsfcvh]\n" );
+ Abc_Print( -2, "\t derives or writes speculatively reduced model into file \"%s\"\n", pFileName );
Abc_Print( -2, "\t-A file : file name for dumping speculative-reduced model [default = \"gsrm.aig\"]\n" );
Abc_Print( -2, "\t-d : toggle creating dual-output miter [default = %s]\n", fDualOut? "yes": "no" );
Abc_Print( -2, "\t-r : toggle writing reduced network for synthesis [default = %s]\n", fSynthesis? "yes": "no" );
Abc_Print( -2, "\t-s : toggle using speculation at the internal nodes [default = %s]\n", fSpeculate? "yes": "no" );
Abc_Print( -2, "\t-f : toggle filtering to remove redundant equivalences [default = %s]\n", fSkipSome? "yes": "no" );
+ Abc_Print( -2, "\t-c : toggle using combinational speculation [default = %s]\n", fComb? "yes": "no" );
Abc_Print( -2, "\t-v : toggle printing verbose information [default = %s]\n", fVerbose? "yes": "no" );
Abc_Print( -2, "\t-h : print the command usage\n");
return 1;
@@ -36771,10 +37663,10 @@ int Abc_CommandAbc9Cec( Abc_Frame_t * pAbc, int argc, char ** argv )
FILE * pFile;
Gia_Man_t * pGias[2] = {NULL, NULL}, * pMiter;
char ** pArgvNew;
- int c, nArgcNew, fMiter = 0, fDualOutput = 0, fDumpMiter = 0;
+ int c, nArgcNew, fUseSim = 0, fUseNew = 0, fMiter = 0, fDualOutput = 0, fDumpMiter = 0;
Cec_ManCecSetDefaultParams( pPars );
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "CTnmdasvh" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "CTnmdasxtvwh" ) ) != EOF )
{
switch ( c )
{
@@ -36815,9 +37707,18 @@ int Abc_CommandAbc9Cec( Abc_Frame_t * pAbc, int argc, char ** argv )
case 's':
pPars->fSilent ^= 1;
break;
+ case 'x':
+ fUseNew ^= 1;
+ break;
+ case 't':
+ fUseSim ^= 1;
+ break;
case 'v':
pPars->fVerbose ^= 1;
break;
+ case 'w':
+ pPars->fVeryVerbose ^= 1;
+ break;
case 'h':
goto usage;
default:
@@ -36846,13 +37747,46 @@ int Abc_CommandAbc9Cec( Abc_Frame_t * pAbc, int argc, char ** argv )
}
else
{
- Gia_Man_t * pTemp;
+ abctime clk = Abc_Clock();
+ Gia_Obj_t * pObj; int i;
if ( !pPars->fSilent )
Abc_Print( 1, "Assuming the current network is a single-output miter.\n" );
- pTemp = Gia_ManDemiterToDual( pAbc->pGia );
- pAbc->Status = Cec_ManVerify( pTemp, pPars );
- ABC_SWAP( Abc_Cex_t *, pAbc->pGia->pCexComb, pTemp->pCexComb );
- Gia_ManStop( pTemp );
+ if ( fUseSim )
+ {
+ abctime clk = Abc_Clock();
+ extern int Gia_ManCheckSimEquiv( Gia_Man_t * p, int fVerbose );
+ int Status = Gia_ManCheckSimEquiv( pAbc->pGia, pPars->fVerbose );
+ if ( Status == 1 )
+ Abc_Print( 1, "Networks are equivalent. " );
+ else if ( Status == 0 )
+ Abc_Print( 1, "Networks are NOT equivalent. " );
+ else
+ Abc_Print( 1, "Networks are UNDECIDED. " );
+ Abc_PrintTime( 1, "Time", Abc_Clock() - clk );
+ return 0;
+ }
+ // handle the case when the output is disproved by an all-0 primary input pattern
+ ABC_FREE( pAbc->pGia->pCexComb );
+ Gia_ManSetPhase( pAbc->pGia );
+ Gia_ManForEachCo( pAbc->pGia, pObj, i )
+ if ( pObj->fPhase )
+ {
+ pAbc->pGia->pCexComb = Abc_CexAlloc( 0, Gia_ManCiNum(pAbc->pGia), 1 );
+ if ( !pPars->fSilent )
+ {
+ Abc_Print( 1, "Networks are NOT EQUIVALENT. Output %d trivially differs (different phase). ", i );
+ Abc_PrintTime( 1, "Time", Abc_Clock() - clk );
+ }
+ pAbc->Status = 0;// satisfiable
+ break;
+ }
+ if ( pAbc->pGia->pCexComb == NULL )
+ {
+ Gia_Man_t * pTemp = Gia_ManDemiterToDual( pAbc->pGia );
+ pAbc->Status = Cec_ManVerify( pTemp, pPars );
+ ABC_SWAP( Abc_Cex_t *, pAbc->pGia->pCexComb, pTemp->pCexComb );
+ Gia_ManStop( pTemp );
+ }
}
Abc_FrameReplaceCex( pAbc, &pAbc->pGia->pCexComb );
return 0;
@@ -36931,7 +37865,7 @@ int Abc_CommandAbc9Cec( Abc_Frame_t * pAbc, int argc, char ** argv )
}
}
// compute the miter
- pMiter = Gia_ManMiter( pGias[0], pGias[1], 0, 1, 0, 0, pPars->fVerbose );
+ pMiter = Gia_ManMiter( pGias[0], pGias[1], 0, !fUseNew, 0, 0, pPars->fVerbose );
if ( pMiter )
{
if ( fDumpMiter )
@@ -36939,8 +37873,46 @@ int Abc_CommandAbc9Cec( Abc_Frame_t * pAbc, int argc, char ** argv )
Abc_Print( 0, "The verification miter is written into file \"%s\".\n", "cec_miter.aig" );
Gia_AigerWrite( pMiter, "cec_miter.aig", 0, 0, 0 );
}
- pAbc->Status = Cec_ManVerify( pMiter, pPars );
- Abc_FrameReplaceCex( pAbc, &pGias[0]->pCexComb );
+ if ( pGias[0]->vSimsPi )
+ {
+ pMiter->vSimsPi = Vec_WrdDup(pGias[0]->vSimsPi);
+ pMiter->nSimWords = pGias[0]->nSimWords;
+ }
+ if ( fUseSim && Gia_ManCiNum(pMiter) > 40 )
+ {
+ Abc_Print( -1, "This type of CEC can only be applied to AIGs with no more than 40 inputs.\n" );
+ return 0;
+ }
+ if ( fUseSim )
+ {
+ abctime clk = Abc_Clock();
+ extern int Gia_ManCheckSimEquiv( Gia_Man_t * p, int fVerbose );
+ int Status = Gia_ManCheckSimEquiv( pMiter, pPars->fVerbose );
+ if ( Status == 1 )
+ Abc_Print( 1, "Networks are equivalent. " );
+ else if ( Status == 0 )
+ Abc_Print( 1, "Networks are NOT equivalent. " );
+ else
+ Abc_Print( 1, "Networks are UNDECIDED. " );
+ Abc_PrintTime( 1, "Time", Abc_Clock() - clk );
+ }
+ else if ( fUseNew )
+ {
+ abctime clk = Abc_Clock();
+ extern Gia_Man_t * Cec4_ManSimulateTest3( Gia_Man_t * p, int nBTLimit, int fVerbose );
+ Gia_Man_t * pNew = Cec4_ManSimulateTest3( pMiter, pPars->nBTLimit, pPars->fVerbose );
+ if ( Gia_ManAndNum(pNew) == 0 )
+ Abc_Print( 1, "Networks are equivalent. " );
+ else
+ Abc_Print( 1, "Networks are UNDECIDED. " );
+ Abc_PrintTime( 1, "Time", Abc_Clock() - clk );
+ Gia_ManStop( pNew );
+ }
+ else
+ {
+ pAbc->Status = Cec_ManVerify( pMiter, pPars );
+ Abc_FrameReplaceCex( pAbc, &pGias[0]->pCexComb );
+ }
Gia_ManStop( pMiter );
}
if ( pGias[0] != pAbc->pGia )
@@ -36949,7 +37921,7 @@ int Abc_CommandAbc9Cec( Abc_Frame_t * pAbc, int argc, char ** argv )
return 0;
usage:
- Abc_Print( -2, "usage: &cec [-CT num] [-nmdasvh]\n" );
+ Abc_Print( -2, "usage: &cec [-CT num] [-nmdasxtvwh]\n" );
Abc_Print( -2, "\t new combinational equivalence checker\n" );
Abc_Print( -2, "\t-C num : the max number of conflicts at a node [default = %d]\n", pPars->nBTLimit );
Abc_Print( -2, "\t-T num : approximate runtime limit in seconds [default = %d]\n", pPars->TimeLimit );
@@ -36958,7 +37930,10 @@ usage:
Abc_Print( -2, "\t-d : toggle using dual output miter [default = %s]\n", fDualOutput? "yes":"no");
Abc_Print( -2, "\t-a : toggle writing dual-output miter [default = %s]\n", fDumpMiter? "yes":"no");
Abc_Print( -2, "\t-s : toggle silent operation [default = %s]\n", pPars->fSilent ? "yes":"no");
+ Abc_Print( -2, "\t-x : toggle using new solver [default = %s]\n", fUseNew? "yes":"no");
+ Abc_Print( -2, "\t-t : toggle using simulation [default = %s]\n", fUseSim? "yes":"no");
Abc_Print( -2, "\t-v : toggle verbose output [default = %s]\n", pPars->fVerbose? "yes":"no");
+ Abc_Print( -2, "\t-w : toggle printing SAT solver statistics [default = %s]\n", pPars->fVeryVerbose? "yes":"no");
Abc_Print( -2, "\t-h : print the command usage\n");
return 1;
}
@@ -39302,7 +40277,7 @@ int Abc_CommandAbc9Mf( Abc_Frame_t * pAbc, int argc, char ** argv )
Gia_Man_t * pNew; int c;
Mf_ManSetDefaultPars( pPars );
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "KCFARLEDWaekmcgvwh" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "KCFARLEDWaekmclgvwh" ) ) != EOF )
{
switch ( c )
{
@@ -39426,6 +40401,9 @@ int Abc_CommandAbc9Mf( Abc_Frame_t * pAbc, int argc, char ** argv )
case 'c':
pPars->fGenCnf ^= 1;
break;
+ case 'l':
+ pPars->fGenLit ^= 1;
+ break;
case 'g':
pPars->fPureAig ^= 1;
break;
@@ -39478,6 +40456,7 @@ usage:
Abc_Print( -2, "\t-k : toggles coarsening the subject graph [default = %s]\n", pPars->fCoarsen? "yes": "no" );
Abc_Print( -2, "\t-m : toggles cut minimization [default = %s]\n", pPars->fCutMin? "yes": "no" );
Abc_Print( -2, "\t-c : toggles mapping for CNF generation [default = %s]\n", pPars->fGenCnf? "yes": "no" );
+ Abc_Print( -2, "\t-l : toggles mapping for literals [default = %s]\n", pPars->fGenLit? "yes": "no" );
Abc_Print( -2, "\t-g : toggles generating AIG without mapping [default = %s]\n", pPars->fPureAig? "yes": "no" );
Abc_Print( -2, "\t-v : toggles verbose output [default = %s]\n", pPars->fVerbose? "yes": "no" );
Abc_Print( -2, "\t-w : toggles very verbose output [default = %s]\n", pPars->fVeryVerbose? "yes": "no" );
@@ -40314,6 +41293,365 @@ usage:
SeeAlso []
***********************************************************************/
+int Abc_CommandAbc9LNetRead( Abc_Frame_t * pAbc, int argc, char ** argv )
+{
+ extern Gia_Man_t * Vec_WrdReadTest( char * pFileName );
+ extern void Gia_ManReadSimInfoInputs( char * pFileName, char * pFileOut1, int fVerbose );
+ int c, fVerbose = 0;
+ Extra_UtilGetoptReset();
+ while ( ( c = Extra_UtilGetopt( argc, argv, "vh" ) ) != EOF )
+ {
+ switch ( c )
+ {
+ case 'v':
+ fVerbose ^= 1;
+ break;
+ case 'h':
+ default:
+ goto usage;
+ }
+ }
+ if ( argc == globalUtilOptind + 2 ) // read 1 file, write 1 file
+ {
+ Gia_ManReadSimInfoInputs( argv[globalUtilOptind], argv[globalUtilOptind+1], fVerbose );
+ return 0;
+ }
+ if ( strstr(argv[globalUtilOptind], ".v") )
+ {
+ Gia_Man_t * pNew = Vec_WrdReadTest( argv[globalUtilOptind] );
+ if ( pNew == NULL )
+ {
+ printf( "Cannot read network from file \"%s\".\n", argv[globalUtilOptind] );
+ return 0;
+ }
+ Abc_FrameUpdateGia( pAbc, pNew );
+ }
+ return 0;
+
+usage:
+ Abc_Print( -2, "usage: &lnetread [-vh] <file> <file2>\n" );
+ Abc_Print( -2, "\t reads and converts the network or the simulation data\n" );
+ Abc_Print( -2, "\t-v : toggles verbose output [default = %s]\n", fVerbose? "yes": "no" );
+ Abc_Print( -2, "\t-h : prints the command usage\n");
+ Abc_Print( -2, "\t<file> : input file name with simulation information\n");
+ Abc_Print( -2, "\t<file2> : output file name with simulation information\n");
+ return 1;
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+int Abc_CommandAbc9LNetSim( Abc_Frame_t * pAbc, int argc, char ** argv )
+{
+ extern void Gia_ManSimInfoPassTest( Gia_Man_t * p, char * pFileName, char * pFileName2, int fVerbose );
+ int c, fVerbose = 0;
+ Extra_UtilGetoptReset();
+ while ( ( c = Extra_UtilGetopt( argc, argv, "vh" ) ) != EOF )
+ {
+ switch ( c )
+ {
+ case 'v':
+ fVerbose ^= 1;
+ break;
+ case 'h':
+ default:
+ goto usage;
+ }
+ }
+ if ( pAbc->pGia == NULL )
+ {
+ Abc_Print( -1, "Empty GIA network.\n" );
+ return 1;
+ }
+ if ( argc != globalUtilOptind + 2 )
+ {
+ Abc_Print( -1, "Expecting two file names on the command line.\n" );
+ return 1;
+ }
+ Gia_ManSimInfoPassTest( pAbc->pGia, argv[globalUtilOptind], argv[globalUtilOptind+1], fVerbose );
+ return 0;
+
+usage:
+ Abc_Print( -2, "usage: &lnetsim [-vh] <file> <file2>\n" );
+ Abc_Print( -2, "\t performs specialized AIG simulation\n" );
+ Abc_Print( -2, "\t-v : toggles verbose output [default = %s]\n", fVerbose? "yes": "no" );
+ Abc_Print( -2, "\t-h : prints the command usage\n");
+ Abc_Print( -2, "\t<file> : input file name with simulation information\n");
+ Abc_Print( -2, "\t<file2> : output file name with simulation information\n");
+ return 1;
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+int Abc_CommandAbc9LNetEval( Abc_Frame_t * pAbc, int argc, char ** argv )
+{
+ extern void Gia_ManSimInfoEval( Gia_Man_t * p, char * pFileName, char * pFileName2, int nOuts, int fVerbose );
+ int c, nOuts = -1, fVerbose = 0;
+ Extra_UtilGetoptReset();
+ while ( ( c = Extra_UtilGetopt( argc, argv, "Ovh" ) ) != EOF )
+ {
+ switch ( c )
+ {
+ case 'O':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-O\" should be followed by a positive integer.\n" );
+ goto usage;
+ }
+ nOuts = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ break;
+ case 'v':
+ fVerbose ^= 1;
+ break;
+ case 'h':
+ default:
+ goto usage;
+ }
+ }
+ if ( pAbc->pGia == NULL )
+ {
+ Abc_Print( -1, "Empty GIA network.\n" );
+ return 1;
+ }
+ if ( argc != globalUtilOptind + 2 )
+ {
+ Abc_Print( -1, "Expecting two file names on the command line.\n" );
+ return 1;
+ }
+ Gia_ManSimInfoEval( pAbc->pGia, argv[globalUtilOptind], argv[globalUtilOptind+1], nOuts, fVerbose );
+ return 0;
+
+usage:
+ Abc_Print( -2, "usage: &lneteval [-O num] [-vh] <file> <file2>\n" );
+ Abc_Print( -2, "\t performs testing of the AIG on the simulation data\n" );
+ Abc_Print( -2, "\t-O num : the output group size [default = %d]\n", nOuts );
+ Abc_Print( -2, "\t-v : toggles verbose output [default = %s]\n", fVerbose? "yes": "no" );
+ Abc_Print( -2, "\t-h : prints the command usage\n");
+ Abc_Print( -2, "\t<file> : file name with simulation information\n");
+ Abc_Print( -2, "\t<file2> : file name with simulation information\n");
+ return 1;
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+int Abc_CommandAbc9LNetOpt( Abc_Frame_t * pAbc, int argc, char ** argv )
+{
+ extern Gia_Man_t * Gia_ManPerformLNetOpt( Gia_Man_t * p, int fTryNew, char * pFileName, int nIns, int nOuts, int Thresh, int nRounds, int fVerbose );
+ extern Gia_Man_t * Gia_ManPerformLNetOptNew( Gia_Man_t * p, char * pFileName, int nIns, int nOuts, int Thresh, int nRounds, int fVerbose );
+ Gia_Man_t * pTemp;
+ char * pFileName = NULL;
+ int c, nIns = 6, nOuts = 2, Limit = 0, nRounds = 20, fVerbose = 0;
+ Extra_UtilGetoptReset();
+ while ( ( c = Extra_UtilGetopt( argc, argv, "IORXvh" ) ) != EOF )
+ {
+ switch ( c )
+ {
+ case 'I':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-I\" should be followed by a positive integer.\n" );
+ goto usage;
+ }
+ nIns = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ break;
+ case 'O':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-O\" should be followed by a positive integer.\n" );
+ goto usage;
+ }
+ nOuts = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ break;
+ case 'R':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-R\" should be followed by a positive integer.\n" );
+ goto usage;
+ }
+ Limit = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ break;
+ case 'X':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-X\" should be followed by a positive integer.\n" );
+ goto usage;
+ }
+ nRounds = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ break;
+ case 'v':
+ fVerbose ^= 1;
+ break;
+ case 'h':
+ default:
+ goto usage;
+ }
+ }
+ if ( argc > globalUtilOptind + 1 )
+ {
+ return 0;
+ }
+ if ( pAbc->pGia == NULL )
+ {
+ Abc_Print( -1, "Empty GIA network.\n" );
+ return 1;
+ }
+ if ( argc == globalUtilOptind + 1 )
+ {
+ FILE * pFile = fopen( argv[globalUtilOptind], "rb" );
+ if ( pFile == NULL )
+ {
+ Abc_Print( -1, "Abc_CommandAbc9BCore(): Cannot open file \"%s\" for reading the simulation information.\n", argv[globalUtilOptind] );
+ return 0;
+ }
+ fclose( pFile );
+ pFileName = argv[globalUtilOptind];
+ }
+ pTemp = Gia_ManPerformLNetOptNew( pAbc->pGia, pFileName, nIns, nOuts, Limit, nRounds, fVerbose );
+ Abc_FrameUpdateGia( pAbc, pTemp );
+ return 0;
+
+usage:
+ Abc_Print( -2, "usage: &lnetopt [-IORX num] [-vh] <file>\n" );
+ Abc_Print( -2, "\t performs specialized AIG optimization\n" );
+ Abc_Print( -2, "\t-I num : the input support size [default = %d]\n", nIns );
+ Abc_Print( -2, "\t-O num : the output group size [default = %d]\n", nOuts );
+ Abc_Print( -2, "\t-R num : patterns are cares starting this value [default = %d]\n", Limit );
+ Abc_Print( -2, "\t-X num : the number of optimization rounds [default = %d]\n", nRounds );
+ Abc_Print( -2, "\t-v : toggles verbose output [default = %s]\n", fVerbose? "yes": "no" );
+ Abc_Print( -2, "\t-h : prints the command usage\n");
+ Abc_Print( -2, "\t<file> : file name with simulation information\n");
+ return 1;
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+int Abc_CommandAbc9LNetMap( Abc_Frame_t * pAbc, int argc, char ** argv )
+{
+ extern Abc_Ntk_t * Gia_ManPerformLNetMap( Gia_Man_t * p, int GroupSize, int fUseFixed, int fTryNew, int fVerbose );
+ Abc_Ntk_t * pTemp;
+ char * pFileName = NULL;
+ int c, fTryNew = 1, nIns = 6, nOuts = 2, fUseFixed = 0, fVerbose = 0;
+ Extra_UtilGetoptReset();
+ while ( ( c = Extra_UtilGetopt( argc, argv, "IOfxvh" ) ) != EOF )
+ {
+ switch ( c )
+ {
+ case 'I':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-I\" should be followed by a positive integer.\n" );
+ goto usage;
+ }
+ nIns = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ break;
+ case 'O':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-O\" should be followed by a positive integer.\n" );
+ goto usage;
+ }
+ nOuts = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ break;
+ case 'f':
+ fUseFixed ^= 1;
+ break;
+ case 'x':
+ fTryNew ^= 1;
+ break;
+ case 'v':
+ fVerbose ^= 1;
+ break;
+ case 'h':
+ default:
+ goto usage;
+ }
+ }
+ if ( pAbc->pGia == NULL )
+ {
+ Abc_Print( -1, "Empty GIA network.\n" );
+ return 1;
+ }
+ if ( argc == globalUtilOptind + 1 )
+ {
+ FILE * pFile = fopen( argv[globalUtilOptind], "rb" );
+ if ( pFile == NULL )
+ {
+ Abc_Print( -1, "Abc_CommandAbc9BCore(): Cannot open file \"%s\" for reading the simulation information.\n", argv[globalUtilOptind] );
+ return 0;
+ }
+ fclose( pFile );
+ pFileName = argv[globalUtilOptind];
+ }
+ pTemp = Gia_ManPerformLNetMap( pAbc->pGia, nOuts, fUseFixed, fTryNew, fVerbose );
+ Abc_FrameReplaceCurrentNetwork( pAbc, pTemp );
+ return 0;
+
+usage:
+ Abc_Print( -2, "usage: &lnetmap [-IO num] [-fxvh] <file>\n" );
+ Abc_Print( -2, "\t performs specialized LUT mapping\n" );
+ Abc_Print( -2, "\t-I num : the input support size [default = %d]\n", nIns );
+ Abc_Print( -2, "\t-O num : the output group size [default = %d]\n", nOuts );
+ Abc_Print( -2, "\t-f : toggles using fixed primitives [default = %s]\n", fUseFixed? "yes": "no" );
+ Abc_Print( -2, "\t-x : toggles using another computation [default = %s]\n", fTryNew? "yes": "no" );
+ Abc_Print( -2, "\t-v : toggles verbose output [default = %s]\n", fVerbose? "yes": "no" );
+ Abc_Print( -2, "\t-h : prints the command usage\n");
+ Abc_Print( -2, "\t<file> : file name with simulation information\n");
+ return 1;
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
int Abc_CommandAbc9Unmap( Abc_Frame_t * pAbc, int argc, char ** argv )
{
extern void Gia_ManTestStruct( Gia_Man_t * p );
@@ -40675,7 +42013,7 @@ int Abc_CommandAbc9Dch( Abc_Frame_t * pAbc, int argc, char ** argv )
// set defaults
Dch_ManSetDefaultParams( pPars );
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "WCSsptfremvh" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "WCSsptfremgcxvh" ) ) != EOF )
{
switch ( c )
{
@@ -40733,6 +42071,15 @@ int Abc_CommandAbc9Dch( Abc_Frame_t * pAbc, int argc, char ** argv )
case 'm':
fMinLevel ^= 1;
break;
+ case 'g':
+ pPars->fUseGia ^= 1;
+ break;
+ case 'c':
+ pPars->fUseCSat ^= 1;
+ break;
+ case 'x':
+ pPars->fUseNew ^= 1;
+ break;
case 'v':
pPars->fVerbose ^= 1;
break;
@@ -40772,7 +42119,7 @@ int Abc_CommandAbc9Dch( Abc_Frame_t * pAbc, int argc, char ** argv )
return 0;
usage:
- Abc_Print( -2, "usage: &dch [-WCS num] [-sptfremvh]\n" );
+ Abc_Print( -2, "usage: &dch [-WCS num] [-sptfremgcxvh]\n" );
Abc_Print( -2, "\t computes structural choices using a new approach\n" );
Abc_Print( -2, "\t-W num : the max number of simulation words [default = %d]\n", pPars->nWords );
Abc_Print( -2, "\t-C num : the max number of conflicts at a node [default = %d]\n", pPars->nBTLimit );
@@ -40784,6 +42131,9 @@ usage:
Abc_Print( -2, "\t-r : toggle skipping choices with redundant support [default = %s]\n", pPars->fSkipRedSupp? "yes": "no" );
Abc_Print( -2, "\t-e : toggle computing and merging equivalences [default = %s]\n", fEquiv? "yes": "no" );
Abc_Print( -2, "\t-m : toggle minimizing logic level after merging equivalences [default = %s]\n", fMinLevel? "yes": "no" );
+ Abc_Print( -2, "\t-g : toggle using GIA to prove equivalences [default = %s]\n", pPars->fUseGia? "yes": "no" );
+ Abc_Print( -2, "\t-c : toggle using circuit-based SAT vs. MiniSat [default = %s]\n", pPars->fUseCSat? "yes": "no" );
+ Abc_Print( -2, "\t-x : toggle using new choice computation [default = %s]\n", pPars->fUseNew? "yes": "no" );
Abc_Print( -2, "\t-v : toggle verbose printout [default = %s]\n", pPars->fVerbose? "yes": "no" );
Abc_Print( -2, "\t-h : print the command usage\n");
return 1;
@@ -42083,6 +43433,64 @@ usage:
SeeAlso []
***********************************************************************/
+int Abc_CommandAbc9Compare( Abc_Frame_t * pAbc, int argc, char ** argv )
+{
+ extern void Gia_Iso4TestTwo( Gia_Man_t * pGia0, Gia_Man_t * pGia1 );
+ Gia_Man_t * pGia0, * pGia1;
+ char ** pArgvNew; int nArgcNew;
+ int c, fVerbose = 0;
+ Extra_UtilGetoptReset();
+ while ( ( c = Extra_UtilGetopt( argc, argv, "vh" ) ) != EOF )
+ {
+ switch ( c )
+ {
+ case 'v':
+ fVerbose ^= 1;
+ break;
+ case 'h':
+ goto usage;
+ default:
+ goto usage;
+ }
+ }
+ pArgvNew = argv + globalUtilOptind;
+ nArgcNew = argc - globalUtilOptind;
+ if ( nArgcNew != 2 )
+ {
+ Abc_Print( -1, "Abc_CommandAbc9Compare(): This command expects two AIG file names on the command line.\n" );
+ return 1;
+ }
+ pGia0 = Gia_AigerRead( pArgvNew[0], 0, 0, 0 );
+ pGia1 = Gia_AigerRead( pArgvNew[1], 0, 0, 0 );
+ if ( pGia0 == NULL || pGia1 == NULL )
+ {
+ Abc_Print( -1, "Abc_CommandAbc9Compare(): Reading input files did not work.\n" );
+ return 1;
+ }
+ Gia_Iso4TestTwo( pGia0, pGia1 );
+ Gia_ManStop( pGia0 );
+ Gia_ManStop( pGia1 );
+ return 0;
+
+usage:
+ Abc_Print( -2, "usage: &compare <file1> <file2> [-vh]\n" );
+ Abc_Print( -2, "\t compared two AIGs for structural similarity\n" );
+ Abc_Print( -2, "\t-v : toggle printing verbose information [default = %s]\n", fVerbose? "yes": "no" );
+ Abc_Print( -2, "\t-h : print the command usage\n");
+ return 1;
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
int Abc_CommandAbc9CexInfo( Abc_Frame_t * pAbc, int argc, char ** argv )
{
extern void Bmc_CexTest( Gia_Man_t * p, Abc_Cex_t * pCex, int fVerbose );
@@ -44409,6 +45817,7 @@ int Abc_CommandAbc9SatClp( Abc_Frame_t * pAbc, int argc, char ** argv )
return 0;
}
vSop = Bmc_CollapseOne( pAbc->pGia, nCubeLim, nBTLimit, fCanon, 0, fVerbose );
+ printf( "%s\n", Vec_StrArray(vSop) );
Vec_StrFree( vSop );
return 0;
@@ -45703,7 +47112,7 @@ int Abc_CommandAbc9Mfs( Abc_Frame_t * pAbc, int argc, char ** argv )
pPars->nDepthMax = 100;
pPars->nWinSizeMax = 2000;
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "WFDMLCNdaebvwh" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "WFDMLCNdaeblvwh" ) ) != EOF )
{
switch ( c )
{
@@ -45796,6 +47205,9 @@ int Abc_CommandAbc9Mfs( Abc_Frame_t * pAbc, int argc, char ** argv )
case 'b':
pPars->fAllBoxes ^= 1;
break;
+ case 'l':
+ pPars->fUseDcs ^= 1;
+ break;
case 'v':
pPars->fVerbose ^= 1;
break;
@@ -45835,12 +47247,21 @@ int Abc_CommandAbc9Mfs( Abc_Frame_t * pAbc, int argc, char ** argv )
return 0;
}
*/
- pTemp = Gia_ManPerformMfs( pAbc->pGia, pPars );
+ if ( Gia_ManRegNum(pAbc->pGia) == 0 )
+ pTemp = Gia_ManPerformMfs( pAbc->pGia, pPars );
+ else
+ {
+ int nRegs = Gia_ManRegNum(pAbc->pGia);
+ pAbc->pGia->nRegs = 0;
+ pTemp = Gia_ManPerformMfs( pAbc->pGia, pPars );
+ Gia_ManSetRegNum( pAbc->pGia, nRegs );
+ Gia_ManSetRegNum( pTemp, nRegs );
+ }
Abc_FrameUpdateGia( pAbc, pTemp );
return 0;
usage:
- Abc_Print( -2, "usage: &mfs [-WFDMLCN <num>] [-daebvwh]\n" );
+ Abc_Print( -2, "usage: &mfs [-WFDMLCN <num>] [-daeblvwh]\n" );
Abc_Print( -2, "\t performs don't-care-based optimization of logic networks\n" );
Abc_Print( -2, "\t-W <num> : the number of levels in the TFO cone (0 <= num) [default = %d]\n", pPars->nTfoLevMax );
Abc_Print( -2, "\t-F <num> : the max number of fanouts to skip (1 <= num) [default = %d]\n", pPars->nFanoutMax );
@@ -45853,6 +47274,7 @@ usage:
Abc_Print( -2, "\t-a : toggle minimizing area or area+edges [default = %s]\n", pPars->fArea? "area": "area+edges" );
Abc_Print( -2, "\t-e : toggle high-effort resubstitution [default = %s]\n", pPars->fMoreEffort? "yes": "no" );
Abc_Print( -2, "\t-b : toggle preserving all white boxes [default = %s]\n", pPars->fAllBoxes? "yes": "no" );
+ Abc_Print( -2, "\t-l : toggle deriving don't-cares [default = %s]\n", pPars->fUseDcs? "yes": "no" );
Abc_Print( -2, "\t-v : toggle printing optimization summary [default = %s]\n", pPars->fVerbose? "yes": "no" );
Abc_Print( -2, "\t-w : toggle printing detailed stats for each node [default = %s]\n", pPars->fVeryVerbose? "yes": "no" );
Abc_Print( -2, "\t-h : print the command usage\n");
@@ -46043,13 +47465,35 @@ usage:
***********************************************************************/
int Abc_CommandAbc9DeepSyn( Abc_Frame_t * pAbc, int argc, char ** argv )
{
- extern Gia_Man_t * Gia_ManDeepSyn( Gia_Man_t * pGia, int TimeOut, int nAnds, int Seed, int fVerbose );
- Gia_Man_t * pTemp; int c, TimeOut = 0, nAnds = 0, Seed = 0, fVerbose = 0;
+ extern Gia_Man_t * Gia_ManDeepSyn( Gia_Man_t * pGia, int nIters, int nNoImpr, int TimeOut, int nAnds, int Seed, int fUseTwo, int fVerbose );
+ Gia_Man_t * pTemp; int c, nIters = 1, nNoImpr = ABC_INFINITY, TimeOut = 0, nAnds = 0, Seed = 0, fUseTwo = 0, fVerbose = 0;
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "TASvh" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "IJTAStvh" ) ) != EOF )
{
switch ( c )
{
+ case 'I':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-I\" should be followed by an integer.\n" );
+ goto usage;
+ }
+ nIters = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ if ( nIters < 0 )
+ goto usage;
+ break;
+ case 'J':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-J\" should be followed by an integer.\n" );
+ goto usage;
+ }
+ nNoImpr = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ if ( nNoImpr < 0 )
+ goto usage;
+ break;
case 'T':
if ( globalUtilOptind >= argc )
{
@@ -46083,6 +47527,9 @@ int Abc_CommandAbc9DeepSyn( Abc_Frame_t * pAbc, int argc, char ** argv )
if ( Seed < 0 )
goto usage;
break;
+ case 't':
+ fUseTwo ^= 1;
+ break;
case 'v':
fVerbose ^= 1;
break;
@@ -46097,16 +47544,19 @@ int Abc_CommandAbc9DeepSyn( Abc_Frame_t * pAbc, int argc, char ** argv )
Abc_Print( -1, "Abc_CommandAbc9DeepSyn(): There is no AIG.\n" );
return 0;
}
- pTemp = Gia_ManDeepSyn( pAbc->pGia, TimeOut, nAnds, Seed, fVerbose );
+ pTemp = Gia_ManDeepSyn( pAbc->pGia, nIters, nNoImpr, TimeOut, nAnds, Seed, fUseTwo, fVerbose );
Abc_FrameUpdateGia( pAbc, pTemp );
return 0;
usage:
- Abc_Print( -2, "usage: &deepsyn [-TAS <num>] [-vh]\n" );
+ Abc_Print( -2, "usage: &deepsyn [-IJTAS <num>] [-tvh]\n" );
Abc_Print( -2, "\t performs synthesis\n" );
+ Abc_Print( -2, "\t-I <num> : the number of iterations [default = %d]\n", nIters );
+ Abc_Print( -2, "\t-J <num> : the number of steps without improvements [default = %d]\n", nNoImpr );
Abc_Print( -2, "\t-T <num> : the timeout in seconds (0 = no timeout) [default = %d]\n", TimeOut );
Abc_Print( -2, "\t-A <num> : the number of nodes to stop (0 = no limit) [default = %d]\n", nAnds );
- Abc_Print( -2, "\t-S <num> : user-specified random seed (0 <= num <= 100) [default = %d]\n", Seed );
+ Abc_Print( -2, "\t-S <num> : user-specified random seed (0 <= num <= 100) [default = %d]\n", Seed );
+ Abc_Print( -2, "\t-t : toggle using two-input LUTs [default = %s]\n", fUseTwo? "yes": "no" );
Abc_Print( -2, "\t-v : toggle printing optimization summary [default = %s]\n", fVerbose? "yes": "no" );
Abc_Print( -2, "\t-h : print the command usage\n");
return 1;
@@ -46123,6 +47573,107 @@ usage:
SeeAlso []
***********************************************************************/
+int Abc_CommandAbc9StochSyn( Abc_Frame_t * pAbc, int argc, char ** argv )
+{
+ extern void Gia_ManStochSyn( int nMaxSize, int nIters, int TimeOut, int Seed, int fVerbose, char * pScript );
+ int c, nMaxSize = 1000, nIters = 10, TimeOut = 0, Seed = 0, fVerbose = 0; char * pScript;
+ Extra_UtilGetoptReset();
+ while ( ( c = Extra_UtilGetopt( argc, argv, "NITSvh" ) ) != EOF )
+ {
+ switch ( c )
+ {
+ case 'N':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-N\" should be followed by an integer.\n" );
+ goto usage;
+ }
+ nMaxSize = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ if ( nMaxSize < 0 )
+ goto usage;
+ break;
+ case 'I':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-I\" should be followed by an integer.\n" );
+ goto usage;
+ }
+ nIters = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ if ( nIters < 0 )
+ goto usage;
+ break;
+ case 'T':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-T\" should be followed by an integer.\n" );
+ goto usage;
+ }
+ TimeOut = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ if ( TimeOut < 0 )
+ goto usage;
+ break;
+ case 'S':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-S\" should be followed by an integer.\n" );
+ goto usage;
+ }
+ Seed = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ if ( Seed < 0 )
+ goto usage;
+ break;
+ case 'v':
+ fVerbose ^= 1;
+ break;
+ case 'h':
+ goto usage;
+ default:
+ goto usage;
+ }
+ }
+ if ( pAbc->pGia == NULL )
+ {
+ Abc_Print( -1, "Abc_CommandAbc9StochSyn(): There is no AIG.\n" );
+ return 0;
+ }
+ if ( argc != globalUtilOptind + 1 )
+ {
+ printf( "Expecting a synthesis script in quotes on the command line (for example: \"&st; &dch; &if\").\n" );
+ goto usage;
+ }
+ pScript = Abc_UtilStrsav( argv[globalUtilOptind] );
+ Gia_ManStochSyn( nMaxSize, nIters, TimeOut, Seed, fVerbose, pScript );
+ ABC_FREE( pScript );
+ return 0;
+
+usage:
+ Abc_Print( -2, "usage: &stochsyn [-NITS <num>] [-tvh] <script>\n" );
+ Abc_Print( -2, "\t performs stochastic synthesis\n" );
+ Abc_Print( -2, "\t-N <num> : the max partition size (in AIG nodes or LUTs) [default = %d]\n", nMaxSize );
+ Abc_Print( -2, "\t-I <num> : the number of iterations [default = %d]\n", nIters );
+ Abc_Print( -2, "\t-T <num> : the timeout in seconds (0 = no timeout) [default = %d]\n", TimeOut );
+ Abc_Print( -2, "\t-S <num> : user-specified random seed (0 <= num <= 100) [default = %d]\n", Seed );
+ Abc_Print( -2, "\t-v : toggle printing optimization summary [default = %s]\n", fVerbose? "yes": "no" );
+ Abc_Print( -2, "\t-h : print the command usage\n");
+ Abc_Print( -2, "\t<script> : synthesis script to use for each partition\n");
+ return 1;
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
int Abc_CommandAbc9CexCut( Abc_Frame_t * pAbc, int argc, char ** argv )
{
return -1;
@@ -47779,6 +49330,10 @@ usage:
***********************************************************************/
int Abc_CommandAbc9Test( Abc_Frame_t * pAbc, int argc, char ** argv )
{
+ extern Gia_Man_t * Gia_ManPerformNewResub( Gia_Man_t * p, int nWinCount, int nCutSize, int nProcs, int fVerbose );
+ extern void Gia_RsbEnumerateWindows( Gia_Man_t * p, int nInputsMax, int nLevelsMax );
+ extern int Gia_ManSumTotalOfSupportSizes( Gia_Man_t * p );
+ extern void Abc_Tt6MinTest2( Gia_Man_t * p );
int c, fVerbose = 0;
int nFrames = 5;
int fSwitch = 0;
@@ -47834,13 +49389,13 @@ int Abc_CommandAbc9Test( Abc_Frame_t * pAbc, int argc, char ** argv )
goto usage;
}
}
-// if ( pAbc->pGia == NULL )
-// {
-// Abc_Print( -1, "Abc_CommandAbc9Test(): There is no AIG.\n" );
-// return 1;
-// }
-// Abc_FrameUpdateGia( pAbc, Abc_Procedure(pAbc->pGia) );
-// Gia_SimQualityTest( pAbc->pGia );
+ if ( pAbc->pGia == NULL )
+ {
+ Abc_Print( -1, "Abc_CommandAbc9Test(): There is no AIG.\n" );
+ return 1;
+ }
+ Abc_FrameUpdateGia( pAbc, Gia_ManPerformNewResub(pAbc->pGia, 100, 6, 1, 1) );
+// printf( "AIG in \"%s\" has the sum of output support sizes equal to %d.\n", pAbc->pGia->pSpec, Gia_ManSumTotalOfSupportSizes(pAbc->pGia) );
return 0;
usage:
Abc_Print( -2, "usage: &test [-FW num] [-svh]\n" );
diff --git a/src/base/abci/abcBalance.c b/src/base/abci/abcBalance.c
index 552cba7f..185ef9c1 100644
--- a/src/base/abci/abcBalance.c
+++ b/src/base/abci/abcBalance.c
@@ -266,7 +266,7 @@ Abc_Obj_t * Abc_NodeBalance_rec( Abc_Ntk_t * pNtkNew, Abc_Obj_t * pNodeOld, Vec_
if ( vSuper->nSize < 2 )
printf( "BUG!\n" );
// sort the new nodes by level in the decreasing order
- Vec_PtrSort( vSuper, (int (*)(void))Abc_NodeCompareLevelsDecrease );
+ Vec_PtrSort( vSuper, (int (*)(const void *, const void *))Abc_NodeCompareLevelsDecrease );
// balance the nodes
assert( vSuper->nSize > 1 );
while ( vSuper->nSize > 1 )
diff --git a/src/base/abci/abcCollapse.c b/src/base/abci/abcCollapse.c
index ca54d542..136712cb 100644
--- a/src/base/abci/abcCollapse.c
+++ b/src/base/abci/abcCollapse.c
@@ -195,7 +195,16 @@ Abc_Ntk_t * Abc_NtkFromGlobalBdds( Abc_Ntk_t * pNtk, int fReverse )
Extra_ProgressBarStop( pProgress );
return pNtkNew;
}
-Abc_Ntk_t * Abc_NtkCollapse( Abc_Ntk_t * pNtk, int fBddSizeMax, int fDualRail, int fReorder, int fReverse, int fVerbose )
+void Abc_NtkDumpVariableOrder( Abc_Ntk_t * pNtk )
+{
+ DdManager * dd = (DdManager *)Abc_NtkGlobalBddMan( pNtk );
+ FILE * pFile = fopen( "order.txt", "wb" ); int i;
+ for ( i = 0; i < dd->size; i++ )
+ fprintf( pFile, "%d ", dd->invperm[i] );
+ fprintf( pFile, "\n" );
+ fclose( pFile );
+}
+Abc_Ntk_t * Abc_NtkCollapse( Abc_Ntk_t * pNtk, int fBddSizeMax, int fDualRail, int fReorder, int fReverse, int fDumpOrder, int fVerbose )
{
Abc_Ntk_t * pNtkNew;
abctime clk = Abc_Clock();
@@ -210,6 +219,8 @@ Abc_Ntk_t * Abc_NtkCollapse( Abc_Ntk_t * pNtk, int fBddSizeMax, int fDualRail, i
printf( "Shared BDD size = %6d nodes. ", Cudd_ReadKeys(dd) - Cudd_ReadDead(dd) );
ABC_PRT( "BDD construction time", Abc_Clock() - clk );
}
+ if ( fDumpOrder )
+ Abc_NtkDumpVariableOrder( pNtk );
// create the new network
pNtkNew = Abc_NtkFromGlobalBdds( pNtk, fReverse );
@@ -236,7 +247,7 @@ Abc_Ntk_t * Abc_NtkCollapse( Abc_Ntk_t * pNtk, int fBddSizeMax, int fDualRail, i
#else
-Abc_Ntk_t * Abc_NtkCollapse( Abc_Ntk_t * pNtk, int fBddSizeMax, int fDualRail, int fReorder, int fReverse, int fVerbose )
+Abc_Ntk_t * Abc_NtkCollapse( Abc_Ntk_t * pNtk, int fBddSizeMax, int fDualRail, int fReorder, int fReverse, int fDumpOrder, int fVerbose )
{
return NULL;
}
diff --git a/src/base/abci/abcDar.c b/src/base/abci/abcDar.c
index 56eb139a..483f65b9 100644
--- a/src/base/abci/abcDar.c
+++ b/src/base/abci/abcDar.c
@@ -91,7 +91,7 @@ void Abc_CollectTopOr( Abc_Obj_t * pObj, Vec_Ptr_t * vSuper )
if ( Abc_ObjIsComplement(pObj) )
{
Abc_CollectTopOr_rec( Abc_ObjNot(pObj), vSuper );
- Vec_PtrUniqify( vSuper, (int (*)())Abc_ObjCompareById );
+ Vec_PtrUniqify( vSuper, (int (*)(const void *, const void *))Abc_ObjCompareById );
}
else
Vec_PtrPush( vSuper, Abc_ObjNot(pObj) );
@@ -858,6 +858,7 @@ Abc_Ntk_t * Abc_NtkFromMappedGia( Gia_Man_t * p, int fFindEnables, int fUseBuffs
Gia_LutForEachFanin( p, i, iFan, k )
Abc_ObjAddFanin( pObjNew, Abc_NtkObj(pNtkNew, Gia_ObjValue(Gia_ManObj(p, iFan))) );
pObjNew->pData = Abc_ObjHopFromGia( (Hop_Man_t *)pNtkNew->pManFunc, p, i, vReflect );
+ pObjNew->fPersist = Gia_ObjLutIsMux(p, i) && Gia_ObjLutSize(p, i) == 3;
pObj->Value = Abc_ObjId( pObjNew );
}
Vec_PtrFree( vReflect );
@@ -1650,6 +1651,7 @@ Abc_Ntk_t * Abc_NtkDChoice( Abc_Ntk_t * pNtk, int fBalance, int fUpdateLevel, in
***********************************************************************/
Abc_Ntk_t * Abc_NtkDch( Abc_Ntk_t * pNtk, Dch_Pars_t * pPars )
{
+ extern Aig_Man_t * Dar_ManChoiceNew( Aig_Man_t * pAig, Dch_Pars_t * pPars );
extern Gia_Man_t * Dar_NewChoiceSynthesis( Aig_Man_t * pAig, int fBalance, int fUpdateLevel, int fPower, int fLightSynth, int fVerbose );
extern Aig_Man_t * Cec_ComputeChoices( Gia_Man_t * pGia, Dch_Pars_t * pPars );
@@ -1661,23 +1663,28 @@ Abc_Ntk_t * Abc_NtkDch( Abc_Ntk_t * pNtk, Dch_Pars_t * pPars )
pMan = Abc_NtkToDar( pNtk, 0, 0 );
if ( pMan == NULL )
return NULL;
-clk = Abc_Clock();
- if ( pPars->fSynthesis )
- pGia = Dar_NewChoiceSynthesis( pMan, 1, 1, pPars->fPower, pPars->fLightSynth, pPars->fVerbose );
- else
+ if ( pPars->fUseNew )
+ pMan = Dar_ManChoiceNew( pMan, pPars );
+ else
{
- pGia = Gia_ManFromAig( pMan );
- Aig_ManStop( pMan );
- }
+clk = Abc_Clock();
+ if ( pPars->fSynthesis )
+ pGia = Dar_NewChoiceSynthesis( pMan, 1, 1, pPars->fPower, pPars->fLightSynth, pPars->fVerbose );
+ else
+ {
+ pGia = Gia_ManFromAig( pMan );
+ Aig_ManStop( pMan );
+ }
pPars->timeSynth = Abc_Clock() - clk;
- if ( pPars->fUseGia )
- pMan = Cec_ComputeChoices( pGia, pPars );
- else
- {
- pMan = Gia_ManToAigSkip( pGia, 3 );
- Gia_ManStop( pGia );
- pMan = Dch_ComputeChoices( pTemp = pMan, pPars );
- Aig_ManStop( pTemp );
+ if ( pPars->fUseGia )
+ pMan = Cec_ComputeChoices( pGia, pPars );
+ else
+ {
+ pMan = Gia_ManToAigSkip( pGia, 3 );
+ Gia_ManStop( pGia );
+ pMan = Dch_ComputeChoices( pTemp = pMan, pPars );
+ Aig_ManStop( pTemp );
+ }
}
pNtkAig = Abc_NtkFromDarChoices( pNtk, pMan );
Aig_ManStop( pMan );
diff --git a/src/base/abci/abcDress2.c b/src/base/abci/abcDress2.c
index 1b1eb9bf..e7adb41f 100644
--- a/src/base/abci/abcDress2.c
+++ b/src/base/abci/abcDress2.c
@@ -21,6 +21,7 @@
#include "base/abc/abc.h"
#include "aig/aig/aig.h"
#include "proof/dch/dch.h"
+#include "aig/gia/giaAig.h"
ABC_NAMESPACE_IMPL_START
@@ -274,6 +275,32 @@ Vec_Ptr_t * Abc_NtkDressMapIds( Aig_Man_t * pMiter, Abc_Ntk_t * pNtk1, Abc_Ntk_t
/**Function*************************************************************
+ Synopsis [Alternative way to compute equivalences.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+void Dch_ComputeEquivalences2( Aig_Man_t * pMiter, Dch_Pars_t * pPars )
+{
+ extern Gia_Man_t * Cec4_ManSimulateTest3( Gia_Man_t * p, int nBTLimit, int fVerbose );
+ Gia_Man_t * pGia = Gia_ManFromAigSimple(pMiter);
+ Gia_Man_t * pNew = Cec4_ManSimulateTest3( pGia, pPars->nBTLimit, pPars->fVerbose );
+ int i, k;
+ ABC_FREE( pMiter->pReprs );
+ pMiter->pReprs = ABC_CALLOC( Aig_Obj_t *, Aig_ManObjNumMax(pMiter) );
+ Gia_ManForEachClass( pGia, i )
+ Gia_ClassForEachObj1( pGia, i, k )
+ pMiter->pReprs[k] = Aig_ManObj( pMiter, i );
+ Gia_ManStop( pGia );
+ Gia_ManStop( pNew );
+}
+
+/**Function*************************************************************
+
Synopsis [Computes equivalence classes of objects in pNtk1 and pNtk2.]
Description [Returns the array (Vec_Ptr_t) of integer arrays (Vec_Int_t).
@@ -307,7 +334,7 @@ Vec_Ptr_t * Abc_NtkDressComputeEquivs( Abc_Ntk_t * pNtk1, Abc_Ntk_t * pNtk2, int
pPars->nBTLimit = nConflictLimit;
pPars->fVerbose = fVerbose;
// perform SAT sweeping
- Dch_ComputeEquivalences( pMiter, pPars );
+ Dch_ComputeEquivalences2( pMiter, pPars );
// now, pMiter is annotated with the equivl class info
// convert this info into the resulting array
vRes = Abc_NtkDressMapIds( pMiter, pNtk1, pNtk2 );
diff --git a/src/base/abci/abcEspresso.c b/src/base/abci/abcEspresso.c
index 2da389da..9296b1e7 100644
--- a/src/base/abci/abcEspresso.c
+++ b/src/base/abci/abcEspresso.c
@@ -58,7 +58,7 @@ void Abc_NtkEspresso( Abc_Ntk_t * pNtk, int fVerbose )
Abc_NtkMapToSop(pNtk);
else if ( Abc_NtkHasBdd(pNtk) )
{
- if ( !Abc_NtkBddToSop(pNtk, -1, ABC_INFINITY) )
+ if ( !Abc_NtkBddToSop(pNtk, -1, ABC_INFINITY, 1) )
{
printf( "Abc_NtkEspresso(): Converting to SOPs has failed.\n" );
return;
diff --git a/src/base/abci/abcExtract.c b/src/base/abci/abcExtract.c
index 1b247841..870bc7dc 100644
--- a/src/base/abci/abcExtract.c
+++ b/src/base/abci/abcExtract.c
@@ -19,6 +19,7 @@
***********************************************************************/
#include "base/abc/abc.h"
+#include "aig/gia/giaAig.h"
ABC_NAMESPACE_IMPL_START
@@ -741,7 +742,21 @@ Abc_Ntk_t * Abc_NtkShareXor( Abc_Ntk_t * pNtk, int nMultiSize, int fAnd, int fVe
Abc_ShaManStop( p );
return pNtkNew;
}
-
+Gia_Man_t * Abc_NtkShareXorGia( Gia_Man_t * p, int nMultiSize, int fAnd, int fVerbose )
+{
+ extern Aig_Man_t * Abc_NtkToDar( Abc_Ntk_t * pNtk, int fExors, int fRegisters );
+ extern Abc_Ntk_t * Abc_NtkFromAigPhase( Aig_Man_t * pMan );
+ Aig_Man_t * pMan = Gia_ManToAig( p, 0 );
+ Abc_Ntk_t * pNtk = Abc_NtkFromAigPhase( pMan );
+ Abc_Ntk_t * pNtkNew = Abc_NtkShareXor( pNtk, nMultiSize, fAnd, fVerbose );
+ Aig_Man_t * pAig = Abc_NtkToDar( pNtkNew, 0, 0 );
+ Gia_Man_t * pNew = Gia_ManFromAig( pAig );
+ Abc_NtkDelete( pNtkNew );
+ Abc_NtkDelete( pNtk );
+ Aig_ManStop( pAig );
+ Aig_ManStop( pMan );
+ return pNew;
+}
////////////////////////////////////////////////////////////////////////
/// END OF FILE ///
diff --git a/src/base/abci/abcFx.c b/src/base/abci/abcFx.c
index 60461a4a..487aee3c 100644
--- a/src/base/abci/abcFx.c
+++ b/src/base/abci/abcFx.c
@@ -201,7 +201,7 @@ void Abc_NtkFxInsert( Abc_Ntk_t * pNtk, Vec_Wec_t * vCubes )
// quit if nothing changes
if ( iNodeMax < Abc_NtkObjNumMax(pNtk) )
{
- printf( "The network is unchanged by fast extract.\n" );
+ //printf( "The network is unchanged by fast extract.\n" );
return;
}
// create new nodes
diff --git a/src/base/abci/abcFxu.c b/src/base/abci/abcFxu.c
index 8da306bf..99b3a5eb 100644
--- a/src/base/abci/abcFxu.c
+++ b/src/base/abci/abcFxu.c
@@ -88,7 +88,7 @@ int Abc_NtkFastExtract( Abc_Ntk_t * pNtk, Fxu_Data_t * p )
if ( Abc_NtkIsSopLogic(pNtk) )
{ // to make sure the SOPs are SCC-free
// Abc_NtkSopToBdd(pNtk);
-// Abc_NtkBddToSop(pNtk);
+// Abc_NtkBddToSop(pNtk, 1);
}
// get the network in the SOP form
if ( !Abc_NtkToSop(pNtk, -1, ABC_INFINITY) )
diff --git a/src/base/abci/abcIf.c b/src/base/abci/abcIf.c
index ab88c5e2..491e2c14 100644
--- a/src/base/abci/abcIf.c
+++ b/src/base/abci/abcIf.c
@@ -230,9 +230,13 @@ If_Man_t * Abc_NtkToIf( Abc_Ntk_t * pNtk, If_Par_t * pPars )
Abc_AigConst1(pNtk)->pCopy = (Abc_Obj_t *)If_ManConst1( pIfMan );
Abc_NtkForEachCi( pNtk, pNode, i )
{
- pNode->pCopy = (Abc_Obj_t *)If_ManCreateCi( pIfMan );
+ If_Obj_t * pIfObj = If_ManCreateCi( pIfMan );
+ pNode->pCopy = (Abc_Obj_t *)pIfObj;
// transfer logic level information
Abc_ObjIfCopy(pNode)->Level = pNode->Level;
+ // mark the largest level
+ if ( pIfMan->nLevelMax < (int)pIfObj->Level )
+ pIfMan->nLevelMax = (int)pIfObj->Level;
}
// load the AIG into the mapper
diff --git a/src/base/abci/abcIvy.c b/src/base/abci/abcIvy.c
index 5dc125d0..c680f85a 100644
--- a/src/base/abci/abcIvy.c
+++ b/src/base/abci/abcIvy.c
@@ -91,7 +91,7 @@ Ivy_Man_t * Abc_NtkIvyBefore( Abc_Ntk_t * pNtk, int fSeq, int fUseDc )
assert( !Abc_NtkIsNetlist(pNtk) );
if ( Abc_NtkIsBddLogic(pNtk) )
{
- if ( !Abc_NtkBddToSop(pNtk, -1, ABC_INFINITY) )
+ if ( !Abc_NtkBddToSop(pNtk, -1, ABC_INFINITY, 1) )
{
printf( "Abc_NtkIvyBefore(): Converting to SOPs has failed.\n" );
return NULL;
@@ -601,7 +601,7 @@ int Abc_NtkIvyProve( Abc_Ntk_t ** ppNtk, void * pPars )
printf( "Attempting BDDs with node limit %d ...\n", pParams->nBddSizeLimit );
fflush( stdout );
}
- pNtk = Abc_NtkCollapse( pNtkTemp = pNtk, pParams->nBddSizeLimit, 0, pParams->fBddReorder, 0, 0 );
+ pNtk = Abc_NtkCollapse( pNtkTemp = pNtk, pParams->nBddSizeLimit, 0, pParams->fBddReorder, 0, 0, 0 );
if ( pNtk )
{
Abc_NtkDelete( pNtkTemp );
@@ -640,7 +640,7 @@ Abc_Ntk_t * Abc_NtkIvy( Abc_Ntk_t * pNtk )
assert( !Abc_NtkIsNetlist(pNtk) );
if ( Abc_NtkIsBddLogic(pNtk) )
{
- if ( !Abc_NtkBddToSop(pNtk, -1, ABC_INFINITY) )
+ if ( !Abc_NtkBddToSop(pNtk, -1, ABC_INFINITY, 1) )
{
Vec_IntFree( vInit );
printf( "Abc_NtkIvy(): Converting to SOPs has failed.\n" );
diff --git a/src/base/abci/abcLut.c b/src/base/abci/abcLut.c
index edc2b7de..49c74e6b 100644
--- a/src/base/abci/abcLut.c
+++ b/src/base/abci/abcLut.c
@@ -783,6 +783,166 @@ int Abc_NodeDecomposeStep( Abc_ManScl_t * p )
return 1;
}
+/**Function*************************************************************
+
+ Synopsis [Performs specialized mapping.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+static word s__Truths6[6] = {
+ ABC_CONST(0xAAAAAAAAAAAAAAAA),
+ ABC_CONST(0xCCCCCCCCCCCCCCCC),
+ ABC_CONST(0xF0F0F0F0F0F0F0F0),
+ ABC_CONST(0xFF00FF00FF00FF00),
+ ABC_CONST(0xFFFF0000FFFF0000),
+ ABC_CONST(0xFFFFFFFF00000000)
+};
+word Abc_ObjComputeTruth( Abc_Obj_t * pObj, Vec_Int_t * vSupp )
+{
+ int Index; word t0, t1, tc;
+ assert( Vec_IntSize(vSupp) <= 6 );
+ if ( (Index = Vec_IntFind(vSupp, Abc_ObjId(pObj))) >= 0 )
+ return s__Truths6[Index];
+ assert( Abc_ObjIsNode(pObj) );
+ if ( Abc_ObjFaninNum(pObj) == 0 )
+ return Abc_NodeIsConst0(pObj) ? (word)0 : ~(word)0;
+ assert( Abc_ObjFaninNum(pObj) == 3 );
+ t0 = Abc_ObjComputeTruth( Abc_ObjFanin(pObj, 2), vSupp );
+ t1 = Abc_ObjComputeTruth( Abc_ObjFanin(pObj, 1), vSupp );
+ tc = Abc_ObjComputeTruth( Abc_ObjFanin(pObj, 0), vSupp );
+ return (tc & t1) | (~tc & t0);
+}
+Abc_Obj_t * Abc_NtkSpecialMap_rec( Abc_Ntk_t * pNew, Abc_Obj_t * pObj, Vec_Wec_t * vSupps, Vec_Int_t * vCover )
+{
+ if ( pObj->pCopy )
+ return pObj->pCopy;
+ if ( Abc_ObjFaninNum(pObj) == 0 )
+ return NULL;
+ assert( Abc_ObjFaninNum(pObj) == 3 );
+ if ( pObj->fMarkA || pObj->fMarkB )
+ {
+ Abc_Obj_t * pFan0 = Abc_NtkSpecialMap_rec( pNew, Abc_ObjFanin(pObj, 2), vSupps, vCover );
+ Abc_Obj_t * pFan1 = Abc_NtkSpecialMap_rec( pNew, Abc_ObjFanin(pObj, 1), vSupps, vCover );
+ Abc_Obj_t * pFanC = Abc_NtkSpecialMap_rec( pNew, Abc_ObjFanin(pObj, 0), vSupps, vCover );
+ if ( pFan0 == NULL )
+ pFan0 = Abc_NodeIsConst0(Abc_ObjFanin(pObj, 2)) ? Abc_NtkCreateNodeConst0(pNew) : Abc_NtkCreateNodeConst1(pNew);
+ if ( pFan1 == NULL )
+ pFan1 = Abc_NodeIsConst0(Abc_ObjFanin(pObj, 1)) ? Abc_NtkCreateNodeConst0(pNew) : Abc_NtkCreateNodeConst1(pNew);
+ pObj->pCopy = Abc_NtkCreateNodeMux( pNew, pFanC, pFan1, pFan0 );
+ pObj->pCopy->fMarkA = pObj->fMarkA;
+ pObj->pCopy->fMarkB = pObj->fMarkB;
+ }
+ else
+ {
+ Abc_Obj_t * pTemp; int i; word Truth;
+ Vec_Int_t * vSupp = Vec_WecEntry( vSupps, Abc_ObjId(pObj) );
+ Abc_NtkForEachObjVec( vSupp, pObj->pNtk, pTemp, i )
+ Abc_NtkSpecialMap_rec( pNew, pTemp, vSupps, vCover );
+ pObj->pCopy = Abc_NtkCreateNode( pNew );
+ Abc_NtkForEachObjVec( vSupp, pObj->pNtk, pTemp, i )
+ Abc_ObjAddFanin( pObj->pCopy, pTemp->pCopy );
+ Truth = Abc_ObjComputeTruth( pObj, vSupp );
+ pObj->pCopy->pData = Abc_SopCreateFromTruthIsop( (Mem_Flex_t *)pNew->pManFunc, Vec_IntSize(vSupp), &Truth, vCover );
+ assert( Abc_SopGetVarNum((char *)pObj->pCopy->pData) == Vec_IntSize(vSupp) );
+ }
+ return pObj->pCopy;
+}
+Abc_Ntk_t * Abc_NtkSpecialMapping( Abc_Ntk_t * pNtk, int fVerbose )
+{
+ Abc_Ntk_t * pNtkNew;
+ Vec_Int_t * vCover = Vec_IntAlloc( 1 << 16 );
+ Vec_Wec_t * vSupps = Vec_WecStart( Abc_NtkObjNumMax(pNtk) );
+ Abc_Obj_t * pObj, * pFan0, * pFan1, * pFanC; int i, Count[2] = {0};
+ Abc_NtkForEachCi( pNtk, pObj, i )
+ Vec_IntPush( Vec_WecEntry(vSupps, i), i );
+ Abc_NtkForEachNode( pNtk, pObj, i )
+ {
+ Vec_Int_t * vSupp = Vec_WecEntry(vSupps, i);
+ if ( Abc_ObjFaninNum(pObj) == 0 )
+ continue;
+ assert( Abc_ObjFaninNum(pObj) == 3 );
+ pFan0 = Abc_ObjFanin( pObj, 2 );
+ pFan1 = Abc_ObjFanin( pObj, 1 );
+ pFanC = Abc_ObjFanin0( pObj );
+ assert( Abc_ObjIsCi(pFanC) );
+ if ( pFan0->fMarkA && pFan1->fMarkA )
+ {
+ pObj->fMarkB = 1;
+ Vec_IntPush( vSupp, Abc_ObjId(pObj) );
+ continue;
+ }
+ Vec_IntTwoMerge2( Vec_WecEntry(vSupps, Abc_ObjId(pFan0)), Vec_WecEntry(vSupps, Abc_ObjId(pFan1)), vSupp );
+ assert( Vec_IntFind(vSupp, Abc_ObjId(pFanC)) == -1 );
+ Vec_IntPushOrder( vSupp, Abc_ObjId(pFanC) );
+ if ( Vec_IntSize(vSupp) <= 6 )
+ continue;
+ Vec_IntClear( vSupp );
+ if ( !pFan0->fMarkA && !pFan1->fMarkA )
+ {
+ pObj->fMarkA = 1;
+ Vec_IntPush( vSupp, Abc_ObjId(pObj) );
+ }
+ else
+ {
+ Vec_IntPushOrder( vSupp, Abc_ObjId(pFan0) );
+ Vec_IntPushOrder( vSupp, Abc_ObjId(pFan1) );
+ Vec_IntPushOrder( vSupp, Abc_ObjId(pFanC) );
+ }
+ }
+
+ if ( fVerbose )
+ {
+ Abc_NtkForEachNode( pNtk, pObj, i )
+ {
+ printf( "Node %4d : ", i );
+ if ( pObj->fMarkA )
+ printf( " MarkA " );
+ else
+ printf( " " );
+ if ( pObj->fMarkB )
+ printf( " MarkB " );
+ else
+ printf( " " );
+ Vec_IntPrint( Vec_WecEntry(vSupps, i) );
+ }
+ }
+
+ Abc_NtkCleanCopy( pNtk );
+ pNtkNew = Abc_NtkStartFrom( pNtk, ABC_NTK_LOGIC, ABC_FUNC_SOP );
+ Abc_NtkForEachCo( pNtk, pObj, i )
+ if ( Abc_ObjFaninNum(Abc_ObjFanin0(pObj)) == 0 )
+ Abc_ObjFanin0(pObj)->pCopy = Abc_NodeIsConst0(Abc_ObjFanin0(pObj)) ? Abc_NtkCreateNodeConst0(pNtkNew) : Abc_NtkCreateNodeConst1(pNtkNew);
+ else
+ Abc_NtkSpecialMap_rec( pNtkNew, Abc_ObjFanin0(pObj), vSupps, vCover );
+ Abc_NtkFinalize( pNtk, pNtkNew );
+ Abc_NtkCleanMarkAB( pNtk );
+ Vec_WecFree( vSupps );
+ Vec_IntFree( vCover );
+
+ Abc_NtkForEachNode( pNtkNew, pObj, i )
+ {
+ Count[0] += pObj->fMarkA,
+ Count[1] += pObj->fMarkB;
+ pObj->fPersist = pObj->fMarkA | pObj->fMarkB;
+ pObj->fMarkA = pObj->fMarkB = 0;
+ }
+ //printf( "Total = %3d. Nodes = %3d. MarkA = %3d. MarkB = %3d.\n", Abc_NtkNodeNum(pNtkNew),
+ // Abc_NtkNodeNum(pNtkNew) - Count[0] - Count[1], Count[0], Count[1] );
+
+ if ( !Abc_NtkCheck( pNtkNew ) )
+ {
+ printf( "Abc_NtkSpecialMapping: The network check has failed.\n" );
+ Abc_NtkDelete( pNtkNew );
+ return NULL;
+ }
+ return pNtkNew;
+}
+
////////////////////////////////////////////////////////////////////////
/// END OF FILE ///
////////////////////////////////////////////////////////////////////////
diff --git a/src/base/abci/abcLutmin.c b/src/base/abci/abcLutmin.c
index 2ac44060..7bac74bf 100644
--- a/src/base/abci/abcLutmin.c
+++ b/src/base/abci/abcLutmin.c
@@ -610,7 +610,7 @@ Abc_Obj_t * Abc_NtkBddDecompose( Abc_Ntk_t * pNtkNew, Abc_Obj_t * pNode, int nLu
// cofactor w.r.t. the bound set variables
vCofs = Abc_NtkBddCofactors( dd, (DdNode *)pNode->pData, nLutSize );
vUniq = Vec_PtrDup( vCofs );
- Vec_PtrUniqify( vUniq, (int (*)())Vec_PtrSortCompare );
+ Vec_PtrUniqify( vUniq, (int (*)(const void *, const void *))Vec_PtrSortCompare );
// only perform decomposition with it is support reduring with two less vars
if( Vec_PtrSize(vUniq) > (1 << (nLutSize-2)) )
{
@@ -739,7 +739,7 @@ Abc_Ntk_t * Abc_NtkLutmin( Abc_Ntk_t * pNtkInit, int nLutSize, int fVerbose )
else
pNtkNew = Abc_NtkStrash( pNtkInit, 0, 1, 0 );
// collapse the network
- pNtkNew = Abc_NtkCollapse( pTemp = pNtkNew, 10000, 0, 1, 0, 0 );
+ pNtkNew = Abc_NtkCollapse( pTemp = pNtkNew, 10000, 0, 1, 0, 0, 0 );
Abc_NtkDelete( pTemp );
if ( pNtkNew == NULL )
return NULL;
diff --git a/src/base/abci/abcMap.c b/src/base/abci/abcMap.c
index 5389b669..8f5e4ee2 100644
--- a/src/base/abci/abcMap.c
+++ b/src/base/abci/abcMap.c
@@ -32,8 +32,8 @@ ABC_NAMESPACE_IMPL_START
/// DECLARATIONS ///
////////////////////////////////////////////////////////////////////////
-static Map_Man_t * Abc_NtkToMap( Abc_Ntk_t * pNtk, double DelayTarget, int fRecovery, float * pSwitching, int fVerbose );
-static Abc_Ntk_t * Abc_NtkFromMap( Map_Man_t * pMan, Abc_Ntk_t * pNtk, int fUseBuffs );
+extern Map_Man_t * Abc_NtkToMap( Abc_Ntk_t * pNtk, double DelayTarget, int fRecovery, float * pSwitching, int fVerbose );
+extern Abc_Ntk_t * Abc_NtkFromMap( Map_Man_t * pMan, Abc_Ntk_t * pNtk, int fUseBuffs );
static Abc_Obj_t * Abc_NodeFromMap_rec( Abc_Ntk_t * pNtkNew, Map_Node_t * pNodeMap, int fPhase );
static Abc_Obj_t * Abc_NodeFromMapPhase_rec( Abc_Ntk_t * pNtkNew, Map_Node_t * pNodeMap, int fPhase );
@@ -612,7 +612,7 @@ Abc_Ntk_t * Abc_NtkFromMapSuperChoice( Map_Man_t * pMan, Abc_Ntk_t * pNtk )
// duplicate the network
pNtkNew2 = Abc_NtkDup( pNtk );
pNtkNew = Abc_NtkMulti( pNtkNew2, 0, 20, 0, 0, 1, 0 );
- if ( !Abc_NtkBddToSop( pNtkNew, -1, ABC_INFINITY ) )
+ if ( !Abc_NtkBddToSop( pNtkNew, -1, ABC_INFINITY, 1 ) )
{
printf( "Abc_NtkFromMapSuperChoice(): Converting to SOPs has failed.\n" );
return NULL;
diff --git a/src/base/abci/abcMffc.c b/src/base/abci/abcMffc.c
index 1d64df5c..55f39252 100644
--- a/src/base/abci/abcMffc.c
+++ b/src/base/abci/abcMffc.c
@@ -1141,7 +1141,7 @@ Vec_Ptr_t * Abc_NktMffcServer( Abc_Ntk_t * pNtk, int nInMax, int nOutMax )
// sort by their MFFC size
Vec_PtrForEachEntry( Abc_Obj_t *, vPivots, pObj, i )
pObj->iTemp = Vec_IntSize((Vec_Int_t *)Vec_PtrEntry(vVolumes, Abc_ObjId(pObj)));
- Vec_PtrSort( vPivots, (int (*)(void))Abc_NodeCompareVolumeDecrease );
+ Vec_PtrSort( vPivots, (int (*)(const void *, const void *))Abc_NodeCompareVolumeDecrease );
// create marks
vMarks = Vec_IntStart( Abc_NtkObjNumMax(pNtk) );
Vec_PtrForEachEntry( Abc_Obj_t *, vPivots, pObj, i )
diff --git a/src/base/abci/abcMiter.c b/src/base/abci/abcMiter.c
index 81b032d4..6086fc61 100644
--- a/src/base/abci/abcMiter.c
+++ b/src/base/abci/abcMiter.c
@@ -863,7 +863,7 @@ void Abc_NtkAddFrame( Abc_Ntk_t * pNtkFrames, Abc_Ntk_t * pNtk, int iFrame )
{
int fVerbose = 0;
int NodeBef = Abc_NtkNodeNum(pNtkFrames);
- char Buffer[10];
+ char Buffer[16];
Abc_Obj_t * pNode, * pLatch;
int i;
// create the prefix to be added to the node names
@@ -1008,7 +1008,7 @@ Abc_Ntk_t * Abc_NtkFrames2( Abc_Ntk_t * pNtk, int nFrames, int fInitial, AddFram
void Abc_NtkAddFrame2( Abc_Ntk_t * pNtkFrames, Abc_Ntk_t * pNtk, int iFrame, Vec_Ptr_t * vNodes, AddFrameMapping addFrameMapping, void* arg )
{
/*
- char Buffer[10];
+ char Buffer[16];
Abc_Obj_t * pNode, * pNodeNew, * pLatch;
Abc_Obj_t * pConst1, * pConst1New;
int i;
diff --git a/src/base/abci/abcNpnSave.c b/src/base/abci/abcNpnSave.c
index 0e2d13d5..3dd97432 100644
--- a/src/base/abci/abcNpnSave.c
+++ b/src/base/abci/abcNpnSave.c
@@ -564,7 +564,7 @@ void Npn_ManWrite( Npn_Man_t * p, char * pFileName )
for ( i = 0; i < p->nBins; i++ )
for ( pEntry = Npn_ManObj(p, p->pBins[i]); pEntry; pEntry = Npn_ManObj(p, pEntry->iNext) )
Vec_PtrPush( vEntries, pEntry );
- Vec_PtrSort( vEntries, (int (*)())Npn_ManCompareEntries );
+ Vec_PtrSort( vEntries, (int (*)(const void *, const void *))Npn_ManCompareEntries );
Vec_PtrForEachEntry( Npn_Obj_t *, vEntries, pEntry, i )
{
Extra_PrintHexadecimal( pFile, (unsigned *)&pEntry->uTruth, 6 );
diff --git a/src/base/abci/abcNtbdd.c b/src/base/abci/abcNtbdd.c
index d3a19d83..cbf4bbb8 100644
--- a/src/base/abci/abcNtbdd.c
+++ b/src/base/abci/abcNtbdd.c
@@ -34,7 +34,7 @@ ABC_NAMESPACE_IMPL_START
#ifdef ABC_USE_CUDD
-static int Abc_NtkBddToMuxesPerformGlo( Abc_Ntk_t * pNtk, Abc_Ntk_t * pNtkNew, int Limit );
+ int Abc_NtkBddToMuxesPerformGlo( Abc_Ntk_t * pNtk, Abc_Ntk_t * pNtkNew, int Limit, int fReorder, int fUseAdd );
static void Abc_NtkBddToMuxesPerform( Abc_Ntk_t * pNtk, Abc_Ntk_t * pNtkNew );
static Abc_Obj_t * Abc_NodeBddToMuxes( Abc_Obj_t * pNodeOld, Abc_Ntk_t * pNtkNew );
static Abc_Obj_t * Abc_NodeBddToMuxes_rec( DdManager * dd, DdNode * bFunc, Abc_Ntk_t * pNtkNew, st__table * tBdd2Node );
@@ -129,13 +129,13 @@ Abc_Ntk_t * Abc_NtkDeriveFromBdd( void * dd0, void * bFunc, char * pNamePo, Vec_
SeeAlso []
***********************************************************************/
-Abc_Ntk_t * Abc_NtkBddToMuxes( Abc_Ntk_t * pNtk, int fGlobal, int Limit )
+Abc_Ntk_t * Abc_NtkBddToMuxes( Abc_Ntk_t * pNtk, int fGlobal, int Limit, int fUseAdd )
{
Abc_Ntk_t * pNtkNew;
pNtkNew = Abc_NtkStartFrom( pNtk, ABC_NTK_LOGIC, ABC_FUNC_SOP );
if ( fGlobal )
{
- if ( !Abc_NtkBddToMuxesPerformGlo( pNtk, pNtkNew, Limit ) )
+ if ( !Abc_NtkBddToMuxesPerformGlo( pNtk, pNtkNew, Limit, 0, fUseAdd ) )
{
Abc_NtkDelete( pNtkNew );
return NULL;
@@ -237,8 +237,10 @@ Abc_Obj_t * Abc_NodeBddToMuxes_rec( DdManager * dd, DdNode * bFunc, Abc_Ntk_t *
{
Abc_Obj_t * pNodeNew, * pNodeNew0, * pNodeNew1, * pNodeNewC;
assert( !Cudd_IsComplement(bFunc) );
- if ( bFunc == b1 )
+ if ( bFunc == b1 || bFunc == a1 )
return Abc_NtkCreateNodeConst1(pNtkNew);
+ if ( bFunc == a0 )
+ return Abc_NtkCreateNodeConst0(pNtkNew);
if ( st__lookup( tBdd2Node, (char *)bFunc, (char **)&pNodeNew ) )
return pNodeNew;
// solve for the children nodes
@@ -265,13 +267,14 @@ Abc_Obj_t * Abc_NodeBddToMuxes_rec( DdManager * dd, DdNode * bFunc, Abc_Ntk_t *
SeeAlso []
***********************************************************************/
-int Abc_NtkBddToMuxesPerformGlo( Abc_Ntk_t * pNtk, Abc_Ntk_t * pNtkNew, int Limit )
+int Abc_NtkBddToMuxesPerformGlo( Abc_Ntk_t * pNtk, Abc_Ntk_t * pNtkNew, int Limit, int fReorder, int fUseAdd )
{
DdManager * dd;
+ Vec_Ptr_t * vAdds = fUseAdd ? Vec_PtrAlloc(100) : NULL;
Abc_Obj_t * pObj, * pObjNew; int i;
st__table * tBdd2Node;
assert( Abc_NtkIsStrash(pNtk) );
- dd = (DdManager *)Abc_NtkBuildGlobalBdds( pNtk, Limit, 1, 1, 0, 0 );
+ dd = (DdManager *)Abc_NtkBuildGlobalBdds( pNtk, Limit, 1, fReorder, 0, 0 );
if ( dd == NULL )
{
printf( "Construction of global BDDs has failed.\n" );
@@ -286,16 +289,32 @@ int Abc_NtkBddToMuxesPerformGlo( Abc_Ntk_t * pNtk, Abc_Ntk_t * pNtkNew, int Limi
// complement the global functions
Abc_NtkForEachCo( pNtk, pObj, i )
{
- DdNode * bFunc = Abc_ObjGlobalBdd(pObj);
- pObjNew = Abc_NodeBddToMuxes_rec( dd, Cudd_Regular(bFunc), pNtkNew, tBdd2Node );
- if ( Cudd_IsComplement(bFunc) )
- pObjNew = Abc_NtkCreateNodeInv( pNtkNew, pObjNew );
+ DdNode * bFunc = (DdNode *)Abc_ObjGlobalBdd(pObj);
+ if ( fUseAdd )
+ {
+ DdNode * aFunc = Cudd_BddToAdd( dd, bFunc ); Cudd_Ref( aFunc );
+ pObjNew = Abc_NodeBddToMuxes_rec( dd, aFunc, pNtkNew, tBdd2Node );
+ Vec_PtrPush( vAdds, aFunc );
+ }
+ else
+ {
+ pObjNew = Abc_NodeBddToMuxes_rec( dd, Cudd_Regular(bFunc), pNtkNew, tBdd2Node );
+ if ( Cudd_IsComplement(bFunc) )
+ pObjNew = Abc_NtkCreateNodeInv( pNtkNew, pObjNew );
+ }
Abc_ObjAddFanin( pObj->pCopy, pObjNew );
}
// cleanup
st__free_table( tBdd2Node );
Abc_NtkFreeGlobalBdds( pNtk, 0 );
+ if ( vAdds )
+ {
+ DdNode * aTemp;
+ Vec_PtrForEachEntry( DdNode *, vAdds, aTemp, i )
+ Cudd_RecursiveDeref( dd, aTemp );
+ Vec_PtrFree( vAdds );
+ }
Extra_StopManager( dd );
Abc_NtkCleanCopy( pNtk );
return 1;
@@ -410,6 +429,7 @@ void * Abc_NtkBuildGlobalBdds( Abc_Ntk_t * pNtk, int nBddSizeMax, int fDropInter
if ( fReorder )
{
Cudd_ReduceHeap( dd, CUDD_REORDER_SYMM_SIFT, 1 );
+// Cudd_ReduceHeap( dd, CUDD_REORDER_SYMM_SIFT, 1 );
Cudd_AutodynDisable( dd );
}
// Cudd_PrintInfo( dd, stdout );
@@ -662,7 +682,7 @@ ABC_PRT( "Time", Abc_Clock() - clk );
#else
double Abc_NtkSpacePercentage( Abc_Obj_t * pNode ) { return 0.0; }
-Abc_Ntk_t * Abc_NtkBddToMuxes( Abc_Ntk_t * pNtk, int fGlobal, int Limit ) { return NULL; }
+Abc_Ntk_t * Abc_NtkBddToMuxes( Abc_Ntk_t * pNtk, int fGlobal, int Limit, int fUseAdd ) { return NULL; }
#endif
diff --git a/src/base/abci/abcPrint.c b/src/base/abci/abcPrint.c
index ad5fba91..44d5c2c3 100644
--- a/src/base/abci/abcPrint.c
+++ b/src/base/abci/abcPrint.c
@@ -453,6 +453,15 @@ void Abc_NtkPrintStats( Abc_Ntk_t * pNtk, int fFactored, int fSaveBest, int fDum
// if ( Abc_NtkHasSop(pNtk) )
// printf( "The total number of cube pairs = %d.\n", Abc_NtkGetCubePairNum(pNtk) );
+ if ( 0 )
+ {
+ FILE * pTable = fopen( "stats.txt", "a+" );
+ if ( Abc_NtkIsStrash(pNtk) )
+ fprintf( pTable, "%s ", pNtk->pName );
+ fprintf( pTable, "%d ", Abc_NtkNodeNum(pNtk) );
+ fclose( pTable );
+ }
+
fflush( stdout );
if ( pNtk->pExdc )
Abc_NtkPrintStats( pNtk->pExdc, fFactored, fSaveBest, fDumpResult, fUseLutLib, fPrintMuxes, fPower, fGlitch, fSkipBuf, fSkipSmall, fPrintMem );
@@ -1399,7 +1408,7 @@ void Abc_NtkPrintGates( Abc_Ntk_t * pNtk, int fUseLibrary, int fUpdateProfile )
// transform logic functions from BDD to SOP
if ( (fHasBdds = Abc_NtkIsBddLogic(pNtk)) )
{
- if ( !Abc_NtkBddToSop(pNtk, -1, ABC_INFINITY) )
+ if ( !Abc_NtkBddToSop(pNtk, -1, ABC_INFINITY, 1) )
{
printf( "Abc_NtkPrintGates(): Converting to SOPs has failed.\n" );
return;
diff --git a/src/base/abci/abcProve.c b/src/base/abci/abcProve.c
index 03722926..b14c0827 100644
--- a/src/base/abci/abcProve.c
+++ b/src/base/abci/abcProve.c
@@ -201,7 +201,7 @@ int Abc_NtkMiterProve( Abc_Ntk_t ** ppNtk, void * pPars )
fflush( stdout );
}
clk = Abc_Clock();
- pNtk = Abc_NtkCollapse( pNtkTemp = pNtk, pParams->nBddSizeLimit, 0, pParams->fBddReorder, 0, 0 );
+ pNtk = Abc_NtkCollapse( pNtkTemp = pNtk, pParams->nBddSizeLimit, 0, pParams->fBddReorder, 0, 0, 0 );
if ( pNtk )
{
Abc_NtkDelete( pNtkTemp );
diff --git a/src/base/abci/abcReorder.c b/src/base/abci/abcReorder.c
index cf8759c7..8557be1e 100644
--- a/src/base/abci/abcReorder.c
+++ b/src/base/abci/abcReorder.c
@@ -84,7 +84,7 @@ void Abc_NtkBddReorder( Abc_Ntk_t * pNtk, int fVerbose )
reo_man * p;
Abc_Obj_t * pNode;
int i;
- Abc_NtkRemoveDupFanins( pNtk );
+ //Abc_NtkRemoveDupFanins( pNtk );
Abc_NtkMinimumBase( pNtk );
p = Extra_ReorderInit( Abc_NtkGetFaninMax(pNtk), 100 );
Abc_NtkForEachNode( pNtk, pNode, i )
diff --git a/src/base/abci/abcStrash.c b/src/base/abci/abcStrash.c
index e4868d7e..d54957a6 100644
--- a/src/base/abci/abcStrash.c
+++ b/src/base/abci/abcStrash.c
@@ -548,25 +548,27 @@ Abc_Obj_t * Abc_NtkTopmost_rec( Abc_Ntk_t * pNtkNew, Abc_Obj_t * pNode, int Leve
Abc_Ntk_t * Abc_NtkTopmost( Abc_Ntk_t * pNtk, int nLevels )
{
Abc_Ntk_t * pNtkNew;
- Abc_Obj_t * pObjNew, * pObjPo;
- int LevelCut;
+ Abc_Obj_t * pObjNew, * pObj;
+ int LevelCut, i;
assert( Abc_NtkIsStrash(pNtk) );
- assert( Abc_NtkCoNum(pNtk) == 1 );
// get the cutoff level
LevelCut = Abc_MaxInt( 0, Abc_AigLevel(pNtk) - nLevels );
// start the network
pNtkNew = Abc_NtkAlloc( ABC_NTK_STRASH, ABC_FUNC_AIG, 1 );
pNtkNew->pName = Extra_UtilStrsav(pNtk->pName);
- Abc_AigConst1(pNtk)->pCopy = Abc_AigConst1(pNtkNew);
// create PIs below the cut and nodes above the cut
Abc_NtkCleanCopy( pNtk );
- pObjNew = Abc_NtkTopmost_rec( pNtkNew, Abc_ObjFanin0(Abc_NtkPo(pNtk, 0)), LevelCut );
- pObjNew = Abc_ObjNotCond( pObjNew, Abc_ObjFaninC0(Abc_NtkPo(pNtk, 0)) );
+ Abc_AigConst1(pNtk)->pCopy = Abc_AigConst1(pNtkNew);
+ Abc_NtkForEachCo( pNtk, pObj, i )
+ {
+ pObjNew = Abc_NtkTopmost_rec( pNtkNew, Abc_ObjFanin0(pObj), LevelCut );
+ pObjNew = Abc_ObjNotCond( pObjNew, Abc_ObjFaninC0(pObj) );
+ Abc_ObjAddFanin( (pObj->pCopy = Abc_NtkCreatePo(pNtkNew)), pObjNew );
+ }
// add the PO node and name
- pObjPo = Abc_NtkCreatePo(pNtkNew);
- Abc_ObjAddFanin( pObjPo, pObjNew );
Abc_NtkAddDummyPiNames( pNtkNew );
- Abc_ObjAssignName( pObjPo, Abc_ObjName(Abc_NtkPo(pNtk, 0)), NULL );
+ Abc_NtkForEachCo( pNtk, pObj, i )
+ Abc_ObjAssignName( pObj->pCopy, Abc_ObjName(pObj), NULL );
// make sure everything is okay
if ( !Abc_NtkCheck( pNtkNew ) )
{
@@ -578,6 +580,74 @@ Abc_Ntk_t * Abc_NtkTopmost( Abc_Ntk_t * pNtk, int nLevels )
}
+/**Function*************************************************************
+
+ Synopsis [Copies the bottommost levels of the network.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+Abc_Obj_t * Abc_NtkBottommost_rec( Abc_Ntk_t * pNtkNew, Abc_Obj_t * pNode, int LevelCut )
+{
+ assert( !Abc_ObjIsComplement(pNode) );
+ if ( pNode->pCopy )
+ return pNode->pCopy;
+ Abc_NtkBottommost_rec( pNtkNew, Abc_ObjFanin0(pNode), LevelCut );
+ Abc_NtkBottommost_rec( pNtkNew, Abc_ObjFanin1(pNode), LevelCut );
+ if ( pNode->Level > (unsigned)LevelCut )
+ return NULL;
+ return pNode->pCopy = Abc_AigAnd( (Abc_Aig_t *)pNtkNew->pManFunc, Abc_ObjChild0Copy(pNode), Abc_ObjChild1Copy(pNode) );
+}
+
+/**Function*************************************************************
+
+ Synopsis [Copies the topmost levels of the network.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+Abc_Ntk_t * Abc_NtkBottommost( Abc_Ntk_t * pNtk, int nLevels )
+{
+ Abc_Ntk_t * pNtkNew;
+ Abc_Obj_t * pObj, * pObjNew;
+ int i;
+ assert( Abc_NtkIsStrash(pNtk) );
+ assert( nLevels >= 0 );
+ // start the network
+ pNtkNew = Abc_NtkAlloc( ABC_NTK_STRASH, ABC_FUNC_AIG, 1 );
+ pNtkNew->pName = Extra_UtilStrsav(pNtk->pName);
+ // create PIs below the cut and nodes above the cut
+ Abc_NtkCleanCopy( pNtk );
+ Abc_AigConst1(pNtk)->pCopy = Abc_AigConst1(pNtkNew);
+ Abc_NtkForEachCi( pNtk, pObj, i )
+ pObj->pCopy = Abc_NtkCreatePi( pNtkNew );
+ Abc_NtkForEachCo( pNtk, pObj, i )
+ Abc_NtkBottommost_rec( pNtkNew, Abc_ObjFanin0(pObj), nLevels );
+ // add POs to nodes without fanout
+ Abc_NtkForEachNode( pNtkNew, pObjNew, i )
+ if ( Abc_ObjFanoutNum(pObjNew) == 0 )
+ Abc_ObjAddFanin( Abc_NtkCreatePo(pNtkNew), pObjNew );
+ Abc_NtkAddDummyPiNames( pNtkNew );
+ Abc_NtkAddDummyPoNames( pNtkNew );
+ // make sure everything is okay
+ if ( !Abc_NtkCheck( pNtkNew ) )
+ {
+ printf( "Abc_NtkBottommost: The network check has failed.\n" );
+ Abc_NtkDelete( pNtkNew );
+ return NULL;
+ }
+ return pNtkNew;
+}
+
+
/**Function*************************************************************
@@ -642,7 +712,7 @@ Vec_Ptr_t * Abc_NodeGetSuper( Abc_Obj_t * pNode )
Vec_PtrFree( vSuper );
vSuper = vFront;
// uniquify and return the frontier
- Vec_PtrUniqify( vSuper, (int (*)())Vec_CompareNodeIds );
+ Vec_PtrUniqify( vSuper, (int (*)(const void *, const void *))Vec_CompareNodeIds );
return vSuper;
}
diff --git a/src/base/abci/abcSweep.c b/src/base/abci/abcSweep.c
index e970ac38..3306a6af 100644
--- a/src/base/abci/abcSweep.c
+++ b/src/base/abci/abcSweep.c
@@ -619,7 +619,7 @@ int Abc_NtkSweep( Abc_Ntk_t * pNtk, int fVerbose )
nNodesOld = Abc_NtkNodeNum(pNtk);
Abc_NtkCleanup( pNtk, 0 );
// prepare nodes for sweeping
- Abc_NtkRemoveDupFanins(pNtk);
+ //Abc_NtkRemoveDupFanins(pNtk);
Abc_NtkMinimumBase(pNtk);
// collect sweepable nodes
vNodes = Vec_PtrAlloc( 100 );
@@ -649,7 +649,7 @@ int Abc_NtkSweep( Abc_Ntk_t * pNtk, int fVerbose )
Abc_NodeComplementInput( pFanout, pNode );
Abc_ObjPatchFanin( pFanout, pNode, pDriver );
}
- Abc_NodeRemoveDupFanins( pFanout );
+ //Abc_NodeRemoveDupFanins( pFanout );
Abc_NodeMinimumBase( pFanout );
// check if the fanout should be added
if ( Abc_ObjFaninNum(pFanout) < 2 )
@@ -888,7 +888,7 @@ int Abc_NtkReplaceAutonomousLogic( Abc_Ntk_t * pNtk )
Vec_PtrPush( vNodes, pFanin );
}
}
- Vec_PtrUniqify( vNodes, (int (*)(void))Abc_ObjPointerCompare );
+ Vec_PtrUniqify( vNodes, (int (*)(const void *, const void *))Abc_ObjPointerCompare );
// replace these nodes by the PIs
Vec_PtrForEachEntry( Abc_Obj_t *, vNodes, pNode, i )
{
diff --git a/src/base/abci/abcTiming.c b/src/base/abci/abcTiming.c
index ae0e7f45..84cda931 100644
--- a/src/base/abci/abcTiming.c
+++ b/src/base/abci/abcTiming.c
@@ -24,9 +24,11 @@
#include "base/main/main.h"
#include "map/mio/mio.h"
+
ABC_NAMESPACE_IMPL_START
+
////////////////////////////////////////////////////////////////////////
/// DECLARATIONS ///
////////////////////////////////////////////////////////////////////////
@@ -187,8 +189,9 @@ void Abc_NtkTimeSetDefaultRequired( Abc_Ntk_t * pNtk, float Rise, float Fall )
pNtk->pManTime->tReqDef.Rise = Rise;
pNtk->pManTime->tReqDef.Fall = Fall;
// set the required times for each output
- Abc_NtkForEachCo( pNtk, pObj, i )
- Abc_NtkTimeSetRequired( pNtk, Abc_ObjId(pObj), Rise, Fall );
+ Abc_NtkForEachCo( pNtk, pObj, i ){
+ Abc_NtkTimeSetRequired( pNtk, Abc_ObjId(pObj), Rise, Fall );
+ }
}
/**Function*************************************************************
@@ -206,6 +209,7 @@ void Abc_NtkTimeSetArrival( Abc_Ntk_t * pNtk, int ObjId, float Rise, float Fall
{
Vec_Ptr_t * vTimes;
Abc_Time_t * pTime;
+
if ( pNtk->pManTime == NULL )
pNtk->pManTime = Abc_ManTimeStart(pNtk);
Abc_ManTimeExpand( pNtk->pManTime, ObjId + 1, 1 );
@@ -214,6 +218,8 @@ void Abc_NtkTimeSetArrival( Abc_Ntk_t * pNtk, int ObjId, float Rise, float Fall
pTime = (Abc_Time_t *)vTimes->pArray[ObjId];
pTime->Rise = Rise;
pTime->Fall = Fall;
+
+
}
void Abc_NtkTimeSetRequired( Abc_Ntk_t * pNtk, int ObjId, float Rise, float Fall )
{
@@ -473,6 +479,7 @@ Abc_ManTime_t * Abc_ManTimeStart( Abc_Ntk_t * pNtk )
{
int fUseZeroDefaultOutputRequired = 1;
Abc_ManTime_t * p;
+ Abc_Time_t* pTime;
Abc_Obj_t * pObj; int i;
p = pNtk->pManTime = ABC_ALLOC( Abc_ManTime_t, 1 );
memset( p, 0, sizeof(Abc_ManTime_t) );
@@ -480,16 +487,49 @@ Abc_ManTime_t * Abc_ManTimeStart( Abc_Ntk_t * pNtk )
p->vReqs = Vec_PtrAlloc( 0 );
// set default default input=arrivals (assumed to be 0)
// set default default output-requireds (can be either 0 or +infinity, based on the flag)
- p->tReqDef.Rise = fUseZeroDefaultOutputRequired ? 0 : ABC_INFINITY;
- p->tReqDef.Fall = fUseZeroDefaultOutputRequired ? 0 : ABC_INFINITY;
+
// extend manager
Abc_ManTimeExpand( p, Abc_NtkObjNumMax(pNtk) + 1, 0 );
// set the default timing for CIs
- Abc_NtkForEachCi( pNtk, pObj, i )
- Abc_NtkTimeSetArrival( pNtk, Abc_ObjId(pObj), p->tArrDef.Rise, p->tArrDef.Rise );
- // set the default timing for COs
- Abc_NtkForEachCo( pNtk, pObj, i )
- Abc_NtkTimeSetRequired( pNtk, Abc_ObjId(pObj), p->tReqDef.Rise, p->tReqDef.Rise );
+ Abc_NtkForEachCi( pNtk, pObj, i ){
+
+ //get the constrained value, if there is one
+ Vec_Ptr_t * vTimes;
+ vTimes = pNtk->pManTime->vArrs;
+ pTime = (Abc_Time_t *)vTimes->pArray[Abc_ObjId(pObj)];
+ //unconstrained arrival defaults. Note that
+ //unconstrained value in vTimes set to -ABC_INFINITY.
+ if (pTime &&
+ (!(p-> tArrDef.Fall == -ABC_INFINITY ||
+ p-> tArrDef.Rise != -ABC_INFINITY ))
+ ){
+ p->tArrDef.Fall = pTime -> Fall;
+ p->tArrDef.Rise = pTime -> Rise;
+ }
+ else {
+ //use the default arrival time 0 (implicit in memset 0, above).
+ p->tArrDef.Rise = 0;
+ p->tArrDef.Fall = 0;
+ }
+ Abc_NtkTimeSetArrival( pNtk, Abc_ObjId(pObj), p->tArrDef.Rise, p->tArrDef.Rise );
+ }
+
+
+ Abc_NtkForEachCo( pNtk, pObj, i ){
+ Vec_Ptr_t * vTimes;
+ vTimes = pNtk->pManTime->vArrs;
+ pTime = (Abc_Time_t *)vTimes->pArray[Abc_ObjId(pObj)];
+ if (pTime){
+ p->tReqDef.Fall = pTime -> Fall;
+ p->tReqDef.Rise = pTime -> Rise;
+ }
+ else{
+ //use the default
+ p->tReqDef.Rise = fUseZeroDefaultOutputRequired ? 0 : ABC_INFINITY;
+ p->tReqDef.Fall = fUseZeroDefaultOutputRequired ? 0 : ABC_INFINITY;
+ }
+ Abc_NtkTimeSetRequired( pNtk, Abc_ObjId(pObj), p->tReqDef.Rise, p->tReqDef.Rise );
+ }
return p;
}
@@ -571,6 +611,8 @@ void Abc_ManTimeDup( Abc_Ntk_t * pNtkOld, Abc_Ntk_t * pNtkNew )
pNtkNew->pManTime->tOutLoad = ABC_ALLOC( Abc_Time_t, Abc_NtkCiNum(pNtkOld) );
memcpy( pNtkNew->pManTime->tOutLoad, pNtkOld->pManTime->tOutLoad, sizeof(Abc_Time_t) * Abc_NtkCoNum(pNtkOld) );
}
+
+
}
/**Function*************************************************************
diff --git a/src/base/abci/abcUnreach.c b/src/base/abci/abcUnreach.c
index ae4bc84b..5a20e5d8 100644
--- a/src/base/abci/abcUnreach.c
+++ b/src/base/abci/abcUnreach.c
@@ -342,7 +342,7 @@ Abc_Ntk_t * Abc_NtkConstructExdc( DdManager * dd, Abc_Ntk_t * pNtk, DdNode * bUn
Abc_NtkLogicMakeSimpleCos( pNtkNew, 0 );
// transform the network to the SOP representation
- if ( !Abc_NtkBddToSop( pNtkNew, -1, ABC_INFINITY ) )
+ if ( !Abc_NtkBddToSop( pNtkNew, -1, ABC_INFINITY, 1 ) )
{
printf( "Abc_NtkConstructExdc(): Converting to SOPs has failed.\n" );
return NULL;
diff --git a/src/base/abci/abcVerify.c b/src/base/abci/abcVerify.c
index 7199c529..f3e86746 100644
--- a/src/base/abci/abcVerify.c
+++ b/src/base/abci/abcVerify.c
@@ -781,6 +781,8 @@ void Abc_NtkVerifyReportError( Abc_Ntk_t * pNtk1, Abc_Ntk_t * pNtk2, int * pMode
Abc_NtkForEachCi( pNtk1, pNode, i )
pNode->pCopy = (Abc_Obj_t *)(ABC_PTRINT_T)i;
// print the model
+ if ( Vec_PtrSize(vNodes) )
+ {
pNode = (Abc_Obj_t *)Vec_PtrEntry( vNodes, 0 );
if ( Abc_ObjIsCi(pNode) )
{
@@ -790,6 +792,7 @@ void Abc_NtkVerifyReportError( Abc_Ntk_t * pNtk1, Abc_Ntk_t * pNtk2, int * pMode
printf( " %s=%d", Abc_ObjName(pNode), pModel[(int)(ABC_PTRINT_T)pNode->pCopy] );
}
}
+ }
printf( "\n" );
Vec_PtrFree( vNodes );
}
diff --git a/src/base/acb/acb.h b/src/base/acb/acb.h
index 9aed414c..0a188d0f 100644
--- a/src/base/acb/acb.h
+++ b/src/base/acb/acb.h
@@ -1019,6 +1019,12 @@ static inline void Acb_ManPrintStats( Acb_Man_t * p, int nModules, int fVerbose
extern Vec_Int_t * Acb_ObjCollectTfi( Acb_Ntk_t * p, int iObj, int fTerm );
extern Vec_Int_t * Acb_ObjCollectTfo( Acb_Ntk_t * p, int iObj, int fTerm );
+extern Vec_Int_t * Acb_ObjCollectTfiVec( Acb_Ntk_t * p, Vec_Int_t * vObjs );
+extern Vec_Int_t * Acb_ObjCollectTfoVec( Acb_Ntk_t * p, Vec_Int_t * vObjs );
+extern int Acb_NtkCountPiBuffers( Acb_Ntk_t * p, Vec_Int_t * vObjs );
+extern int Acb_NtkCountPoDrivers( Acb_Ntk_t * p, Vec_Int_t * vObjs );
+extern int Acb_NtkFindMffcSize( Acb_Ntk_t * p, Vec_Int_t * vObjsRefed, Vec_Int_t * vObjsDerefed, int nGates[5] );
+
extern int Acb_ObjComputeLevelD( Acb_Ntk_t * p, int iObj );
extern int Acb_NtkComputeLevelD( Acb_Ntk_t * p, Vec_Int_t * vTfo );
extern void Acb_NtkUpdateLevelD( Acb_Ntk_t * p, int iObj );
diff --git a/src/base/acb/acbFunc.c b/src/base/acb/acbFunc.c
index 8f72a00f..3c0bb5f0 100644
--- a/src/base/acb/acbFunc.c
+++ b/src/base/acb/acbFunc.c
@@ -35,8 +35,6 @@ ABC_NAMESPACE_IMPL_START
/// DECLARATIONS ///
////////////////////////////////////////////////////////////////////////
-#define ACB_LAST_NAME_ID 14
-
typedef enum {
ACB_NONE = 0, // 0: unused
ACB_MODULE, // 1: "module"
@@ -52,6 +50,8 @@ typedef enum {
ACB_NOR, // 11: "nor"
ACB_XOR, // 12: "xor"
ACB_XNOR, // 13: "xnor"
+ ACB_MUX, // 14: "_HMUX"
+ ACB_DC, // 15: "_DC"
ACB_UNUSED // 14: unused
} Acb_KeyWords_t;
@@ -70,6 +70,8 @@ static inline char * Acb_Num2Name( int i )
if ( i == 11 ) return "nor";
if ( i == 12 ) return "xor";
if ( i == 13 ) return "xnor";
+ if ( i == 14 ) return "_HMUX";
+ if ( i == 15 ) return "_DC";
return NULL;
}
@@ -83,6 +85,8 @@ static inline int Acb_Type2Oper( int i )
if ( i == 11 ) return ABC_OPER_BIT_NOR;
if ( i == 12 ) return ABC_OPER_BIT_XOR;
if ( i == 13 ) return ABC_OPER_BIT_NXOR;
+ if ( i == 14 ) return ABC_OPER_BIT_MUX;
+ if ( i == 15 ) return ABC_OPER_TRI;
assert( 0 );
return -1;
}
@@ -91,6 +95,7 @@ static inline char * Acb_Oper2Name( int i )
{
if ( i == ABC_OPER_CONST_F ) return "const0";
if ( i == ABC_OPER_CONST_T ) return "const1";
+ if ( i == ABC_OPER_CONST_X ) return "constX";
if ( i == ABC_OPER_BIT_BUF ) return "buf";
if ( i == ABC_OPER_BIT_INV ) return "not";
if ( i == ABC_OPER_BIT_AND ) return "and";
@@ -99,6 +104,8 @@ static inline char * Acb_Oper2Name( int i )
if ( i == ABC_OPER_BIT_NOR ) return "nor";
if ( i == ABC_OPER_BIT_XOR ) return "xor";
if ( i == ABC_OPER_BIT_NXOR ) return "xnor";
+ if ( i == ABC_OPER_BIT_MUX ) return "mux";
+ if ( i == ABC_OPER_TRI ) return "_DC";
assert( 0 );
return NULL;
}
@@ -138,15 +145,28 @@ char * pLibStr[25] = {
"GATE zero 0 O=CONST0;\n"
"GATE one 0 O=CONST1;\n"
};
-void Acb_IntallLibrary()
+char * pLibStr2[25] = {
+ "GATE buf 1 O=a; PIN * INV 1 999 1.0 0.0 1.0 0.0\n"
+ "GATE inv 1 O=!a; PIN * INV 1 999 1.0 0.0 1.0 0.0\n"
+ "GATE and2 1 O=a*b; PIN * INV 1 999 1.0 0.0 1.0 0.0\n"
+ "GATE or2 1 O=a+b; PIN * INV 1 999 1.0 0.0 1.0 0.0\n"
+ "GATE nand2 1 O=!(a*b); PIN * INV 1 999 1.0 0.0 1.0 0.0\n"
+ "GATE nor2 1 O=!(a+b); PIN * INV 1 999 1.0 0.0 1.0 0.0\n"
+ "GATE xor 1 O=!a*b+a*!b; PIN * INV 1 999 1.0 0.0 1.0 0.0\n"
+ "GATE xnor 1 O=a*b+!a*!b; PIN * INV 1 999 1.0 0.0 1.0 0.0\n"
+ "GATE zero 0 O=CONST0;\n"
+ "GATE one 0 O=CONST1;\n"
+};
+void Acb_IntallLibrary( int f2Ins )
{
extern Mio_Library_t * Mio_LibraryReadBuffer( char * pBuffer, int fExtendedFormat, st__table * tExcludeGate, int fVerbose );
Mio_Library_t * pLib;
int i;
// create library string
Vec_Str_t * vLibStr = Vec_StrAlloc( 1000 );
- for ( i = 0; pLibStr[i]; i++ )
- Vec_StrAppend( vLibStr, pLibStr[i] );
+ char ** ppLibStr = f2Ins ? pLibStr2 : pLibStr;
+ for ( i = 0; ppLibStr[i]; i++ )
+ Vec_StrAppend( vLibStr, ppLibStr[i] );
Vec_StrPush( vLibStr, '\0' );
// create library
pLib = Mio_LibraryReadBuffer( Vec_StrArray(vLibStr), 0, NULL, 0 );
@@ -190,17 +210,78 @@ Vec_Int_t * Acb_VerilogSimpleLex( char * pFileName, Abc_Nam_t * pNames )
Vec_Int_t * vBuffer = Vec_IntAlloc( 1000 );
char * pBuffer = Extra_FileReadContents( pFileName );
char * pToken, * pStart, * pLimit = pBuffer + strlen(pBuffer);
+ int i, iToken, RLeft = -1, RRight = -1;
if ( pBuffer == NULL )
return NULL;
Acb_VerilogRemoveComments( pBuffer );
pToken = strtok( pBuffer, " \n\r\t(),;=" );
while ( pToken )
{
- int iToken = Abc_NamStrFindOrAdd( pNames, pToken, NULL );
+ if ( 0 )
+ {
+ if ( !strcmp(pToken, "assign") )
+ {
+ int fBuffer = 0;
+ int nToks = 0, pToks[4];
+ while ( 1 )
+ {
+ pToken = strtok( NULL, " \n\r\t(),=~&" );
+ if ( pToken[0] == ';' )
+ break;
+ if ( pToken[strlen(pToken)-1] == ';' )
+ {
+ pToken[strlen(pToken)-1] = 0;
+ assert( nToks < 3 );
+ pToks[nToks++] = Abc_NamStrFindOrAdd( pNames, pToken, NULL );
+ fBuffer = 1;
+ break;
+ }
+ else
+ {
+ assert( nToks < 3 );
+ pToks[nToks++] = Abc_NamStrFindOrAdd( pNames, pToken, NULL );
+ }
+ }
+ assert( nToks == 2 || nToks == 3 );
+ Vec_IntPush( vBuffer, fBuffer ? ACB_AND : ACB_NAND );
+ Vec_IntPush( vBuffer, pToks[0] );
+ Vec_IntPush( vBuffer, pToks[1] );
+ Vec_IntPush( vBuffer, nToks == 3 ? pToks[2] : pToks[1] );
+ pToken = strtok( NULL, " \n\r\t(),;=" );
+ continue;
+ }
+ }
+
+ if ( pToken[0] == '[' )
+ {
+ assert( RLeft == -1 );
+ RLeft = atoi(pToken+1);
+ RRight = atoi(strstr(pToken,":")+1);
+ pToken = strtok( NULL, " \n\r\t(),;=" );
+ continue;
+ }
+ if ( pToken[0] == '\\' )
+ pToken++;
if ( !strcmp(pToken, "assign") )
- Vec_IntPush( vBuffer, ACB_BUF );
+ iToken = ACB_BUF;
else
- Vec_IntPush( vBuffer, iToken );
+ iToken = Abc_NamStrFindOrAdd( pNames, pToken, NULL );
+ if ( iToken < ACB_UNUSED )
+ RLeft = RRight = -1;
+ else if ( RLeft != -1 )
+ {
+ char Buffer[1000];
+ assert( strlen(pToken) < 990 );
+ for ( i = RRight; i <= RLeft; i++ )
+ {
+ sprintf( Buffer, "%s[%d]", pToken, i );
+ iToken = Abc_NamStrFindOrAdd( pNames, Buffer, NULL );
+ Vec_IntPush( vBuffer, iToken );
+ }
+ pToken = strtok( NULL, " \n\r\t(),;=" );
+ continue;
+ }
+ Vec_IntPush( vBuffer, iToken );
if ( iToken >= ACB_BUF && iToken < ACB_UNUSED )
{
for ( pStart = pToken; pStart < pLimit && *pStart != '\n'; pStart++ )
@@ -245,14 +326,11 @@ void * Acb_VerilogSimpleParse( Vec_Int_t * vBuffer, Abc_Nam_t * pNames )
vCur = vOutputs;
else if ( Token == ACB_WIRE )
vCur = vWires;
- else if ( Token >= ACB_BUF && Token <= ACB_XNOR )
+ else if ( Token >= ACB_BUF && Token < ACB_UNUSED )
{
- //char * pToken = Abc_NamStr(pNames, Vec_IntEntry(vBuffer, i+1));
Vec_IntPush( vTypes, Token );
Vec_IntPush( vTypes, Vec_IntSize(vFanins) );
vCur = vFanins;
- //if ( pToken[1] == 'z' && pToken[2] == '_' && pToken[3] == 'g' && pToken[4] == '_' )
- // i++;
}
else
Vec_IntPush( vCur, Token );
@@ -288,6 +366,8 @@ void * Acb_VerilogSimpleParse( Vec_Int_t * vBuffer, Abc_Nam_t * pNames )
Ndr_AddObject( pDesign, ModuleID, ABC_OPER_CONST_F, 0, 0, 0, 0, 0, NULL, 1, &Token, NULL ); // no fanins
if ( (Token = Abc_NamStrFind(pNames, "1\'b1")) )
Ndr_AddObject( pDesign, ModuleID, ABC_OPER_CONST_T, 0, 0, 0, 0, 0, NULL, 1, &Token, NULL ); // no fanins
+ if ( (Token = Abc_NamStrFind(pNames, "1\'bx")) )
+ Ndr_AddObject( pDesign, ModuleID, ABC_OPER_CONST_X, 0, 0, 0, 0, 0, NULL, 1, &Token, NULL ); // no fanins
Vec_IntForEachEntryDouble( vTypes, Token, Size, i )
if ( Token > 0 )
{
@@ -309,6 +389,182 @@ void * Acb_VerilogSimpleParse( Vec_Int_t * vBuffer, Abc_Nam_t * pNames )
/**Function*************************************************************
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+int Gia_FileSimpleParse_rec( Gia_Man_t * pNew, int Token, Vec_Int_t * vMapType, Vec_Int_t * vTypes, Vec_Int_t * vFanins, Vec_Int_t * vMap )
+{
+ int nFanins, * pFanins, pLits[16];
+ int i, Type, Size, Place = Vec_IntEntry( vMapType, Token );
+ int iLit = Vec_IntEntry( vMap, Token );
+ if ( iLit >= 0 )
+ return iLit;
+ Place = Vec_IntEntry( vMapType, Token );
+ assert( Place >= 0 );
+ Type = Vec_IntEntry( vTypes, Place );
+ Size = Vec_IntEntry( vTypes, Place+1 );
+ nFanins = Vec_IntEntry(vTypes, Place+3) - Size - 1;
+ pFanins = Vec_IntEntryP(vFanins, Size+1);
+ assert( nFanins > 0 && nFanins < 16 );
+ for ( i = 0; i < nFanins; i++ )
+ Gia_FileSimpleParse_rec( pNew, pFanins[i], vMapType, vTypes, vFanins, vMap );
+ for ( i = 0; i < nFanins; i++ )
+ pLits[i] = Vec_IntEntry( vMap, pFanins[i] );
+ if ( nFanins == 1 )
+ {
+ assert( Type == ACB_BUF || Type == ACB_NOT );
+ iLit = Abc_LitNotCond( pLits[0], Type == ACB_NOT );
+ iLit = Gia_ManAppendAnd2( pNew, iLit, iLit );
+ }
+ else
+ {
+ iLit = pLits[0];
+ if ( Type == ACB_AND || Type == ACB_NAND )
+ for ( i = 1; i < nFanins; i++ )
+ iLit = Gia_ManAppendAnd2( pNew, iLit, pLits[i] );
+ else if ( Type == ACB_OR || Type == ACB_NOR )
+ for ( i = 1; i < nFanins; i++ )
+ iLit = Gia_ManAppendOr2( pNew, iLit, pLits[i] );
+ else if ( Type == ACB_XOR || Type == ACB_XNOR )
+ for ( i = 1; i < nFanins; i++ )
+ iLit = Gia_ManAppendXor2( pNew, iLit, pLits[i] );
+ else assert( 0 );
+ iLit = Abc_LitNotCond( iLit, (Type == ACB_NAND || Type == ACB_NOR || Type == ACB_XNOR) );
+ }
+ Vec_IntWriteEntry( vMap, Token, iLit );
+ return iLit;
+}
+Gia_Man_t * Gia_FileSimpleParse( Vec_Int_t * vBuffer, Abc_Nam_t * pNames, int fNames, char * pFileW )
+{
+ Gia_Man_t * pNew = NULL;
+ Vec_Int_t * vInputs = Vec_IntAlloc(100);
+ Vec_Int_t * vOutputs = Vec_IntAlloc(100);
+ Vec_Int_t * vWires = Vec_IntAlloc(100);
+ Vec_Int_t * vTypes = Vec_IntAlloc(100);
+ Vec_Int_t * vFanins = Vec_IntAlloc(100);
+ Vec_Int_t * vCur = NULL;
+ Vec_Int_t * vMap = Vec_IntStartFull( Abc_NamObjNumMax(pNames) );
+ Vec_Int_t * vMapType = Vec_IntStartFull( Abc_NamObjNumMax(pNames) );
+ int i, iLit, Token, Size;
+ char Buffer[1000];
+ assert( Vec_IntEntry(vBuffer, 0) == ACB_MODULE );
+ Vec_IntForEachEntryStart( vBuffer, Token, i, 2 )
+ {
+ if ( vCur == NULL && Token >= ACB_UNUSED )
+ continue;
+ if ( Token == ACB_ENDMODULE )
+ break;
+ if ( Token == ACB_INPUT )
+ vCur = vInputs;
+ else if ( Token == ACB_OUTPUT )
+ vCur = vOutputs;
+ else if ( Token == ACB_WIRE )
+ vCur = vWires;
+ else if ( Token >= ACB_BUF && Token < ACB_UNUSED )
+ {
+ Vec_IntPush( vTypes, Token );
+ Vec_IntPush( vTypes, Vec_IntSize(vFanins) );
+ vCur = vFanins;
+ }
+ else if ( pFileW && vCur == vWires && Abc_NamStr(pNames, Token)[0] == 't' )
+ Vec_IntPush( vInputs, Token );
+ else
+ Vec_IntPush( vCur, Token );
+ }
+ Vec_IntPush( vTypes, -1 );
+ Vec_IntPush( vTypes, Vec_IntSize(vFanins) );
+ // map types
+ Vec_IntForEachEntryDouble( vTypes, Token, Size, i )
+ if ( Token > 0 )
+ Vec_IntWriteEntry( vMapType, Vec_IntEntry(vFanins, Size), i );
+ // create design
+ pNew = Gia_ManStart( 10000 );
+ pNew->pName = Abc_UtilStrsav( Abc_NamStr(pNames, Vec_IntEntry(vBuffer, 1)) );
+ pNew->fGiaSimple = 1;
+ if ( (Token = Abc_NamStrFind(pNames, "1\'b0")) )
+ Vec_IntWriteEntry( vMap, Token, 0 );
+ if ( (Token = Abc_NamStrFind(pNames, "1\'b1")) )
+ Vec_IntWriteEntry( vMap, Token, 1 );
+ if ( (Token = Abc_NamStrFind(pNames, "1\'bx")) )
+ Vec_IntWriteEntry( vMap, Token, 0 );
+ if ( (Token = Abc_NamStrFind(pNames, "1\'bz")) )
+ Vec_IntWriteEntry( vMap, Token, 0 );
+ Vec_IntForEachEntry( vInputs, Token, i )
+ Gia_ManAppendCi(pNew);
+ Vec_IntForEachEntry( vInputs, Token, i )
+ Vec_IntWriteEntry( vMap, Token, Gia_ManAppendAnd2(pNew, Gia_ManCiLit(pNew, i), Gia_ManCiLit(pNew, i)) );
+ Vec_IntForEachEntry( vOutputs, Token, i )
+ Gia_FileSimpleParse_rec( pNew, Token, vMapType, vTypes, vFanins, vMap );
+ Vec_IntForEachEntry( vOutputs, Token, i )
+ Gia_ManAppendCo( pNew, Vec_IntEntry(vMap, Token) );
+ // create names
+ if ( fNames )
+ {
+ pNew->vPolars = Vec_BitStart( Gia_ManObjNum(pNew) );
+ pNew->vNamesNode = Vec_PtrStart( Gia_ManObjNum(pNew) );
+ Vec_IntForEachEntry( vMap, iLit, Token )
+ {
+ if ( iLit == -1 || !Gia_ObjIsAnd(Gia_ManObj(pNew, Abc_Lit2Var(iLit))) )
+ continue;
+ sprintf( Buffer, "%c_%s", Abc_LitIsCompl(iLit) ? 'c' : 'd', Abc_NamStr(pNames, Token) );
+ assert( Vec_PtrEntry(pNew->vNamesNode, Abc_Lit2Var(iLit)) == NULL );
+ Vec_PtrWriteEntry( pNew->vNamesNode, Abc_Lit2Var(iLit), Abc_UtilStrsav(Buffer) );
+ Vec_BitWriteEntry( pNew->vPolars, Abc_Lit2Var(iLit), Abc_LitIsCompl(iLit) );
+ }
+ }
+ else
+ {
+ Gia_Man_t * pTemp;
+ pNew = Gia_ManDupDfsRehash( pTemp = pNew );
+ Gia_ManStop( pTemp );
+ }
+ pNew->vNamesIn = Vec_PtrAlloc( Vec_IntSize(vInputs) );
+ Vec_IntForEachEntry( vInputs, Token, i )
+ Vec_PtrPush( pNew->vNamesIn, Abc_UtilStrsav(Abc_NamStr(pNames, Token)) );
+ pNew->vNamesOut = Vec_PtrAlloc( Vec_IntSize(vOutputs) );
+ Vec_IntForEachEntry( vOutputs, Token, i )
+ Vec_PtrPush( pNew->vNamesOut, Abc_UtilStrsav(Abc_NamStr(pNames, Token)) );
+ if ( pFileW && fNames )
+ {
+ extern Vec_Int_t * Acb_ReadWeightMap( char * pFileName, Abc_Nam_t * pNames );
+ Vec_Int_t * vT2W = Acb_ReadWeightMap( pFileW, pNames );
+ assert( pNew->vWeights == NULL );
+ pNew->vWeights = Vec_IntStartFull( Gia_ManObjNum(pNew) );
+ Vec_IntForEachEntry( vMap, iLit, Token )
+ if ( iLit != -1 && Vec_IntEntry(vT2W, Token) != -1 )
+ Vec_IntWriteEntry( pNew->vWeights, Abc_Lit2Var(iLit), Vec_IntEntry(vT2W, Token) );
+ Vec_IntFree( vT2W );
+ }
+ // cleanup
+ Vec_IntFree( vInputs );
+ Vec_IntFree( vOutputs );
+ Vec_IntFree( vWires );
+ Vec_IntFree( vTypes );
+ Vec_IntFree( vFanins );
+ Vec_IntFree( vMap );
+ Vec_IntFree( vMapType );
+ return pNew;
+}
+Gia_Man_t * Gia_FileSimpleRead( char * pFileName, int fNames, char * pFileW )
+{
+ Abc_Nam_t * pNames = Acb_VerilogStartNames();
+ Vec_Int_t * vBuffer = Acb_VerilogSimpleLex( pFileName, pNames );
+ Gia_Man_t * pNew = vBuffer ? Gia_FileSimpleParse( vBuffer, pNames, fNames, pFileW ) : NULL;
+ assert( pNew->pSpec == NULL );
+ pNew->pSpec = Abc_UtilStrsav( pFileName );
+ Abc_NamDeref( pNames );
+ Vec_IntFree( vBuffer );
+ return pNew;
+}
+
+/**Function*************************************************************
+
Synopsis [Read weights of nodes from the weight file.]
Description []
@@ -355,10 +611,18 @@ Vec_Int_t * Acb_ReadWeightMap( char * pFileName, Abc_Nam_t * pNames )
SeeAlso []
***********************************************************************/
+char ** Acb_PrepareNames( Abc_Nam_t * p )
+{
+ char ** ppRes = ABC_CALLOC( char *, Abc_NamObjNumMax(p) );
+ int i;
+ for ( i = 0; i < Abc_NamObjNumMax(p); i++ )
+ ppRes[i] = Abc_NamStr( p, i );
+ return ppRes;
+}
Acb_Ntk_t * Acb_VerilogSimpleRead( char * pFileName, char * pFileNameW )
{
extern Acb_Ntk_t * Acb_NtkFromNdr( char * pFileName, void * pModule, Abc_Nam_t * pNames, Vec_Int_t * vWeights, int nNameIdMax );
- Acb_Ntk_t * pNtk;
+ Acb_Ntk_t * pNtk;
Abc_Nam_t * pNames = Acb_VerilogStartNames();
Vec_Int_t * vBuffer = Acb_VerilogSimpleLex( pFileName, pNames );
void * pModule = vBuffer ? Acb_VerilogSimpleParse( vBuffer, pNames ) : NULL;
@@ -373,7 +637,12 @@ Acb_Ntk_t * Acb_VerilogSimpleRead( char * pFileName, char * pFileNameW )
printf( "Cannot read weight file \"%s\".\n", pFileNameW );
return NULL;
}
-// Ndr_ModuleWriteVerilog( "iccad17/unit1/test.v", pModule, pNameStrs );
+ if ( 0 )
+ {
+ char ** ppNames = Acb_PrepareNames(pNames);
+ Ndr_WriteVerilog( Extra_FileNameGenericAppend(pFileName, "_ndr.v"), pModule, ppNames, 1 );
+ ABC_FREE( ppNames );
+ }
pNtk = Acb_NtkFromNdr( pFileName, pModule, pNames, vWeights, Abc_NamObjNumMax(pNames) );
Ndr_Delete( pModule );
Vec_IntFree( vBuffer );
@@ -381,6 +650,11 @@ Acb_Ntk_t * Acb_VerilogSimpleRead( char * pFileName, char * pFileNameW )
Abc_NamDeref( pNames );
return pNtk;
}
+void Acb_VerilogSimpleReadTest( char * pFileName )
+{
+ Acb_Ntk_t * p = Acb_VerilogSimpleRead( pFileName, NULL );
+ Acb_NtkFree( p );
+}
/**Function*************************************************************
@@ -440,7 +714,10 @@ void Acb_VerilogSimpleWrite( Acb_Ntk_t * p, char * pFileName )
{
assert( Acb_ObjType(p, iObj) == ABC_OPER_CONST_F || Acb_ObjType(p, iObj) == ABC_OPER_CONST_T );
fprintf( pFile, " %s (", Acb_Oper2Name( ABC_OPER_BIT_BUF ) );
- fprintf( pFile, " 1\'b%d", Acb_ObjType(p, iObj) == ABC_OPER_CONST_T );
+ if ( Acb_ObjType(p, iObj) == ABC_OPER_CONST_X )
+ fprintf( pFile, " 1\'bx" );
+ else
+ fprintf( pFile, " 1\'b%d", Acb_ObjType(p, iObj) == ABC_OPER_CONST_T );
fprintf( pFile, " );\n" );
}
@@ -579,12 +856,18 @@ Vec_Int_t * Acb_NtkFindDivsCis( Acb_Ntk_t * p, Vec_Int_t * vSupp )
printf( "Divisors are %d support variables (CIs in the TFO of the targets).\n", Vec_IntSize(vSupp) );
return vDivs;
}
-Vec_Int_t * Acb_NtkFindDivs( Acb_Ntk_t * p, Vec_Int_t * vSupp, Vec_Bit_t * vBlock, int fVerbose )
+Vec_Int_t * Acb_NtkFindDivs( Acb_Ntk_t * p, Vec_Int_t * vSupp, Vec_Bit_t * vBlock, int fUnitW, int fVerbose )
{
int fPrintWeights = 0;
int nDivLimit = 5000;
int i, iObj;
Vec_Int_t * vDivs = Vec_IntAlloc( 1000 );
+ if ( fUnitW )
+ {
+ Acb_NtkForEachNode( p, iObj )
+ if ( Acb_ObjWeight(p, iObj) > 0 )
+ Vec_IntWriteEntry( &p->vObjWeight, iObj, 1 );
+ }
// mark inputs
Acb_NtkIncTravId( p );
Acb_NtkForEachCiVec( vSupp, p, iObj, i )
@@ -754,6 +1037,31 @@ Gia_Man_t * Acb_NtkToGia( Acb_Ntk_t * p, Vec_Int_t * vSupp, Vec_Int_t * vNodes,
Gia_ManStop( pOne );
return pNew;
}
+int Acb_NtkSaveNames( Acb_Ntk_t * p, Vec_Int_t * vSupp, Vec_Int_t * vNodes, Vec_Int_t * vRoots, Vec_Int_t * vDivs, Vec_Int_t * vTargets, Gia_Man_t * pNew )
+{
+ int i, iObj;
+ assert( pNew->vNamesIn == NULL );
+
+ pNew->vNamesIn = Vec_PtrAlloc( Gia_ManCiNum(pNew) );
+ Acb_NtkForEachCiVec( vSupp, p, iObj, i )
+ Vec_PtrPush( pNew->vNamesIn, Abc_UtilStrsav(Acb_ObjNameStr(p, iObj)) );
+ if ( vTargets )
+ Vec_IntForEachEntry( vTargets, iObj, i )
+ Vec_PtrPush( pNew->vNamesIn, Abc_UtilStrsav(Acb_ObjNameStr(p, iObj)) );
+
+ pNew->vNamesOut = Vec_PtrAlloc( Gia_ManCoNum(pNew) );
+ Acb_NtkForEachCoDriverVec( vRoots, p, iObj, i )
+ Vec_PtrPush( pNew->vNamesOut, Abc_UtilStrsav(Acb_ObjNameStr(p, iObj)) );
+ if ( vDivs )
+ Vec_IntForEachEntry( vDivs, iObj, i )
+ {
+ char Buffer[100];
+ assert( strlen(Acb_ObjNameStr(p, iObj)) < 90 );
+ sprintf( Buffer, "%s_%d", Acb_ObjNameStr(p, iObj), Acb_ObjWeight(p, iObj) );
+ Vec_PtrPush( pNew->vNamesOut, Abc_UtilStrsav(Buffer) );
+ }
+ return 1;
+}
/**Function*************************************************************
@@ -825,6 +1133,21 @@ void Vec_IntPermute( Vec_Int_t * p )
}
}
+void Vec_IntPermute2( Vec_Int_t * p )
+{
+ int i, nSize = Vec_IntSize( p );
+ int * pArray = Vec_IntArray( p );
+ srand( time(NULL) );
+ for ( i = 0; i < nSize-1; i++ )
+ {
+ if ( rand() % 3 == 0 )
+ {
+ printf( "Permuting %d and %d\n", i, i+1 );
+ ABC_SWAP( int, pArray[i], pArray[i+1] );
+ }
+ }
+}
+
void Acb_PrintPatterns( Vec_Wrd_t * vPats, int nPats, Vec_Int_t * vWeights )
{
int i, k, Entry, nDivs = Vec_IntSize(vWeights);
@@ -1541,7 +1864,7 @@ char * Acb_EnumerateSatAssigns( sat_solver * pSat, int PivotVar, int FreeVar, Ve
{
if ( iMint == 1000 )
{
- //if ( Vec_IntSize(vDivVars) == 0 )
+ if ( Vec_IntSize(vDivVars) == 0 )
{
printf( "Assuming constant 0 function.\n" );
Vec_StrClear( vTempSop );
@@ -1897,34 +2220,66 @@ Vec_Ptr_t * Acb_GenerateSignalNames( Acb_Ntk_t * p, Vec_Int_t * vDivs, Vec_Int_t
Vec_StrFree( vStr );
return vRes;
}
+Vec_Int_t * Acb_GetUsedDivs( Vec_Int_t * vDivs, Vec_Int_t * vUsed )
+{
+ int i, iObj;
+ Vec_Int_t * vRes = Vec_IntAlloc( Vec_IntSize(vUsed) );
+ Vec_IntForEachEntryInVec( vDivs, vUsed, iObj, i )
+ Vec_IntPush( vRes, iObj );
+ return vRes;
+}
+Vec_Ptr_t * Acb_SignalNames( Acb_Ntk_t * p, Vec_Int_t * vObjs )
+{
+ Vec_Ptr_t * vNames = Vec_PtrAlloc( Vec_IntSize(vObjs) );
+ int i, iObj;
+ Vec_IntForEachEntry( vObjs, iObj, i )
+ Vec_PtrPush( vNames, Acb_ObjNameStr(p, iObj) );
+ return vNames;
+}
Vec_Str_t * Acb_GeneratePatch( Acb_Ntk_t * p, Vec_Int_t * vDivs, Vec_Int_t * vUsed, Vec_Ptr_t * vSops, Vec_Ptr_t * vGias, Vec_Int_t * vTars )
{
+ extern int Acb_NtkCollectMfsGates( char * pFileName, Vec_Ptr_t * vNamesRefed, Vec_Ptr_t * vNamesDerefed, int nGates1[5] );
extern Vec_Wec_t * Abc_SopSynthesize( Vec_Ptr_t * vSops );
extern Vec_Wec_t * Abc_GiaSynthesize( Vec_Ptr_t * vGias, Gia_Man_t * pMulti );
Vec_Wec_t * vGates = vGias ? Abc_GiaSynthesize(vGias, NULL) : Abc_SopSynthesize(vSops); Vec_Int_t * vGate;
int nOuts = vGias ? Vec_PtrSize(vGias) : Vec_PtrSize(vSops);
int i, k, iObj, nWires = Vec_WecSize(vGates) - Vec_IntSize(vUsed) - nOuts, fFirst = 1;
+ int nGates1[5] = {0}, nGates0[5] = {0};
Vec_Ptr_t * vNames = Acb_GenerateSignalNames( p, vDivs, vUsed, nWires, vTars, vGates );
Vec_Str_t * vStr = Vec_StrAlloc( 100 );
-
- int nInvs = 0, nBufs = 0, nNodes = 0, nConst = 0;
+ Vec_Int_t * vSup = Acb_GetUsedDivs( vDivs, vUsed );
+ Vec_Ptr_t * vSpN = Acb_SignalNames( p, vSup );
+ Vec_Int_t * vTfi = Acb_ObjCollectTfiVec( p, vSup );
+ Vec_Int_t * vTfo = Acb_ObjCollectTfoVec( p, vTars );
+ int nPiCount = Acb_NtkCountPiBuffers( p, vSup );
+ int nPoCount = Acb_NtkCountPoDrivers( p, vTars );
+ int nMffc = Abc_FrameReadSpecName() ? Acb_NtkCollectMfsGates( Abc_FrameReadSpecName(), vSpN, Abc_FrameReadSignalNames(), nGates1 ) : 0;
+ Vec_PtrFree( vSpN );
+ Vec_IntFree( vSup );
Vec_WecForEachLevelStartStop( vGates, vGate, i, Vec_IntSize(vUsed), Vec_IntSize(vUsed)+nWires )
{
if ( Vec_IntSize(vGate) > 2 )
{
char * pName = Acb_Oper2Name(Vec_IntEntry(vGate, 0));
if ( !strcmp(pName, "buf") )
- nBufs++;
+ nGates0[2]++;
else if ( !strcmp(pName, "not") )
- nInvs++;
+ nGates0[3]++;
else
- nNodes++;
+ nGates0[4] += Vec_IntSize(vGate) - 3;
}
else
- nConst++;
+ nGates0[Vec_IntEntry(vGate, 0) == ABC_OPER_CONST_T]++;
}
- Vec_StrPrintF( vStr, "// Patch statistics: in = %d out = %d gate = %d (const = %d buf = %d inv = %d other = %d)\n\n",
- Vec_IntSize(vUsed), nOuts, nWires, nConst, nBufs, nInvs, nNodes );
+
+ Vec_StrPrintF( vStr, "// Patch : in = %d out = %d : pi_in = %d po_out = %d : tfi = %d tfo = %d\n", Vec_IntSize(vUsed), nOuts, nPiCount, nPoCount, Vec_IntSize(vTfi), Vec_IntSize(vTfo) );
+ Vec_StrPrintF( vStr, "// Added : gate =%4d : c0 =%2d c1 =%2d buf =%3d inv =%3d two-input =%4d\n", nWires, nGates0[0], nGates0[1], nGates0[2], nGates0[3], nGates0[4] );
+ if ( Abc_FrameReadSpecName() )
+ Vec_StrPrintF( vStr, "// Removed : gate =%4d : c0 =%2d c1 =%2d buf =%3d inv =%3d two-input =%4d\n", nMffc, nGates1[0], nGates1[1], nGates1[2], nGates1[3], nGates1[4] );
+ if ( Abc_FrameReadSpecName() )
+ Vec_StrPrintF( vStr, "// TOTAL : gate =%4d : c0 =%2d c1 =%2d buf =%3d inv =%3d two-input =%4d\n", nWires-nMffc, nGates0[0]-nGates1[0], nGates0[1]-nGates1[1], nGates0[2]-nGates1[2], nGates0[3]-nGates1[3], nGates0[4]-nGates1[4] );
+ Vec_StrPrintF( vStr, "\n" );
+
Vec_StrAppend( vStr, "module patch (" );
assert( Vec_IntSize(vTars) == nOuts );
@@ -1980,8 +2335,17 @@ Vec_Str_t * Acb_GeneratePatch( Acb_Ntk_t * p, Vec_Int_t * vDivs, Vec_Int_t * vUs
Vec_PtrFreeFree( vNames );
Vec_WecFree( vGates );
- printf( "Synthesized patch with %d inputs, %d outputs and %d gates (const = %d buf = %d inv = %d other = %d).\n",
- Vec_IntSize(vUsed), nOuts, nWires, nConst, nBufs, nInvs, nNodes );
+// printf( "Synthesized patch with %d inputs, %d outputs and %d gates (const = %d buf = %d inv = %d other = %d).\n",
+// Vec_IntSize(vUsed), nOuts, nWires, nConst, nBufs, nInvs, nNodes );
+// printf( "Summary of the results\n" );
+ printf( "\n" );
+ printf( "Patch : in = %d out = %d : pi_in = %d po_out = %d : tfi = %d tfo = %d\n", Vec_IntSize(vUsed), nOuts, nPiCount, nPoCount, Vec_IntSize(vTfi), Vec_IntSize(vTfo) );
+ printf( "Added : gate =%4d : c0 =%2d c1 =%2d buf =%3d inv =%3d two-input =%4d\n", nWires, nGates0[0], nGates0[1], nGates0[2], nGates0[3], nGates0[4] );
+ if ( Abc_FrameReadSpecName() )
+ printf( "Removed : gate =%4d : c0 =%2d c1 =%2d buf =%3d inv =%3d two-input =%4d\n", nMffc, nGates1[0], nGates1[1], nGates1[2], nGates1[3], nGates1[4] );
+ if ( Abc_FrameReadSpecName() )
+ printf( "TOTAL : gate =%4d : c0 =%2d c1 =%2d buf =%3d inv =%3d two-input =%4d\n", nWires-nMffc, nGates0[0]-nGates1[0], nGates0[1]-nGates1[1], nGates0[2]-nGates1[2], nGates0[3]-nGates1[3], nGates0[4]-nGates1[4] );
+ printf( "\n" );
return vStr;
}
@@ -2040,7 +2404,7 @@ Vec_Str_t * Acb_GeneratePatch2( Gia_Man_t * pGia, Vec_Ptr_t * vIns, Vec_Ptr_t *
extern Vec_Wec_t * Abc_GiaSynthesize( Vec_Ptr_t * vGias, Gia_Man_t * pMulti );
Vec_Wec_t * vGates = Abc_GiaSynthesize( NULL, pGia ); Vec_Int_t * vGate;
int nIns = Vec_PtrSize(vIns), nOuts = Vec_PtrSize(vOuts); char * pName;
- int i, k, iObj, nWires = Vec_WecSize(vGates) - nIns - nOuts, fFirst = 1;
+ int i, k, iObj, nWires = Vec_WecSize(vGates) - nIns - nOuts, nTwoIns = 0, fFirst = 1;
Vec_Ptr_t * vNames = Acb_GenerateSignalNames2( vGates, vIns, vOuts );
Vec_Str_t * vStr = Vec_StrAlloc( 100 );
@@ -2049,7 +2413,7 @@ Vec_Str_t * Acb_GeneratePatch2( Gia_Man_t * pGia, Vec_Ptr_t * vIns, Vec_Ptr_t *
Vec_PtrForEachEntry( char *, vOuts, pName, i )
Vec_StrPrintF( vStr, "%s %s", i ? ",":"", pName );
Vec_PtrForEachEntry( char *, vIns, pName, i )
- Vec_StrPrintF( vStr, ", %s", pName );
+ Vec_StrPrintF( vStr, ", %s%s", i ? "":" ", pName );
Vec_StrAppend( vStr, " );\n\n" );
Vec_StrAppend( vStr, " output" );
@@ -2071,8 +2435,9 @@ Vec_Str_t * Acb_GeneratePatch2( Gia_Man_t * pGia, Vec_Ptr_t * vIns, Vec_Ptr_t *
if ( !strncmp(pName, "ww", 2) )
Vec_StrPrintF( vStr, "%s %s", fFirst ? "":",", pName ), fFirst = 0;
}
- Vec_StrAppend( vStr, ";\n\n" );
+ Vec_StrAppend( vStr, ";\n" );
}
+ Vec_StrAppend( vStr, "\n" );
// create internal nodes
Vec_WecForEachLevelStartStop( vGates, vGate, i, nIns, nIns+nWires )
@@ -2083,6 +2448,7 @@ Vec_Str_t * Acb_GeneratePatch2( Gia_Man_t * pGia, Vec_Ptr_t * vIns, Vec_Ptr_t *
Vec_IntForEachEntryStart( vGate, iObj, k, 1 )
Vec_StrPrintF( vStr, "%s %s", k > 1 ? ",":"", (char *)Vec_PtrEntry(vNames, iObj) );
Vec_StrAppend( vStr, " );\n" );
+ nTwoIns += Vec_IntSize(vGate) - 3;
}
else
{
@@ -2098,14 +2464,14 @@ Vec_Str_t * Acb_GeneratePatch2( Gia_Man_t * pGia, Vec_Ptr_t * vIns, Vec_Ptr_t *
Vec_PtrFreeFree( vNames );
Vec_WecFree( vGates );
- printf( "Synthesized patch with %d inputs, %d outputs and %d gates.\n", nIns, nOuts, nWires );
+ printf( "Synthesized patch with %d inputs, %d outputs and %d gates (including %d two-input gates).\n", nIns, nOuts, nWires, nTwoIns );
return vStr;
}
-void Acb_GenerateFile2( Gia_Man_t * pGia, Vec_Ptr_t * vIns, Vec_Ptr_t * vOuts, char * pFileName, char * pFileNameOut )
+void Acb_GenerateFile2( Gia_Man_t * pGia, Vec_Ptr_t * vIns, Vec_Ptr_t * vOuts, char * pFileName, char * pFileNameOut, int fSkipMffc )
{
extern void Acb_GenerateFilePatch( Vec_Str_t * p, char * pFileNamePatch );
extern void Acb_GenerateFileOut( Vec_Str_t * vPatchLine, char * pFileNameF, char * pFileNameOut, Vec_Str_t * vPatch );
- extern void Acb_NtkInsert( char * pFileNameIn, char * pFileNameOut, Vec_Ptr_t * vNames, int fNumber );
+ extern void Acb_NtkInsert( char * pFileNameIn, char * pFileNameOut, Vec_Ptr_t * vNames, int fNumber, int fSkipMffc );
Vec_Str_t * vInst = Acb_GenerateInstance2( vIns, vOuts );
Vec_Str_t * vPatch = Acb_GeneratePatch2( pGia, vIns, vOuts );
//printf( "%s", Vec_StrArray(vPatch) );
@@ -2113,7 +2479,7 @@ void Acb_GenerateFile2( Gia_Man_t * pGia, Vec_Ptr_t * vIns, Vec_Ptr_t * vOuts, c
// generate output files
Acb_GenerateFilePatch( vPatch, "patch.v" );
printf( "Finished dumping patch file \"%s\".\n", "patch.v" );
- Acb_NtkInsert( pFileName, "temp.v", vOuts, 0 );
+ Acb_NtkInsert( pFileName, "temp.v", vOuts, 0, fSkipMffc );
printf( "Finished dumping intermediate file \"%s\".\n", "temp.v" );
Acb_GenerateFileOut( vInst, "temp.v", pFileNameOut, vPatch );
printf( "Finished dumping the resulting file \"%s\".\n", pFileNameOut );
@@ -2479,7 +2845,7 @@ Vec_Ptr_t * Acb_TransformPatchFunctions( Vec_Ptr_t * vSops, Vec_Wec_t * vSupps,
Vec_IntWriteEntry( vMap, iVar, Vec_IntSize(vUsed) );
Vec_IntPush( vUsed, iVar );
}
- printf( "The number of used variables %d (out of %d).\n", Vec_IntSum(vPres), Vec_IntSize(vPres) );
+ //printf( "The number of used variables %d (out of %d).\n", Vec_IntSum(vPres), Vec_IntSize(vPres) );
// remap SOPs
Vec_WecForEachLevel( vSupps, vLevel, i )
{
@@ -2505,13 +2871,14 @@ Vec_Ptr_t * Acb_TransformPatchFunctions( Vec_Ptr_t * vSops, Vec_Wec_t * vSupps,
SeeAlso []
***********************************************************************/
-int Acb_NtkEcoPerform( Acb_Ntk_t * pNtkF, Acb_Ntk_t * pNtkG, char * pFileName[4], int fCisOnly, int fCheck, int fVerbose, int fVeryVerbose )
+int Acb_NtkEcoPerform( Acb_Ntk_t * pNtkF, Acb_Ntk_t * pNtkG, char * pFileName[4], int nTimeout, int fCisOnly, int fInputs, int fCheck, int fUnitW, int fVerbose, int fVeryVerbose )
{
extern Gia_Man_t * Abc_SopSynthesizeOne( char * pSop, int fClp );
+ abctime clkStart = Abc_Clock();
abctime clk = Abc_Clock();
int nTargets = Vec_IntSize(&pNtkF->vTargets);
- int TimeOut = fCisOnly ? 0 : 60; // 60 seconds
+ int TimeOut = fCisOnly ? 0 : 120; // 60 seconds
int RetValue = 1;
// compute various sets of nodes
@@ -2520,7 +2887,7 @@ int Acb_NtkEcoPerform( Acb_Ntk_t * pNtkF, Acb_Ntk_t * pNtkG, char * pFileName[4]
Vec_Int_t * vSuppF = Acb_NtkFindSupp( pNtkF, vRoots );
Vec_Int_t * vSuppG = Acb_NtkFindSupp( pNtkG, vRoots );
Vec_Int_t * vSupp = Vec_IntTwoMerge( vSuppF, vSuppG );
- Vec_Int_t * vDivs = fCisOnly ? Acb_NtkFindDivsCis( pNtkF, vSupp ) : Acb_NtkFindDivs( pNtkF, vSupp, vBlock, fVerbose );
+ Vec_Int_t * vDivs = (fCisOnly || fInputs) ? Acb_NtkFindDivsCis( pNtkF, vSupp ) : Acb_NtkFindDivs( pNtkF, vSupp, vBlock, fUnitW, fVerbose );
Vec_Int_t * vNodesF = Acb_NtkFindNodes( pNtkF, vRoots, vDivs );
Vec_Int_t * vNodesG = Acb_NtkFindNodes( pNtkG, vRoots, NULL );
@@ -2543,6 +2910,10 @@ int Acb_NtkEcoPerform( Acb_Ntk_t * pNtkF, Acb_Ntk_t * pNtkG, char * pFileName[4]
char * pSop = NULL;
int i;
+// int Value = Acb_NtkSaveNames( pNtkF, vSupp, vNodesF, vRoots, vDivs, &pNtkF->vTargets, pGiaF );
+// Gia_AigerWrite( pGiaF, pFileBase, 0, 0, 0 );
+// return 0;
+
if ( fVerbose )
{
printf( "The number of targets = %d.\n", nTargets );
@@ -2622,6 +2993,14 @@ int Acb_NtkEcoPerform( Acb_Ntk_t * pNtkF, Acb_Ntk_t * pNtkG, char * pFileName[4]
RetValue = 0;
goto cleanup;
}
+ if ( nTimeout && (Abc_Clock() - clkStart)/CLOCKS_PER_SEC >= nTimeout )
+ {
+ Vec_IntFreeP( &vSupp );
+ ABC_FREE( pSop );
+ printf( "The target computation timed out after %d seconds.\n", nTimeout );
+ RetValue = 0;
+ goto cleanup;
+ }
// add new function to the miter
pOne = Abc_SopSynthesizeOne( pSop, 1 );
@@ -2683,6 +3062,16 @@ int Acb_NtkEcoPerform( Acb_Ntk_t * pNtkF, Acb_Ntk_t * pNtkG, char * pFileName[4]
if ( pFileName[3] == NULL ) Acb_GenerateFilePatch( vPatch, "patch.v" );
Acb_GenerateFileOut( vInst, pFileName[0], pFileName[3] ? pFileName[3] : (char *)"out.v", vPatch );
printf( "Finished dumping resulting file \"%s\".\n\n", pFileName[3] ? pFileName[3] : "out.v" );
+/*
+ {
+ char * pFileBase = Extra_FileNameGenericAppend( pFileName[0], "_patch.v" );
+ Acb_GenerateFilePatch( vPatch, pFileBase );
+ pFileBase = Extra_FileNameGenericAppend( pFileName[0], "_out.v" );
+ Acb_GenerateFileOut( vInst, pFileName[0], pFileName[3] ? pFileName[3] : pFileBase, vPatch );
+ Acb_GenerateFileOut( vInst, pFileName[0], pFileName[3] ? pFileName[3] : "out.v", vPatch );
+ printf( "Finished dumping resulting file \"%s\".\n\n", pFileName[3] ? pFileName[3] : pFileBase );
+ }
+*/
//Gia_AigerWrite( pGiaG, "test.aig", 0, 0, 0 );
cleanup:
// cleanup
@@ -2734,7 +3123,7 @@ void Acb_NtkTestRun2( char * pFileNames[3], int fVerbose )
Acb_Ntk_t * pNtk = Acb_VerilogSimpleRead( pFileNames[0], pFileNames[2] );
Acb_VerilogSimpleWrite( pNtk, pFileNameOut );
Acb_ManFree( pNtk->pDesign );
- Acb_IntallLibrary();
+ Acb_IntallLibrary( 0 );
}
/**Function*************************************************************
@@ -2748,7 +3137,7 @@ void Acb_NtkTestRun2( char * pFileNames[3], int fVerbose )
SeeAlso []
***********************************************************************/
-void Acb_NtkRunEco( char * pFileNames[4], int fCheck, int fRandom, int fVerbose, int fVeryVerbose )
+void Acb_NtkRunEco( char * pFileNames[4], int nTimeout, int fCheck, int fRandom, int fInputs, int fUnitW, int fVerbose, int fVeryVerbose )
{
char Command[1000]; int Result = 1;
Acb_Ntk_t * pNtkF = Acb_VerilogSimpleRead( pFileNames[0], pFileNames[2] );
@@ -2768,12 +3157,12 @@ void Acb_NtkRunEco( char * pFileNames[4], int fCheck, int fRandom, int fVerbose,
assert( Acb_NtkCiNum(pNtkF) == Acb_NtkCiNum(pNtkG) );
assert( Acb_NtkCoNum(pNtkF) == Acb_NtkCoNum(pNtkG) );
- Acb_IntallLibrary();
+ Acb_IntallLibrary( Abc_FrameReadSignalNames() != NULL );
- if ( !Acb_NtkEcoPerform( pNtkF, pNtkG, pFileNames, 0, fCheck, fVerbose, fVeryVerbose ) )
+ if ( !Acb_NtkEcoPerform( pNtkF, pNtkG, pFileNames, nTimeout, 0, fInputs, fCheck, fUnitW, fVerbose, fVeryVerbose ) )
{
// printf( "General computation timed out. Trying inputs only.\n\n" );
-// if ( !Acb_NtkEcoPerform( pNtkF, pNtkG, pFileNames, 1, fCheck, fVerbose, fVeryVerbose ) )
+// if ( !Acb_NtkEcoPerform( pNtkF, pNtkG, pFileNames, nTimeout, 1, fInputs, fCheck, fUnitW, fVerbose, fVeryVerbose ) )
// printf( "Input-only computation also timed out.\n\n" );
printf( "Computation did not succeed.\n" );
Result = 0;
diff --git a/src/base/acb/acbTest.c b/src/base/acb/acbTest.c
index fa632ca0..1faea72a 100644
--- a/src/base/acb/acbTest.c
+++ b/src/base/acb/acbTest.c
@@ -19,6 +19,11 @@
***********************************************************************/
#include "acb.h"
+#include "aig/saig/saig.h"
+#include "aig/gia/giaAig.h"
+#include "base/abc/abc.h"
+#include "proof/fraig/fraig.h"
+#include "misc/util/utilTruth.h"
ABC_NAMESPACE_IMPL_START
@@ -26,6 +31,8 @@ ABC_NAMESPACE_IMPL_START
/// DECLARATIONS ///
////////////////////////////////////////////////////////////////////////
+static int fForceZero = 0;
+
////////////////////////////////////////////////////////////////////////
/// FUNCTION DEFINITIONS ///
////////////////////////////////////////////////////////////////////////
@@ -41,8 +48,612 @@ ABC_NAMESPACE_IMPL_START
SeeAlso []
***********************************************************************/
+void Gia_ManSimTry( Gia_Man_t * pF, Gia_Man_t * pG )
+{
+ int i, j, n, nWords = 500;
+ Vec_Wrd_t * vSimsF, * vSimsG;
+ Abc_Random(1);
+ Vec_WrdFreeP( &pF->vSimsPi );
+ Vec_WrdFreeP( &pG->vSimsPi );
+ pF->vSimsPi = Vec_WrdStartRandom( Gia_ManCiNum(pF) * nWords );
+ pG->vSimsPi = Vec_WrdDup( pF->vSimsPi );
+ vSimsF = Gia_ManSimPatSim( pF );
+ vSimsG = Gia_ManSimPatSim( pG );
+ assert( Gia_ManObjNum(pF) * nWords == Vec_WrdSize(vSimsF) );
+ for ( i = 0; i < Gia_ManCoNum(pF)/2; i++ )
+ {
+ Gia_Obj_t * pObjFb = Gia_ManCo( pF, 2*i+0 );
+ Gia_Obj_t * pObjFx = Gia_ManCo( pF, 2*i+1 );
+ Gia_Obj_t * pObjGb = Gia_ManCo( pG, 2*i+0 );
+ Gia_Obj_t * pObjGx = Gia_ManCo( pG, 2*i+1 );
+ word * pSimFb = Vec_WrdEntryP(vSimsF, Gia_ObjId(pF, pObjFb)*nWords);
+ word * pSimFx = Vec_WrdEntryP(vSimsF, Gia_ObjId(pF, pObjFx)*nWords);
+ word * pSimGb = Vec_WrdEntryP(vSimsG, Gia_ObjId(pG, pObjGb)*nWords);
+ word * pSimGx = Vec_WrdEntryP(vSimsG, Gia_ObjId(pG, pObjGx)*nWords);
+
+ int nBitsFx = Abc_TtCountOnesVec(pSimFx, nWords);
+ int nBitsF1 = Abc_TtCountOnesVecMask(pSimFx, pSimFb, nWords, 1);
+ int nBitsF0 = nWords*64 - nBitsFx - nBitsF1;
+
+ int nBitsGx = Abc_TtCountOnesVec(pSimGx, nWords);
+ int nBitsG1 = Abc_TtCountOnesVecMask(pSimGx, pSimGb, nWords, 1);
+ int nBitsG0 = nWords*64 - nBitsGx - nBitsG1;
+
+ printf( "Output %4d : ", i );
+
+ printf( " RF : " );
+ printf( "0 =%7.3f %% ", 100.0*nBitsF0/64/nWords );
+ printf( "1 =%7.3f %% ", 100.0*nBitsF1/64/nWords );
+ printf( "X =%7.3f %% ", 100.0*nBitsFx/64/nWords );
+
+ printf( " GF : " );
+ printf( "0 =%7.3f %% ", 100.0*nBitsG0/64/nWords );
+ printf( "1 =%7.3f %% ", 100.0*nBitsG1/64/nWords );
+ printf( "X =%7.3f %% ", 100.0*nBitsGx/64/nWords );
+
+ printf( "\n" );
+ if ( i == 20 )
+ break;
+ }
+
+ printf( "\n" );
+ for ( j = 0; j < 20; j++ )
+ {
+ for ( n = 0; n < 2; n++ )
+ {
+ for ( i = 0; i < Gia_ManCoNum(pF)/2; i++ )
+ {
+ Gia_Obj_t * pObjFb = Gia_ManCo( pF, 2*i+0 );
+ Gia_Obj_t * pObjFx = Gia_ManCo( pF, 2*i+1 );
+ Gia_Obj_t * pObjGb = Gia_ManCo( pG, 2*i+0 );
+ Gia_Obj_t * pObjGx = Gia_ManCo( pG, 2*i+1 );
+ word * pSimFb = Vec_WrdEntryP(vSimsF, Gia_ObjId(pF, pObjFb)*nWords);
+ word * pSimFx = Vec_WrdEntryP(vSimsF, Gia_ObjId(pF, pObjFx)*nWords);
+ word * pSimGb = Vec_WrdEntryP(vSimsG, Gia_ObjId(pG, pObjGb)*nWords);
+ word * pSimGx = Vec_WrdEntryP(vSimsG, Gia_ObjId(pG, pObjGx)*nWords);
+ word * pSimb = n ? pSimGb : pSimFb;
+ word * pSimx = n ? pSimGx : pSimFx;
+ if ( Abc_TtGetBit(pSimx, j) )
+ printf( "x" );
+ else if ( Abc_TtGetBit(pSimb, j) )
+ printf( "1" );
+ else
+ printf( "0" );
+ }
+ printf( "\n" );
+ }
+ printf( "\n" );
+ }
+
+ Vec_WrdFree( vSimsF );
+ Vec_WrdFree( vSimsG );
+ printf( "\n" );
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+void Gia_ManDualNot( Gia_Man_t * p, int LitA[2], int LitZ[2] )
+{
+ LitZ[0] = Abc_LitNot(LitA[0]);
+ LitZ[1] = LitA[1];
+
+ if ( fForceZero ) LitZ[0] = Gia_ManHashAnd( p, LitZ[0], Abc_LitNot(LitZ[1]) );
+}
+// computes Z = XOR(A, B) where A, B, Z belong to {0,1,x} encoded as 0=00, 1=01, x=1-
+void Gia_ManDualXor2( Gia_Man_t * p, int LitA[2], int LitB[2], int LitZ[2] )
+{
+ LitZ[0] = Gia_ManHashXor( p, LitA[0], LitB[0] );
+ LitZ[1] = Gia_ManHashOr( p, LitA[1], LitB[1] );
+
+ if ( fForceZero ) LitZ[0] = Gia_ManHashAnd( p, LitZ[0], Abc_LitNot(LitZ[1]) );
+}
+void Gia_ManDualXorN( Gia_Man_t * p, int * pLits, int n, int LitZ[2] )
+{
+ int i;
+ LitZ[0] = 0;
+ LitZ[1] = 0;
+ for ( i = 0; i < n; i++ )
+ {
+ LitZ[0] = Gia_ManHashXor( p, LitZ[0], pLits[2*i] );
+ LitZ[1] = Gia_ManHashOr ( p, LitZ[1], pLits[2*i+1] );
+ }
+}
+// computes Z = AND(A, B) where A, B, Z belong to {0,1,x} encoded as 0=00, 1=01, z=1-
+void Gia_ManDualAnd2( Gia_Man_t * p, int LitA[2], int LitB[2], int LitZ[2] )
+{
+ int ZeroA = Gia_ManHashAnd( p, Abc_LitNot(LitA[0]), Abc_LitNot(LitA[1]) );
+ int ZeroB = Gia_ManHashAnd( p, Abc_LitNot(LitB[0]), Abc_LitNot(LitB[1]) );
+ int ZeroZ = Gia_ManHashOr( p, ZeroA, ZeroB );
+ LitZ[0] = Gia_ManHashAnd( p, LitA[0], LitB[0] );
+ LitZ[1] = Gia_ManHashAnd( p, Gia_ManHashOr( p, LitA[1], LitB[1] ), Abc_LitNot(ZeroZ) );
+
+ //LitZ[0] = Gia_ManHashAnd( p, Gia_ManHashAnd(p, LitA[0], Abc_LitNot(LitA[1])), Gia_ManHashAnd(p, LitB[0], Abc_LitNot(LitB[1])) );
+ //LitZ[1] = Gia_ManHashAnd( p, Gia_ManHashOr(p, LitA[0], LitA[1]), Gia_ManHashOr(p, LitB[0], LitB[1]) );
+ //LitZ[1] = Gia_ManHashAnd( p, LitZ[1], Abc_LitNot(LitZ[0]) );
+}
+void Gia_ManDualAndN( Gia_Man_t * p, int * pLits, int n, int LitZ[2] )
+{
+ int i, LitZero = 0, LitOne = 0;
+ LitZ[0] = 1;
+ for ( i = 0; i < n; i++ )
+ {
+ int Lit = Gia_ManHashAnd( p, Abc_LitNot(pLits[2*i]), Abc_LitNot(pLits[2*i+1]) );
+ LitZero = Gia_ManHashOr( p, LitZero, Lit );
+ LitOne = Gia_ManHashOr( p, LitOne, pLits[2*i+1] );
+ LitZ[0] = Gia_ManHashAnd( p, LitZ[0], pLits[2*i] );
+ }
+ LitZ[1] = Gia_ManHashAnd( p, LitOne, Abc_LitNot(LitZero) );
+
+ if ( fForceZero ) LitZ[0] = Gia_ManHashAnd( p, LitZ[0], Abc_LitNot(LitZ[1]) );
+}
+/*
+module _DC(O, C, D);
+ output O;
+ input C, D;
+ assign O = D ? 1'bx : C;
+endmodule
+*/
+void Gia_ManDualDc( Gia_Man_t * p, int LitC[2], int LitD[2], int LitZ[2] )
+{
+ LitZ[0] = LitC[0];
+// LitZ[0] = Gia_ManHashMux( p, LitD[0], 0, LitC[0] );
+ LitZ[1] = Gia_ManHashOr(p, Gia_ManHashOr(p,LitD[0],LitD[1]), LitC[1] );
+
+ if ( fForceZero ) LitZ[0] = Gia_ManHashAnd( p, LitZ[0], Abc_LitNot(LitZ[1]) );
+}
+void Gia_ManDualMux( Gia_Man_t * p, int LitC[2], int LitT[2], int LitE[2], int LitZ[2] )
+{
+/*
+ // total logic size: 18 nodes
+ int Xnor = Gia_ManHashXor( p, Abc_LitNot(LitT[0]), LitE[0] );
+ int Cond = Gia_ManHashAnd( p, Abc_LitNot(LitT[1]), Abc_LitNot(LitE[1]) );
+ int pTempE[2], pTempT[2];
+ pTempE[0] = Gia_ManHashMux( p, LitC[0], LitT[0], LitE[0] );
+ pTempE[1] = Gia_ManHashMux( p, LitC[0], LitT[1], LitE[1] );
+ //pTempT[0] = LitT[0];
+ pTempT[0] = Gia_ManHashAnd( p, LitT[0], LitE[0] );
+ pTempT[1] = Gia_ManHashAnd( p, Cond, Xnor );
+ LitZ[0] = Gia_ManHashMux( p, LitC[1], pTempT[0], pTempE[0] );
+ LitZ[1] = Gia_ManHashMux( p, LitC[1], pTempT[1], pTempE[1] );
+*/
+ // total logic size: 14 nodes
+ int Xnor = Gia_ManHashXor( p, Abc_LitNot(LitT[0]), LitE[0] );
+ int Cond = Gia_ManHashAnd( p, Abc_LitNot(LitT[1]), Abc_LitNot(LitE[1]) );
+ int XVal1 = Abc_LitNot( Gia_ManHashAnd( p, Cond, Xnor ) );
+ int XVal0 = Gia_ManHashMux( p, LitC[0], LitT[1], LitE[1] );
+ LitZ[0] = Gia_ManHashMux( p, LitC[0], LitT[0], LitE[0] );
+ LitZ[1] = Gia_ManHashMux( p, LitC[1], XVal1, XVal0 );
+
+ if ( fForceZero ) LitZ[0] = Gia_ManHashAnd( p, LitZ[0], Abc_LitNot(LitZ[1]) );
+}
+int Gia_ManDualCompare( Gia_Man_t * p, int LitF[2], int LitS[2] )
+{
+ int iMiter = Gia_ManHashXor( p, LitF[0], LitS[0] );
+ iMiter = Gia_ManHashOr( p, LitF[1], iMiter );
+ iMiter = Gia_ManHashAnd( p, Abc_LitNot(LitS[1]), iMiter );
+ return iMiter;
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+void Acb_ObjToGiaDual( Gia_Man_t * pNew, Acb_Ntk_t * p, int iObj, Vec_Int_t * vTemp, Vec_Int_t * vCopies, int pRes[2] )
+{
+ //char * pName = Abc_NamStr( p->pDesign->pStrs, Acb_ObjName(p, iObj) );
+ int * pFanin, iFanin, k, Type;
+ assert( !Acb_ObjIsCio(p, iObj) );
+ Vec_IntClear( vTemp );
+ Acb_ObjForEachFaninFast( p, iObj, pFanin, iFanin, k )
+ {
+ int * pLits = Vec_IntEntryP( vCopies, 2*iFanin );
+ assert( pLits[0] >= 0 && pLits[1] >= 0 );
+ Vec_IntPushTwo( vTemp, pLits[0], pLits[1] );
+ }
+ Type = Acb_ObjType( p, iObj );
+ if ( Type == ABC_OPER_CONST_F )
+ {
+ pRes[0] = 0;
+ pRes[1] = 0;
+ return;
+ }
+ if ( Type == ABC_OPER_CONST_T )
+ {
+ pRes[0] = 1;
+ pRes[1] = 0;
+ return;
+ }
+ if ( Type == ABC_OPER_CONST_X )
+ {
+ pRes[0] = 0;
+ pRes[1] = 1;
+ return;
+ }
+ if ( Type == ABC_OPER_BIT_BUF )
+ {
+ pRes[0] = Vec_IntEntry(vTemp, 0);
+ pRes[1] = Vec_IntEntry(vTemp, 1);
+ return;
+ }
+ if ( Type == ABC_OPER_BIT_INV )
+ {
+ Gia_ManDualNot( pNew, Vec_IntArray(vTemp), pRes );
+ return;
+ }
+ if ( Type == ABC_OPER_TRI )
+ {
+ // in the file inputs are ordered as follows: _DC \n6_5[9] ( .O(\108 ), .C(\96 ), .D(\107 ));
+ // in this code, we expect them as follows: void Gia_ManDualDc( Gia_Man_t * p, int LitC[2], int LitD[2], int LitZ[2] )
+ assert( Vec_IntSize(vTemp) == 4 );
+ Gia_ManDualDc( pNew, Vec_IntArray(vTemp), Vec_IntArray(vTemp) + 2, pRes );
+ return;
+ }
+ if ( Type == ABC_OPER_BIT_MUX )
+ {
+ // in the file inputs are ordered as follows: _HMUX \U$1 ( .O(\282 ), .I0(1'b1), .I1(\277 ), .S(\281 ));
+ // in this code, we expect them as follows: void Gia_ManDualMux( Gia_Man_t * p, int LitC[2], int LitT[2], int LitE[2], int LitZ[2] )
+ assert( Vec_IntSize(vTemp) == 6 );
+ ABC_SWAP( int, Vec_IntArray(vTemp)[0], Vec_IntArray(vTemp)[4] );
+ ABC_SWAP( int, Vec_IntArray(vTemp)[1], Vec_IntArray(vTemp)[5] );
+ Gia_ManDualMux( pNew, Vec_IntArray(vTemp), Vec_IntArray(vTemp) + 2, Vec_IntArray(vTemp) + 4, pRes );
+ return;
+ }
+ if ( Type == ABC_OPER_BIT_AND || Type == ABC_OPER_BIT_NAND )
+ {
+ Gia_ManDualAndN( pNew, Vec_IntArray(vTemp), Vec_IntSize(vTemp)/2, pRes );
+ if ( Type == ABC_OPER_BIT_NAND )
+ pRes[0] = Abc_LitNot( pRes[0] );
+ return;
+ }
+ if ( Type == ABC_OPER_BIT_OR || Type == ABC_OPER_BIT_NOR )
+ {
+ int * pArray = Vec_IntArray( vTemp );
+ for ( k = 0; k < Vec_IntSize(vTemp)/2; k++ )
+ pArray[2*k] = Abc_LitNot( pArray[2*k] );
+ Gia_ManDualAndN( pNew, pArray, Vec_IntSize(vTemp)/2, pRes );
+ if ( Type == ABC_OPER_BIT_OR )
+ pRes[0] = Abc_LitNot( pRes[0] );
+ return;
+ }
+ if ( Type == ABC_OPER_BIT_XOR || Type == ABC_OPER_BIT_NXOR )
+ {
+ assert( Vec_IntSize(vTemp) == 4 );
+ Gia_ManDualXor2( pNew, Vec_IntArray(vTemp), Vec_IntArray(vTemp) + 2, pRes );
+ if ( Type == ABC_OPER_BIT_NXOR )
+ pRes[0] = Abc_LitNot( pRes[0] );
+ return;
+ }
+ assert( 0 );
+}
+Gia_Man_t * Acb_NtkGiaDeriveDual( Acb_Ntk_t * p )
+{
+ extern Vec_Int_t * Acb_NtkFindNodes2( Acb_Ntk_t * p );
+ Gia_Man_t * pNew, * pOne;
+ Vec_Int_t * vFanins, * vNodes;
+ Vec_Int_t * vCopies = Vec_IntStartFull( 2*Acb_NtkObjNum(p) );
+ int i, iObj, * pLits;
+ pNew = Gia_ManStart( 5 * Acb_NtkObjNum(p) );
+ pNew->pName = Abc_UtilStrsav(Acb_NtkName(p));
+ Gia_ManHashAlloc( pNew );
+ pLits = Vec_IntEntryP( vCopies, 0 );
+ pLits[0] = 0;
+ pLits[1] = 0;
+ Acb_NtkForEachCi( p, iObj, i )
+ {
+ pLits = Vec_IntEntryP( vCopies, 2*iObj );
+ pLits[0] = Gia_ManAppendCi(pNew);
+ pLits[1] = 0;
+ }
+ vFanins = Vec_IntAlloc( 4 );
+ vNodes = Acb_NtkFindNodes2( p );
+ Vec_IntForEachEntry( vNodes, iObj, i )
+ {
+ pLits = Vec_IntEntryP( vCopies, 2*iObj );
+ Acb_ObjToGiaDual( pNew, p, iObj, vFanins, vCopies, pLits );
+ }
+ Vec_IntFree( vNodes );
+ Vec_IntFree( vFanins );
+ Acb_NtkForEachCo( p, iObj, i )
+ {
+ pLits = Vec_IntEntryP( vCopies, 2*Acb_ObjFanin(p, iObj, 0) );
+ Gia_ManAppendCo( pNew, pLits[0] );
+ Gia_ManAppendCo( pNew, pLits[1] );
+ }
+ Vec_IntFree( vCopies );
+ pNew = Gia_ManCleanup( pOne = pNew );
+ Gia_ManStop( pOne );
+ return pNew;
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+Gia_Man_t * Acb_NtkGiaDeriveMiter( Gia_Man_t * pOne, Gia_Man_t * pTwo, int Type )
+{
+ Gia_Man_t * pNew, * pTemp;
+ Gia_Obj_t * pObj;
+ int i;
+ assert( Gia_ManCiNum(pOne) == Gia_ManCiNum(pTwo) );
+ assert( Gia_ManCoNum(pOne) == Gia_ManCoNum(pTwo) );
+ pNew = Gia_ManStart( Gia_ManObjNum(pOne) + Gia_ManObjNum(pTwo) + 5*Gia_ManCoNum(pOne)/2 );
+ pNew->pName = Abc_UtilStrsav( "miter" );
+ pNew->pSpec = NULL;
+ Gia_ManHashAlloc( pNew );
+ Gia_ManConst0(pOne)->Value = 0;
+ Gia_ManConst0(pTwo)->Value = 0;
+ Gia_ManForEachCi( pOne, pObj, i )
+ pObj->Value = Gia_ManAppendCi( pNew );
+ Gia_ManForEachCi( pTwo, pObj, i )
+ pObj->Value = Gia_ManCi(pOne, i)->Value;
+ Gia_ManForEachAnd( pOne, pObj, i )
+ pObj->Value = Gia_ManHashAnd( pNew, Gia_ObjFanin0Copy(pObj), Gia_ObjFanin1Copy(pObj) );
+ Gia_ManForEachAnd( pTwo, pObj, i )
+ pObj->Value = Gia_ManHashAnd( pNew, Gia_ObjFanin0Copy(pObj), Gia_ObjFanin1Copy(pObj) );
+ Gia_ManForEachCo( pOne, pObj, i )
+ pObj->Value = Gia_ObjFanin0Copy(pObj);
+ Gia_ManForEachCo( pTwo, pObj, i )
+ pObj->Value = Gia_ObjFanin0Copy(pObj);
+ if ( Type == 0 ) // only main circuit
+ {
+ for ( i = 0; i < Gia_ManCoNum(pOne); i += 2 )
+ {
+ int pLitsF[2] = { Gia_ManCo(pOne, i)->Value, Gia_ManCo(pOne, i+1)->Value };
+ int pLitsS[2] = { Gia_ManCo(pTwo, i)->Value, Gia_ManCo(pTwo, i+1)->Value };
+ Gia_ManAppendCo( pNew, pLitsF[0] );
+ Gia_ManAppendCo( pNew, pLitsS[0] );
+ }
+ }
+ else if ( Type == 1 ) // only shadow circuit
+ {
+ for ( i = 0; i < Gia_ManCoNum(pOne); i += 2 )
+ {
+ int pLitsF[2] = { Gia_ManCo(pOne, i)->Value, Gia_ManCo(pOne, i+1)->Value };
+ int pLitsS[2] = { Gia_ManCo(pTwo, i)->Value, Gia_ManCo(pTwo, i+1)->Value };
+ Gia_ManAppendCo( pNew, pLitsF[1] );
+ Gia_ManAppendCo( pNew, pLitsS[1] );
+ }
+ }
+ else // comparator of the two
+ {
+ for ( i = 0; i < Gia_ManCoNum(pOne); i += 2 )
+ {
+ int pLitsF[2] = { Gia_ManCo(pOne, i)->Value, Gia_ManCo(pOne, i+1)->Value };
+ int pLitsS[2] = { Gia_ManCo(pTwo, i)->Value, Gia_ManCo(pTwo, i+1)->Value };
+ Gia_ManAppendCo( pNew, Gia_ManDualCompare( pNew, pLitsF, pLitsS ) );
+ }
+ }
+ Gia_ManHashStop( pNew );
+ pNew = Gia_ManCleanup( pTemp = pNew );
+ Gia_ManStop( pTemp );
+ return pNew;
+}
+
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+void Acb_OutputFile( char * pFileName, Acb_Ntk_t * pNtkF, int * pModel )
+{
+ char * pFileName0 = pFileName? pFileName : "output";
+ FILE * pFile = fopen( pFileName0, "wb" );
+ if ( pFile == NULL )
+ {
+ printf( "Cannot open results file \"%s\".\n", pFileName0 );
+ return;
+ }
+ if ( pModel == NULL )
+ fprintf( pFile, "EQ\n" );
+ else
+ {
+ /*
+ NEQ
+ in 1
+ a 1
+ b 0
+ */
+ int i, iObj;
+ fprintf( pFile, "NEQ\n" );
+ Acb_NtkForEachPi( pNtkF, iObj, i )
+ fprintf( pFile, "%s %d\n", Acb_ObjNameStr(pNtkF, iObj), pModel[i] );
+ }
+ fclose( pFile );
+ printf( "Produced output file \"%s\".\n\n", pFileName0 );
+}
+int * Acb_NtkSolve( Gia_Man_t * p )
+{
+ extern Abc_Ntk_t * Abc_NtkFromAigPhase( Aig_Man_t * pMan );
+ Aig_Man_t * pMan = Gia_ManToAig( p, 0 );
+ Abc_Ntk_t * pNtkTemp = Abc_NtkFromAigPhase( pMan );
+ Prove_Params_t Params, * pParams = &Params;
+ Prove_ParamsSetDefault( pParams );
+ pParams->fUseRewriting = 1;
+ pParams->fVerbose = 0;
+ Aig_ManStop( pMan );
+ if ( pNtkTemp )
+ {
+ abctime clk = Abc_Clock();
+ int RetValue = Abc_NtkIvyProve( &pNtkTemp, pParams );
+ int * pModel = pNtkTemp->pModel;
+ pNtkTemp->pModel = NULL;
+ Abc_NtkDelete( pNtkTemp );
+ printf( "The networks are %s. ", RetValue == 1 ? "equivalent" : (RetValue == 0 ? "NOT equivalent" : "UNDECIDED") );
+ Abc_PrintTime( 1, "Time", Abc_Clock() - clk );
+ if ( RetValue == 0 )
+ return pModel;
+ }
+ return NULL;
+}
+
+/**Function*************************************************************
+
+ Synopsis [Various statistics.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+void Acb_NtkPrintCecStats( Acb_Ntk_t * pNtk )
+{
+ int iObj, nDcs = 0, nMuxes = 0;
+ Acb_NtkForEachNode( pNtk, iObj )
+ if ( Acb_ObjType( pNtk, iObj ) == ABC_OPER_TRI )
+ nDcs++;
+ else if ( Acb_ObjType( pNtk, iObj ) == ABC_OPER_BIT_MUX )
+ nMuxes++;
+
+ printf( "PI = %6d ", Acb_NtkCiNum(pNtk) );
+ printf( "PO = %6d ", Acb_NtkCoNum(pNtk) );
+ printf( "Obj = %6d ", Acb_NtkObjNum(pNtk) );
+ printf( "DC = %4d ", nDcs );
+ printf( "Mux = %4d ", nMuxes );
+ printf( "\n" );
+}
+
+/**Function*************************************************************
+
+ Synopsis [Changing the PI order.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+void Acb_NtkUpdateCiOrder( Acb_Ntk_t * pNtkF, Acb_Ntk_t * pNtkG )
+{
+ int i, iObj;
+ Vec_Int_t * vMap = Vec_IntStartFull( Acb_ManNameIdMax(pNtkG->pDesign) );
+ Vec_Int_t * vOrder = Vec_IntStartFull( Acb_NtkCiNum(pNtkG) );
+ Acb_NtkForEachCi( pNtkG, iObj, i )
+ Vec_IntWriteEntry( vMap, Acb_ObjName(pNtkG, iObj), i );
+ Acb_NtkForEachCi( pNtkF, iObj, i )
+ {
+ int NameIdG = Acb_ManStrId( pNtkG->pDesign, Acb_ObjNameStr(pNtkF, iObj) );
+ int iPerm = NameIdG < Vec_IntSize(vMap) ? Vec_IntEntry( vMap, NameIdG ) : -1;
+ if ( iPerm == -1 )
+ printf( "Cannot find name \"%s\" of PI %d of F among PIs of G.\n", Acb_ObjNameStr(pNtkF, iObj), i );
+ else
+ Vec_IntWriteEntry( vOrder, iPerm, iObj );
+ }
+ Vec_IntClear( &pNtkF->vCis );
+ Vec_IntAppend( &pNtkF->vCis, vOrder );
+ Vec_IntFree( vOrder );
+ Vec_IntFree( vMap );
+}
+int Acb_NtkCheckPiOrder( Acb_Ntk_t * pNtkF, Acb_Ntk_t * pNtkG )
+{
+ int i, nPis = Acb_NtkCiNum(pNtkF);
+ for ( i = 0; i < nPis; i++ )
+ {
+ char * pNameF = Acb_ObjNameStr( pNtkF, Acb_NtkCi(pNtkF, i) );
+ char * pNameG = Acb_ObjNameStr( pNtkG, Acb_NtkCi(pNtkG, i) );
+ if ( strcmp(pNameF, pNameG) )
+ {
+// printf( "PI %d has different names (%s and %s) in these networks.\n", i, pNameF, pNameG );
+ printf( "Networks have different PI names. Reordering PIs of the implementation network.\n" );
+ Acb_NtkUpdateCiOrder( pNtkF, pNtkG );
+ break;
+ }
+ }
+ if ( i == nPis )
+ printf( "Networks have the same PI names.\n" );
+ return i == nPis;
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
void Acb_NtkRunTest( char * pFileNames[4], int fFancy, int fVerbose )
{
+ extern Acb_Ntk_t * Acb_VerilogSimpleRead( char * pFileName, char * pFileNameW );
+ extern void Gia_AigerWrite( Gia_Man_t * p, char * pFileName, int fWriteSymbols, int fCompact, int fWriteNewLine );
+
+ int fSolve = 1;
+ int * pModel = NULL;
+ Gia_Man_t * pGiaF = NULL;
+ Gia_Man_t * pGiaG = NULL;
+ Gia_Man_t * pGia = NULL;
+ Acb_Ntk_t * pNtkF = Acb_VerilogSimpleRead( pFileNames[0], NULL );
+ Acb_Ntk_t * pNtkG = Acb_VerilogSimpleRead( pFileNames[1], NULL );
+ if ( !pNtkF || !pNtkG )
+ return;
+
+ assert( Acb_NtkCiNum(pNtkF) == Acb_NtkCiNum(pNtkG) );
+ assert( Acb_NtkCoNum(pNtkF) == Acb_NtkCoNum(pNtkG) );
+
+ Acb_NtkCheckPiOrder( pNtkF, pNtkG );
+ //Acb_NtkCheckPiOrder( pNtkG, pNtkF );
+ Acb_NtkPrintCecStats( pNtkF );
+ Acb_NtkPrintCecStats( pNtkG );
+
+ pGiaF = Acb_NtkGiaDeriveDual( pNtkF );
+ pGiaG = Acb_NtkGiaDeriveDual( pNtkG );
+ pGia = Acb_NtkGiaDeriveMiter( pGiaF, pGiaG, 2 );
+ //Gia_AigerWrite( pGiaF, Extra_FileNameGenericAppend(pFileNames[1], "_f2.aig"), 0, 0, 0 );
+ //Gia_AigerWrite( pGiaG, Extra_FileNameGenericAppend(pFileNames[1], "_g2.aig"), 0, 0, 0 );
+ //Gia_AigerWrite( pGia, Extra_FileNameGenericAppend(pFileNames[1], "_miter_0.aig"), 0, 0, 0 );
+ //printf( "Written the miter info file \"%s\".\n", Extra_FileNameGenericAppend(pFileNames[1], "_miter_0.aig") );
+
+ //Gia_ManPrintStats( pGia, NULL );
+ //Gia_ManSimTry( pGiaF, pGiaG );
+
+ if ( fSolve )
+ {
+ pModel = Acb_NtkSolve( pGia );
+ Acb_OutputFile( pFileNames[2], pNtkF, pModel );
+ ABC_FREE( pModel );
+ }
+
+ Gia_ManStop( pGia );
+ Gia_ManStop( pGiaF );
+ Gia_ManStop( pGiaG );
+
+ Acb_ManFree( pNtkF->pDesign );
+ Acb_ManFree( pNtkG->pDesign );
}
diff --git a/src/base/acb/acbUtil.c b/src/base/acb/acbUtil.c
index 2243541b..ef106e86 100644
--- a/src/base/acb/acbUtil.c
+++ b/src/base/acb/acbUtil.c
@@ -21,6 +21,7 @@
#include "acb.h"
#include "base/abc/abc.h"
#include "base/io/ioAbc.h"
+#include "base/main/main.h"
ABC_NAMESPACE_IMPL_START
@@ -71,6 +72,15 @@ Vec_Int_t * Acb_ObjCollectTfi( Acb_Ntk_t * p, int iObj, int fTerm )
Acb_ObjCollectTfi_rec( p, iObj, fTerm );
return &p->vArray0;
}
+Vec_Int_t * Acb_ObjCollectTfiVec( Acb_Ntk_t * p, Vec_Int_t * vObjs )
+{
+ int i, iObj;
+ Vec_IntClear( &p->vArray0 );
+ Acb_NtkIncTravId( p );
+ Vec_IntForEachEntry( vObjs, iObj, i )
+ Acb_ObjCollectTfi_rec( p, iObj, 0 );
+ return &p->vArray0;
+}
void Acb_ObjCollectTfo_rec( Acb_Ntk_t * p, int iObj, int fTerm )
{
@@ -95,6 +105,219 @@ Vec_Int_t * Acb_ObjCollectTfo( Acb_Ntk_t * p, int iObj, int fTerm )
Acb_ObjCollectTfo_rec( p, iObj, fTerm );
return &p->vArray1;
}
+Vec_Int_t * Acb_ObjCollectTfoVec( Acb_Ntk_t * p, Vec_Int_t * vObjs )
+{
+ int i, iObj;
+ if ( !Acb_NtkHasObjFanout(p) )
+ Acb_NtkCreateFanout( p );
+ Vec_IntClear( &p->vArray1 );
+ Acb_NtkIncTravId( p );
+ Vec_IntForEachEntry( vObjs, iObj, i )
+ Acb_ObjCollectTfo_rec( p, iObj, 0 );
+ return &p->vArray1;
+}
+
+/**Function*************************************************************
+
+ Synopsis [Count the number of nodes driving the POs.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+int Acb_NtkIsPiBuffers( Acb_Ntk_t * p, int iObj )
+{
+ if ( Acb_ObjIsCi(p, iObj) )
+ return 1;
+ if ( Acb_ObjFaninNum(p, iObj) != 1 )
+ return 0;
+ return Acb_NtkIsPiBuffers( p, Acb_ObjFanin(p, iObj, 0) );
+}
+int Acb_NtkCountPiBuffers( Acb_Ntk_t * p, Vec_Int_t * vObjs )
+{
+ int i, iObj, Count = 0;
+ Vec_IntForEachEntry( vObjs, iObj, i )
+ Count += Acb_NtkIsPiBuffers( p, iObj );
+ return Count;
+}
+int Acb_NtkCountPoDrivers( Acb_Ntk_t * p, Vec_Int_t * vObjs )
+{
+ int i, iObj, Count = 0;
+ Acb_NtkIncTravId( p );
+ Acb_NtkForEachCo( p, iObj, i )
+ {
+ int Fanin0 = Acb_ObjFanin0(p, iObj);
+ Acb_ObjSetTravIdCur( p, iObj );
+ Acb_ObjSetTravIdCur( p, Fanin0 );
+ if ( Acb_ObjFaninNum(p, Fanin0) == 1 )
+ Acb_ObjSetTravIdCur( p, Acb_ObjFanin0(p, Fanin0) );
+ }
+ Vec_IntForEachEntry( vObjs, iObj, i )
+ Count += Acb_ObjIsTravIdCur(p, iObj);
+ return Count;
+}
+
+/**Function*************************************************************
+
+ Synopsis [Compute MFFC size.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+int Acb_NtkNodeDeref_rec( Vec_Int_t * vRefs, Acb_Ntk_t * p, int iObj )
+{
+ int i, Fanin, * pFanins, Counter = 1;
+ if ( Acb_ObjIsCi(p, iObj) )
+ return 0;
+ Acb_ObjForEachFaninFast( p, iObj, pFanins, Fanin, i )
+ {
+ assert( Vec_IntEntry(vRefs, Fanin) > 0 );
+ Vec_IntAddToEntry( vRefs, Fanin, -1 );
+ if ( Vec_IntEntry(vRefs, Fanin) == 0 )
+ Counter += Acb_NtkNodeDeref_rec( vRefs, p, Fanin );
+ }
+ return Counter;
+}
+int Acb_NtkNodeRef_rec( Vec_Int_t * vRefs, Acb_Ntk_t * p, int iObj )
+{
+ int i, Fanin, * pFanins, Counter = 1;
+ if ( Acb_ObjIsCi(p, iObj) )
+ return 0;
+ Acb_ObjForEachFaninFast( p, iObj, pFanins, Fanin, i )
+ {
+ if ( Vec_IntEntry(vRefs, Fanin) == 0 )
+ Counter += Acb_NtkNodeRef_rec( vRefs, p, Fanin );
+ Vec_IntAddToEntry( vRefs, Fanin, 1 );
+ }
+ return Counter;
+}
+
+/**Function*************************************************************
+
+ Synopsis [Computing and updating direct and reverse logic level.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+void Acb_NtkCollectDeref_rec( Vec_Int_t * vRefs, Acb_Ntk_t * p, int iObj, Vec_Int_t * vRes )
+{
+ int i, Fanin, * pFanins;
+ if ( Acb_ObjIsCi(p, iObj) )
+ return;
+ Vec_IntPush( vRes, iObj );
+ Acb_ObjForEachFaninFast( p, iObj, pFanins, Fanin, i )
+ {
+ assert( Vec_IntEntry(vRefs, Fanin) > 0 );
+ Vec_IntAddToEntry( vRefs, Fanin, -1 );
+ if ( Vec_IntEntry(vRefs, Fanin) == 0 )
+ Acb_NtkCollectDeref_rec( vRefs, p, Fanin, vRes );
+ }
+}
+Vec_Int_t * Acb_NtkCollectMffc( Acb_Ntk_t * p, Vec_Int_t * vObjsRefed, Vec_Int_t * vObjsDerefed )
+{
+ Vec_Int_t * vRes = Vec_IntAlloc( 100 );
+ Vec_Int_t * vRefs = Vec_IntStart( Acb_NtkObjNumMax(p) );
+ int i, iObj, Fanin, * pFanins;
+ Acb_NtkForEachObj( p, iObj )
+ Acb_ObjForEachFaninFast( p, iObj, pFanins, Fanin, i )
+ Vec_IntAddToEntry( vRefs, Fanin, 1 );
+ Acb_NtkForEachCo( p, iObj, i )
+ Vec_IntAddToEntry( vRefs, iObj, 1 );
+ if ( vObjsRefed )
+ Vec_IntForEachEntry( vObjsRefed, iObj, i )
+ Vec_IntAddToEntry( vRefs, iObj, 1 );
+ Vec_IntForEachEntry( vObjsDerefed, iObj, i )
+ {
+ if ( Acb_ObjIsCo(p, iObj) )
+ iObj = Acb_ObjFanin0(p, iObj);
+ if ( Vec_IntEntry(vRefs, iObj) != 0 )
+ Acb_NtkCollectDeref_rec( vRefs, p, iObj, vRes );
+ }
+ Vec_IntFree( vRefs );
+ Vec_IntUniqify( vRes );
+ return vRes;
+}
+
+Vec_Int_t * Acb_NamesToIds( Acb_Ntk_t * pNtk, Vec_Int_t * vNamesInv, Vec_Ptr_t * vNames )
+{
+ Vec_Int_t * vRes = Vec_IntAlloc( Vec_PtrSize(vNames) );
+ char * pName; int i;
+ Vec_PtrForEachEntry( char *, vNames, pName, i )
+ {
+ int NameId = Acb_NtkStrId(pNtk, pName);
+ int iObjId = 0;
+ if ( NameId < 1 )
+ printf( "Cannot find name \"%s\" in the network \"%s\".\n", pName, pNtk->pDesign->pName );
+ else
+ iObjId = Vec_IntEntry( vNamesInv, NameId );
+ Vec_IntPush( vRes, iObjId );
+ }
+ return vRes;
+}
+int Acb_NtkCollectMfsGates( char * pFileName, Vec_Ptr_t * vNamesRefed, Vec_Ptr_t * vNamesDerefed, int nGates[5] )
+{
+ Acb_Ntk_t * pNtkF = Acb_VerilogSimpleRead( pFileName, NULL );
+ Vec_Int_t * vNamesInv = Vec_IntInvert( &pNtkF->vObjName, 0 ) ;
+ Vec_Int_t * vObjsRefed = Acb_NamesToIds( pNtkF, vNamesInv, vNamesRefed );
+ Vec_Int_t * vObjsDerefed = Acb_NamesToIds( pNtkF, vNamesInv, vNamesDerefed );
+ Vec_Int_t * vNodes = Acb_NtkCollectMffc( pNtkF, vObjsRefed, vObjsDerefed );
+ int i, iObj, RetValue = Vec_IntSize(vNodes);
+ Vec_IntFree( vNamesInv );
+ Vec_IntFree( vObjsRefed );
+ Vec_IntFree( vObjsDerefed );
+ for ( i = 0; i < 5; i++ )
+ nGates[i] = 0;
+ Vec_IntForEachEntry( vNodes, iObj, i )
+ {
+ int nFan = Acb_ObjFaninNum(pNtkF, iObj);
+ int Type = Acb_ObjType( pNtkF, iObj );
+ if ( Type == ABC_OPER_CONST_F )
+ nGates[0]++;
+ else if ( Type == ABC_OPER_CONST_T )
+ nGates[1]++;
+ else if ( Type == ABC_OPER_BIT_BUF || Type == ABC_OPER_CO )
+ nGates[2]++;
+ else if ( Type == ABC_OPER_BIT_INV )
+ nGates[3]++;
+ else
+ {
+ assert( nFan >= 2 );
+ nGates[4] += Acb_ObjFaninNum(pNtkF, iObj)-1;
+ }
+ }
+ Vec_IntFree( vNodes );
+ Acb_ManFree( pNtkF->pDesign );
+ return RetValue;
+}
+Vec_Ptr_t * Acb_NtkReturnMfsGates( char * pFileName, Vec_Ptr_t * vNodes )
+{
+ Vec_Ptr_t * vMffc = Vec_PtrAlloc( 100 );
+ Acb_Ntk_t * pNtkF = Acb_VerilogSimpleRead( pFileName, NULL );
+ Vec_Int_t * vNamesInv = Vec_IntInvert( &pNtkF->vObjName, 0 ) ;
+ Vec_Int_t * vNodeObjs = Acb_NamesToIds( pNtkF, vNamesInv, vNodes );
+ Vec_Int_t * vNodeMffc = Acb_NtkCollectMffc( pNtkF, NULL, vNodeObjs );
+ int i, iObj;
+ Vec_IntForEachEntry( vNodeMffc, iObj, i )
+ Vec_PtrPush( vMffc, Abc_UtilStrsav( Acb_ObjNameStr(pNtkF, iObj) ) );
+//Vec_IntPrint( vNodeMffc );
+//Vec_PtrPrintNames( vMffc );
+ Vec_IntFree( vNodeMffc );
+ Vec_IntFree( vNodeObjs );
+ Vec_IntFree( vNamesInv );
+ Acb_ManFree( pNtkF->pDesign );
+ return vMffc;
+}
/**Function*************************************************************
@@ -671,6 +894,8 @@ int Acb_NtkExtract( char * pFileName0, char * pFileName1, int fUseXors, int fVer
int nTargets = Vec_IntSize(&pNtkF->vTargets);
Gia_Man_t * pGiaF = Acb_NtkToGia2( pNtkF, fUseBuf, fUseXors, &pNtkF->vTargets, 0 );
Gia_Man_t * pGiaG = Acb_NtkToGia2( pNtkG, 0, 0, NULL, nTargets );
+ pGiaF->pSpec = Abc_UtilStrsav( pNtkF->pDesign->pSpec );
+ pGiaG->pSpec = Abc_UtilStrsav( pNtkG->pDesign->pSpec );
assert( Acb_NtkCiNum(pNtkF) == Acb_NtkCiNum(pNtkG) );
assert( Acb_NtkCoNum(pNtkF) == Acb_NtkCoNum(pNtkG) );
*ppGiaF = pGiaF;
@@ -784,6 +1009,8 @@ int Abc_NtkExtract( char * pFileName0, char * pFileName1, int fUseXors, int fVer
Gia_Man_t * pGiaG = Abc_NtkToGia2( pNtkG, 0 );
assert( Abc_NtkCiNum(pNtkF) == Abc_NtkCiNum(pNtkG) );
assert( Abc_NtkCoNum(pNtkF) == Abc_NtkCoNum(pNtkG) );
+ pGiaF->pSpec = Abc_UtilStrsav( pNtkF->pSpec );
+ pGiaG->pSpec = Abc_UtilStrsav( pNtkG->pSpec );
*ppGiaF = pGiaF;
*ppGiaG = pGiaG;
*pvNodes = Abc_NtkCollectCopies( pNtkF, pGiaF, pvNodesR, pvPolar );
@@ -846,7 +1073,7 @@ Vec_Int_t * Acb_NtkPlaces( char * pFileName, Vec_Ptr_t * vNames )
ABC_FREE( pBuffer );
return vPlaces;
}
-void Acb_NtkInsert( char * pFileNameIn, char * pFileNameOut, Vec_Ptr_t * vNames, int fNumber )
+void Acb_NtkInsert( char * pFileNameIn, char * pFileNameOut, Vec_Ptr_t * vNames, int fNumber, int fSkipMffc )
{
int i, k, Prev = 0, Pos, Pos2, iObj;
Vec_Int_t * vPlaces;
@@ -864,15 +1091,32 @@ void Acb_NtkInsert( char * pFileNameIn, char * pFileNameOut, Vec_Ptr_t * vNames,
printf( "Cannot open input file \"%s\".\n", pFileNameIn );
return;
}
- vPlaces = Acb_NtkPlaces( pFileNameIn, vNames );
- Vec_IntForEachEntryDouble( vPlaces, Pos, iObj, i )
+ if ( fSkipMffc )
{
- for ( k = Prev; k < Pos; k++ )
- fputc( pBuffer[k], pFile );
- fprintf( pFile, "// [t_%d = %s] //", iObj, (char *)Vec_PtrEntry(vNames, iObj) );
- Prev = Pos;
+ Vec_Ptr_t * vMffcNames = Acb_NtkReturnMfsGates( pFileNameIn, vNames );
+ vPlaces = Acb_NtkPlaces( pFileNameIn, vMffcNames );
+ Vec_IntForEachEntryDouble( vPlaces, Pos, iObj, i )
+ {
+ for ( k = Prev; k < Pos; k++ )
+ fputc( pBuffer[k], pFile );
+ fprintf( pFile, "// MFFC %d = %s //", iObj, (char *)Vec_PtrEntry(vMffcNames, iObj) );
+ Prev = Pos;
+ }
+ Vec_IntFree( vPlaces );
+ Vec_PtrFreeFree( vMffcNames );
+ }
+ else
+ {
+ vPlaces = Acb_NtkPlaces( pFileNameIn, vNames );
+ Vec_IntForEachEntryDouble( vPlaces, Pos, iObj, i )
+ {
+ for ( k = Prev; k < Pos; k++ )
+ fputc( pBuffer[k], pFile );
+ fprintf( pFile, "// [t_%d = %s] //", iObj, (char *)Vec_PtrEntry(vNames, iObj) );
+ Prev = Pos;
+ }
+ Vec_IntFree( vPlaces );
}
- Vec_IntFree( vPlaces );
pName = strstr(pBuffer, "endmodule");
Pos2 = pName - pBuffer;
for ( k = Prev; k < Pos2; k++ )
@@ -939,7 +1183,7 @@ void Acb_Ntk4CollectRing( Acb_Ntk_t * pNtk, Vec_Int_t * vStart, Vec_Int_t * vRes
}
void Acb_Ntk4DumpWeightsInt( Acb_Ntk_t * pNtk, Vec_Int_t * vObjs, char * pFileName )
{
- int i, iObj;//, Weight;
+ int i, iObj;//, Count = 0;//, Weight;
Vec_Int_t * vDists, * vStart, * vNexts;
FILE * pFile = fopen( pFileName, "wb" );
if ( pFile == NULL )
@@ -971,15 +1215,30 @@ void Acb_Ntk4DumpWeightsInt( Acb_Ntk_t * pNtk, Vec_Int_t * vObjs, char * pFileNa
// Vec_IntForEachEntry( vDists, Weight, i )
// if ( Weight && Acb_ObjNameStr(pNtk, i)[0] != '1' )
// fprintf( pFile, "%s %d\n", Acb_ObjNameStr(pNtk, i), 10000+Weight );
+/*
+ // mark reachable
+ Vec_IntClear( &pNtk->vArray0 );
+ Acb_NtkIncTravId( pNtk );
+ Acb_NtkForEachCo( pNtk, iObj, i )
+ if ( !Vec_IntEntry(vStatus, i) )
+ Acb_ObjCollectTfi_rec( pNtk, iObj, 0 );
+*/
Acb_NtkForEachObj( pNtk, iObj )
{
char * pName = Acb_ObjNameStr(pNtk, iObj);
int Weight = Vec_IntEntry(vDists, iObj);
if ( Weight == 0 )
Weight = 10000;
+/*
+ if ( !Acb_ObjSetTravIdCur(pNtk, iObj) )
+ {
+ Count++;
+ continue;
+ }
+*/
fprintf( pFile, "%s %d\n", pName, 100000+Weight );
}
-
+ //printf( "Skipped %d nodes.\n", Count );
Vec_IntFree( vDists );
fclose( pFile );
}
@@ -1000,27 +1259,6 @@ void Acb_Ntk4DumpWeights( char * pFileNameIn, Vec_Ptr_t * vObjNames, char * pFil
Vec_IntFree( vObjs );
}
-/**Function*************************************************************
-
- Synopsis []
-
- Description []
-
- SideEffects []
-
- SeeAlso []
-
-***********************************************************************/
-void Acb_NtkRunSim( char * pFileName[4], int nWords, int nBeam, int LevL, int LevU, int fOrder, int fFancy, int fUseBuf, int fRandom, int fUseWeights, int fVerbose, int fVeryVerbose )
-{
- extern int Gia_Sim4Try( char * pFileName0, char * pFileName1, char * pFileName2, int nWords, int nBeam, int LevL, int LevU, int fOrder, int fFancy, int fUseBuf, int fVerbose );
- extern void Acb_NtkRunEco( char * pFileNames[4], int fCheck, int fRandom, int fVerbose, int fVeryVerbose );
- char * pFileNames[4] = { pFileName[2], pFileName[1], fUseWeights ? (char *)"weights.txt" : NULL, pFileName[2] };
- if ( Gia_Sim4Try( pFileName[0], pFileName[1], pFileName[2], nWords, nBeam, LevL, LevU, fOrder, fFancy, fUseBuf, fVerbose ) )
- Acb_NtkRunEco( pFileNames, 1, fRandom, fVerbose, fVeryVerbose );
-}
-
-
////////////////////////////////////////////////////////////////////////
/// END OF FILE ///
////////////////////////////////////////////////////////////////////////
diff --git a/src/base/cba/cbaNtk.c b/src/base/cba/cbaNtk.c
index 5be0aa6c..c3f8fae9 100644
--- a/src/base/cba/cbaNtk.c
+++ b/src/base/cba/cbaNtk.c
@@ -445,7 +445,7 @@ void Cba_NtkObjOrder( Cba_Ntk_t * p, Vec_Int_t * vObjs, Vec_Int_t * vNameIds )
// printf( "%s \n", pName );
// printf( "\n" );
// do the sorting
- Vec_PtrSort( vNames, (int (*)(void))Cba_StrCmp );
+ Vec_PtrSort( vNames, (int (*)(const void *, const void *))Cba_StrCmp );
// print after
// Vec_PtrForEachEntry( char *, vNames, pName, i )
// printf( "%s \n", pName );
diff --git a/src/base/cmd/cmdHist.c b/src/base/cmd/cmdHist.c
index 218d832f..b8cfc98f 100644
--- a/src/base/cmd/cmdHist.c
+++ b/src/base/cmd/cmdHist.c
@@ -65,7 +65,8 @@ void Cmd_HistoryAddCommand( Abc_Frame_t * p, const char * command )
strncmp(Buffer,"time",4) &&
strncmp(Buffer,"quit",4) &&
strncmp(Buffer,"alias",5) &&
-// strncmp(Buffer,"source",6) &&
+ strncmp(Buffer,"source abc.rc",13) &&
+ strncmp(Buffer,"source ..\\abc.rc",16) &&
strncmp(Buffer,"history",7) && strncmp(Buffer,"hi ", 3) && strcmp(Buffer,"hi") &&
Buffer[strlen(Buffer)-1] != '?' )
{
diff --git a/src/base/io/io.c b/src/base/io/io.c
index a5cffbf4..5cf74ef9 100644
--- a/src/base/io/io.c
+++ b/src/base/io/io.c
@@ -24,6 +24,13 @@
#include "proof/abs/abs.h"
#include "sat/bmc/bmc.h"
+#ifdef WIN32
+#include <process.h>
+#define unlink _unlink
+#else
+#include <unistd.h>
+#endif
+
ABC_NAMESPACE_IMPL_START
////////////////////////////////////////////////////////////////////////
@@ -49,6 +56,7 @@ static int IoCommandReadVerilog ( Abc_Frame_t * pAbc, int argc, char **argv );
static int IoCommandReadStatus ( Abc_Frame_t * pAbc, int argc, char **argv );
static int IoCommandReadGig ( Abc_Frame_t * pAbc, int argc, char **argv );
static int IoCommandReadJson ( Abc_Frame_t * pAbc, int argc, char **argv );
+static int IoCommandReadSF ( Abc_Frame_t * pAbc, int argc, char **argv );
static int IoCommandWrite ( Abc_Frame_t * pAbc, int argc, char **argv );
static int IoCommandWriteHie ( Abc_Frame_t * pAbc, int argc, char **argv );
@@ -118,6 +126,7 @@ void Io_Init( Abc_Frame_t * pAbc )
Cmd_CommandAdd( pAbc, "I/O", "read_status", IoCommandReadStatus, 0 );
Cmd_CommandAdd( pAbc, "I/O", "&read_gig", IoCommandReadGig, 0 );
Cmd_CommandAdd( pAbc, "I/O", "read_json", IoCommandReadJson, 0 );
+ Cmd_CommandAdd( pAbc, "I/O", "read_sf", IoCommandReadSF, 0 );
Cmd_CommandAdd( pAbc, "I/O", "write", IoCommandWrite, 0 );
Cmd_CommandAdd( pAbc, "I/O", "write_hie", IoCommandWriteHie, 0 );
@@ -1415,6 +1424,73 @@ usage:
return 1;
}
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+int IoCommandReadSF( Abc_Frame_t * pAbc, int argc, char ** argv )
+{
+ extern void Io_TransformSF2PLA( char * pNameIn, char * pNameOut );
+
+ Abc_Ntk_t * pNtk;
+ FILE * pFile;
+ char * pFileName, * pFileTemp = "_temp_sf_.pla";
+ int c;
+
+ Extra_UtilGetoptReset();
+ while ( ( c = Extra_UtilGetopt( argc, argv, "h" ) ) != EOF )
+ {
+ switch ( c )
+ {
+ case 'h':
+ goto usage;
+ default:
+ goto usage;
+ }
+ }
+ if ( argc != globalUtilOptind + 1 )
+ {
+ goto usage;
+ }
+
+ // get the input file name
+ pFileName = argv[globalUtilOptind];
+ if ( (pFile = fopen( pFileName, "r" )) == NULL )
+ {
+ fprintf( pAbc->Err, "Cannot open input file \"%s\". \n", pFileName );
+ return 1;
+ }
+ fclose( pFile );
+ Io_TransformSF2PLA( pFileName, pFileTemp );
+ pNtk = Io_Read( pFileTemp, IO_FILE_PLA, 1, 0 );
+ unlink( pFileTemp );
+ if ( pNtk == NULL )
+ return 1;
+ ABC_FREE( pNtk->pName );
+ pNtk->pName = Extra_FileNameGeneric( pFileName );
+ ABC_FREE( pNtk->pSpec );
+ pNtk->pSpec = Abc_UtilStrsav( pFileName );
+ // replace the current network
+ Abc_FrameReplaceCurrentNetwork( pAbc, pNtk );
+ Abc_FrameClearVerifStatus( pAbc );
+
+ return 0;
+
+usage:
+ fprintf( pAbc->Err, "usage: read_sf [-h] <file>\n" );
+ fprintf( pAbc->Err, "\t reads file in SF format\n" );
+ fprintf( pAbc->Err, "\t-h : prints the command summary\n" );
+ fprintf( pAbc->Err, "\tfile : the name of a file to read\n" );
+ return 1;
+}
+
/**Function*************************************************************
@@ -2906,17 +2982,36 @@ usage:
***********************************************************************/
int IoCommandWriteVerilog( Abc_Frame_t * pAbc, int argc, char **argv )
{
+ extern void Io_WriteVerilogLut( Abc_Ntk_t * pNtk, char * pFileName, int nLutSize, int fFixed, int fNoModules );
char * pFileName;
- int c, fOnlyAnds = 0;
+ int c, fFixed = 0, fOnlyAnds = 0, fNoModules = 0;
+ int nLutSize = -1;
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "ah" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "Kfamh" ) ) != EOF )
{
switch ( c )
{
+ case 'K':
+ if ( globalUtilOptind >= argc )
+ {
+ Abc_Print( -1, "Command line switch \"-K\" should be followed by an integer.\n" );
+ goto usage;
+ }
+ nLutSize = atoi(argv[globalUtilOptind]);
+ globalUtilOptind++;
+ if ( nLutSize < 2 || nLutSize > 6 )
+ goto usage;
+ break;
+ case 'f':
+ fFixed ^= 1;
+ break;
case 'a':
fOnlyAnds ^= 1;
break;
+ case 'm':
+ fNoModules ^= 1;
+ break;
case 'h':
goto usage;
default:
@@ -2930,6 +3025,8 @@ int IoCommandWriteVerilog( Abc_Frame_t * pAbc, int argc, char **argv )
}
if ( argc != globalUtilOptind + 1 )
goto usage;
+ if ( fFixed )
+ nLutSize = 6;
// get the output file name
pFileName = argv[globalUtilOptind];
// call the corresponding file writer
@@ -2941,14 +3038,19 @@ int IoCommandWriteVerilog( Abc_Frame_t * pAbc, int argc, char **argv )
Io_WriteVerilog( pNtkTemp, pFileName, 1 );
Abc_NtkDelete( pNtkTemp );
}
+ else if ( nLutSize >= 2 && nLutSize <= 6 )
+ Io_WriteVerilogLut( pAbc->pNtkCur, pFileName, nLutSize, fFixed, fNoModules );
else
- Io_Write( pAbc->pNtkCur, pFileName, IO_FILE_VERILOG );
+ Io_Write( pAbc->pNtkCur, pFileName, IO_FILE_VERILOG );
return 0;
usage:
- fprintf( pAbc->Err, "usage: write_verilog [-ah] <file>\n" );
+ fprintf( pAbc->Err, "usage: write_verilog [-K num] [-famh] <file>\n" );
fprintf( pAbc->Err, "\t writes the current network in Verilog format\n" );
+ fprintf( pAbc->Err, "\t-K num : write the network using instances of K-LUTs (2 <= K <= 6) [default = not used]\n" );
+ fprintf( pAbc->Err, "\t-f : toggle using fixed format [default = %s]\n", fFixed? "yes":"no" );
fprintf( pAbc->Err, "\t-a : toggle writing expressions with only ANDs (without XORs and MUXes) [default = %s]\n", fOnlyAnds? "yes":"no" );
+ fprintf( pAbc->Err, "\t-m : toggle writing additional modules [default = %s]\n", !fNoModules? "yes":"no" );
fprintf( pAbc->Err, "\t-h : print the help massage\n" );
fprintf( pAbc->Err, "\tfile : the name of the file to write\n" );
return 1;
diff --git a/src/base/io/ioReadAiger.c b/src/base/io/ioReadAiger.c
index f87d971f..9cf41413 100644
--- a/src/base/io/ioReadAiger.c
+++ b/src/base/io/ioReadAiger.c
@@ -480,6 +480,7 @@ Abc_Ntk_t * Io_ReadAiger( char * pFileName, int fCheck )
if ( pCur < pContents + nFileSize && *pCur != 'c' )
{
int Counter = 0;
+ int fNodeNames = 0;
while ( pCur < pContents + nFileSize && *pCur != 'c' )
{
// get the terminal type
@@ -490,6 +491,12 @@ Abc_Ntk_t * Io_ReadAiger( char * pFileName, int fCheck )
vTerms = pNtkNew->vBoxes;
else if ( *pCur == 'o' || *pCur == 'b' || *pCur == 'c' || *pCur == 'j' || *pCur == 'f' )
vTerms = pNtkNew->vPos;
+ else if ( *pCur == 'n' )
+ {
+ fNodeNames++;
+ while ( *pCur++ != '\n' );
+ continue;
+ }
else
{
// fprintf( stdout, "Wrong terminal type.\n" );
@@ -543,6 +550,8 @@ Abc_Ntk_t * Io_ReadAiger( char * pFileName, int fCheck )
}
// if ( Counter )
// printf( "Io_ReadAiger(): Added %d default names for nameless I/O/register objects.\n", Counter );
+ if ( fNodeNames )
+ printf( "Io_ReadAiger(): The names of internal nodes are not supported. Ignoring %d node names.\n", fNodeNames );
}
else
{
diff --git a/src/base/io/ioReadBench.c b/src/base/io/ioReadBench.c
index 3ea3fb70..42eb908d 100644
--- a/src/base/io/ioReadBench.c
+++ b/src/base/io/ioReadBench.c
@@ -88,7 +88,7 @@ Abc_Ntk_t * Io_ReadBenchNetwork( Extra_FileReader_t * p )
Abc_Ntk_t * pNtk;
Abc_Obj_t * pNode, * pNet;
Vec_Str_t * vString;
- unsigned uTruth[8];
+ unsigned uTruth[2048];
char * pType, ** ppNames, * pString;
int iLine, nNames, nDigits, fLutsPresent = 0;
@@ -161,7 +161,7 @@ Abc_Ntk_t * Io_ReadBenchNetwork( Extra_FileReader_t * p )
ppNames = (char **)vTokens->pArray + 3;
nNames = vTokens->nSize - 3;
// check the number of inputs
- if ( nNames > 8 )
+ if ( nNames > 15 )
{
printf( "%s: Currently cannot read truth tables with more than 8 inputs (%d).\n", Extra_FileReaderGetFileName(p), nNames );
Vec_StrFree( vString );
diff --git a/src/base/io/ioReadBlif.c b/src/base/io/ioReadBlif.c
index 405b44d6..e8979c9b 100644
--- a/src/base/io/ioReadBlif.c
+++ b/src/base/io/ioReadBlif.c
@@ -22,6 +22,9 @@
#include "base/main/main.h"
#include "map/mio/mio.h"
+
+
+
ABC_NAMESPACE_IMPL_START
@@ -877,10 +880,13 @@ int Io_ReadBlifNetworkInputArrival( Io_ReadBlif_t * p, Vec_Ptr_t * vTokens )
return 1;
}
// set timing info
- //Abc_NtkTimeSetArrival( p->pNtkCur, Abc_ObjFanin0(pNet)->Id, (float)TimeRise, (float)TimeFall );
- Vec_IntPush( p->vInArrs, Abc_ObjFanin0(pNet)->Id );
- Vec_IntPush( p->vInArrs, Abc_Float2Int((float)TimeRise) );
- Vec_IntPush( p->vInArrs, Abc_Float2Int((float)TimeFall) );
+ // printf("Debug: Forcing setting of arrival times\n");
+ if (Abc_ObjFaninNum(pNet) >0){
+ Abc_NtkTimeSetArrival( p->pNtkCur, Abc_ObjFanin0(pNet)->Id, (float)TimeRise, (float)TimeFall );
+ Vec_IntPush( p->vInArrs, Abc_ObjFanin0(pNet)->Id );
+ Vec_IntPush( p->vInArrs, Abc_Float2Int((float)TimeRise) );
+ Vec_IntPush( p->vInArrs, Abc_Float2Int((float)TimeFall) );
+ }
return 0;
}
@@ -928,7 +934,10 @@ int Io_ReadBlifNetworkOutputRequired( Io_ReadBlif_t * p, Vec_Ptr_t * vTokens )
return 1;
}
// set timing info
-// Abc_NtkTimeSetRequired( p->pNtkCur, Abc_ObjFanout0(pNet)->Id, (float)TimeRise, (float)TimeFall );
+ // printf("Setting required time for object %d to R %f F %f\n",
+ // Abc_ObjFanout0(pNet)->Id, (float)TimeRise, (float)TimeFall );
+
+ Abc_NtkTimeSetRequired( p->pNtkCur, Abc_ObjFanout0(pNet)->Id, (float)TimeRise, (float)TimeFall );
Vec_IntPush( p->vOutReqs, Abc_ObjFanout0(pNet)->Id );
Vec_IntPush( p->vOutReqs, Abc_Float2Int((float)TimeRise) );
Vec_IntPush( p->vOutReqs, Abc_Float2Int((float)TimeFall) );
diff --git a/src/base/io/ioReadBlifMv.c b/src/base/io/ioReadBlifMv.c
index c1808ef5..e5c6fe49 100644
--- a/src/base/io/ioReadBlifMv.c
+++ b/src/base/io/ioReadBlifMv.c
@@ -1351,7 +1351,8 @@ static int Io_MvParseLineSubckt( Io_MvMod_t * p, char * pLine )
Abc_Ntk_t * pModel;
Abc_Obj_t * pBox, * pNet, * pTerm;
char * pToken, * pName, * pName2, ** ppNames;
- int nEquals, Last, i, k;
+ int nEquals, i, k;
+ word Last;
// split the line into tokens
nEquals = Io_MvCountChars( pLine, '=' );
@@ -1404,9 +1405,9 @@ static int Io_MvParseLineSubckt( Io_MvMod_t * p, char * pLine )
pName2 = NULL;
pName = Abc_ObjName(Abc_ObjFanout0(pTerm));
for ( k = 0; k < nEquals; k++ )
- if ( !strcmp( ppNames[2*((k+Last)%nEquals)], pName ) )
+ if ( !strcmp( ppNames[2*(int)((k+Last)%nEquals)], pName ) )
{
- pName2 = ppNames[2*((k+Last)%nEquals)+1];
+ pName2 = ppNames[2*(int)((k+Last)%nEquals)+1];
Last = k+Last+1;
break;
}
@@ -1656,7 +1657,7 @@ static int Io_MvWriteValues( Abc_Obj_t * pNode, Vec_Str_t * vFunc )
***********************************************************************/
static int Io_MvParseLiteralMv( Io_MvMod_t * p, Abc_Obj_t * pNode, char * pToken, Vec_Str_t * vFunc, int iLit )
{
- char Buffer[10];
+ char Buffer[16];
Io_MvVar_t * pVar;
Abc_Obj_t * pFanin, * pNet;
char * pCur, * pNext;
diff --git a/src/base/io/ioUtil.c b/src/base/io/ioUtil.c
index c6b47b11..ddfcc91a 100644
--- a/src/base/io/ioUtil.c
+++ b/src/base/io/ioUtil.c
@@ -862,6 +862,62 @@ FILE * Io_FileOpen( const char * FileName, const char * PathVar, const char * Mo
}
}
+/**Function*************************************************************
+
+ Synopsis [Tranform SF into PLA.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+void Io_TransformSF2PLA( char * pNameIn, char * pNameOut )
+{
+ int fStart = 0, Size = 1000000;
+ char * pBuffer, * pToken;
+ FILE * pFileIn = fopen( pNameIn, "rb" );
+ FILE * pFileOut = fopen( pNameOut, "wb" );
+ if ( pFileIn == NULL )
+ {
+ if ( pFileOut ) fclose( pFileOut );
+ printf( "Cannot open file \"%s\" for reading.\n", pNameIn );
+ return;
+ }
+ if ( pFileOut == NULL )
+ {
+ if ( pFileIn ) fclose( pFileIn );
+ printf( "Cannot open file \"%s\" for reading.\n", pNameOut );
+ return;
+ }
+ pBuffer = ABC_ALLOC( char, Size );
+ fprintf( pFileOut, ".type fd\n" );
+ while ( fgets(pBuffer, Size, pFileIn) )
+ {
+ if ( strstr(pBuffer, "END_SDF") )
+ break;
+ if ( strstr(pBuffer, "SDF") )
+ {
+ char * pRes = fgets(pBuffer, Size, pFileIn);
+ assert( pRes != NULL );
+ if ( (pToken = strtok( pBuffer, " \t\r\n" )) )
+ fprintf( pFileOut, ".i %d\n", atoi(pToken) );
+ if ( (pToken = strtok( NULL, " \t\r\n" )) )
+ fprintf( pFileOut, ".o %d\n", atoi(pToken) );
+ if ( (pToken = strtok( NULL, " \t\r\n" )) )
+ fprintf( pFileOut, ".p %d\n", atoi(pToken) );
+ fStart = 1;
+ }
+ else if ( fStart )
+ fprintf( pFileOut, "%s", pBuffer );
+ }
+ fprintf( pFileOut, ".e\n" );
+ fclose( pFileIn );
+ fclose( pFileOut );
+ ABC_FREE( pBuffer );
+}
+
////////////////////////////////////////////////////////////////////////
/// END OF FILE ///
////////////////////////////////////////////////////////////////////////
diff --git a/src/base/io/ioWriteBench.c b/src/base/io/ioWriteBench.c
index 81d64582..23de719e 100644
--- a/src/base/io/ioWriteBench.c
+++ b/src/base/io/ioWriteBench.c
@@ -259,7 +259,7 @@ int Io_WriteBenchLutOneNode( FILE * pFile, Abc_Obj_t * pNode, Vec_Int_t * vTruth
int i, nFanins;
assert( Abc_ObjIsNode(pNode) );
nFanins = Abc_ObjFaninNum(pNode);
- assert( nFanins <= 8 );
+ assert( nFanins <= 15 );
// compute the truth table
pTruth = Hop_ManConvertAigToTruth( (Hop_Man_t *)pNode->pNtk->pManFunc, Hop_Regular((Hop_Obj_t *)pNode->pData), nFanins, vTruth, 0 );
if ( Hop_IsComplement((Hop_Obj_t *)pNode->pData) )
diff --git a/src/base/io/ioWriteDot.c b/src/base/io/ioWriteDot.c
index d9687c6e..0ab3c4d2 100644
--- a/src/base/io/ioWriteDot.c
+++ b/src/base/io/ioWriteDot.c
@@ -100,7 +100,7 @@ void Io_WriteDotNtk( Abc_Ntk_t * pNtk, Vec_Ptr_t * vNodes, Vec_Ptr_t * vNodesSho
// transform logic functions from BDD to SOP
if ( (fHasBdds = Abc_NtkIsBddLogic(pNtk)) )
{
- if ( !Abc_NtkBddToSop(pNtk, -1, ABC_INFINITY) )
+ if ( !Abc_NtkBddToSop(pNtk, -1, ABC_INFINITY, 1) )
{
printf( "Io_WriteDotNtk(): Converting to SOPs has failed.\n" );
return;
@@ -463,7 +463,7 @@ void Io_WriteDotSeq( Abc_Ntk_t * pNtk, Vec_Ptr_t * vNodes, Vec_Ptr_t * vNodesSho
// transform logic functions from BDD to SOP
if ( (fHasBdds = Abc_NtkIsBddLogic(pNtk)) )
{
- if ( !Abc_NtkBddToSop(pNtk, -1, ABC_INFINITY) )
+ if ( !Abc_NtkBddToSop(pNtk, -1, ABC_INFINITY, 1) )
{
printf( "Io_WriteDotNtk(): Converting to SOPs has failed.\n" );
return;
diff --git a/src/base/io/ioWriteVerilog.c b/src/base/io/ioWriteVerilog.c
index 2e481324..e05aed2e 100644
--- a/src/base/io/ioWriteVerilog.c
+++ b/src/base/io/ioWriteVerilog.c
@@ -567,6 +567,14 @@ void Io_WriteVerilogObjects( FILE * pFile, Abc_Ntk_t * pNtk, int fOnlyAnds )
Hop_IthVar((Hop_Man_t *)pNtk->pManFunc, k)->pData = Extra_UtilStrsav(Io_WriteVerilogGetName(Abc_ObjName(pFanin)));
// write the formula
Hop_ObjPrintVerilog( pFile, pFunc, vLevels, 0, fOnlyAnds );
+ if ( pObj->fPersist )
+ {
+ Abc_Obj_t * pFan0 = Abc_ObjFanin0(Abc_ObjFanin(pObj, 0));
+ Abc_Obj_t * pFan1 = Abc_ObjFanin0(Abc_ObjFanin(pObj, 1));
+ int Cond = Abc_ObjIsNode(pFan0) && Abc_ObjIsNode(pFan1) && !pFan0->fPersist && !pFan1->fPersist;
+ fprintf( pFile, "; // MUXF7 %s\n", Cond ? "":"to be legalized" );
+ }
+ else
fprintf( pFile, ";\n" );
// clear the input names
Abc_ObjForEachFanin( pObj, pFanin, k )
@@ -631,10 +639,8 @@ int Io_WriteVerilogWiresCount( Abc_Ntk_t * pNtk )
char * Io_WriteVerilogGetName( char * pName )
{
static char Buffer[500];
- int Length, i;
- Length = strlen(pName);
- // consider the case of a signal having name "0" or "1"
- if ( !(Length == 1 && (pName[0] == '0' || pName[0] == '1')) )
+ int i, Length = strlen(pName);
+ if ( pName[0] < '0' || pName[0] > '9' )
{
for ( i = 0; i < Length; i++ )
if ( !((pName[i] >= 'a' && pName[i] <= 'z') ||
@@ -653,6 +659,248 @@ char * Io_WriteVerilogGetName( char * pName )
return Buffer;
}
+
+/**Function*************************************************************
+
+ Synopsis [Write the network of K-input LUTs.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+void Io_WriteLutModule( FILE * pFile, int nLutSize )
+{
+ fprintf( pFile, "module lut%d #( parameter TT = %d\'h0 ) ( input [%d:0] in, output out );\n", nLutSize, 1<<nLutSize, nLutSize-1 );
+ fprintf( pFile, " assign out = TT[in];\n" );
+ fprintf( pFile, "endmodule\n\n" );
+}
+void Io_WriteFixedModules( FILE * pFile )
+{
+ fprintf( pFile, "module LUT6 #( parameter INIT = 64\'h0000000000000000 ) (\n" );
+ fprintf( pFile, " output O,\n" );
+ fprintf( pFile, " input I0,\n" );
+ fprintf( pFile, " input I1,\n" );
+ fprintf( pFile, " input I2,\n" );
+ fprintf( pFile, " input I3,\n" );
+ fprintf( pFile, " input I4,\n" );
+ fprintf( pFile, " input I5\n" );
+ fprintf( pFile, ");\n" );
+ fprintf( pFile, " assign O = INIT[ {I5, I4, I3, I2, I1, I0} ];\n" );
+ fprintf( pFile, "endmodule\n\n" );
+
+ fprintf( pFile, "module MUXF7 (\n" );
+ fprintf( pFile, " output O,\n" );
+ fprintf( pFile, " input I0,\n" );
+ fprintf( pFile, " input I1,\n" );
+ fprintf( pFile, " input S\n" );
+ fprintf( pFile, ");\n" );
+ fprintf( pFile, " assign O = S ? I1 : I0;\n" );
+ fprintf( pFile, "endmodule\n\n" );
+
+ fprintf( pFile, "module MUXF8 (\n" );
+ fprintf( pFile, " output O,\n" );
+ fprintf( pFile, " input I0,\n" );
+ fprintf( pFile, " input I1,\n" );
+ fprintf( pFile, " input S\n" );
+ fprintf( pFile, ");\n" );
+ fprintf( pFile, " assign O = S ? I1 : I0;\n" );
+ fprintf( pFile, "endmodule\n\n" );
+}
+void Io_WriteVerilogObjectsLut( FILE * pFile, Abc_Ntk_t * pNtk, int nLutSize, int fFixed )
+{
+ Abc_Ntk_t * pNtkBox;
+ Abc_Obj_t * pObj, * pTerm;
+ int i, k, Counter, nDigits, Length = 0;
+
+ // write boxes
+ nDigits = Abc_Base10Log( Abc_NtkBoxNum(pNtk)-Abc_NtkLatchNum(pNtk) );
+ Counter = 0;
+ Abc_NtkForEachBox( pNtk, pObj, i )
+ {
+ if ( Abc_ObjIsLatch(pObj) )
+ continue;
+ pNtkBox = (Abc_Ntk_t *)pObj->pData;
+ fprintf( pFile, " %s box%0*d", pNtkBox->pName, nDigits, Counter++ );
+ fprintf( pFile, "(" );
+ Abc_NtkForEachPi( pNtkBox, pTerm, k )
+ {
+ fprintf( pFile, ".%s", Io_WriteVerilogGetName(Abc_ObjName(Abc_ObjFanout0(pTerm))) );
+ fprintf( pFile, "(%s), ", Io_WriteVerilogGetName(Abc_ObjName(Abc_ObjFanin0(Abc_ObjFanin(pObj,k)))) );
+ }
+ Abc_NtkForEachPo( pNtkBox, pTerm, k )
+ {
+ fprintf( pFile, ".%s", Io_WriteVerilogGetName(Abc_ObjName(Abc_ObjFanin0(pTerm))) );
+ fprintf( pFile, "(%s)%s", Io_WriteVerilogGetName(Abc_ObjName(Abc_ObjFanout0(Abc_ObjFanout(pObj,k)))), k==Abc_NtkPoNum(pNtkBox)-1? "":", " );
+ }
+ fprintf( pFile, ");\n" );
+ }
+
+ // find the longest signal name
+ Abc_NtkForEachNode( pNtk, pObj, i )
+ {
+ Length = Abc_MaxInt( Length, strlen(Io_WriteVerilogGetName(Abc_ObjName(Abc_ObjFanout0(pObj)))) );
+ Abc_ObjForEachFanin( pObj, pTerm, k )
+ Length = Abc_MaxInt( Length, strlen(Io_WriteVerilogGetName(Abc_ObjName(pTerm))) );
+ }
+
+ // write LUT instances
+ nDigits = Abc_Base10Log( Abc_NtkNodeNum(pNtk) );
+ Counter = 0;
+ if ( fFixed )
+ Abc_NtkForEachNode( pNtk, pObj, i )
+ {
+ if ( pObj->fPersist )
+ {
+ int One = Abc_ObjFanin0(Abc_ObjFanin(pObj, 1))->fPersist && Abc_ObjFanin0(Abc_ObjFanin(pObj, 2))->fPersist;
+ fprintf( pFile, " MUXF%d ", 7+One );
+ fprintf( pFile, " mux_%0*d (", nDigits, Counter++ );
+ fprintf( pFile, " %*s", Length, Io_WriteVerilogGetName(Abc_ObjName(Abc_ObjFanout0(pObj))) );
+ for ( k = Abc_ObjFaninNum(pObj) - 1; k >= 0; k-- )
+ fprintf( pFile, ", %*s", Length, Io_WriteVerilogGetName(Abc_ObjName(Abc_ObjFanin(pObj, k))) );
+ fprintf( pFile, " );\n" );
+ }
+ else
+ {
+ word Truth = Abc_SopToTruth( (char *)pObj->pData, Abc_ObjFaninNum(pObj) );
+ fprintf( pFile, " LUT6 #(64\'h" );
+ fprintf( pFile, "%08x%08x", (unsigned)(Truth >> 32), (unsigned)Truth );
+ fprintf( pFile, ") lut_%0*d (", nDigits, Counter++ );
+ fprintf( pFile, " %*s", Length, Io_WriteVerilogGetName(Abc_ObjName(Abc_ObjFanout0(pObj))) );
+ for ( k = 0; k < Abc_ObjFaninNum(pObj); k++ )
+ fprintf( pFile, ", %*s", Length, Io_WriteVerilogGetName(Abc_ObjName(Abc_ObjFanin(pObj, k))) );
+ for ( ; k < 6; k++ )
+ fprintf( pFile, ", %*s", Length, "1\'b0" );
+ fprintf( pFile, " );\n" );
+ }
+ }
+ else
+ Abc_NtkForEachNode( pNtk, pObj, i )
+ {
+ word Truth = Abc_SopToTruth( (char *)pObj->pData, Abc_ObjFaninNum(pObj) );
+ fprintf( pFile, " lut%d #(%d\'h", nLutSize, 1<<nLutSize );
+ if ( nLutSize == 6 )
+ fprintf( pFile, "%08x%08x", (unsigned)(Truth >> 32), (unsigned)Truth );
+ else
+ fprintf( pFile, "%0*x", 1<<(nLutSize-2), Abc_InfoMask(1 << nLutSize) & (unsigned)Truth );
+ fprintf( pFile, ") lut_%0*d ( {", nDigits, Counter++ );
+ for ( k = nLutSize - 1; k >= Abc_ObjFaninNum(pObj); k-- )
+ fprintf( pFile, "%*s, ", Length, "1\'b0" );
+ for ( k = Abc_ObjFaninNum(pObj) - 1; k >= 0; k-- )
+ fprintf( pFile, "%*s%s", Length, Io_WriteVerilogGetName(Abc_ObjName(Abc_ObjFanin(pObj, k))), k==0 ? "":", " );
+ fprintf( pFile, "}, %*s );\n", Length, Io_WriteVerilogGetName(Abc_ObjName(Abc_ObjFanout0(pObj))) );
+ }
+}
+void Io_WriteVerilogLutInt( FILE * pFile, Abc_Ntk_t * pNtk, int nLutSize, int fFixed )
+{
+ // write inputs and outputs
+// fprintf( pFile, "module %s ( gclk,\n ", Abc_NtkName(pNtk) );
+ fprintf( pFile, "module %s ( ", Io_WriteVerilogGetName(Abc_NtkName(pNtk)) );
+ // add the clock signal if it does not exist
+ if ( Abc_NtkLatchNum(pNtk) > 0 && Nm_ManFindIdByName(pNtk->pManName, "clock", ABC_OBJ_PI) == -1 )
+ fprintf( pFile, "clock, " );
+ // write other primary inputs
+ fprintf( pFile, "\n " );
+ if ( Abc_NtkPiNum(pNtk) > 0 )
+ {
+ Io_WriteVerilogPis( pFile, pNtk, 3 );
+ fprintf( pFile, ",\n " );
+ }
+ if ( Abc_NtkPoNum(pNtk) > 0 )
+ Io_WriteVerilogPos( pFile, pNtk, 3 );
+ fprintf( pFile, " );\n\n" );
+ // add the clock signal if it does not exist
+ if ( Abc_NtkLatchNum(pNtk) > 0 && Nm_ManFindIdByName(pNtk->pManName, "clock", ABC_OBJ_PI) == -1 )
+ fprintf( pFile, " input clock;\n" );
+ // write inputs, outputs, registers, and wires
+ if ( Abc_NtkPiNum(pNtk) > 0 )
+ {
+// fprintf( pFile, " input gclk," );
+ fprintf( pFile, " input " );
+ Io_WriteVerilogPis( pFile, pNtk, 10 );
+ fprintf( pFile, ";\n" );
+ }
+ if ( Abc_NtkPoNum(pNtk) > 0 )
+ {
+ fprintf( pFile, " output" );
+ Io_WriteVerilogPos( pFile, pNtk, 5 );
+ fprintf( pFile, ";\n\n" );
+ }
+ // if this is not a blackbox, write internal signals
+ if ( !Abc_NtkHasBlackbox(pNtk) )
+ {
+ if ( Abc_NtkLatchNum(pNtk) > 0 )
+ {
+ fprintf( pFile, " reg" );
+ Io_WriteVerilogRegs( pFile, pNtk, 4 );
+ fprintf( pFile, ";\n\n" );
+ }
+ if ( Io_WriteVerilogWiresCount(pNtk) > 0 )
+ {
+ fprintf( pFile, " wire" );
+ Io_WriteVerilogWires( pFile, pNtk, 4 );
+ fprintf( pFile, ";\n\n" );
+ }
+ // write nodes
+ Io_WriteVerilogObjectsLut( pFile, pNtk, nLutSize, fFixed );
+ // write registers
+ if ( Abc_NtkLatchNum(pNtk) > 0 )
+ {
+ fprintf( pFile, "\n" );
+ Io_WriteVerilogLatches( pFile, pNtk );
+ }
+ }
+ // finalize the file
+ fprintf( pFile, "\nendmodule\n\n" );
+}
+void Io_WriteVerilogLut( Abc_Ntk_t * pNtk, char * pFileName, int nLutSize, int fFixed, int fNoModules )
+{
+ FILE * pFile;
+ Abc_Ntk_t * pNtkTemp;
+ Abc_Obj_t * pObj;
+ int i, Counter = 0;
+ Abc_NtkForEachNode( pNtk, pObj, i )
+ if ( Abc_ObjFaninNum(pObj) > nLutSize )
+ {
+ if ( Counter < 3 )
+ printf( "Node \"%s\" has the fanin count (%d) larger than the LUT size (%d).\n", Abc_ObjName(pObj), Abc_ObjFaninNum(pObj), nLutSize );
+ Counter++;
+ }
+ if ( Counter )
+ {
+ printf( "In total, %d internal logic nodes exceed the fanin count limit. Verilog is not written.\n", Counter );
+ return;
+ }
+
+ // start the output stream
+ pFile = fopen( pFileName, "w" );
+ if ( pFile == NULL )
+ {
+ fprintf( stdout, "Io_WriteVerilog(): Cannot open the output file \"%s\".\n", pFileName );
+ return;
+ }
+
+ // write the equations for the network
+ fprintf( pFile, "// Benchmark \"%s\" written by ABC on %s\n", pNtk->pName, Extra_TimeStamp() );
+ fprintf( pFile, "\n" );
+ if ( !fNoModules )
+ {
+ if ( fFixed )
+ Io_WriteFixedModules( pFile );
+ else
+ Io_WriteLutModule( pFile, nLutSize );
+ }
+ pNtkTemp = Abc_NtkToNetlist( pNtk );
+ Abc_NtkToSop( pNtkTemp, -1, ABC_INFINITY );
+ Io_WriteVerilogLutInt( pFile, pNtkTemp, nLutSize, fFixed );
+ Abc_NtkDelete( pNtkTemp );
+
+ fprintf( pFile, "\n" );
+ fclose( pFile );
+}
+
////////////////////////////////////////////////////////////////////////
/// END OF FILE ///
////////////////////////////////////////////////////////////////////////
diff --git a/src/base/main/abcapis.h b/src/base/main/abcapis.h
index e384896d..d34306ba 100644
--- a/src/base/main/abcapis.h
+++ b/src/base/main/abcapis.h
@@ -78,8 +78,11 @@ extern ABC_DLL void Abc_NtkSetFlopNum( Abc_Frame_t * pAbc, int nFlops );
// procedures to input/output 'mini LUT'
extern ABC_DLL void Abc_FrameGiaInputMiniLut( Abc_Frame_t * pAbc, void * pMiniLut );
+extern ABC_DLL void Abc_FrameGiaInputMiniLut2( Abc_Frame_t * pAbc, void * pMiniLut );
extern ABC_DLL void * Abc_FrameGiaOutputMiniLut( Abc_Frame_t * pAbc );
extern ABC_DLL char * Abc_FrameGiaOutputMiniLutAttr( Abc_Frame_t * pAbc, void * pMiniLut );
+extern ABC_DLL int * Abc_FrameReadMiniLutSwitching( Abc_Frame_t * pAbc );
+extern ABC_DLL int * Abc_FrameReadMiniLutSwitchingPo( Abc_Frame_t * pAbc );
// procedures to input/output NDR data-structure
extern ABC_DLL void Abc_FrameInputNdr( Abc_Frame_t * pAbc, void * pData );
diff --git a/src/base/main/main.h b/src/base/main/main.h
index 2efb3358..f3457e27 100644
--- a/src/base/main/main.h
+++ b/src/base/main/main.h
@@ -105,10 +105,13 @@ extern ABC_DLL void * Abc_FrameReadManDd();
extern ABC_DLL void * Abc_FrameReadManDec();
extern ABC_DLL void * Abc_FrameReadManDsd();
extern ABC_DLL void * Abc_FrameReadManDsd2();
+extern ABC_DLL Vec_Ptr_t * Abc_FrameReadSignalNames();
+extern ABC_DLL char * Abc_FrameReadSpecName();
extern ABC_DLL char * Abc_FrameReadFlag( char * pFlag );
extern ABC_DLL int Abc_FrameIsFlagEnabled( char * pFlag );
extern ABC_DLL int Abc_FrameIsBatchMode();
+extern ABC_DLL void Abc_FrameSetBatchMode( int Mode );
extern ABC_DLL int Abc_FrameIsBridgeMode();
extern ABC_DLL void Abc_FrameSetBridgeMode();
@@ -147,6 +150,8 @@ extern ABC_DLL void Abc_FrameSetCnf( Vec_Int_t * vInv );
extern ABC_DLL void Abc_FrameSetStr( Vec_Str_t * vInv );
extern ABC_DLL void Abc_FrameSetJsonStrs( Abc_Nam_t * pStrs );
extern ABC_DLL void Abc_FrameSetJsonObjs( Vec_Wec_t * vObjs );
+extern ABC_DLL void Abc_FrameSetSignalNames( Vec_Ptr_t * vNames );
+extern ABC_DLL void Abc_FrameSetSpecName( char * pFileName );
extern ABC_DLL int Abc_FrameCheckPoConst( Abc_Frame_t * p, int iPoNum );
diff --git a/src/base/main/mainFrame.c b/src/base/main/mainFrame.c
index 1d54f4e4..ba41d4c1 100644
--- a/src/base/main/mainFrame.c
+++ b/src/base/main/mainFrame.c
@@ -67,6 +67,8 @@ void * Abc_FrameReadManDec() { if ( s_GlobalFram
void * Abc_FrameReadManDsd() { return s_GlobalFrame->pManDsd; }
void * Abc_FrameReadManDsd2() { return s_GlobalFrame->pManDsd2; }
char * Abc_FrameReadFlag( char * pFlag ) { return Cmd_FlagReadByName( s_GlobalFrame, pFlag ); }
+Vec_Ptr_t * Abc_FrameReadSignalNames() { return s_GlobalFrame->vSignalNames; }
+char * Abc_FrameReadSpecName() { return s_GlobalFrame->pSpecName; }
int Abc_FrameReadBmcFrames( Abc_Frame_t * p ) { return s_GlobalFrame->nFrames; }
int Abc_FrameReadProbStatus( Abc_Frame_t * p ) { return s_GlobalFrame->Status; }
@@ -102,8 +104,11 @@ void Abc_FrameSetManDsd2( void * pMan ) { if (s_GlobalFrame
void Abc_FrameSetInv( Vec_Int_t * vInv ) { Vec_IntFreeP(&s_GlobalFrame->pAbcWlcInv); s_GlobalFrame->pAbcWlcInv = vInv; }
void Abc_FrameSetJsonStrs( Abc_Nam_t * pStrs ) { Abc_NamDeref( s_GlobalFrame->pJsonStrs ); s_GlobalFrame->pJsonStrs = pStrs; }
void Abc_FrameSetJsonObjs( Vec_Wec_t * vObjs ) { Vec_WecFreeP(&s_GlobalFrame->vJsonObjs ); s_GlobalFrame->vJsonObjs = vObjs; }
+void Abc_FrameSetSignalNames( Vec_Ptr_t * vNames ) { if ( s_GlobalFrame->vSignalNames ) Vec_PtrFreeFree( s_GlobalFrame->vSignalNames ); s_GlobalFrame->vSignalNames = vNames; }
+void Abc_FrameSetSpecName( char * pFileName ) { ABC_FREE( s_GlobalFrame->pSpecName ); s_GlobalFrame->pSpecName = pFileName; }
int Abc_FrameIsBatchMode() { return s_GlobalFrame ? s_GlobalFrame->fBatchMode : 0; }
+void Abc_FrameSetBatchMode( int Mode ) { if ( s_GlobalFrame ) s_GlobalFrame->fBatchMode = Mode; }
int Abc_FrameIsBridgeMode() { return s_GlobalFrame ? s_GlobalFrame->fBridgeMode : 0; }
void Abc_FrameSetBridgeMode() { if ( s_GlobalFrame ) s_GlobalFrame->fBridgeMode = 1; }
@@ -231,6 +236,9 @@ void Abc_FrameDeallocate( Abc_Frame_t * p )
}
Vec_IntFreeP( &p->vIndFlops );
Vec_PtrFreeP( &p->vLTLProperties_global );
+ if ( p->vSignalNames )
+ Vec_PtrFreeFree( p->vSignalNames );
+ ABC_FREE( p->pSpecName );
Abc_FrameDeleteAllNetworks( p );
ABC_FREE( p->pDrivingCell );
ABC_FREE( p->pCex2 );
diff --git a/src/base/main/mainInit.c b/src/base/main/mainInit.c
index d85d7b67..693cea90 100644
--- a/src/base/main/mainInit.c
+++ b/src/base/main/mainInit.c
@@ -65,6 +65,8 @@ extern void Abc85_Init( Abc_Frame_t * pAbc );
extern void Abc85_End( Abc_Frame_t * pAbc );
extern void Glucose_Init( Abc_Frame_t *pAbc );
extern void Glucose_End( Abc_Frame_t * pAbc );
+extern void Glucose2_Init( Abc_Frame_t *pAbc );
+extern void Glucose2_End( Abc_Frame_t * pAbc );
static Abc_FrameInitializer_t* s_InitializerStart = NULL;
static Abc_FrameInitializer_t* s_InitializerEnd = NULL;
@@ -117,9 +119,9 @@ void Abc_FrameInit( Abc_Frame_t * pAbc )
Bac_Init( pAbc );
Cba_Init( pAbc );
Pla_Init( pAbc );
- Sim_Init( pAbc );
Test_Init( pAbc );
Glucose_Init( pAbc );
+ Glucose2_Init( pAbc );
for( p = s_InitializerStart ; p ; p = p->next )
if(p->init)
p->init(pAbc);
@@ -157,7 +159,6 @@ void Abc_FrameEnd( Abc_Frame_t * pAbc )
Bac_End( pAbc );
Cba_End( pAbc );
Pla_End( pAbc );
- Sim_End( pAbc );
Test_End( pAbc );
Glucose_End( pAbc );
}
diff --git a/src/base/main/mainInt.h b/src/base/main/mainInt.h
index bc57ad2a..e860878e 100644
--- a/src/base/main/mainInt.h
+++ b/src/base/main/mainInt.h
@@ -133,6 +133,8 @@ struct Abc_Frame_t_
int nFrames; // the number of time frames completed by BMC
Vec_Ptr_t * vPlugInComBinPairs; // pairs of command and its binary name
Vec_Ptr_t * vLTLProperties_global; // related to LTL
+ Vec_Ptr_t * vSignalNames; // temporary storage for signal names
+ char * pSpecName;
void * pSave1;
void * pSave2;
void * pSave3;
diff --git a/src/base/main/mainUtils.c b/src/base/main/mainUtils.c
index d1fe1d20..377299fd 100644
--- a/src/base/main/mainUtils.c
+++ b/src/base/main/mainUtils.c
@@ -52,7 +52,14 @@ static char * DateReadFromDateString( char * datestr );
char * Abc_UtilsGetVersion( Abc_Frame_t * pAbc )
{
static char Version[1000];
+#if __GNUC__
+ #pragma GCC diagnostic push
+ #pragma GCC diagnostic ignored "-Wdate-time"
+#endif
sprintf(Version, "%s (compiled %s %s)", ABC_VERSION, __DATE__, __TIME__);
+#if __GNUC__
+ #pragma GCC diagnostic pop
+#endif
return Version;
}
diff --git a/src/base/wlc/wlc.c b/src/base/wlc/wlc.c
index 6f0890e2..261ec96b 100644
--- a/src/base/wlc/wlc.c
+++ b/src/base/wlc/wlc.c
@@ -265,6 +265,446 @@ void Wlc_BlastMultiplierCnfTest( int nBits )
sat_solver_delete( pSat );
}
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+Vec_Int_t * Wlc_ManGenAdderN( Gia_Man_t * p, int nLits, int * pLitsA, int * pLitsB, int Carry )
+{
+ extern void Wlc_BlastFullAdder( Gia_Man_t * pNew, int a, int b, int c, int * pc, int * ps );
+ Vec_Int_t * vRes = Vec_IntStart( nLits + 1 );
+ int i, * pRes = Vec_IntArray(vRes);
+ for ( i = 0; i < nLits; i++ )
+ Wlc_BlastFullAdder( p, pLitsA[i], pLitsB[i], Carry, &Carry, &pRes[i] );
+ pRes[nLits] = Carry;
+ return vRes;
+}
+Vec_Int_t * Wlc_ManGenAdder2_rec( Gia_Man_t * p, int nLits, int * pLitsA, int * pLitsB, int Carry, int Size )
+{
+ Vec_Int_t * vRes, * vRes0, * vRes1, * vRes2; int i, iCtrl;
+ if ( nLits == Size )
+ return Wlc_ManGenAdderN( p, nLits, pLitsA, pLitsB, Carry );
+ vRes0 = Wlc_ManGenAdder2_rec( p, nLits/2, pLitsA, pLitsB, Carry, Size );
+ vRes1 = Wlc_ManGenAdder2_rec( p, nLits/2, pLitsA + nLits/2, pLitsB + nLits/2, 0, Size );
+ vRes2 = Wlc_ManGenAdder2_rec( p, nLits/2, pLitsA + nLits/2, pLitsB + nLits/2, 1, Size );
+ vRes = Vec_IntAlloc( nLits + 1 );
+ Vec_IntAppend( vRes, vRes0 );
+ iCtrl = Vec_IntPop( vRes );
+ for ( i = 0; i <= nLits/2; i++ )
+ Vec_IntPush( vRes, Gia_ManHashMux(p, iCtrl, Vec_IntEntry(vRes2, i), Vec_IntEntry(vRes1, i)) );
+ assert( Vec_IntSize(vRes) == nLits + 1 );
+ Vec_IntFree( vRes0 );
+ Vec_IntFree( vRes1 );
+ Vec_IntFree( vRes2 );
+ return vRes;
+}
+Gia_Man_t * Wlc_ManGenAdder2( int nBits, int Size, int fSigned )
+{
+ Gia_Man_t * pTemp, * pNew; int n, i, iLit, nBitsAll;
+ Vec_Int_t * vOuts, * vLits = Vec_IntAlloc( 1000 );
+ pNew = Gia_ManStart( 1000 );
+ pNew->pName = Abc_UtilStrsav( "adder" );
+ for ( nBitsAll = Size; nBitsAll < nBits; nBitsAll *= 2 )
+ ;
+ for ( n = 0; n < 2; n++ )
+ {
+ for ( i = 0; i < nBits; i++ )
+ Vec_IntPush( vLits, Gia_ManAppendCi(pNew) );
+ for ( ; i < nBitsAll; i++ )
+ Vec_IntPush( vLits, fSigned ? Vec_IntEntry(vLits, nBits-1) : 0 );
+ }
+ Gia_ManHashAlloc( pNew );
+ vOuts = Wlc_ManGenAdder2_rec( pNew, nBitsAll, Vec_IntEntryP(vLits, 0), Vec_IntEntryP(vLits, Vec_IntSize(vLits)/2), 0, Size );
+ Gia_ManHashStop( pNew );
+ Vec_IntForEachEntry( vOuts, iLit, i )
+ Gia_ManAppendCo( pNew, iLit );
+ Vec_IntFree( vLits );
+ Vec_IntFree( vOuts );
+ pNew = Gia_ManCleanup( pTemp = pNew );
+ Gia_ManStop( pTemp );
+ return pNew;
+}
+
+Vec_Int_t * Wlc_ManGenAdder_rec( Gia_Man_t * p, int nLits, int * pLitsA, int * pLitsB, int Carry, int Size )
+{
+ Vec_Int_t * vRes, * vRes0, * vRes1, * vRes2, * vRes3, * vRes4; int i, iCtrl;
+ if ( nLits == Size )
+ return Wlc_ManGenAdderN( p, nLits, pLitsA, pLitsB, Carry );
+ assert( nLits % 3 == 0 );
+ vRes0 = Wlc_ManGenAdder_rec( p, nLits/3, pLitsA + 0*nLits/3, pLitsB + 0*nLits/3, Carry, Size );
+ vRes1 = Wlc_ManGenAdder_rec( p, nLits/3, pLitsA + 1*nLits/3, pLitsB + 1*nLits/3, 0, Size );
+ vRes2 = Wlc_ManGenAdder_rec( p, nLits/3, pLitsA + 1*nLits/3, pLitsB + 1*nLits/3, 1, Size );
+ vRes3 = Wlc_ManGenAdder_rec( p, nLits/3, pLitsA + 2*nLits/3, pLitsB + 2*nLits/3, 0, Size );
+ vRes4 = Wlc_ManGenAdder_rec( p, nLits/3, pLitsA + 2*nLits/3, pLitsB + 2*nLits/3, 1, Size );
+ vRes = Vec_IntAlloc( nLits + 1 );
+ Vec_IntAppend( vRes, vRes0 );
+ iCtrl = Vec_IntPop( vRes );
+ for ( i = 0; i <= nLits/3; i++ )
+ Vec_IntPush( vRes, Gia_ManHashMux(p, iCtrl, Vec_IntEntry(vRes2, i), Vec_IntEntry(vRes1, i)) );
+ iCtrl = Vec_IntPop( vRes );
+ for ( i = 0; i <= nLits/3; i++ )
+ Vec_IntPush( vRes, Gia_ManHashMux(p, iCtrl, Vec_IntEntry(vRes4, i), Vec_IntEntry(vRes3, i)) );
+ assert( Vec_IntSize(vRes) == nLits + 1 );
+ Vec_IntFree( vRes0 );
+ Vec_IntFree( vRes1 );
+ Vec_IntFree( vRes2 );
+ Vec_IntFree( vRes3 );
+ Vec_IntFree( vRes4 );
+ return vRes;
+}
+Gia_Man_t * Wlc_ManGenAdder( int nBits )
+{
+ Gia_Man_t * pTemp, * pNew; int n, i, iLit, nBitsAll;
+ Vec_Int_t * vOuts, * vLits = Vec_IntAlloc( 1000 );
+ pNew = Gia_ManStart( 1000 );
+ pNew->pName = Abc_UtilStrsav( "adder" );
+ for ( nBitsAll = 3; nBitsAll < nBits; nBitsAll *= 3 )
+ ;
+ for ( n = 0; n < 2; n++ )
+ {
+ for ( i = 0; i < nBits; i++ )
+ Vec_IntPush( vLits, Gia_ManAppendCi(pNew) );
+ for ( ; i < nBitsAll; i++ )
+ Vec_IntPush( vLits, 0 );
+ }
+ Gia_ManHashAlloc( pNew );
+ vOuts = Wlc_ManGenAdder_rec( pNew, nBitsAll, Vec_IntEntryP(vLits, 0), Vec_IntEntryP(vLits, Vec_IntSize(vLits)/2), 0, 3 );
+ Gia_ManHashStop( pNew );
+ Vec_IntForEachEntryStop( vOuts, iLit, i, nBits+1 )
+ Gia_ManAppendCo( pNew, iLit );
+ Vec_IntFree( vLits );
+ Vec_IntFree( vOuts );
+ pNew = Gia_ManCleanup( pTemp = pNew );
+ Gia_ManStop( pTemp );
+ return pNew;
+}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+void Wlc_BuildOne32( Gia_Man_t * p, int * pLitIn, int * pLitOut )
+{
+ Wlc_BlastFullAdder( p, pLitIn[0], pLitIn[1], pLitIn[2], &pLitIn[5], &pLitOut[0] );
+ Wlc_BlastFullAdder( p, pLitIn[3], pLitIn[4], pLitIn[5], &pLitOut[2], &pLitOut[1] );
+}
+void Wlc_BuildOne51( Gia_Man_t * p, int * pLitIn, int * pLitOut )
+{
+ int Lit00, Lit01, Lit11;
+ Wlc_BlastFullAdder( p, pLitIn[0], pLitIn[1], pLitIn[2], &Lit01, &Lit00 );
+ Wlc_BlastFullAdder( p, pLitIn[3], pLitIn[4], Lit00, &Lit11, &pLitOut[0] );
+ Wlc_BlastFullAdder( p, pLitIn[5], Lit01, Lit11, &pLitOut[2], &pLitOut[1] );
+}
+void Wlc_BuildOne6( Gia_Man_t * p, int * pLitIn, int Const1, int * pLitOut )
+{
+ int Lit00, Lit01, Lit10, Lit11, Lit12;
+ Wlc_BlastFullAdder( p, pLitIn[0], pLitIn[1], pLitIn[2], &Lit01, &Lit00 );
+ Wlc_BlastFullAdder( p, pLitIn[3], pLitIn[4], pLitIn[5], &Lit11, &Lit10 );
+ Wlc_BlastFullAdder( p, Lit00, Lit10, Const1, &Lit12, &pLitOut[0] );
+ Wlc_BlastFullAdder( p, Lit01, Lit11, Lit12, &pLitOut[2],&pLitOut[1] );
+}
+Vec_Wec_t * Wlc_ManGenTree_iter( Gia_Man_t * p, Vec_Wec_t * vBits, int * pCounter )
+{
+ Vec_Wec_t * vBitsNew = Vec_WecStart( Vec_WecSize(vBits) );
+ int i, k, pLitsIn[16], pLitsOut[16], Count = 0, fSimple = Vec_WecMaxLevelSize(vBits) <= 3;
+ for ( i = 0; i < Vec_WecSize(vBits)-1; i++ )
+ {
+ Vec_Int_t * vBits0 = Vec_WecEntry(vBits, i);
+ Vec_Int_t * vBits1 = Vec_WecEntry(vBits, i+1);
+ if ( fSimple )
+ {
+ assert( Vec_IntSize(vBits0) <= 3 );
+ for ( k = 0; Vec_IntSize(vBits0) > 0; k++ )
+ pLitsIn[k] = Vec_IntPop( vBits0 );
+ for ( ; k < 3; k++ )
+ pLitsIn[k] = 0;
+ assert( k == 3 );
+ Wlc_BlastFullAdder( p, pLitsIn[0], pLitsIn[1], pLitsIn[2], &pLitsOut[1], &pLitsOut[0] );
+ Vec_WecPush( vBitsNew, i+0, pLitsOut[0] );
+ Vec_WecPush( vBitsNew, i+1, pLitsOut[1] );
+ Count += 2;
+ continue;
+ }
+ while ( Vec_IntSize(vBits0) >= 6 )
+ {
+ for ( k = 0; k < 6; k++ )
+ pLitsIn[k] = Vec_IntPop( vBits0 );
+ assert( k == 6 );
+ Wlc_BuildOne6( p, pLitsIn, 0, pLitsOut );
+ Vec_WecPush( vBitsNew, i+0, pLitsOut[0] );
+ Vec_WecPush( vBitsNew, i+1, pLitsOut[1] );
+ Vec_WecPush( vBitsNew, i+2, pLitsOut[2] );
+ Count += 3;
+ }
+ if ( Vec_IntSize(vBits0) == 5 && Vec_IntSize(vBits1) > 0 )
+ {
+ for ( k = 0; Vec_IntSize(vBits0) > 0; k++ )
+ pLitsIn[k] = Vec_IntPop( vBits0 );
+ pLitsIn[k++] = Vec_IntPop( vBits1 );
+ assert( k == 6 );
+ Wlc_BuildOne51( p, pLitsIn, pLitsOut );
+ Vec_WecPush( vBitsNew, i+0, pLitsOut[0] );
+ Vec_WecPush( vBitsNew, i+1, pLitsOut[1] );
+ Vec_WecPush( vBitsNew, i+2, pLitsOut[2] );
+ Count += 3;
+ }
+ if ( Vec_IntSize(vBits0) == 5 && Vec_IntSize(vBits1) == 0 )
+ {
+ for ( k = 0; Vec_IntSize(vBits0) > 0; k++ )
+ pLitsIn[k] = Vec_IntPop( vBits0 );
+ pLitsIn[k++] = 0;
+ assert( k == 6 );
+ Wlc_BuildOne6( p, pLitsIn, 0, pLitsOut );
+ Vec_WecPush( vBitsNew, i+0, pLitsOut[0] );
+ Vec_WecPush( vBitsNew, i+1, pLitsOut[1] );
+ Vec_WecPush( vBitsNew, i+2, pLitsOut[2] );
+ Count += 3;
+ }
+ if ( Vec_IntSize(vBits0) == 4 && Vec_IntSize(vBits1) > 0 )
+ {
+ for ( k = 0; Vec_IntSize(vBits0) > 0; k++ )
+ pLitsIn[k] = Vec_IntPop( vBits0 );
+ pLitsIn[k++] = 0;
+ pLitsIn[k++] = Vec_IntPop( vBits1 );
+ assert( k == 6 );
+ Wlc_BuildOne51( p, pLitsIn, pLitsOut );
+ Vec_WecPush( vBitsNew, i+0, pLitsOut[0] );
+ Vec_WecPush( vBitsNew, i+1, pLitsOut[1] );
+ Vec_WecPush( vBitsNew, i+2, pLitsOut[2] );
+ Count += 3;
+ }
+ if ( Vec_IntSize(vBits0) == 3 && Vec_IntSize(vBits1) >= 2 )
+ {
+ for ( k = 0; Vec_IntSize(vBits0) > 0; k++ )
+ pLitsIn[k] = Vec_IntPop( vBits0 );
+ pLitsIn[k++] = Vec_IntPop( vBits1 );
+ pLitsIn[k++] = Vec_IntPop( vBits1 );
+ assert( k == 5 );
+ Wlc_BuildOne32( p, pLitsIn, pLitsOut );
+ Vec_WecPush( vBitsNew, i+0, pLitsOut[0] );
+ Vec_WecPush( vBitsNew, i+1, pLitsOut[1] );
+ Vec_WecPush( vBitsNew, i+2, pLitsOut[2] );
+ Count += 3;
+ }
+ if ( Vec_IntSize(vBits0) >= 3 )
+ {
+ for ( k = 0; k < 3; k++ )
+ pLitsIn[k] = Vec_IntPop( vBits0 );
+ assert( k == 3 );
+ Wlc_BlastFullAdder( p, pLitsIn[0], pLitsIn[1], pLitsIn[2], &pLitsOut[1], &pLitsOut[0] );
+ Vec_WecPush( vBitsNew, i+0, pLitsOut[0] );
+ Vec_WecPush( vBitsNew, i+1, pLitsOut[1] );
+ Count += 2;
+ }
+/*
+ if ( Vec_IntSize(vBits0) == 2 )
+ {
+ Vec_IntClear( vBits0 );
+ Vec_WecPush( vBitsNew, i+0, 0 );
+ Vec_WecPush( vBitsNew, i+1, 0 );
+ Count += 2;
+ }
+*/
+ for ( k = 0; Vec_IntSize(vBits0) > 0; k++ )
+ Vec_WecPush( vBitsNew, i, Vec_IntPop(vBits0) );
+ }
+ if ( pCounter )
+ *pCounter = Count;
+ return vBitsNew;
+}
+void Wlc_ManGenTreeOne( Gia_Man_t * pNew, Vec_Wec_t * vBits0, int fMult, int fVerbose )
+{
+ extern int Wlc_BlastAdder( Gia_Man_t * pNew, int * pAdd0, int * pAdd1, int nBits, int Carry ); // result is in pAdd0
+
+ Vec_Wec_t * vTemp, * vBits = Vec_WecDup( vBits0 );
+ Vec_Int_t * vOuts = Vec_IntAlloc( 1000 ), * vOuts2;
+ Vec_Int_t * vLits0 = Vec_IntAlloc( 1000 );
+ Vec_Int_t * vLits1 = Vec_IntAlloc( 1000 );
+ int i, iLit, nBitsAll = 0, CounterAll = 0, Counter = 1;
+ for ( i = 0; Counter && i < 1000; i++ )
+ {
+ if ( fVerbose ) printf( "LEVEL %d\n", i );
+ if ( fVerbose ) Vec_WecPrint( vBits, 0 );
+ if ( Vec_WecMaxLevelSize(vBits) <= 2 )
+ break;
+ vBits = Wlc_ManGenTree_iter( pNew, vTemp = vBits, &Counter );
+ Vec_WecFree( vTemp );
+ CounterAll += Counter;
+ }
+ printf( "Total count = %d.\n", CounterAll );
+ if ( !fMult )
+ {
+ int Carry;
+/*
+ Vec_WecForEachLevel( vBits, vOuts2, i )
+ {
+ if ( i == 10 )
+ break;
+ if ( i == 0 )
+ {
+ assert( Vec_IntSize(vOuts2) == 1 );
+ Vec_IntPush( vOuts, Vec_IntPop(vOuts2) );
+ continue;
+ }
+ assert( Vec_IntSize(vOuts2) == 1 || Vec_IntSize(vOuts2) == 2 );
+ Vec_IntPush( vLits0, Vec_IntPop(vOuts2) );
+ if ( Vec_IntSize(vOuts2) == 1 )
+ Vec_IntPush( vLits1, Vec_IntPop(vOuts2) );
+ else
+ {
+ Vec_IntPush( vLits1, 0 );
+ }
+ }
+ assert( Vec_IntSize(vLits0) == 9 );
+ assert( Vec_IntSize(vLits1) == 9 );
+*/
+ Vec_WecForEachLevel( vBits, vOuts2, i )
+ {
+ if ( Vec_IntSize(vOuts2) == 0 )
+ break;
+ assert( Vec_IntSize(vOuts2) == 1 || Vec_IntSize(vOuts2) == 2 );
+ Vec_IntPush( vLits0, Vec_IntPop(vOuts2) );
+ if ( Vec_IntSize(vOuts2) == 1 )
+ Vec_IntPush( vLits1, Vec_IntPop(vOuts2) );
+ else
+ Vec_IntPush( vLits1, 0 );
+ }
+ printf( "The adder size is %d.\n", Vec_IntSize(vLits0) );
+ Vec_IntShrink( vLits0, 11 );
+ Vec_IntShrink( vLits1, 11 );
+
+// vOuts2 = Wlc_ManGenAdder_rec( pNew, 9, Vec_IntArray(vLits0), Vec_IntArray(vLits1), 0, 3 );
+// Vec_IntAppend( vOuts, vOuts2 );
+// Vec_IntFree( vOuts2 );
+
+ Carry = Wlc_BlastAdder( pNew, Vec_IntArray(vLits0), Vec_IntArray(vLits1), 11, 0 );
+ Vec_IntAppend( vOuts, vLits0 );
+ Vec_IntPush( vOuts, Carry );
+
+
+ Gia_ManAppendCo( pNew, Vec_IntEntry(vOuts, 11) );
+ }
+ else
+ {
+ Vec_WecForEachLevel( vBits, vOuts2, i )
+ {
+ if ( Vec_IntSize(vOuts2) == 0 )
+ break;
+ assert( Vec_IntSize(vOuts2) == 1 || Vec_IntSize(vOuts2) == 2 );
+ Vec_IntPush( vLits0, Vec_IntPop(vOuts2) );
+ if ( Vec_IntSize(vOuts2) == 1 )
+ Vec_IntPush( vLits1, Vec_IntPop(vOuts2) );
+ else
+ Vec_IntPush( vLits1, 0 );
+ }
+ printf( "The adder size is %d.\n", Vec_IntSize(vLits0) );
+ Vec_IntShrink( vLits0, Gia_ManCiNum(pNew)+1 ); // mult
+ Vec_IntShrink( vLits1, Gia_ManCiNum(pNew)+1 ); // mult
+
+ for ( nBitsAll = 3; nBitsAll < Vec_IntSize(vLits0); nBitsAll *= 3 )
+ ;
+ for ( i = Vec_IntSize(vLits0); i < nBitsAll; i++ )
+ {
+ Vec_IntPush( vLits0, 0 );
+ Vec_IntPush( vLits1, 0 );
+ }
+ assert( Vec_IntSize(vLits0) == nBitsAll );
+ assert( Vec_IntSize(vLits1) == nBitsAll );
+
+ vOuts2 = Wlc_ManGenAdder_rec( pNew, nBitsAll, Vec_IntArray(vLits0), Vec_IntArray(vLits1), 0, 3 );
+ Vec_IntAppend( vOuts, vOuts2 );
+ Vec_IntFree( vOuts2 );
+ //Carry = Wlc_BlastAdder( pNew, Vec_IntArray(vLits0), Vec_IntArray(vLits1), nBitsAll, 0 );
+ //Vec_IntAppend( vOuts, vLits0 );
+ //Vec_IntPush( vOuts, Carry );
+
+ Vec_IntShrink( vOuts, Gia_ManCiNum(pNew) ); // mult
+ //Vec_IntShrink( vOuts, Gia_ManCiNum(pNew)/2 );
+
+ Vec_IntForEachEntry( vOuts, iLit, i )
+ Gia_ManAppendCo( pNew, iLit );
+ }
+
+ Vec_IntFree( vOuts );
+ Vec_IntFree( vLits0 );
+ Vec_IntFree( vLits1 );
+ Vec_WecFree( vBits );
+}
+Gia_Man_t * Wlc_ManGenTree( int nInputs, int Value, int nBits, int fVerbose )
+{
+ Gia_Man_t * pTemp, * pNew; int i, Counter = 0;
+ Vec_Wec_t * vBits = Vec_WecStart( nBits+2 );
+ for ( i = 0; i < nBits+2; i++ )
+ Vec_WecPush( vBits, i, (Value >> i) & 1 );
+ pNew = Gia_ManStart( 1000 );
+ pNew->pName = Abc_UtilStrsav( "tree" );
+ for ( i = 0; i < nInputs; i++ )
+ Vec_WecPush( vBits, 0, Gia_ManAppendCi(pNew) );
+ Gia_ManHashAlloc( pNew );
+ Wlc_ManGenTreeOne( pNew, vBits, 0, fVerbose );
+ Gia_ManHashStop( pNew );
+ Vec_WecFree( vBits );
+ pNew = Gia_ManCleanup( pTemp = pNew );
+ Gia_ManStop( pTemp );
+ return pNew;
+}
+
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+Gia_Man_t * Wlc_ManGenProd( int nInputs, int fVerbose )
+{
+ extern void Wlc_BlastBooth( Gia_Man_t * pNew, int * pArgA, int * pArgB, int nArgA, int nArgB, Vec_Int_t * vRes, int fSigned, int fCla, Vec_Wec_t ** pvProds );
+ extern void Wlc_BlastMultiplier3( Gia_Man_t * pNew, int * pArgA, int * pArgB, int nArgA, int nArgB, Vec_Int_t * vRes, int fSigned, int fCla, Vec_Wec_t ** pvProds );
+ Vec_Int_t * vIns = Vec_IntAlloc( 2*nInputs );
+ Gia_Man_t * pTemp, * pNew;
+ Vec_Wec_t * vProds; int i;
+ pNew = Gia_ManStart( 1000 );
+ pNew->pName = Abc_UtilStrsav( "tree" );
+
+ for ( i = 0; i < 2*nInputs; i++ )
+ Vec_IntPush( vIns, Gia_ManAppendCi(pNew) );
+ //for ( i = 0; i < nInputs; i++ )
+ // Vec_IntPush( vIns, Gia_ManAppendCi(pNew) );
+ //for ( i = 0; i < nInputs; i++ )
+ // Vec_IntPush( vIns, Vec_IntEntry(vIns, i) );
+
+ Gia_ManHashAlloc( pNew );
+ Wlc_BlastBooth( pNew, Vec_IntArray(vIns), Vec_IntArray(vIns)+nInputs, nInputs, nInputs, NULL, 0, 0, &vProds );
+ //Wlc_BlastMultiplier3( pNew, Vec_IntArray(vIns), Vec_IntArray(vIns)+nInputs, nInputs, nInputs, NULL, 0, 0, &vProds );
+ //Vec_WecPrint( vProds, 0 );
+ Wlc_ManGenTreeOne( pNew, vProds, 1, fVerbose );
+ Gia_ManHashStop( pNew );
+ Vec_WecFree( vProds );
+ Vec_IntFree( vIns );
+ pNew = Gia_ManCleanup( pTemp = pNew );
+ Gia_ManStop( pTemp );
+ return pNew;
+}
+
////////////////////////////////////////////////////////////////////////
/// END OF FILE ///
////////////////////////////////////////////////////////////////////////
diff --git a/src/base/wlc/wlc.h b/src/base/wlc/wlc.h
index 0a4f745c..0b3bed6c 100644
--- a/src/base/wlc/wlc.h
+++ b/src/base/wlc/wlc.h
@@ -217,6 +217,7 @@ struct Wlc_BstPar_t_
int fBooth;
int fNonRest;
int fCla;
+ int fDivBy0;
int fNoCleanup;
int fCreateMiter;
int fCreateWordMiter;
@@ -238,6 +239,7 @@ static inline void Wlc_BstParDefault( Wlc_BstPar_t * pPar )
pPar->fMulti = 0;
pPar->fBooth = 0;
pPar->fCla = 0;
+ pPar->fDivBy0 = 0;
pPar->fCreateMiter = 0;
pPar->fCreateWordMiter = 0;
pPar->fDecMuxes = 0;
diff --git a/src/base/wlc/wlcAbc.c b/src/base/wlc/wlcAbc.c
index e1b06ffd..8b7dbfa7 100644
--- a/src/base/wlc/wlcAbc.c
+++ b/src/base/wlc/wlcAbc.c
@@ -140,7 +140,7 @@ void Wlc_NtkPrintInvStats( Wlc_Ntk_t * pNtk, Vec_Int_t * vCounts, int fVerbose )
SeeAlso []
***********************************************************************/
-Abc_Ntk_t * Wlc_NtkGetInv( Wlc_Ntk_t * pNtk, Vec_Int_t * vInv )
+Abc_Ntk_t * Wlc_NtkGetInv( Wlc_Ntk_t * pNtk, Vec_Int_t * vInv, Vec_Ptr_t * vNamesIn )
{
extern Vec_Int_t * Pdr_InvCounts( Vec_Int_t * vInv );
extern Vec_Str_t * Pdr_InvPrintStr( Vec_Int_t * vInv, Vec_Int_t * vCounts );
@@ -166,8 +166,16 @@ Abc_Ntk_t * Wlc_NtkGetInv( Wlc_Ntk_t * pNtk, Vec_Int_t * vInv )
if ( Entry == 0 )
continue;
pMainObj = Abc_NtkCreatePi( pMainNtk );
- sprintf( Buffer, "pi%d", i );
- Abc_ObjAssignName( pMainObj, Buffer, NULL );
+ // If vNamesIn is given, take names from there for as many entries as possible
+ // otherwise generate names from counter
+ if (vNamesIn != NULL && i < Vec_PtrSize(vNamesIn)) {
+ Abc_ObjAssignName( pMainObj, (char *)Vec_PtrEntry(vNamesIn, i), NULL );
+ }
+ else
+ {
+ sprintf( Buffer, "pi%d", i );
+ Abc_ObjAssignName( pMainObj, Buffer, NULL );
+ }
}
if ( Abc_NtkPiNum(pMainNtk) != nInputs )
{
diff --git a/src/base/wlc/wlcAbs.c b/src/base/wlc/wlcAbs.c
index 402ce21b..c297c54f 100644
--- a/src/base/wlc/wlcAbs.c
+++ b/src/base/wlc/wlcAbs.c
@@ -867,10 +867,10 @@ static Vec_Bit_t * Wlc_NtkMarkLimit( Wlc_Ntk_t * p, Wlc_Par_t * pPars )
}
}
- Vec_PtrSort( vAdds, (int (*)(void))IntPairPtrCompare ) ;
- Vec_PtrSort( vMults, (int (*)(void))IntPairPtrCompare ) ;
- Vec_PtrSort( vMuxes, (int (*)(void))IntPairPtrCompare ) ;
- Vec_PtrSort( vFlops, (int (*)(void))IntPairPtrCompare ) ;
+ Vec_PtrSort( vAdds, (int (*)(const void *, const void *))IntPairPtrCompare ) ;
+ Vec_PtrSort( vMults, (int (*)(const void *, const void *))IntPairPtrCompare ) ;
+ Vec_PtrSort( vMuxes, (int (*)(const void *, const void *))IntPairPtrCompare ) ;
+ Vec_PtrSort( vFlops, (int (*)(const void *, const void *))IntPairPtrCompare ) ;
Vec_PtrForEachEntry( Int_Pair_t *, vAdds, pPair, i )
{
diff --git a/src/base/wlc/wlcBlast.c b/src/base/wlc/wlcBlast.c
index 3a01e238..6e910cd8 100644
--- a/src/base/wlc/wlcBlast.c
+++ b/src/base/wlc/wlcBlast.c
@@ -345,11 +345,12 @@ void Wlc_BlastFullAdder( Gia_Man_t * pNew, int a, int b, int c, int * pc, int *
if ( fCompl )
*ps = Abc_LitNot(*ps), *pc = Abc_LitNot(*pc);
}
-void Wlc_BlastAdder( Gia_Man_t * pNew, int * pAdd0, int * pAdd1, int nBits, int Carry ) // result is in pAdd0
+int Wlc_BlastAdder( Gia_Man_t * pNew, int * pAdd0, int * pAdd1, int nBits, int Carry ) // result is in pAdd0
{
int b;
for ( b = 0; b < nBits; b++ )
Wlc_BlastFullAdder( pNew, pAdd0[b], pAdd1[b], Carry, &Carry, &pAdd0[b] );
+ return Carry;
}
void Wlc_BlastSubtract( Gia_Man_t * pNew, int * pAdd0, int * pAdd1, int nBits, int Carry ) // result is in pAdd0
{
@@ -1022,7 +1023,7 @@ void Wlc_BlastReduceMatrix2( Gia_Man_t * pNew, Vec_Wec_t * vProds, Vec_Int_t * v
}
-void Wlc_BlastMultiplier3( Gia_Man_t * pNew, int * pArgA, int * pArgB, int nArgA, int nArgB, Vec_Int_t * vRes, int fSigned, int fCla )
+void Wlc_BlastMultiplier3( Gia_Man_t * pNew, int * pArgA, int * pArgB, int nArgA, int nArgB, Vec_Int_t * vRes, int fSigned, int fCla, Vec_Wec_t ** pvProds )
{
Vec_Wec_t * vProds = Vec_WecStart( nArgA + nArgB );
Vec_Wec_t * vLevels = Vec_WecStart( nArgA + nArgB );
@@ -1043,7 +1044,10 @@ void Wlc_BlastMultiplier3( Gia_Man_t * pNew, int * pArgA, int * pArgB, int nArgA
Vec_WecPush( vLevels, nArgA+nArgB-1, 0 );
}
- Wlc_BlastReduceMatrix( pNew, vProds, vLevels, vRes, fSigned, fCla );
+ if ( pvProds )
+ *pvProds = Vec_WecDup(vProds);
+ else
+ Wlc_BlastReduceMatrix( pNew, vProds, vLevels, vRes, fSigned, fCla );
// Wlc_BlastReduceMatrix2( pNew, vProds, vRes, fSigned, fCla );
Vec_WecFree( vProds );
@@ -1086,7 +1090,7 @@ void Wlc_BlastDecoder( Gia_Man_t * pNew, int * pNum, int nNum, Vec_Int_t * vTmp,
Vec_IntPush( vRes, iMint );
}
}
-void Wlc_BlastBooth( Gia_Man_t * pNew, int * pArgA, int * pArgB, int nArgA, int nArgB, Vec_Int_t * vRes, int fSigned, int fCla )
+void Wlc_BlastBooth( Gia_Man_t * pNew, int * pArgA, int * pArgB, int nArgA, int nArgB, Vec_Int_t * vRes, int fSigned, int fCla, Vec_Wec_t ** pvProds )
{
Vec_Wec_t * vProds = Vec_WecStart( nArgA + nArgB + 3 );
Vec_Wec_t * vLevels = Vec_WecStart( nArgA + nArgB + 3 );
@@ -1159,9 +1163,11 @@ void Wlc_BlastBooth( Gia_Man_t * pNew, int * pArgA, int * pArgB, int nArgA, int
//Vec_WecPrint( vProds, 0 );
//Wlc_BlastPrintMatrix( pNew, vProds, 1 );
//printf( "Cutoff ID for partial products = %d.\n", Gia_ManObjNum(pNew) );
- Wlc_BlastReduceMatrix( pNew, vProds, vLevels, vRes, fSigned, fCla );
-// Wlc_BlastReduceMatrix2( pNew, vProds, vRes, fSigned, fCla );
-
+ if ( pvProds )
+ *pvProds = Vec_WecDup(vProds);
+ else
+ Wlc_BlastReduceMatrix( pNew, vProds, vLevels, vRes, fSigned, fCla );
+ // Wlc_BlastReduceMatrix2( pNew, vProds, vRes, fSigned, fCla );
Vec_WecFree( vProds );
Vec_WecFree( vLevels );
Vec_IntFree( vArgB );
@@ -1792,9 +1798,9 @@ Gia_Man_t * Wlc_NtkBitBlast( Wlc_Ntk_t * p, Wlc_BstPar_t * pParIn )
if ( Wlc_NtkCountConstBits(pArg0, nRangeMax) < Wlc_NtkCountConstBits(pArg1, nRangeMax) )
ABC_SWAP( int *, pArg0, pArg1 );
if ( pPar->fBooth )
- Wlc_BlastBooth( pNew, pArg0, pArg1, nRange0, nRange1, vRes, fSigned, pPar->fCla );
+ Wlc_BlastBooth( pNew, pArg0, pArg1, nRange0, nRange1, vRes, fSigned, pPar->fCla, NULL );
else if ( pPar->fCla )
- Wlc_BlastMultiplier3( pNew, pArg0, pArg1, nRange0, nRange1, vRes, Wlc_ObjIsSignedFanin01(p, pObj), pPar->fCla );
+ Wlc_BlastMultiplier3( pNew, pArg0, pArg1, nRange0, nRange1, vRes, Wlc_ObjIsSignedFanin01(p, pObj), pPar->fCla, NULL );
else
Wlc_BlastMultiplier( pNew, pArg0, pArg1, nRangeMax, nRangeMax, vTemp2, vRes, fSigned );
if ( nRange > Vec_IntSize(vRes) )
@@ -1815,7 +1821,7 @@ Gia_Man_t * Wlc_NtkBitBlast( Wlc_Ntk_t * p, Wlc_BstPar_t * pParIn )
else
Wlc_BlastDivider( pNew, pArg0, nRangeMax, pArg1, nRangeMax, pObj->Type == WLC_OBJ_ARI_DIVIDE, vRes );
Vec_IntShrink( vRes, nRange );
- //if ( pObj->Type == WLC_OBJ_ARI_DIVIDE )
+ if ( !pPar->fDivBy0 )
Wlc_BlastZeroCondition( pNew, pFans1, nRange1, vRes );
}
else if ( pObj->Type == WLC_OBJ_ARI_MINUS )
@@ -2104,7 +2110,7 @@ Gia_Man_t * Wlc_NtkBitBlast( Wlc_Ntk_t * p, Wlc_BstPar_t * pParIn )
// complement flop inputs whose init state is 1
for ( i = 0; i < nFf2Regs; i++ )
Gia_ManAppendCo( pNew, Gia_ManAppendCi(pNew) );
- //Gia_ManSetRegNum( pNew, nFf2Regs );
+ Gia_ManSetRegNum( pNew, nFf2Regs );
}
else
{
@@ -2490,6 +2496,98 @@ Gia_Man_t * Wlc_NtkBitBlast( Wlc_Ntk_t * p, Wlc_BstPar_t * pParIn )
return pNew;
}
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+float * Extra_FileReadFloat( FILE * pFile, int * pnFileSize )
+{
+ float * pBuffer;
+ int RetValue, nFileSize;
+ fseek( pFile, 0, SEEK_END );
+ nFileSize = *pnFileSize = ftell( pFile );
+ rewind( pFile );
+ assert( nFileSize%4 == 0 );
+ pBuffer = ABC_CALLOC( float, nFileSize/4 );
+ RetValue = fread( pBuffer, nFileSize, 1, pFile );
+ return pBuffer;
+}
+float * Extra_FileReadFloatContents( char * pFileName, int * pnFileSize )
+{
+ FILE * pFile;
+ float * pBuffer;
+ pFile = fopen( pFileName, "rb" );
+ pBuffer = pFile ? Extra_FileReadFloat( pFile, pnFileSize ) : NULL;
+ if ( pFile ) fclose( pFile );
+ return pBuffer;
+}
+static inline int Extra_FixedFound( int Value, int Fixed )
+{
+ Value += 1 << (Fixed-1);
+ Value >>= Fixed;
+ return Value;
+}
+static inline int Extra_ConvertFloat8( float Value )
+{
+ return Extra_FixedFound( (int)(Value * (1 << 16)), 8 );
+}
+Gia_Man_t * Wlc_BlastArray( char * pFileName )
+{
+ int nFileSize = 0;
+ float * pBuffer = Extra_FileReadFloatContents( pFileName, &nFileSize );
+ int i, v, Value, nInputs = nFileSize/4 - 1;
+ Vec_Int_t * vArg0 = Vec_IntAlloc( 100 );
+ Vec_Int_t * vArg1 = Vec_IntAlloc( 100 );
+ Vec_Int_t * vTemp = Vec_IntAlloc( 100 );
+ Vec_Int_t * vRes = Vec_IntAlloc( 100 );
+ Vec_Int_t * vSum = Vec_IntAlloc( 100 );
+ Gia_Man_t * pTemp, * pNew = Gia_ManStart( 10000 );
+ pNew->pName = Abc_UtilStrsav( "blast" );
+ Gia_ManHashAlloc( pNew );
+ for ( i = 0; i < 8*nInputs; i++ )
+ Gia_ManAppendCi(pNew);
+
+ Value = (Extra_ConvertFloat8(pBuffer[0]) << 8) | (1 << 7);
+ for ( v = 0; v < 20; v++ )
+ Vec_IntPush( vSum, (Value >> v) & 1 );
+
+ for ( i = 0; i < nInputs; i++ )
+ {
+ Value = Extra_ConvertFloat8( pBuffer[1+i] );
+
+ Vec_IntClear( vArg0 );
+ for ( v = 0; v < 8; v++ )
+ Vec_IntPush( vArg0, Gia_ManCiLit(pNew, 8*i+v) );
+
+ Vec_IntClear( vArg1 );
+ for ( v = 0; v < 12; v++ )
+ Vec_IntPush( vArg1, (Value >> v) & 1 );
+
+ Wlc_BlastMultiplier( pNew, Vec_IntArray(vArg0), Vec_IntArray(vArg1), 8, 12, vTemp, vRes, 1 );
+ Wlc_BlastAdder( pNew, Vec_IntArray(vSum), Vec_IntArray(vRes), 20, 0 );
+ }
+ ABC_FREE( pBuffer );
+ for ( v = 8; v < 16; v++ )
+ Gia_ManAppendCo( pNew, Vec_IntEntry(vSum, v) );
+ Vec_IntFree( vArg0 );
+ Vec_IntFree( vArg1 );
+ Vec_IntFree( vTemp );
+ Vec_IntFree( vRes );
+ Vec_IntFree( vSum );
+
+ pNew = Gia_ManCleanup( pTemp = pNew );
+ Gia_ManStop( pTemp );
+ return pNew;
+}
+
////////////////////////////////////////////////////////////////////////
/// END OF FILE ///
////////////////////////////////////////////////////////////////////////
diff --git a/src/base/wlc/wlcCom.c b/src/base/wlc/wlcCom.c
index 51f15597..39f1bebd 100644
--- a/src/base/wlc/wlcCom.c
+++ b/src/base/wlc/wlcCom.c
@@ -1037,7 +1037,7 @@ int Abc_CommandBlast( Abc_Frame_t * pAbc, int argc, char ** argv )
Wlc_BstParDefault( pPar );
pPar->nOutputRange = 2;
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "ORAMcombqadestnizvh" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "ORAMcombqaydestnizvh" ) ) != EOF )
{
switch ( c )
{
@@ -1103,6 +1103,9 @@ int Abc_CommandBlast( Abc_Frame_t * pAbc, int argc, char ** argv )
case 'a':
pPar->fCla ^= 1;
break;
+ case 'y':
+ pPar->fDivBy0 ^= 1;
+ break;
case 'd':
pPar->fCreateMiter ^= 1;
break;
@@ -1198,7 +1201,7 @@ int Abc_CommandBlast( Abc_Frame_t * pAbc, int argc, char ** argv )
Abc_FrameUpdateGia( pAbc, pNew );
return 0;
usage:
- Abc_Print( -2, "usage: %%blast [-ORAM num] [-combqadestnizvh]\n" );
+ Abc_Print( -2, "usage: %%blast [-ORAM num] [-combqaydestnizvh]\n" );
Abc_Print( -2, "\t performs bit-blasting of the word-level design\n" );
Abc_Print( -2, "\t-O num : zero-based index of the first word-level PO to bit-blast [default = %d]\n", pPar->iOutput );
Abc_Print( -2, "\t-R num : the total number of word-level POs to bit-blast [default = %d]\n", pPar->nOutputRange );
@@ -1210,6 +1213,7 @@ usage:
Abc_Print( -2, "\t-b : toggle generating radix-4 Booth multipliers [default = %s]\n", pPar->fBooth? "yes": "no" );
Abc_Print( -2, "\t-q : toggle generating non-restoring square root [default = %s]\n", pPar->fNonRest? "yes": "no" );
Abc_Print( -2, "\t-a : toggle generating carry-look-ahead adder [default = %s]\n", pPar->fCla? "yes": "no" );
+ Abc_Print( -2, "\t-y : toggle creating different divide-by-0 condition [default = %s]\n", pPar->fDivBy0? "yes": "no" );
Abc_Print( -2, "\t-d : toggle creating dual-output multi-output miter [default = %s]\n", pPar->fCreateMiter? "yes": "no" );
Abc_Print( -2, "\t-e : toggle creating miter with output word bits combined [default = %s]\n", pPar->fCreateWordMiter? "yes": "no" );
Abc_Print( -2, "\t-s : toggle creating decoded MUXes [default = %s]\n", pPar->fDecMuxes? "yes": "no" );
@@ -1327,16 +1331,20 @@ usage:
******************************************************************************/
int Abc_CommandRetime( Abc_Frame_t * pAbc, int argc, char ** argv )
{
- extern void Wln_NtkRetimeTest( char * pFileName, int fSkipSimple, int fDump, int fVerbose );
+ extern void Wln_NtkRetimeTest( char * pFileName, int fIgnoreIO, int fSkipSimple, int fDump, int fVerbose );
FILE * pFile;
char * pFileName = NULL;
+ int fIgnoreIO = 0;
int fSkipSimple = 0;
int c, fDump = 0, fVerbose = 0;
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "sdvh" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "isdvh" ) ) != EOF )
{
switch ( c )
{
+ case 'i':
+ fIgnoreIO ^= 1;
+ break;
case 's':
fSkipSimple ^= 1;
break;
@@ -1362,7 +1370,7 @@ int Abc_CommandRetime( Abc_Frame_t * pAbc, int argc, char ** argv )
printf( "Transforming NDR into internal represnetation has failed.\n" );
return 0;
}
- vMoves = Wln_NtkRetime( pNtk, fSkipSimple, fVerbose );
+ vMoves = Wln_NtkRetime( pNtk, fIgnoreIO, fSkipSimple, fVerbose );
Wln_NtkFree( pNtk );
ABC_FREE( pAbc->pNdrArray );
if ( vMoves ) pAbc->pNdrArray = Vec_IntReleaseNewArray( vMoves );
@@ -1385,11 +1393,12 @@ int Abc_CommandRetime( Abc_Frame_t * pAbc, int argc, char ** argv )
return 0;
}
fclose( pFile );
- Wln_NtkRetimeTest( pFileName, fSkipSimple, fDump, fVerbose );
+ Wln_NtkRetimeTest( pFileName, fIgnoreIO, fSkipSimple, fDump, fVerbose );
return 0;
usage:
- Abc_Print( -2, "usage: %%retime [-sdvh]\n" );
+ Abc_Print( -2, "usage: %%retime [-isdvh]\n" );
Abc_Print( -2, "\t performs retiming for the NDR design\n" );
+ Abc_Print( -2, "\t-i : toggle ignoring delays of IO paths [default = %s]\n", fIgnoreIO? "yes": "no" );
Abc_Print( -2, "\t-s : toggle printing simple nodes [default = %s]\n", !fSkipSimple? "yes": "no" );
Abc_Print( -2, "\t-d : toggle dumping the network in Verilog [default = %s]\n", fDump? "yes": "no" );
Abc_Print( -2, "\t-v : toggle printing verbose information [default = %s]\n", fVerbose? "yes": "no" );
@@ -1718,15 +1727,19 @@ usage:
******************************************************************************/
int Abc_CommandInvGet( Abc_Frame_t * pAbc, int argc, char ** argv )
{
- extern Abc_Ntk_t * Wlc_NtkGetInv( Wlc_Ntk_t * pNtk, Vec_Int_t * vInv );
+ extern Abc_Ntk_t * Wlc_NtkGetInv( Wlc_Ntk_t * pNtk, Vec_Int_t * vInv, Vec_Ptr_t * vNamesIn );
Abc_Ntk_t * pMainNtk;
Wlc_Ntk_t * pNtk = Wlc_AbcGetNtk(pAbc);
- int c, fVerbose = 0;
+ int c, i, fVerbose = 0, fFlopNamesFromGia = 0;
+ Vec_Ptr_t * vNamesIn = NULL;
Extra_UtilGetoptReset();
- while ( ( c = Extra_UtilGetopt( argc, argv, "vh" ) ) != EOF )
+ while ( ( c = Extra_UtilGetopt( argc, argv, "fvh" ) ) != EOF )
{
switch ( c )
{
+ case 'f':
+ fFlopNamesFromGia ^= 1;
+ break;
case 'v':
fVerbose ^= 1;
break;
@@ -1741,16 +1754,38 @@ int Abc_CommandInvGet( Abc_Frame_t * pAbc, int argc, char ** argv )
Abc_Print( 1, "Abc_CommandInvGet(): Invariant is not available.\n" );
return 0;
}
+ // See if we shall and can copy the PI names from the current GIA
+ if ( fFlopNamesFromGia )
+ {
+ if ( pAbc->pGia == NULL )
+ {
+ Abc_Print( 1, "Abc_CommandInvGet(): No network in &-space, cannot copy names.\n" );
+ fFlopNamesFromGia = 0;
+ }
+ else
+ {
+ vNamesIn = Vec_PtrStart( Gia_ManRegNum(pAbc->pGia) );
+ for ( i = 0; i < Gia_ManRegNum(pAbc->pGia); ++i )
+ {
+ // Only the registers
+ Vec_PtrSetEntry( vNamesIn, i, Extra_UtilStrsav( (const char*)Vec_PtrEntry( pAbc->pGia->vNamesIn, Gia_ManPiNum(pAbc->pGia)+i ) ) );
+ }
+ }
+ }
// derive the network
- pMainNtk = Wlc_NtkGetInv( pNtk, Wlc_AbcGetInv(pAbc) );
+ pMainNtk = Wlc_NtkGetInv( pNtk, Wlc_AbcGetInv(pAbc), vNamesIn );
+ // Delete names
+ if (vNamesIn)
+ Vec_PtrFree( vNamesIn );
// replace the current network
if ( pMainNtk )
Abc_FrameReplaceCurrentNetwork( pAbc, pMainNtk );
return 0;
usage:
- Abc_Print( -2, "usage: inv_get [-vh]\n" );
+ Abc_Print( -2, "usage: inv_get [-fvh]\n" );
Abc_Print( -2, "\t places invariant found by PDR as the current network in the main-space\n" );
- Abc_Print( -2, "\t (in the case of \'sat\' or \'undecided\', inifity clauses are used)\n" );
+ Abc_Print( -2, "\t (in the case of \'sat\' or \'undecided\', infinity clauses are used)\n" );
+ Abc_Print( -2, "\t-f : toggle reading flop names from the &-space [default = %s]\n", fFlopNamesFromGia? "yes": "no" );
Abc_Print( -2, "\t-v : toggle printing verbose information [default = %s]\n", fVerbose? "yes": "no" );
Abc_Print( -2, "\t-h : print the command usage\n");
return 1;
diff --git a/src/base/wlc/wlcNdr.c b/src/base/wlc/wlcNdr.c
index 3212500f..d401281a 100644
--- a/src/base/wlc/wlcNdr.c
+++ b/src/base/wlc/wlcNdr.c
@@ -263,7 +263,7 @@ void Wlc_NtkToNdrTest( Wlc_Ntk_t * pNtk )
ppNames[i] = Wlc_ObjName(pNtk, i);
// verify by writing Verilog
- Ndr_WriteVerilog( NULL, pDesign, ppNames );
+ Ndr_WriteVerilog( NULL, pDesign, ppNames, 0 );
Ndr_Write( "test.ndr", pDesign );
// cleanup
@@ -368,7 +368,7 @@ Wlc_Ntk_t * Wlc_NtkFromNdr( void * pData )
Ndr_Data_t * p = (Ndr_Data_t *)pData;
Wlc_Obj_t * pObj; Vec_Int_t * vName2Obj, * vFanins = Vec_IntAlloc( 100 );
int Mod = 2, i, k, Obj, * pArray, nDigits, fFound, NameId, NameIdMax;
- Vec_Wrd_t * vTruths = NULL;
+ Vec_Wrd_t * vTruths = NULL; int nTruths[2] = {0};
Wlc_Ntk_t * pTemp, * pNtk = Wlc_NtkAlloc( "top", Ndr_DataObjNum(p, Mod)+1 );
Wlc_NtkCheckIntegrity( pData );
Vec_IntClear( &pNtk->vFfs );
@@ -415,11 +415,14 @@ Wlc_Ntk_t * Wlc_NtkFromNdr( void * pData )
Vec_IntPush( &pNtk->vFfs2, iObj );
if ( Type == ABC_OPER_LUT )
{
+ word * pTruth;
if ( vTruths == NULL )
vTruths = Vec_WrdStart( 1000 );
if ( NameId >= Vec_WrdSize(vTruths) )
Vec_WrdFillExtra( vTruths, 2*NameId, 0 );
- Vec_WrdWriteEntry( vTruths, NameId, *((word *)Ndr_ObjReadBodyP(p, Obj, NDR_FUNCTION)) );
+ pTruth = (word *)Ndr_ObjReadBodyP(p, Obj, NDR_FUNCTION);
+ Vec_WrdWriteEntry( vTruths, NameId, pTruth ? *pTruth : 0 );
+ nTruths[ pTruth != NULL ]++;
}
if ( Type == ABC_OPER_SLICE )
Vec_IntPushTwo( vFanins, End, Beg );
@@ -437,6 +440,8 @@ Wlc_Ntk_t * Wlc_NtkFromNdr( void * pData )
Wlc_ObjFanin1(pNtk, pObj)->Signed = 1;
}
}
+ if ( nTruths[0] )
+ printf( "Warning! The number of LUTs without function is %d (out of %d).\n", nTruths[0], nTruths[0]+nTruths[1] );
// mark primary outputs
Ndr_ModForEachPo( p, Mod, Obj )
{
@@ -487,7 +492,7 @@ Wlc_Ntk_t * Wlc_NtkFromNdr( void * pData )
pNtk->pManName = Abc_NamStart( NameIdMax+1, 10 );
for ( i = 1; i <= NameIdMax; i++ )
{
- char pName[20]; sprintf( pName, "s%0*d", nDigits, i );
+ char pName[100]; sprintf( pName, "s%0*d", nDigits, i );
NameId = Abc_NamStrFindOrAdd( pNtk->pManName, pName, &fFound );
assert( !fFound && i == NameId );
}
@@ -535,7 +540,7 @@ Wlc_Ntk_t * Wlc_ReadNdr( char * pFileName )
void * pData = Ndr_Read( pFileName );
Wlc_Ntk_t * pNtk = Wlc_NtkFromNdr( pData );
//char * ppNames[10] = { NULL, "a", "b", "c", "d", "e", "f", "g", "h", "i" };
- //Ndr_WriteVerilog( NULL, pData, ppNames );
+ //Ndr_WriteVerilog( NULL, pData, ppNames, 0 );
//Ndr_Delete( pData );
Abc_FrameInputNdr( Abc_FrameGetGlobalFrame(), pData );
return pNtk;
diff --git a/src/base/wln/wln.h b/src/base/wln/wln.h
index 510d74c1..93a1a92a 100644
--- a/src/base/wln/wln.h
+++ b/src/base/wln/wln.h
@@ -246,7 +246,7 @@ extern int Wln_ObjClone( Wln_Ntk_t * pNew, Wln_Ntk_t * p, int iObj );
extern int Wln_ObjCreateCo( Wln_Ntk_t * p, int iFanin );
extern void Wln_ObjPrint( Wln_Ntk_t * p, int iObj );
/*=== wlcRetime.c ========================================================*/
-extern Vec_Int_t * Wln_NtkRetime( Wln_Ntk_t * p, int fSkipSimple, int fVerbose );
+extern Vec_Int_t * Wln_NtkRetime( Wln_Ntk_t * p, int fIgnoreIO, int fSkipSimple, int fVerbose );
extern void Wln_NtkRetimeCreateDelayInfo( Wln_Ntk_t * pNtk );
/*=== wlcWriteVer.c ========================================================*/
extern void Wln_WriteVer( Wln_Ntk_t * p, char * pFileName );
diff --git a/src/base/wln/wlnNdr.c b/src/base/wln/wlnNdr.c
index eb685463..9eaf71ed 100644
--- a/src/base/wln/wlnNdr.c
+++ b/src/base/wln/wlnNdr.c
@@ -96,7 +96,7 @@ void Wln_NtkToNdrTest( Wln_Ntk_t * p )
ppNames[i] = Abc_UtilStrsav(Wln_ObjName(p, i));
// verify by writing Verilog
- Ndr_WriteVerilog( NULL, pDesign, ppNames );
+ Ndr_WriteVerilog( NULL, pDesign, ppNames, 0 );
Ndr_Write( "test.ndr", pDesign );
// cleanup
@@ -256,7 +256,7 @@ Wln_Ntk_t * Wln_NtkFromNdr( void * pData, int fDump )
pNtk->pManName = Abc_NamStart( NameIdMax+1, 10 );
for ( i = 1; i <= NameIdMax; i++ )
{
- char pName[20]; sprintf( pName, "s%0*d", nDigits, i );
+ char pName[100]; sprintf( pName, "s%0*d", nDigits, i );
NameId = Abc_NamStrFindOrAdd( pNtk->pManName, pName, &fFound );
assert( !fFound && i == NameId );
}
@@ -301,7 +301,7 @@ Wln_Ntk_t * Wln_ReadNdr( char * pFileName )
Wln_Ntk_t * pNtk = pData ? Wln_NtkFromNdr( pData, 0 ) : NULL;
if ( pNtk ) return NULL;
//char * ppNames[10] = { NULL, "a", "b", "c", "d", "e", "f", "g", "h", "i" };
- //Ndr_WriteVerilog( NULL, pData, ppNames );
+ //Ndr_WriteVerilog( NULL, pData, ppNames, 0 );
Ndr_Delete( pData );
return pNtk;
}
@@ -314,7 +314,7 @@ void Wln_ReadNdrTest()
Wln_NtkStaticFanoutTest( pNtk );
Wln_NtkFree( pNtk );
}
-void Wln_NtkRetimeTest( char * pFileName, int fSkipSimple, int fDump, int fVerbose )
+void Wln_NtkRetimeTest( char * pFileName, int fIgnoreIO, int fSkipSimple, int fDump, int fVerbose )
{
Vec_Int_t * vMoves;
void * pData = Ndr_Read( pFileName );
@@ -326,7 +326,7 @@ void Wln_NtkRetimeTest( char * pFileName, int fSkipSimple, int fDump, int fVerbo
return;
}
Wln_NtkRetimeCreateDelayInfo( pNtk );
- vMoves = Wln_NtkRetime( pNtk, fSkipSimple, fVerbose );
+ vMoves = Wln_NtkRetime( pNtk, fIgnoreIO, fSkipSimple, fVerbose );
//Vec_IntPrint( vMoves );
Vec_IntFree( vMoves );
Wln_NtkFree( pNtk );
diff --git a/src/base/wln/wlnRetime.c b/src/base/wln/wlnRetime.c
index 734ac194..5ccc1dd0 100644
--- a/src/base/wln/wlnRetime.c
+++ b/src/base/wln/wlnRetime.c
@@ -335,6 +335,55 @@ void Wln_RetFindSources( Wln_Ret_t * p )
/**Function*************************************************************
+ Synopsis [Mark paths from PIs to POs.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+int Wln_RetMarkPaths_rec( Wln_Ntk_t * p, int iObj, int fVerbose )
+{
+ int k, iFanin, fPrev = 1;
+ if ( Wln_ObjIsTravIdPrevious(p, iObj) )
+ return 1;
+ if ( Wln_ObjIsTravIdCurrent(p, iObj) )
+ return 0;
+ if ( Wln_ObjIsCio(p, iObj) || Wln_ObjIsFf(p, iObj) )
+ return 0;
+ Wln_ObjForEachFanin( p, iObj, iFanin, k )
+ fPrev &= Wln_RetMarkPaths_rec( p, iFanin, fVerbose );
+ if ( fPrev )
+ {
+ Wln_ObjSetTravIdPrevious( p, iObj );
+ if ( Vec_IntEntry(&p->vInstIds, iObj) > 0 )
+ {
+ if ( fVerbose )
+ printf( "Updating delay %5d -> %5d : ", Vec_IntEntry(&p->vInstIds, iObj), 1 );
+ if ( fVerbose )
+ Wln_ObjPrint( p, iObj );
+ Vec_IntWriteEntry( &p->vInstIds, iObj, 1 );
+ }
+ return 1;
+ }
+ Wln_ObjSetTravIdCurrent( p, iObj );
+ return 0;
+}
+void Wln_RetMarkPaths( Wln_Ntk_t * p, int fVerbose )
+{
+ int i, iObj;
+ Wln_NtkIncrementTravId( p );
+ Wln_NtkIncrementTravId( p );
+ Wln_NtkForEachPi( p, iObj, i )
+ Wln_ObjSetTravIdPrevious( p, iObj );
+ Wln_NtkForEachPo( p, iObj, i )
+ Wln_RetMarkPaths_rec( p, Wln_ObjFanin0(p, iObj), fVerbose );
+}
+
+/**Function*************************************************************
+
Synopsis [Retimability check.]
Description []
@@ -571,7 +620,7 @@ void Wln_NtkRetimeCreateDelayInfo( Wln_Ntk_t * pNtk )
printf( "Assuming default delays: 10 units for most nodes and 1 unit for bit-slice, concat, and buffers driving COs.\n" );
}
}
-Vec_Int_t * Wln_NtkRetime( Wln_Ntk_t * pNtk, int fSkipSimple, int fVerbose )
+Vec_Int_t * Wln_NtkRetime_int( Wln_Ntk_t * pNtk, int fSkipSimple, int fVerbose )
{
Wln_Ret_t * p = Wln_RetAlloc( pNtk );
Vec_Int_t * vSources = &p->vSources;
@@ -666,6 +715,12 @@ Vec_Int_t * Wln_NtkRetime( Wln_Ntk_t * pNtk, int fSkipSimple, int fVerbose )
}
return vMoves;
}
+Vec_Int_t * Wln_NtkRetime( Wln_Ntk_t * pNtk, int fIgnoreIO, int fSkipSimple, int fVerbose )
+{
+ if ( fIgnoreIO )
+ Wln_RetMarkPaths( pNtk, fVerbose );
+ return Wln_NtkRetime_int( pNtk, fSkipSimple, fVerbose );
+}
////////////////////////////////////////////////////////////////////////
/// END OF FILE ///