diff options
author | Alan Mishchenko <alanmi@berkeley.edu> | 2013-07-12 13:02:32 -0700 |
---|---|---|
committer | Alan Mishchenko <alanmi@berkeley.edu> | 2013-07-12 13:02:32 -0700 |
commit | fba33fbba407f96800863bde5a7061b09c2f9ff2 (patch) | |
tree | 28b8cf1f69d3e345c7953157c450efdd90531b7b /src/map/mpm | |
parent | 2ee26b00f9ac8dc93bd1335f89d4c3b165dbd7fd (diff) | |
download | abc-fba33fbba407f96800863bde5a7061b09c2f9ff2.tar.gz abc-fba33fbba407f96800863bde5a7061b09c2f9ff2.tar.bz2 abc-fba33fbba407f96800863bde5a7061b09c2f9ff2.zip |
New technology mapper.
Diffstat (limited to 'src/map/mpm')
-rw-r--r-- | src/map/mpm/module.make | 9 | ||||
-rw-r--r-- | src/map/mpm/mpm.c | 55 | ||||
-rw-r--r-- | src/map/mpm/mpm.h | 82 | ||||
-rw-r--r-- | src/map/mpm/mpmAbc.c | 270 | ||||
-rw-r--r-- | src/map/mpm/mpmCore.c | 96 | ||||
-rw-r--r-- | src/map/mpm/mpmDsd.c | 52 | ||||
-rw-r--r-- | src/map/mpm/mpmInt.h | 225 | ||||
-rw-r--r-- | src/map/mpm/mpmLib.c | 74 | ||||
-rw-r--r-- | src/map/mpm/mpmMap.c | 988 | ||||
-rw-r--r-- | src/map/mpm/mpmMig.c | 177 | ||||
-rw-r--r-- | src/map/mpm/mpmMig.h | 353 | ||||
-rw-r--r-- | src/map/mpm/mpmPre.c | 885 | ||||
-rw-r--r-- | src/map/mpm/mpmTruth.c | 52 | ||||
-rw-r--r-- | src/map/mpm/mpmUtil.c | 52 |
14 files changed, 3370 insertions, 0 deletions
diff --git a/src/map/mpm/module.make b/src/map/mpm/module.make new file mode 100644 index 00000000..facf3bbf --- /dev/null +++ b/src/map/mpm/module.make @@ -0,0 +1,9 @@ +SRC += src/map/mpm/mpmAbc.c \ + src/map/mpm/mpmCore.c \ + src/map/mpm/mpmDsd.c \ + src/map/mpm/mpmLib.c \ + src/map/mpm/mpmMap.c \ + src/map/mpm/mpmMig.c \ + src/map/mpm/mpmPre.c \ + src/map/mpm/mpmTruth.c \ + src/map/mpm/mpmUtil.c diff --git a/src/map/mpm/mpm.c b/src/map/mpm/mpm.c new file mode 100644 index 00000000..f56cde8f --- /dev/null +++ b/src/map/mpm/mpm.c @@ -0,0 +1,55 @@ +/**CFile**************************************************************** + + FileName [mpm.c] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [Configurable technology mapper.] + + Synopsis [] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 1, 2013.] + + Revision [$Id: mpm.c,v 1.00 2013/06/01 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#include "mpmInt.h" + +ABC_NAMESPACE_IMPL_START + + +//////////////////////////////////////////////////////////////////////// +/// DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Mpm_ManTest() +{ +} + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + + +ABC_NAMESPACE_IMPL_END + diff --git a/src/map/mpm/mpm.h b/src/map/mpm/mpm.h new file mode 100644 index 00000000..a8a600f4 --- /dev/null +++ b/src/map/mpm/mpm.h @@ -0,0 +1,82 @@ +/**CFile**************************************************************** + + FileName [mpm.h] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [Configurable technology mapper.] + + Synopsis [External declarations.] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 1, 2013.] + + Revision [$Id: mpm.h,v 1.00 2013/06/01 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#ifndef ABC__map__mpm__h +#define ABC__map__mpm__h + + +//////////////////////////////////////////////////////////////////////// +/// INCLUDES /// +//////////////////////////////////////////////////////////////////////// + +#include <stdio.h> +#include <stdlib.h> +#include <string.h> +#include <assert.h> + +ABC_NAMESPACE_HEADER_START + +//////////////////////////////////////////////////////////////////////// +/// PARAMETERS /// +//////////////////////////////////////////////////////////////////////// + +#define MPM_VAR_MAX 32 + +//////////////////////////////////////////////////////////////////////// +/// BASIC TYPES /// +//////////////////////////////////////////////////////////////////////// + +typedef struct Mpm_LibLut_t_ Mpm_LibLut_t; +struct Mpm_LibLut_t_ +{ + char * pName; // the name of the LUT library + int LutMax; // the maximum LUT size + int fVarPinDelays; // set to 1 if variable pin delays are specified + int pLutAreas[MPM_VAR_MAX+1]; // the areas of LUTs + int pLutDelays[MPM_VAR_MAX+1][MPM_VAR_MAX+1]; // the delays of LUTs +}; + +typedef struct Mpm_Par_t_ Mpm_Par_t; +struct Mpm_Par_t_ +{ + int DelayTarget; + int fVerbose; +}; + +//////////////////////////////////////////////////////////////////////// +/// MACRO DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + +/*=== mpmCore.c ===========================================================*/ +extern void Mpm_ManSetParsDefault( Mpm_Par_t * p ); + +ABC_NAMESPACE_HEADER_END + +#endif + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + diff --git a/src/map/mpm/mpmAbc.c b/src/map/mpm/mpmAbc.c new file mode 100644 index 00000000..939d7782 --- /dev/null +++ b/src/map/mpm/mpmAbc.c @@ -0,0 +1,270 @@ +/**CFile**************************************************************** + + FileName [mpmAbc.c] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [Configurable technology mapper.] + + Synopsis [Interface with ABC data structures.] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 1, 2013.] + + Revision [$Id: mpmAbc.c,v 1.00 2013/06/01 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#include "aig/gia/gia.h" +#include "mpmInt.h" + +ABC_NAMESPACE_IMPL_START + + +//////////////////////////////////////////////////////////////////////// +/// DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline int Mig_ObjFanin0Copy( Gia_Obj_t * pObj ) { return Abc_LitNotCond( Gia_ObjFanin0(pObj)->Value, Gia_ObjFaninC0(pObj) ); } +static inline int Mig_ObjFanin1Copy( Gia_Obj_t * pObj ) { return Abc_LitNotCond( Gia_ObjFanin1(pObj)->Value, Gia_ObjFaninC1(pObj) ); } +Mig_Man_t * Mig_ManCreate( void * pGia ) +{ + Gia_Man_t * p = (Gia_Man_t *)pGia; + Mig_Man_t * pNew; + Gia_Obj_t * pObj; + int i; + // create the new manager + pNew = Mig_ManStart(); + pNew->pName = Abc_UtilStrsav( p->pName ); + Gia_ManConst0(p)->Value = 0; + // create objects + Gia_ManForEachObj1( p, pObj, i ) + { + if ( Gia_ObjIsAnd(pObj) ) + pObj->Value = Mig_ManAppendAnd( pNew, Mig_ObjFanin0Copy(pObj), Mig_ObjFanin1Copy(pObj) ); + else if ( Gia_ObjIsCi(pObj) ) + pObj->Value = Mig_ManAppendCi( pNew ); + else if ( Gia_ObjIsCo(pObj) ) + pObj->Value = Mig_ManAppendCo( pNew, Mig_ObjFanin0Copy(pObj) ); + else assert( 0 ); + } + Mig_ManSetRegNum( pNew, Gia_ManRegNum(p) ); + return pNew; +} + +/**Function************************************************************* + + Synopsis [Recursively derives the local AIG for the cut.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline unsigned Mpm_CutDataInt( Mpm_Cut_t * pCut ) { return pCut->hNext; } +static inline void Mpm_CutSetDataInt( Mpm_Cut_t * pCut, unsigned Data ) { pCut->hNext = Data; } +int Mpm_ManNodeIfToGia_rec( Gia_Man_t * pNew, Mpm_Man_t * pMan, Mig_Obj_t * pObj, Vec_Ptr_t * vVisited, int fHash ) +{ + Mig_Obj_t * pTemp; + Mpm_Cut_t * pCut; + int iFunc, iFunc0, iFunc1; + // get the best cut + pCut = Mpm_ObjCutBestP( pMan, pObj ); + // if the cut is visited, return the result + if ( Mpm_CutDataInt(pCut) ) + return Mpm_CutDataInt(pCut); + // mark the node as visited + Vec_PtrPush( vVisited, pCut ); + // insert the worst case + Mpm_CutSetDataInt( pCut, ~0 ); + // skip in case of primary input + if ( Mig_ObjIsCi(pObj) ) + return Mpm_CutDataInt(pCut); + // compute the functions of the children + for ( pTemp = pObj; pTemp; pTemp = Mig_ObjSibl(pTemp) ) + { + iFunc0 = Mpm_ManNodeIfToGia_rec( pNew, pMan, Mig_ObjFanin0(pTemp), vVisited, fHash ); + if ( iFunc0 == ~0 ) + continue; + iFunc1 = Mpm_ManNodeIfToGia_rec( pNew, pMan, Mig_ObjFanin1(pTemp), vVisited, fHash ); + if ( iFunc1 == ~0 ) + continue; + // both branches are solved + if ( fHash ) + iFunc = Gia_ManHashAnd( pNew, Abc_LitNotCond(iFunc0, Mig_ObjFaninC0(pTemp)), Abc_LitNotCond(iFunc1, Mig_ObjFaninC1(pTemp)) ); + else + iFunc = Gia_ManAppendAnd( pNew, Abc_LitNotCond(iFunc0, Mig_ObjFaninC0(pTemp)), Abc_LitNotCond(iFunc1, Mig_ObjFaninC1(pTemp)) ); + if ( Mig_ObjPhase(pTemp) != Mig_ObjPhase(pObj) ) + iFunc = Abc_LitNot(iFunc); + Mpm_CutSetDataInt( pCut, iFunc ); + break; + } + return Mpm_CutDataInt(pCut); +} +int Mpm_ManNodeIfToGia( Gia_Man_t * pNew, Mpm_Man_t * pMan, Mig_Obj_t * pObj, Vec_Int_t * vLeaves, int fHash ) +{ + Mpm_Cut_t * pCut; + Mig_Obj_t * pFanin; + int i, iRes; + // get the best cut + pCut = Mpm_ObjCutBestP( pMan, pObj ); + assert( pCut->nLeaves > 1 ); + // set the leaf variables + Mpm_CutForEachLeaf( pMan->pMig, pCut, pFanin, i ) + Mpm_CutSetDataInt( Mpm_ObjCutBestP(pMan, pFanin), Vec_IntEntry(vLeaves, i) ); + // recursively compute the function while collecting visited cuts + Vec_PtrClear( pMan->vTemp ); + iRes = Mpm_ManNodeIfToGia_rec( pNew, pMan, pObj, pMan->vTemp, fHash ); + if ( iRes == ~0 ) + { + Abc_Print( -1, "Mpm_ManNodeIfToGia(): Computing local AIG has failed.\n" ); + return ~0; + } + // clean the cuts + Mpm_CutForEachLeaf( pMan->pMig, pCut, pFanin, i ) + Mpm_CutSetDataInt( Mpm_ObjCutBestP(pMan, pFanin), 0 ); + Vec_PtrForEachEntry( Mpm_Cut_t *, pMan->vTemp, pCut, i ) + Mpm_CutSetDataInt( pCut, 0 ); + return iRes; +} +void * Mpm_ManFromIfLogic( Mpm_Man_t * pMan ) +{ + Gia_Man_t * pNew; + Mpm_Cut_t * pCutBest; + Mig_Obj_t * pObj, * pFanin; + Vec_Int_t * vMapping, * vMapping2, * vPacking = NULL; + Vec_Int_t * vLeaves, * vLeaves2, * vCover; + int i, k, Entry, iLitNew; +// assert( !pMan->pPars->fDeriveLuts || pMan->pPars->fTruth ); + // start mapping and packing + vMapping = Vec_IntStart( Mig_ManObjNum(pMan->pMig) ); + vMapping2 = Vec_IntStart( 1 ); + if ( 0 ) // pMan->pPars->fDeriveLuts && pMan->pPars->pLutStruct ) + { + vPacking = Vec_IntAlloc( 1000 ); + Vec_IntPush( vPacking, 0 ); + } + // create new manager + pNew = Gia_ManStart( Mig_ManObjNum(pMan->pMig) ); + // iterate through nodes used in the mapping + vCover = Vec_IntAlloc( 1 << 16 ); + vLeaves = Vec_IntAlloc( 16 ); + vLeaves2 = Vec_IntAlloc( 16 ); + Mig_ManCleanCopy( pMan->pMig ); + Mig_ManForEachObj( pMan->pMig, pObj ) + { + if ( !Mpm_ObjMapRef(pMan, pObj) && !Mig_ObjIsTerm(pObj) ) + continue; + if ( Mig_ObjIsNode(pObj) ) + { + // collect leaves of the best cut + Vec_IntClear( vLeaves ); + pCutBest = Mpm_ObjCutBestP( pMan, pObj ); + Mpm_CutForEachLeaf( pMan->pMig, pCutBest, pFanin, k ) + Vec_IntPush( vLeaves, Mig_ObjCopy(pFanin) ); + // perform one of the two types of mapping: with and without structures + iLitNew = Mpm_ManNodeIfToGia( pNew, pMan, pObj, vLeaves, 0 ); + // write mapping + Vec_IntSetEntry( vMapping, Abc_Lit2Var(iLitNew), Vec_IntSize(vMapping2) ); + Vec_IntPush( vMapping2, Vec_IntSize(vLeaves) ); + Vec_IntForEachEntry( vLeaves, Entry, k ) + assert( Abc_Lit2Var(Entry) < Abc_Lit2Var(iLitNew) ); + Vec_IntForEachEntry( vLeaves, Entry, k ) + Vec_IntPush( vMapping2, Abc_Lit2Var(Entry) ); + Vec_IntPush( vMapping2, Abc_Lit2Var(iLitNew) ); + } + else if ( Mig_ObjIsCi(pObj) ) + iLitNew = Gia_ManAppendCi(pNew); + else if ( Mig_ObjIsCo(pObj) ) + iLitNew = Gia_ManAppendCo( pNew, Abc_LitNotCond(Mig_ObjCopy(Mig_ObjFanin0(pObj)), Mig_ObjFaninC0(pObj)) ); + else if ( Mig_ObjIsConst0(pObj) ) + { + iLitNew = 0; + // create const LUT + Vec_IntWriteEntry( vMapping, 0, Vec_IntSize(vMapping2) ); + Vec_IntPush( vMapping2, 0 ); + Vec_IntPush( vMapping2, 0 ); + } + else assert( 0 ); + Mig_ObjSetCopy( pObj, iLitNew ); + } + Vec_IntFree( vCover ); + Vec_IntFree( vLeaves ); + Vec_IntFree( vLeaves2 ); +// printf( "Mapping array size: IfMan = %d. Gia = %d. Increase = %.2f\n", +// Mig_ManObjNum(pMan), Gia_ManObjNum(pNew), 1.0 * Gia_ManObjNum(pNew) / Mig_ManObjNum(pMan) ); + // finish mapping + if ( Vec_IntSize(vMapping) > Gia_ManObjNum(pNew) ) + Vec_IntShrink( vMapping, Gia_ManObjNum(pNew) ); + else + Vec_IntFillExtra( vMapping, Gia_ManObjNum(pNew), 0 ); + assert( Vec_IntSize(vMapping) == Gia_ManObjNum(pNew) ); + Vec_IntForEachEntry( vMapping, Entry, i ) + if ( Entry > 0 ) + Vec_IntAddToEntry( vMapping, i, Gia_ManObjNum(pNew) ); + Vec_IntAppend( vMapping, vMapping2 ); + Vec_IntFree( vMapping2 ); + // attach mapping and packing + assert( pNew->vMapping == NULL ); + assert( pNew->vPacking == NULL ); + pNew->vMapping = vMapping; + pNew->vPacking = vPacking; + // verify that COs have mapping + { + Gia_Obj_t * pObj; + Gia_ManForEachCo( pNew, pObj, i ) + assert( !Gia_ObjIsAnd(Gia_ObjFanin0(pObj)) || Gia_ObjIsLut(pNew, Gia_ObjFaninId0p(pNew, pObj)) ); + } + return pNew; +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +/* +void Mig_ManTest2( Gia_Man_t * pGia ) +{ + extern int Gia_ManSuppSizeTest( Gia_Man_t * p ); + Mig_Man_t * p; + Gia_ManSuppSizeTest( pGia ); + p = Mig_ManCreate( pGia ); + Mig_ManSuppSizeTest( p ); + Mig_ManStop( p ); +} +*/ + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + + +ABC_NAMESPACE_IMPL_END + diff --git a/src/map/mpm/mpmCore.c b/src/map/mpm/mpmCore.c new file mode 100644 index 00000000..605e716c --- /dev/null +++ b/src/map/mpm/mpmCore.c @@ -0,0 +1,96 @@ +/**CFile**************************************************************** + + FileName [mpmCore.c] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [Configurable technology mapper.] + + Synopsis [Core procedures.] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 1, 2013.] + + Revision [$Id: mpmCore.c,v 1.00 2013/06/01 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#include "aig/gia/gia.h" +#include "mpmInt.h" + +ABC_NAMESPACE_IMPL_START + + +//////////////////////////////////////////////////////////////////////// +/// DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Mpm_ManSetParsDefault( Mpm_Par_t * p ) +{ + memset( p, 0, sizeof(Mpm_Par_t) ); + p->DelayTarget = -1; // delay target + p->fVerbose = 0; // verbose output +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Gia_Man_t * Mpm_ManPerformTest( Mig_Man_t * pMig ) +{ + Gia_Man_t * pNew; + Mpm_LibLut_t * pLib; + Mpm_Man_t * p; + pLib = Mpm_LibLutSetSimple( 6 ); + p = Mpm_ManStart( pMig, pLib, 8 ); + Mpm_ManPrintStatsInit( p ); + Mpm_ManPrepare( p ); + Mpm_ManPerform( p ); + Mpm_ManPrintStats( p ); + pNew = (Gia_Man_t *)Mpm_ManFromIfLogic( p ); + Mpm_ManStop( p ); + Mpm_LibLutFree( pLib ); + return pNew; +} +Gia_Man_t * Mpm_ManMappingTest( Gia_Man_t * pGia, Mpm_Par_t * pPars ) +{ + Mig_Man_t * p; + Gia_Man_t * pNew; + p = Mig_ManCreate( pGia ); + pNew = Mpm_ManPerformTest( p ); + Mig_ManStop( p ); + return pNew; +} + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + + +ABC_NAMESPACE_IMPL_END + diff --git a/src/map/mpm/mpmDsd.c b/src/map/mpm/mpmDsd.c new file mode 100644 index 00000000..0cff45af --- /dev/null +++ b/src/map/mpm/mpmDsd.c @@ -0,0 +1,52 @@ +/**CFile**************************************************************** + + FileName [mpmDsd.c] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [Configurable technology mapper.] + + Synopsis [DSD manipulation.] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 1, 2013.] + + Revision [$Id: mpmDsd.c,v 1.00 2013/06/01 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#include "mpmInt.h" + +ABC_NAMESPACE_IMPL_START + + +//////////////////////////////////////////////////////////////////////// +/// DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + + +ABC_NAMESPACE_IMPL_END + diff --git a/src/map/mpm/mpmInt.h b/src/map/mpm/mpmInt.h new file mode 100644 index 00000000..bb235833 --- /dev/null +++ b/src/map/mpm/mpmInt.h @@ -0,0 +1,225 @@ +/**CFile**************************************************************** + + FileName [mpmInt.h] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [Configurable technology mapper.] + + Synopsis [Interal declarations.] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 1, 2013.] + + Revision [$Id: mpmInt.h,v 1.00 2013/06/01 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#ifndef ABC__map__mpm_Int_h +#define ABC__map__mpm_Int_h + + +//////////////////////////////////////////////////////////////////////// +/// INCLUDES /// +//////////////////////////////////////////////////////////////////////// + +#include <stdio.h> +#include <stdlib.h> +#include <string.h> +#include <assert.h> + +//#include "misc/tim/tim.h" +#include "misc/vec/vec.h" +#include "misc/mem/mem2.h" +#include "mpmMig.h" +#include "mpm.h" + +ABC_NAMESPACE_HEADER_START + +//////////////////////////////////////////////////////////////////////// +/// PARAMETERS /// +//////////////////////////////////////////////////////////////////////// + +#define MPM_CUT_MAX 64 + +#define MPM_UNIT_TIME 1 +#define MPM_UNIT_AREA 20 +#define MPM_UNIT_EDGE 50 +#define MPM_UNIT_REFS 100 + +//////////////////////////////////////////////////////////////////////// +/// BASIC TYPES /// +//////////////////////////////////////////////////////////////////////// + +typedef struct Mpm_Cut_t_ Mpm_Cut_t; // 8 bytes + NLeaves * 4 bytes +struct Mpm_Cut_t_ +{ + int hNext; // next cut + unsigned iFunc : 26; // function + unsigned fUseless : 1; // internal flag + unsigned nLeaves : 5; // leaves + int pLeaves[0]; // leaves +}; + +typedef struct Mpm_Inf_t_ Mpm_Inf_t; // 32 bytes +struct Mpm_Inf_t_ +{ + int hCut; // cut handle + unsigned nLeaves : 6; // the number of leaves + unsigned mCost : 26; // area cost of this cut + int mTime; // arrival time + int mArea; // area (flow) + int mEdge; // edge (flow) + int mAveRefs; // area references + word uSign; // cut signature +}; + +typedef struct Mpm_Uni_t_ Mpm_Uni_t; // 48 bytes +struct Mpm_Uni_t_ +{ + Mpm_Inf_t Inf; // information + unsigned iFunc : 26; // function + unsigned fUseless : 1; // internal flag + unsigned nLeaves : 5; // leaves + int pLeaves[MPM_VAR_MAX]; // leaves +}; + +typedef struct Mpm_Man_t_ Mpm_Man_t; +struct Mpm_Man_t_ +{ + Mig_Man_t * pMig; // AIG manager + // mapping parameters + int nLutSize; // LUT size + int nNumCuts; // cut count + Mpm_LibLut_t * pLibLut; // LUT library + // mapping attributes + int GloRequired; // global arrival time + int GloArea; // total area + int GloEdge; // total edge + int fMainRun; // after preprocessing is finished + // cut management + Mmr_Step_t * pManCuts; // cut memory + // temporary cut storage + int nCutStore; // number of cuts in storage + Mpm_Uni_t * pCutStore[MPM_CUT_MAX+1]; // storage for cuts + Mpm_Uni_t pCutUnits[MPM_CUT_MAX+1]; // cut info units + Vec_Int_t vFreeUnits; // free cut info units + Vec_Ptr_t * vTemp; // storage for cuts + // object presence + unsigned char * pObjPres; // object presence + Mpm_Cut_t * pCutTemp; // temporary cut + Vec_Str_t vObjShared; // object presence + // cut comparison + int (* pCutCmp) (Mpm_Inf_t *, Mpm_Inf_t *);// procedure to compare cuts + // fanin cuts/signatures + int nCuts[3]; // fanin cut counts + Mpm_Cut_t * pCuts[3][MPM_CUT_MAX+1]; // fanin cuts + word pSigns[3][MPM_CUT_MAX+1]; // fanin cut signatures + // functionality +// Dsd_Man_t * pManDsd; + void * pManDsd; + int pPerm[MPM_VAR_MAX]; + // mapping attributes + Vec_Int_t vCutBests; // cut best + Vec_Int_t vCutLists; // cut list + Vec_Int_t vMigRefs; // original references + Vec_Int_t vMapRefs; // exact mapping references + Vec_Int_t vEstRefs; // estimated mapping references + Vec_Int_t vRequireds; // required time + Vec_Int_t vTimes; // arrival time + Vec_Int_t vAreas; // area + Vec_Int_t vEdges; // edge + // statistics + int nCutsMerged; + abctime timeFanin; + abctime timeDerive; + abctime timeMerge; + abctime timeEval; + abctime timeCompare; + abctime timeStore; + abctime timeOther; + abctime timeTotal; +}; + +//////////////////////////////////////////////////////////////////////// +/// MACRO DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + +static inline int Mpm_ObjCutBest( Mpm_Man_t * p, Mig_Obj_t * pObj ) { return Vec_IntEntry(&p->vCutBests, Mig_ObjId(pObj)); } +static inline void Mpm_ObjSetCutBest( Mpm_Man_t * p, Mig_Obj_t * pObj, int i ) { Vec_IntWriteEntry(&p->vCutBests, Mig_ObjId(pObj), i); } + +static inline int Mpm_CutWordNum( int nLeaves ) { return (sizeof(Mpm_Cut_t)/sizeof(int) + nLeaves + 1) >> 1; } +static inline Mpm_Cut_t * Mpm_CutFetch( Mpm_Man_t * p, int h ) { Mpm_Cut_t * pCut = (Mpm_Cut_t *)Mmr_StepEntry( p->pManCuts, h ); assert( Mpm_CutWordNum(pCut->nLeaves) == (h & p->pManCuts->uMask) ); return pCut; } +static inline Mpm_Cut_t * Mpm_ObjCutBestP( Mpm_Man_t * p, Mig_Obj_t * pObj ) { return Mpm_CutFetch( p, Mpm_ObjCutBest(p, pObj) ); } + +static inline int Mpm_ObjCutList( Mpm_Man_t * p, Mig_Obj_t * pObj ) { return Vec_IntEntry(&p->vCutLists, Mig_ObjId(pObj)); } +static inline int * Mpm_ObjCutListP( Mpm_Man_t * p, Mig_Obj_t * pObj ) { return Vec_IntEntryP(&p->vCutLists, Mig_ObjId(pObj)); } +static inline void Mpm_ObjSetCutList( Mpm_Man_t * p, Mig_Obj_t * pObj, int i ) { Vec_IntWriteEntry(&p->vCutLists, Mig_ObjId(pObj), i); } + +static inline void Mpm_ManSetMigRefs( Mpm_Man_t * p ) { assert( Vec_IntSize(&p->vMigRefs) == Vec_IntSize(&p->pMig->vRefs) ); memcpy( Vec_IntArray(&p->vMigRefs), Vec_IntArray(&p->pMig->vRefs), sizeof(int) * Mig_ManObjNum(p->pMig) ); } +static inline int Mig_ObjMigRefNum( Mpm_Man_t * p, Mig_Obj_t * pObj ) { return Vec_IntEntry(&p->vMigRefs, Mig_ObjId(pObj)); } +static inline int Mig_ObjMigRefDec( Mpm_Man_t * p, Mig_Obj_t * pObj ) { return Vec_IntAddToEntry(&p->vMigRefs, Mig_ObjId(pObj), -1); } + +static inline void Mpm_ManCleanMapRefs( Mpm_Man_t * p ) { Vec_IntFill( &p->vMapRefs, Mig_ManObjNum(p->pMig), 0 ); } +static inline int Mpm_ObjMapRef( Mpm_Man_t * p, Mig_Obj_t * pObj ) { return Vec_IntEntry(&p->vMapRefs, Mig_ObjId(pObj)); } +static inline void Mpm_ObjSetMapRef( Mpm_Man_t * p, Mig_Obj_t * pObj, int i ) { Vec_IntWriteEntry(&p->vMapRefs, Mig_ObjId(pObj), i); } + +static inline int Mpm_ObjEstRef( Mpm_Man_t * p, Mig_Obj_t * pObj ) { return Vec_IntEntry(&p->vEstRefs, Mig_ObjId(pObj)); } +static inline void Mpm_ObjSetEstRef( Mpm_Man_t * p, Mig_Obj_t * pObj, int i ) { Vec_IntWriteEntry(&p->vEstRefs, Mig_ObjId(pObj), i); } + +static inline void Mpm_ManCleanRequired( Mpm_Man_t * p ) { Vec_IntFill(&p->vRequireds,Mig_ManObjNum(p->pMig),ABC_INFINITY);} +static inline int Mpm_ObjRequired( Mpm_Man_t * p, Mig_Obj_t * pObj ) { return Vec_IntEntry(&p->vRequireds, Mig_ObjId(pObj)); } +static inline void Mpm_ObjSetRequired( Mpm_Man_t * p, Mig_Obj_t * pObj, int i ) { Vec_IntWriteEntry(&p->vRequireds, Mig_ObjId(pObj), i); } + +static inline int Mpm_ObjTime( Mpm_Man_t * p, Mig_Obj_t * pObj ) { return Vec_IntEntry(&p->vTimes, Mig_ObjId(pObj)); } +static inline void Mpm_ObjSetTime( Mpm_Man_t * p, Mig_Obj_t * pObj, int i ) { Vec_IntWriteEntry(&p->vTimes, Mig_ObjId(pObj), i); } + +static inline int Mpm_ObjArea( Mpm_Man_t * p, Mig_Obj_t * pObj ) { return Vec_IntEntry(&p->vAreas, Mig_ObjId(pObj)); } +static inline void Mpm_ObjSetArea( Mpm_Man_t * p, Mig_Obj_t * pObj, int i ) { Vec_IntWriteEntry(&p->vAreas, Mig_ObjId(pObj), i); } + +static inline int Mpm_ObjEdge( Mpm_Man_t * p, Mig_Obj_t * pObj ) { return Vec_IntEntry(&p->vEdges, Mig_ObjId(pObj)); } +static inline void Mpm_ObjSetEdge( Mpm_Man_t * p, Mig_Obj_t * pObj, int i ) { Vec_IntWriteEntry(&p->vEdges, Mig_ObjId(pObj), i); } + +// iterators over object cuts +#define Mpm_ObjForEachCut( p, pObj, hCut, pCut ) \ + for ( hCut = Mpm_ObjCutList(p, pObj); hCut && (pCut = Mpm_CutFetch(p, hCut)); hCut = pCut->hNext ) +#define Mpm_ObjForEachCutSafe( p, pObj, hCut, pCut, hNext ) \ + for ( hCut = Mpm_ObjCutList(p, pObj); hCut && (pCut = Mpm_CutFetch(p, hCut)) && ((hNext = pCut->hNext), 1); hCut = hNext ) + +// iterators over cut leaves +#define Mpm_CutForEachLeafId( pCut, iLeafId, i ) \ + for ( i = 0; i < (int)pCut->nLeaves && ((iLeafId = Abc_Lit2Var(pCut->pLeaves[i])), 1); i++ ) +#define Mpm_CutForEachLeaf( p, pCut, pLeaf, i ) \ + for ( i = 0; i < (int)pCut->nLeaves && (pLeaf = Mig_ManObj(p, Abc_Lit2Var(pCut->pLeaves[i]))); i++ ) + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + +/*=== mpmAbc.c ===========================================================*/ +extern Mig_Man_t * Mig_ManCreate( void * pGia ); +extern void * Mpm_ManFromIfLogic( Mpm_Man_t * pMan ); +/*=== mpmCore.c ===========================================================*/ +extern Mpm_Man_t * Mpm_ManStart( Mig_Man_t * pMig, Mpm_LibLut_t * pLib, int nNumCuts ); +extern void Mpm_ManStop( Mpm_Man_t * p ); +extern void Mpm_ManPrintStatsInit( Mpm_Man_t * p ); +extern void Mpm_ManPrintStats( Mpm_Man_t * p ); +/*=== mpmDsd.c ===========================================================*/ +/*=== mpmLib.c ===========================================================*/ +extern Mpm_LibLut_t * Mpm_LibLutSetSimple( int nLutSize ); +extern void Mpm_LibLutFree( Mpm_LibLut_t * pLib ); +/*=== mpmMap.c ===========================================================*/ +extern void Mpm_ManPrepare( Mpm_Man_t * p ); +extern void Mpm_ManPerform( Mpm_Man_t * p ); + +ABC_NAMESPACE_HEADER_END + +#endif + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + diff --git a/src/map/mpm/mpmLib.c b/src/map/mpm/mpmLib.c new file mode 100644 index 00000000..14330323 --- /dev/null +++ b/src/map/mpm/mpmLib.c @@ -0,0 +1,74 @@ +/**CFile**************************************************************** + + FileName [mpmLib.c] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [Configurable technology mapper.] + + Synopsis [DSD manipulation for 6-input functions.] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 1, 2013.] + + Revision [$Id: mpmLib.c,v 1.00 2013/06/01 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#include "mpmInt.h" + +ABC_NAMESPACE_IMPL_START + + +//////////////////////////////////////////////////////////////////////// +/// DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Mpm_LibLut_t * Mpm_LibLutSetSimple( int nLutSize ) +{ + Mpm_LibLut_t * pLib; + int i, k; + assert( nLutSize < MPM_VAR_MAX ); + pLib = ABC_CALLOC( Mpm_LibLut_t, 1 ); + pLib->LutMax = nLutSize; + for ( i = 1; i <= pLib->LutMax; i++ ) + { + pLib->pLutAreas[i] = MPM_UNIT_AREA; + for ( k = 0; k < i; k++ ) + pLib->pLutDelays[i][k] = MPM_UNIT_TIME; + } + return pLib; +} +void Mpm_LibLutFree( Mpm_LibLut_t * pLib ) +{ + if ( pLib == NULL ) + return; + ABC_FREE( pLib->pName ); + ABC_FREE( pLib ); +} + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + + +ABC_NAMESPACE_IMPL_END + diff --git a/src/map/mpm/mpmMap.c b/src/map/mpm/mpmMap.c new file mode 100644 index 00000000..a876de2c --- /dev/null +++ b/src/map/mpm/mpmMap.c @@ -0,0 +1,988 @@ +/**CFile**************************************************************** + + FileName [mpmMap.c] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [Configurable technology mapper.] + + Synopsis [Mapping algorithm.] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 1, 2013.] + + Revision [$Id: mpmMap.c,v 1.00 2013/06/01 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#include "mpmInt.h" +#include "misc/util/utilTruth.h" + +ABC_NAMESPACE_IMPL_START + +//////////////////////////////////////////////////////////////////////// +/// DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + +/* + // check special cases + if ( fUseFunc ) + { + pCut0 = p->pCuts[0][0]; pCut1 = p->pCuts[1][0]; + if ( pCut0->iFunc < 2 || pCut1->iFunc < 2 ) + { + assert( Mig_ObjIsAnd(pObj) ); + if ( Abc_LitNotCond(pCut0->iFunc, Mig_ObjFaninC0(pObj)) == 0 || + Abc_LitNotCond(pCut1->iFunc, Mig_ObjFaninC1(pObj)) == 0 ) // set the resulting cut to 0 + Mig_ManObj(p, pObj)->hCutList = Mpm_CutCreateZero( p, pObj ); + else if ( Abc_LitNotCond(pCut0->iFunc, Mig_ObjFaninC0(pObj)) == 1 ) // set the resulting set to be that of Fanin1 + Mig_ManObj(p, pObj)->hCutList = Mpm_CutCopySet( p, Mig_ObjFanin1(pObj), 0 ); + else if ( Abc_LitNotCond(pCut1->iFunc, Mig_ObjFaninC1(pObj)) == 1 ) // set the resulting set to be that of Fanin0 + Mig_ManObj(p, pObj)->hCutList = Mpm_CutCopySet( p, Mig_ObjFanin0(pObj), 0 ); + else assert( 0 ); + goto finish; + } + } + // compute cut function + if ( fUseFunc ) + { + extern int Mpm_FuncCompute( void * p, int iDsd0, int iDsd1, Vec_Str_t * vShared, int * pPerm, int * pnLeaves ); + int nLeavesOld = p->pCutTemp->nLeaves; + int nLeaves = p->pCutTemp->nLeaves; + iDsd0 = Abc_LitNotCond( pCut0->iFunc, Mig_ObjFaninC0(pObj) ); + iDsd1 = Abc_LitNotCond( pCut1->iFunc, Mig_ObjFaninC1(pObj) ); + if ( iDsd0 > iDsd1 ) + { + ABC_SWAP( int, iDsd0, iDsd1 ); + ABC_SWAP( Mpm_Cut_t *, pCut0, pCut1 ); + } + // compute functionality and filter cuts dominated by support-reduced cuts + p->pCutTemp->iFunc = Mpm_FuncCompute( p->pManDsd, iDsd0, iDsd1, &p->vObjShared, p->pPerm, &nLeaves ); + Mpm_ObjUpdateCut( p->pCutTemp, p->pPerm, nLeaves ); + // consider filtering based on functionality + if ( nLeaves == 0 ) // derived const cut + { + Mig_ManObj(p, pObj)->hCutList = Mpm_CutCreateZero( p, pObj ); + goto finish; + } + if ( nLeaves == 1 ) // derived unit cut + { + pFanin = Mig_ManObj( p->pMig, Abc_Lit2Var(p->pCutTemp->pLeaves[0]) ); + Mig_ManObj(p, pObj)->hCutList = Mpm_CutCopySet( p, pFanin, Abc_LitIsCompl(p->pCutTemp->pLeaves[0]) ); + goto finish; + } + if ( nLeaves < nLeavesOld ) // reduced support of the cut + { + ArrTime = Mpm_CutGetArrTime( p, p->pCutTemp ); + if ( ArrTime > pMapObj->mRequired ) + continue; + } + } +*/ + + +/**Function************************************************************* + + Synopsis [Cut manipulation.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline int Mpm_CutAlloc( Mpm_Man_t * p, int nLeaves, Mpm_Cut_t ** ppCut ) +{ + int hHandle = Mmr_StepFetch( p->pManCuts, Mpm_CutWordNum(nLeaves) ); + *ppCut = (Mpm_Cut_t *)Mmr_StepEntry( p->pManCuts, hHandle ); + (*ppCut)->nLeaves = nLeaves; + (*ppCut)->hNext = 0; + (*ppCut)->fUseless = 0; + return hHandle; +} +static inline int Mpm_CutCreateZero( Mpm_Man_t * p ) +{ + Mpm_Cut_t * pCut; + int hCut = Mpm_CutAlloc( p, 0, &pCut ); + pCut->iFunc = 0; // const0 + return hCut; +} +static inline int Mpm_CutCreateUnit( Mpm_Man_t * p, int Id ) +{ + Mpm_Cut_t * pCut; + int hCut = Mpm_CutAlloc( p, 1, &pCut ); + pCut->iFunc = 2; // var + pCut->pLeaves[0] = Abc_Var2Lit( Id, 0 ); + return hCut; +} +static inline int Mpm_CutCreate( Mpm_Man_t * p, int * pLeaves, int nLeaves, int fUseless, Mpm_Cut_t ** ppCut ) +{ + int hCutNew = Mpm_CutAlloc( p, nLeaves, ppCut ); + (*ppCut)->fUseless = fUseless; + (*ppCut)->nLeaves = nLeaves; + memcpy( (*ppCut)->pLeaves, pLeaves, sizeof(int) * nLeaves ); + return hCutNew; +} +static inline int Mpm_CutDup( Mpm_Man_t * p, Mpm_Cut_t * pCut, int fCompl ) +{ + Mpm_Cut_t * pCutNew; + int hCutNew = Mpm_CutAlloc( p, pCut->nLeaves, &pCutNew ); + pCutNew->iFunc = Abc_LitNotCond( pCut->iFunc, fCompl ); + pCutNew->fUseless = pCut->fUseless; + pCutNew->nLeaves = pCut->nLeaves; + memcpy( pCutNew->pLeaves, pCut->pLeaves, sizeof(int) * pCut->nLeaves ); + return hCutNew; +} +static inline int Mpm_CutCopySet( Mpm_Man_t * p, Mig_Obj_t * pObj, int fCompl ) +{ + Mpm_Cut_t * pCut; + int hCut, iList = 0, * pList = &iList; + Mpm_ObjForEachCut( p, pObj, hCut, pCut ) + { + *pList = Mpm_CutDup( p, pCut, fCompl ); + pList = &Mpm_CutFetch( p, *pList )->hNext; + } + *pList = 0; + return iList; +} +/* +static inline void Mpm_CutRef( Mpm_Man_t * p, int * pLeaves, int nLeaves ) +{ + int i; + for ( i = 0; i < nLeaves; i++ ) + Mig_ManObj( p->pMig, Abc_Lit2Var(pLeaves[i]) )->nMapRefs++; +} +static inline void Mpm_CutDeref( Mpm_Man_t * p, int * pLeaves, int nLeaves ) +{ + int i; + for ( i = 0; i < nLeaves; i++ ) + Mig_ManObj( p->pMig, Abc_Lit2Var(pLeaves[i]) )->nMapRefs--; +} +*/ +static inline void Mpm_CutPrint( int * pLeaves, int nLeaves ) +{ + int i; + printf( "%d : { ", nLeaves ); + for ( i = 0; i < nLeaves; i++ ) + printf( "%d ", pLeaves[i] ); + printf( "}\n" ); +} +static inline void Mpm_CutPrintAll( Mpm_Man_t * p ) +{ + int i; + for ( i = 0; i < p->nCutStore; i++ ) + { + printf( "%2d : ", i ); + Mpm_CutPrint( p->pCutStore[i]->pLeaves, p->pCutStore[i]->nLeaves ); + } +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Mpm_Man_t * Mpm_ManStart( Mig_Man_t * pMig, Mpm_LibLut_t * pLib, int nNumCuts ) +{ + Mpm_Man_t * p; + assert( sizeof(Mpm_Inf_t) % sizeof(word) == 0 ); // aligned info to word boundary + assert( Mpm_CutWordNum(32) < 32 ); // using 5 bits for word count + assert( nNumCuts <= MPM_CUT_MAX ); + Mig_ManSetRefs( pMig, 1 ); + // alloc + p = ABC_CALLOC( Mpm_Man_t, 1 ); + p->pMig = pMig; + p->pLibLut = pLib; + p->nLutSize = pLib->LutMax; + p->nNumCuts = nNumCuts; + p->timeTotal = Abc_Clock(); + // cuts + p->pManCuts = Mmr_StepStart( 13, Abc_Base2Log(Mpm_CutWordNum(p->nLutSize) + 1) ); + Vec_IntGrow( &p->vFreeUnits, nNumCuts + 1 ); + p->pObjPres = ABC_FALLOC( unsigned char, Mig_ManObjNum(pMig) ); + p->pCutTemp = (Mpm_Cut_t *)ABC_CALLOC( word, Mpm_CutWordNum(p->nLutSize) ); + Vec_StrGrow( &p->vObjShared, 32 ); + p->vTemp = Vec_PtrAlloc( 1000 ); + // mapping attributes + Vec_IntFill( &p->vCutBests, Mig_ManObjNum(pMig), 0 ); + Vec_IntFill( &p->vCutLists, Mig_ManObjNum(pMig), 0 ); + Vec_IntFill( &p->vMigRefs, Mig_ManObjNum(pMig), 0 ); + Vec_IntFill( &p->vMapRefs, Mig_ManObjNum(pMig), 0 ); + Vec_IntFill( &p->vEstRefs, Mig_ManObjNum(pMig), 0 ); + Vec_IntFill( &p->vRequireds, Mig_ManObjNum(pMig), ABC_INFINITY ); + Vec_IntFill( &p->vTimes, Mig_ManObjNum(pMig), 0 ); + Vec_IntFill( &p->vAreas, Mig_ManObjNum(pMig), 0 ); + Vec_IntFill( &p->vEdges, Mig_ManObjNum(pMig), 0 ); + // start DSD manager + p->pManDsd = NULL; + pMig->pMan = p; + return p; +} +void Mpm_ManStop( Mpm_Man_t * p ) +{ + Vec_PtrFree( p->vTemp ); + Mmr_StepStop( p->pManCuts ); + ABC_FREE( p->vFreeUnits.pArray ); + ABC_FREE( p->vObjShared.pArray ); + ABC_FREE( p->pCutTemp ); + ABC_FREE( p->pObjPres ); + // mapping attributes + ABC_FREE( p->vCutBests.pArray ); + ABC_FREE( p->vCutLists.pArray ); + ABC_FREE( p->vMigRefs.pArray ); + ABC_FREE( p->vMapRefs.pArray ); + ABC_FREE( p->vEstRefs.pArray ); + ABC_FREE( p->vRequireds.pArray ); + ABC_FREE( p->vTimes.pArray ); + ABC_FREE( p->vAreas.pArray ); + ABC_FREE( p->vEdges.pArray ); + ABC_FREE( p ); +} +void Mpm_ManPrintStatsInit( Mpm_Man_t * p ) +{ + printf( "K = %d. C = %d. Cands = %d. Choices = %d.\n", + p->nLutSize, p->nNumCuts, Mig_ManCiNum(p->pMig) + Mig_ManNodeNum(p->pMig), 0 ); +} +void Mpm_ManPrintStats( Mpm_Man_t * p ) +{ + printf( "Memory usage: Mig = %.2f MB Map = %.2f MB Cut = %.2f MB Total = %.2f MB. ", + 1.0 * Mig_ManObjNum(p->pMig) * sizeof(Mig_Obj_t) / (1 << 20), + 1.0 * Mig_ManObjNum(p->pMig) * 48 / (1 << 20), + 1.0 * Mmr_StepMemory(p->pManCuts) / (1 << 17), + 1.0 * Mig_ManObjNum(p->pMig) * sizeof(Mig_Obj_t) / (1 << 20) + + 1.0 * Mig_ManObjNum(p->pMig) * 48 / (1 << 20) + + 1.0 * Mmr_StepMemory(p->pManCuts) / (1 << 17) ); + +#ifdef MIG_RUNTIME + printf( "\n" ); + p->timeTotal = Abc_Clock() - p->timeTotal; + p->timeOther = p->timeTotal - (p->timeFanin + p->timeDerive); + + Abc_Print( 1, "Runtime breakdown:\n" ); + ABC_PRTP( "Precomputing fanin info ", p->timeFanin , p->timeTotal ); + ABC_PRTP( "Complete cut computation ", p->timeDerive , p->timeTotal ); + ABC_PRTP( "- Merging cuts ", p->timeMerge , p->timeTotal ); + ABC_PRTP( "- Evaluting cut parameters ", p->timeEval , p->timeTotal ); + ABC_PRTP( "- Checking cut containment ", p->timeCompare, p->timeTotal ); + ABC_PRTP( "- Adding cuts to storage ", p->timeStore , p->timeTotal ); + ABC_PRTP( "Other ", p->timeOther , p->timeTotal ); + ABC_PRTP( "TOTAL ", p->timeTotal , p->timeTotal ); +#else + Abc_PrintTime( 1, "Time", Abc_Clock() - p->timeTotal ); +#endif +} + + +/**Function************************************************************* + + Synopsis [Cut merging.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline void Mig_ManObjPresClean( Mpm_Man_t * p ) +{ + int i; + for ( i = 0; i < (int)p->pCutTemp->nLeaves; i++ ) + p->pObjPres[Abc_Lit2Var(p->pCutTemp->pLeaves[i])] = (unsigned char)0xFF; +// for ( i = 0; i < Mig_ManObjNum(p->pMig); i++ ) +// assert( p->pObjPres[i] == (unsigned char)0xFF ); + Vec_StrClear(&p->vObjShared); +} +static inline int Mig_ManObjPres( Mpm_Man_t * p, int k, int iLit ) +{ + int iObj = Abc_Lit2Var(iLit); +// assert( iLit > 1 && iLit < 2 * Mig_ManObjNum(p->pMig) ); + if ( p->pObjPres[iObj] != (unsigned char)0xFF ) + return 1; + if ( (int)p->pCutTemp->nLeaves == p->nLutSize ) + return 0; + p->pObjPres[iObj] = p->pCutTemp->nLeaves; + p->pCutTemp->pLeaves[p->pCutTemp->nLeaves++] = iLit; + return 1; +} +static inline int Mpm_ObjDeriveCut( Mpm_Man_t * p, Mpm_Cut_t ** pCuts, Mpm_Cut_t * pCut ) +{ + int i, c; + pCut->nLeaves = 0; + for ( c = 0; pCuts[c] && c < 3; c++ ) + for ( i = 0; i < (int)pCuts[c]->nLeaves; i++ ) + if ( !Mig_ManObjPres( p, i, pCuts[c]->pLeaves[i] ) ) + return 0; + pCut->hNext = 0; + pCut->iFunc = 0; pCut->iFunc = ~pCut->iFunc; + pCut->fUseless = 0; + assert( pCut->nLeaves > 0 ); + p->nCutsMerged++; + return 1; +} + +static inline int Mpm_ManSetIsSmaller( Mpm_Man_t * p, int * pLits, int nLits ) // check if pCut is contained in the current one (p->pCutTemp) +{ + int i, Index; + for ( i = 0; i < nLits; i++ ) + { + Index = (int)p->pObjPres[Abc_Lit2Var(pLits[i])]; + if ( Index == 0xFF ) + return 0; + assert( Index < (int)p->pCutTemp->nLeaves ); + } + return 1; +} +static inline int Mpm_ManSetIsBigger( Mpm_Man_t * p, int * pLits, int nLits ) // check if pCut contains the current one (p->pCutTemp) +{ + int i, Index; + unsigned uMask = 0; + for ( i = 0; i < nLits; i++ ) + { + Index = (int)p->pObjPres[Abc_Lit2Var(pLits[i])]; + if ( Index == 0xFF ) + continue; + assert( Index < (int)p->pCutTemp->nLeaves ); + uMask |= (1 << Index); + } + return uMask == ~(~(unsigned)0 << p->pCutTemp->nLeaves); +} +static inline int Mpm_ManSetIsDisjoint( Mpm_Man_t * p, Mpm_Cut_t * pCut ) // check if pCut is disjoint +{ + int i; + for ( i = 0; i < (int)pCut->nLeaves; i++ ) + if ( (int)p->pObjPres[Abc_Lit2Var(pCut->pLeaves[i])] != 0xFF ) + return 0; + return 1; +} + + +/**Function************************************************************* + + Synopsis [Cut attibutes.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline word Mpm_CutGetSign( Mpm_Cut_t * pCut ) +{ + int i, iLeaf; + word uSign = 0; + Mpm_CutForEachLeafId( pCut, iLeaf, i ) + uSign |= ((word)1 << (iLeaf & 0x3F)); + return uSign; +} +static inline int Mpm_CutGetArrTime( Mpm_Man_t * p, Mpm_Cut_t * pCut ) +{ + int * pmTimes = Vec_IntArray( &p->vTimes ); + int * pDelays = p->pLibLut->pLutDelays[pCut->nLeaves]; + int i, iLeaf, ArrTime = 0; + Mpm_CutForEachLeafId( pCut, iLeaf, i ) + ArrTime = Abc_MaxInt( ArrTime, pmTimes[iLeaf] + pDelays[i] ); + return ArrTime; +} +static inline void Mpm_CutSetupInfo( Mpm_Man_t * p, Mpm_Cut_t * pCut, int ArrTime, Mpm_Inf_t * pInfo ) +{ + int * pMigRefs = Vec_IntArray( &p->vMigRefs ); + int * pMapRefs = Vec_IntArray( &p->vMapRefs ); + int * pEstRefs = Vec_IntArray( &p->vEstRefs ); + int * pmArea = Vec_IntArray( &p->vAreas ); + int * pmEdge = Vec_IntArray( &p->vEdges ); + int i, iLeaf; + memset( pInfo, 0, sizeof(Mpm_Inf_t) ); + pInfo->nLeaves = pCut->nLeaves; + pInfo->mTime = ArrTime; + pInfo->mArea = p->pLibLut->pLutAreas[pCut->nLeaves]; + pInfo->mEdge = MPM_UNIT_EDGE * pCut->nLeaves; + Mpm_CutForEachLeafId( pCut, iLeaf, i ) + { + if ( p->fMainRun && pMapRefs[iLeaf] == 0 ) // not used in the mapping + { + pInfo->mArea += pmArea[iLeaf]; + pInfo->mEdge += pmEdge[iLeaf]; + } + else + { + assert( pEstRefs[iLeaf] > 0 ); + pInfo->mArea += MPM_UNIT_REFS * pmArea[iLeaf] / pEstRefs[iLeaf]; + pInfo->mEdge += MPM_UNIT_REFS * pmEdge[iLeaf] / pEstRefs[iLeaf]; + pInfo->mAveRefs += p->fMainRun ? pMapRefs[iLeaf] : pMigRefs[iLeaf]; + } + pInfo->uSign |= ((word)1 << (iLeaf & 0x3F)); + } + pInfo->mAveRefs = pInfo->mAveRefs * MPM_UNIT_EDGE / pCut->nLeaves; +} + +/**Function************************************************************* + + Synopsis [Cut translation.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline Mpm_Uni_t * Mpm_CutToUnit( Mpm_Man_t * p, Mpm_Cut_t * pCut ) +{ + Mpm_Uni_t * pUnit = p->pCutUnits + Vec_IntPop(&p->vFreeUnits); + pUnit->iFunc = pCut->iFunc; + pUnit->fUseless = pCut->fUseless; + pUnit->nLeaves = pCut->nLeaves; + memcpy( pUnit->pLeaves, pCut->pLeaves, sizeof(int) * pCut->nLeaves ); + return pUnit; +} +static inline void Mpm_UnitRecycle( Mpm_Man_t * p, Mpm_Uni_t * pUnit ) +{ + Vec_IntPush( &p->vFreeUnits, pUnit - p->pCutUnits ); +} +static inline void Mpm_ManPrepareCutStore( Mpm_Man_t * p ) +{ + int i; + p->nCutStore = 0; + Vec_IntClear( &p->vFreeUnits ); + for ( i = p->nNumCuts; i >= 0; i-- ) + Vec_IntPush( &p->vFreeUnits, i ); + assert( Vec_IntSize(&p->vFreeUnits) == p->nNumCuts + 1 ); +} +// compares cut against those present in the store +int Mpm_ObjAddCutToStore( Mpm_Man_t * p, Mpm_Cut_t * pCut, int ArrTime ) +{ + int fEnableContainment = 1; + Mpm_Uni_t * pUnit, * pUnitNew; + int k, iPivot, last; + // create new unit +#ifdef MIG_RUNTIME + abctime clk; +clk = Abc_Clock(); +#endif + pUnitNew = Mpm_CutToUnit( p, pCut ); + Mpm_CutSetupInfo( p, pCut, ArrTime, &pUnitNew->Inf ); +#ifdef MIG_RUNTIME +p->timeEval += Abc_Clock() - clk; +#endif + // special case when the cut store is empty + if ( p->nCutStore == 0 ) + { + p->pCutStore[p->nCutStore++] = pUnitNew; + return 1; + } + // special case when the cut store is full and last cut is better than new cut + if ( p->nCutStore == p->nNumCuts-1 && p->pCutCmp(&pUnitNew->Inf, &p->pCutStore[p->nCutStore-1]->Inf) > 0 ) + { + Mpm_UnitRecycle( p, pUnitNew ); + return 0; + } + // find place of the given cut in the store + assert( p->nCutStore <= p->nNumCuts ); + for ( iPivot = p->nCutStore - 1; iPivot >= 0; iPivot-- ) + if ( p->pCutCmp(&pUnitNew->Inf, &p->pCutStore[iPivot]->Inf) > 0 ) // iPivot-th cut is better than new cut + break; + + if ( fEnableContainment ) + { +#ifdef MIG_RUNTIME +clk = Abc_Clock(); +#endif + // filter this cut using other cuts + for ( k = 0; k <= iPivot; k++ ) + { + pUnit = p->pCutStore[k]; + if ( pUnitNew->Inf.nLeaves >= pUnit->Inf.nLeaves && + (pUnitNew->Inf.uSign & pUnit->Inf.uSign) == pUnit->Inf.uSign && + Mpm_ManSetIsSmaller(p, pUnit->pLeaves, pUnit->nLeaves) ) + { +// printf( "\n" ); +// Mpm_CutPrint( pUnitNew->pLeaves, pUnitNew->nLeaves ); +// Mpm_CutPrint( pUnit->pLeaves, pUnit->nLeaves ); + Mpm_UnitRecycle( p, pUnitNew ); +#ifdef MIG_RUNTIME +p->timeCompare += Abc_Clock() - clk; +#endif + return 0; + } + } + } + + // special case when the best cut is useless while the new cut is not + if ( p->pCutStore[0]->fUseless && !pUnitNew->fUseless ) + iPivot = -1; + // insert this cut at location iPivot + iPivot++; + for ( k = p->nCutStore++; k > iPivot; k-- ) + p->pCutStore[k] = p->pCutStore[k-1]; + p->pCutStore[iPivot] = pUnitNew; + + if ( fEnableContainment ) + { + // filter other cuts using this cut + for ( k = last = iPivot+1; k < p->nCutStore; k++ ) + { + pUnit = p->pCutStore[k]; + if ( pUnitNew->Inf.nLeaves <= pUnit->Inf.nLeaves && + (pUnitNew->Inf.uSign & pUnit->Inf.uSign) == pUnitNew->Inf.uSign && + Mpm_ManSetIsBigger(p, pUnit->pLeaves, pUnit->nLeaves) ) + { +// printf( "\n" ); +// Mpm_CutPrint( pUnitNew->pLeaves, pUnitNew->nLeaves ); +// Mpm_CutPrint( pUnit->pLeaves, pUnit->nLeaves ); + Mpm_UnitRecycle( p, pUnit ); + continue; + } + p->pCutStore[last++] = p->pCutStore[k]; + } + p->nCutStore = last; +#ifdef MIG_RUNTIME +p->timeCompare += Abc_Clock() - clk; +#endif + } + + // remove the last cut if too many + if ( p->nCutStore == p->nNumCuts ) + Mpm_UnitRecycle( p, p->pCutStore[--p->nCutStore] ); + assert( p->nCutStore < p->nNumCuts ); + return 1; +} +// create storage from cuts at the node +void Mpm_ObjAddChoiceCutsToStore( Mpm_Man_t * p, Mig_Obj_t * pObj, int ReqTime ) +{ + Mpm_Cut_t * pCut; + int hCut, hNext, ArrTime; + assert( p->nCutStore == 0 ); + assert( Vec_IntSize(&p->vFreeUnits) == p->nNumCuts + 1 ); + Mpm_ObjForEachCutSafe( p, pObj, hCut, pCut, hNext ) + { + ArrTime = Mpm_CutGetArrTime( p, pCut ); + if ( ArrTime > ReqTime ) + continue; + Mpm_ObjAddCutToStore( p, pCut, ArrTime ); + Mmr_StepRecycle( p->pManCuts, hCut ); + } +} + +// create cuts at the node from storage +void Mpm_ObjTranslateCutsFromStore( Mpm_Man_t * p, Mig_Obj_t * pObj, int fAddUnit ) +{ + Mpm_Cut_t * pCut; + Mpm_Uni_t * pUnit; + int i, *pList = Mpm_ObjCutListP( p, pObj ); + assert( p->nCutStore > 0 && p->nCutStore <= p->nNumCuts ); + assert( *pList == 0 ); + // translate cuts + for ( i = 0; i < p->nCutStore; i++ ) + { + pUnit = p->pCutStore[i]; + *pList = Mpm_CutCreate( p, pUnit->pLeaves, pUnit->nLeaves, pUnit->fUseless, &pCut ); + pList = &pCut->hNext; + Mpm_UnitRecycle( p, pUnit ); + } + *pList = fAddUnit ? Mpm_CutCreateUnit( p, Mig_ObjId(pObj) ) : 0; + assert( Vec_IntSize(&p->vFreeUnits) == p->nNumCuts + 1 ); +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline void Mpm_ObjUpdateCut( Mpm_Cut_t * pCut, int * pPerm, int nLeaves ) +{ + int i; + assert( nLeaves <= (int)pCut->nLeaves ); + for ( i = 0; i < nLeaves; i++ ) + pPerm[i] = Abc_LitNotCond( pCut->pLeaves[Abc_Lit2Var(pPerm[i])], Abc_LitIsCompl(pPerm[i]) ); + memcpy( pCut->pLeaves, pPerm, sizeof(int) * nLeaves ); + pCut->nLeaves = nLeaves; +} +static inline void Mpm_ObjRecycleCuts( Mpm_Man_t * p, Mig_Obj_t * pObj ) +{ + Mpm_Cut_t * pCut; + int hCut, hNext; + Mpm_ObjForEachCutSafe( p, pObj, hCut, pCut, hNext ) + Mmr_StepRecycle( p->pManCuts, hCut ); + Mpm_ObjSetCutList( p, pObj, 0 ); +} +static inline void Mpm_ObjDerefFaninCuts( Mpm_Man_t * p, Mig_Obj_t * pObj ) +{ + Mig_Obj_t * pFanin; + int i; + Mig_ObjForEachFanin( pObj, pFanin, i ) + if ( Mig_ObjIsNode(pFanin) && Mig_ObjMigRefDec(p, pFanin) == 0 ) + Mpm_ObjRecycleCuts( p, pFanin ); + if ( Mig_ObjSiblId(pObj) ) + Mpm_ObjRecycleCuts( p, Mig_ObjSibl(pObj) ); + if ( Mig_ObjMigRefNum(p, pObj) == 0 ) + Mpm_ObjRecycleCuts( p, pObj ); +} +static inline void Mpm_ObjCollectFaninsAndSigns( Mpm_Man_t * p, Mig_Obj_t * pObj, int i ) +{ + Mpm_Cut_t * pCut; + int hCut, nCuts = 0; + Mpm_ObjForEachCut( p, pObj, hCut, pCut ) + { + p->pCuts[i][nCuts] = pCut; + p->pSigns[i][nCuts++] = Mpm_CutGetSign( pCut ); + } + p->nCuts[i] = nCuts; +} +static inline void Mpm_ObjPrepareFanins( Mpm_Man_t * p, Mig_Obj_t * pObj ) +{ + Mig_Obj_t * pFanin; + int i; + Mig_ObjForEachFanin( pObj, pFanin, i ) + Mpm_ObjCollectFaninsAndSigns( p, pFanin, i ); +} + +/**Function************************************************************* + + Synopsis [Cut enumeration.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline int Mpm_ManDeriveCutNew( Mpm_Man_t * p, Mpm_Cut_t ** pCuts, int Required ) +{ +// int fUseFunc = 0; + Mpm_Cut_t * pCut = p->pCutTemp; + int ArrTime; +#ifdef MIG_RUNTIME +abctime clk = clock(); +#endif + + Mig_ManObjPresClean( p ); + if ( !Mpm_ObjDeriveCut( p, pCuts, pCut ) ) + { +#ifdef MIG_RUNTIME +p->timeMerge += clock() - clk; +#endif + return 1; + } +#ifdef MIG_RUNTIME +p->timeMerge += clock() - clk; +clk = clock(); +#endif + ArrTime = Mpm_CutGetArrTime( p, pCut ); +#ifdef MIG_RUNTIME +p->timeEval += clock() - clk; +#endif + + if ( p->fMainRun && ArrTime > Required ) + return 1; +#ifdef MIG_RUNTIME +clk = Abc_Clock(); +#endif + Mpm_ObjAddCutToStore( p, pCut, ArrTime ); +#ifdef MIG_RUNTIME +p->timeStore += Abc_Clock() - clk; +#endif + return 1; + // return 0 if const or buffer cut is derived - reset all cuts to contain only one +} +int Mpm_ManDeriveCuts( Mpm_Man_t * p, Mig_Obj_t * pObj ) +{ +// static int Flag = 0; + Mpm_Cut_t * pCuts[3]; + int Required = Mpm_ObjRequired( p, pObj ); + int hCutBest = Mpm_ObjCutBest( p, pObj ); + int c0, c1, c2; +#ifdef MIG_RUNTIME + abctime clk; +#endif + Mpm_ManPrepareCutStore( p ); + assert( Mpm_ObjCutList(p, pObj) == 0 ); + if ( hCutBest > 0 ) // cut list is assigned + { + Mpm_Cut_t * pCut = Mpm_ObjCutBestP( p, pObj ); + int Times = Mpm_CutGetArrTime( p, pCut ); + assert( pCut->hNext == 0 ); + if ( Times > Required ) + printf( "Arrival time (%d) exceeds required time (%d) at object %d.\n", Times, Required, Mig_ObjId(pObj) ); + if ( p->fMainRun ) + Mpm_ObjAddCutToStore( p, pCut, Times ); + else + Mpm_ObjSetTime( p, pObj, Times ); + } + // start storage with choice cuts + if ( p->pMig->vSibls.nSize && Mig_ObjSiblId(pObj) ) + Mpm_ObjAddChoiceCutsToStore( p, Mig_ObjSibl(pObj), Required ); + // compute signatures for fanin cuts +#ifdef MIG_RUNTIME +clk = Abc_Clock(); +#endif + Mpm_ObjPrepareFanins( p, pObj ); +#ifdef MIG_RUNTIME +p->timeFanin += Abc_Clock() - clk; +#endif + // compute cuts in the internal storage +#ifdef MIG_RUNTIME +clk = Abc_Clock(); +#endif + if ( Mig_ObjIsNode2(pObj) ) + { + // go through cut pairs + pCuts[2] = NULL; + for ( c0 = 0; c0 < p->nCuts[0] && (pCuts[0] = p->pCuts[0][c0]); c0++ ) + for ( c1 = 0; c1 < p->nCuts[1] && (pCuts[1] = p->pCuts[1][c1]); c1++ ) + if ( Abc_TtCountOnes(p->pSigns[0][c0] | p->pSigns[1][c1]) <= p->nLutSize ) + if ( !Mpm_ManDeriveCutNew( p, pCuts, Required ) ) + goto finish; + } + else if ( Mig_ObjIsNode3(pObj) ) + { + // go through cut triples + for ( c0 = 0; c0 < p->nCuts[0] && (pCuts[0] = p->pCuts[0][c0]); c0++ ) + for ( c1 = 0; c1 < p->nCuts[1] && (pCuts[1] = p->pCuts[1][c1]); c1++ ) + for ( c2 = 0; c2 < p->nCuts[2] && (pCuts[2] = p->pCuts[2][c2]); c2++ ) + if ( Abc_TtCountOnes(p->pSigns[0][c0] | p->pSigns[1][c1] | p->pSigns[2][c2]) <= p->nLutSize ) + if ( !Mpm_ManDeriveCutNew( p, pCuts, Required ) ) + goto finish; + } + else assert( 0 ); +#ifdef MIG_RUNTIME +p->timeDerive += Abc_Clock() - clk; +#endif +finish: + // transform internal storage into regular cuts +// if ( Flag == 0 && p->nCutStore == p->nNumCuts - 1 ) +// Flag = 1, Mpm_CutPrintAll( p ); +// printf( "%d ", p->nCutStore ); + // save best cut + assert( p->nCutStore > 0 ); + if ( p->pCutStore[0]->Inf.mTime <= Required ) + { + Mpm_Cut_t * pCut; + if ( hCutBest ) + Mmr_StepRecycle( p->pManCuts, hCutBest ); + hCutBest = Mpm_CutCreate( p, p->pCutStore[0]->pLeaves, p->pCutStore[0]->nLeaves, p->pCutStore[0]->fUseless, &pCut ); + Mpm_ObjSetCutBest( p, pObj, hCutBest ); + Mpm_ObjSetTime( p, pObj, p->pCutStore[0]->Inf.mTime ); + Mpm_ObjSetArea( p, pObj, p->pCutStore[0]->Inf.mArea ); + Mpm_ObjSetEdge( p, pObj, p->pCutStore[0]->Inf.mEdge ); + } + else assert( !p->fMainRun ); + assert( hCutBest > 0 ); + // transform internal storage into regular cuts + Mpm_ObjTranslateCutsFromStore( p, pObj, Mig_ObjRefNum(pObj) > 0 ); + // dereference fanin cuts and reference node + Mpm_ObjDerefFaninCuts( p, pObj ); + return 1; +} + + +/**Function************************************************************* + + Synopsis [Required times.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline int Mpm_ManFindArrivalMax( Mpm_Man_t * p ) +{ + int * pmTimes = Vec_IntArray( &p->vTimes ); + Mig_Obj_t * pObj; + int i, ArrMax = 0; + Mig_ManForEachCo( p->pMig, pObj, i ) + ArrMax = Abc_MaxInt( ArrMax, pmTimes[ Mig_ObjFaninId0(pObj) ] ); + return ArrMax; +} +static inline void Mpm_ManFinalizeRound( Mpm_Man_t * p ) +{ + int * pMapRefs = Vec_IntArray( &p->vMapRefs ); + int * pRequired = Vec_IntArray( &p->vRequireds ); + Mig_Obj_t * pObj; + Mpm_Cut_t * pCut; + int * pDelays; + int i, iLeaf; + p->GloArea = 0; + p->GloEdge = 0; + p->GloRequired = Mpm_ManFindArrivalMax(p); + Mpm_ManCleanMapRefs( p ); + Mpm_ManCleanRequired( p ); + Mig_ManForEachObjReverse( p->pMig, pObj ) + { + if ( Mig_ObjIsCo(pObj) ) + { + pRequired[Mig_ObjFaninId0(pObj)] = p->GloRequired; + pMapRefs [Mig_ObjFaninId0(pObj)]++; + } + else if ( Mig_ObjIsNode(pObj) ) + { + int Required = pRequired[Mig_ObjId(pObj)]; + assert( Required > 0 ); + if ( pMapRefs[Mig_ObjId(pObj)] > 0 ) + { + pCut = Mpm_ObjCutBestP( p, pObj ); + pDelays = p->pLibLut->pLutDelays[pCut->nLeaves]; + Mpm_CutForEachLeafId( pCut, iLeaf, i ) + { + pRequired[iLeaf] = Abc_MinInt( pRequired[iLeaf], Required - pDelays[i] ); + pMapRefs [iLeaf]++; + } + p->GloArea += p->pLibLut->pLutAreas[pCut->nLeaves]; + p->GloEdge += pCut->nLeaves; + } + } + else if ( Mig_ObjIsBuf(pObj) ) + { + } + } + p->GloArea /= MPM_UNIT_AREA; +} +static inline void Mpm_ManComputeEstRefs( Mpm_Man_t * p ) +{ + int * pMapRefs = Vec_IntArray( &p->vMapRefs ); + int * pEstRefs = Vec_IntArray( &p->vEstRefs ); + int i; + assert( p->fMainRun ); +// pObj->EstRefs = (float)((2.0 * pObj->EstRefs + pObj->nRefs) / 3.0); + for ( i = 0; i < Mig_ManObjNum(p->pMig); i++ ) + pEstRefs[i] = (1 * pEstRefs[i] + MPM_UNIT_REFS * pMapRefs[i]) / 2; +} + +/**Function************************************************************* + + Synopsis [Cut comparison.] + + Description [Returns positive number if new one is better than old one.] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Mpm_CutCompareDelay( Mpm_Inf_t * pOld, Mpm_Inf_t * pNew ) +{ + if ( pOld->mTime != pNew->mTime ) return pOld->mTime - pNew->mTime; + if ( pOld->nLeaves != pNew->nLeaves ) return pOld->nLeaves - pNew->nLeaves; + if ( pOld->mArea != pNew->mArea ) return pOld->mArea - pNew->mArea; + if ( pOld->mEdge != pNew->mEdge ) return pOld->mEdge - pNew->mEdge; + return 0; +} +int Mpm_CutCompareDelay2( Mpm_Inf_t * pOld, Mpm_Inf_t * pNew ) +{ + if ( pOld->mTime != pNew->mTime ) return pOld->mTime - pNew->mTime; + if ( pOld->mArea != pNew->mArea ) return pOld->mArea - pNew->mArea; + if ( pOld->mEdge != pNew->mEdge ) return pOld->mEdge - pNew->mEdge; + if ( pOld->nLeaves != pNew->nLeaves ) return pOld->nLeaves - pNew->nLeaves; + return 0; +} +int Mpm_CutCompareArea( Mpm_Inf_t * pOld, Mpm_Inf_t * pNew ) +{ + if ( pOld->mArea != pNew->mArea ) return pOld->mArea - pNew->mArea; + if ( pOld->nLeaves != pNew->nLeaves ) return pOld->nLeaves - pNew->nLeaves; + if ( pOld->mEdge != pNew->mEdge ) return pOld->mEdge - pNew->mEdge; + if ( pOld->mAveRefs != pNew->mAveRefs ) return pOld->mAveRefs - pNew->mAveRefs; + if ( pOld->mTime != pNew->mTime ) return pOld->mTime - pNew->mTime; + return 0; +} +int Mpm_CutCompareArea2( Mpm_Inf_t * pOld, Mpm_Inf_t * pNew ) +{ + if ( pOld->mArea != pNew->mArea ) return pOld->mArea - pNew->mArea; + if ( pOld->mEdge != pNew->mEdge ) return pOld->mEdge - pNew->mEdge; + if ( pOld->mAveRefs != pNew->mAveRefs ) return pOld->mAveRefs - pNew->mAveRefs; + if ( pOld->nLeaves != pNew->nLeaves ) return pOld->nLeaves - pNew->nLeaves; + if ( pOld->mTime != pNew->mTime ) return pOld->mTime - pNew->mTime; + return 0; +} + +/**Function************************************************************* + + Synopsis [Technology mapping experiment.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Mpm_ManPrepare( Mpm_Man_t * p ) +{ + Mig_Obj_t * pObj; + int i, hCut; + Mig_ManForEachCi( p->pMig, pObj, i ) + { + hCut = Mpm_CutCreateUnit( p, Mig_ObjId(pObj) ); + Mpm_ObjSetCutBest( p, pObj, hCut ); + Mpm_ObjSetCutList( p, pObj, hCut ); + } + Mig_ManForEachCand( p->pMig, pObj ) + Mpm_ObjSetEstRef( p, pObj, MPM_UNIT_REFS * Mig_ObjRefNum(pObj) ); +} +void Mpm_ManPerformRound( Mpm_Man_t * p ) +{ + Mig_Obj_t * pObj; + abctime clk = Abc_Clock(); + p->nCutsMerged = 0; + Mpm_ManSetMigRefs( p ); + Mig_ManForEachNode( p->pMig, pObj ) + Mpm_ManDeriveCuts( p, pObj ); + Mpm_ManFinalizeRound( p ); + printf( "Del =%5d. Ar =%8d. Edge =%8d. Cut =%10d. Max =%10d. Rem =%6d. ", + p->GloRequired, p->GloArea, p->GloEdge, + p->nCutsMerged, p->pManCuts->nEntriesMax, p->pManCuts->nEntries ); + Abc_PrintTime( 1, "Time", Abc_Clock() - clk ); +} +void Mpm_ManPerform( Mpm_Man_t * p ) +{ + p->pCutCmp = Mpm_CutCompareDelay; + Mpm_ManPerformRound( p ); + + p->pCutCmp = Mpm_CutCompareDelay2; + Mpm_ManPerformRound( p ); + + p->pCutCmp = Mpm_CutCompareArea; + Mpm_ManPerformRound( p ); + + p->fMainRun = 1; + + p->pCutCmp = Mpm_CutCompareArea; + Mpm_ManComputeEstRefs( p ); + Mpm_ManPerformRound( p ); + + p->pCutCmp = Mpm_CutCompareArea2; + Mpm_ManComputeEstRefs( p ); + Mpm_ManPerformRound( p ); +} + + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + + +ABC_NAMESPACE_IMPL_END + diff --git a/src/map/mpm/mpmMig.c b/src/map/mpm/mpmMig.c new file mode 100644 index 00000000..d5b35beb --- /dev/null +++ b/src/map/mpm/mpmMig.c @@ -0,0 +1,177 @@ +/**CFile**************************************************************** + + FileName [mpmMig.c] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [Configurable technology mapper.] + + Synopsis [Subject graph data structure.] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 1, 2013.] + + Revision [$Id: mpmMig.c,v 1.00 2013/06/01 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#include "mpmInt.h" + +ABC_NAMESPACE_IMPL_START + + +//////////////////////////////////////////////////////////////////////// +/// DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Mig_Man_t * Mig_ManStart() +{ + Mig_Man_t * p; + assert( sizeof(Mig_Obj_t) >= 16 ); + assert( (1 << MIG_BASE) == MIG_MASK + 1 ); + p = ABC_CALLOC( Mig_Man_t, 1 ); + Vec_IntGrow( &p->vCis, 1024 ); + Vec_IntGrow( &p->vCos, 1024 ); + Mig_ManAppendObj( p ); // const0 + return p; +} +void Mig_ManStop( Mig_Man_t * p ) +{ + if ( 0 ) + printf( "Subject graph uses %d pages of %d objects with %d entries. Total memory = %.2f MB.\n", + Vec_PtrSize(&p->vPages), MIG_MASK + 1, p->nObjs, + 1.0 * Vec_PtrSize(&p->vPages) * (MIG_MASK + 1) * 16 / (1 << 20) ); + // attributes + ABC_FREE( p->vTravIds.pArray ); + ABC_FREE( p->vCopies.pArray ); + ABC_FREE( p->vLevels.pArray ); + ABC_FREE( p->vRefs.pArray ); + ABC_FREE( p->vSibls.pArray ); + // pages + Vec_PtrForEachEntry( Mig_Obj_t *, &p->vPages, p->pPage, p->iPage ) + --p->pPage, ABC_FREE( p->pPage ); + // objects + ABC_FREE( p->vPages.pArray ); + ABC_FREE( p->vCis.pArray ); + ABC_FREE( p->vCos.pArray ); + ABC_FREE( p->pName ); + ABC_FREE( p ); +} + + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Mig_ManSetRefs( Mig_Man_t * p, int fSkipCos ) +{ + Mig_Obj_t * pObj; + int i, iFanin; + // increment references + Vec_IntFill( &p->vRefs, Mig_ManObjNum(p), 0 ); + Mig_ManForEachNode( p, pObj ) + Mig_ObjForEachFaninId( pObj, iFanin, i ) + Vec_IntAddToEntry( &p->vRefs, iFanin, 1 ); + if ( !fSkipCos ) + { + // and CO references + Mig_ManForEachCo( p, pObj, i ) + Vec_IntAddToEntry( &p->vRefs, Mig_ObjFaninId(pObj, 0), 1 ); + // check that internal nodes have fanins + Mig_ManForEachNode( p, pObj ) + assert( Vec_IntEntry(&p->vRefs, Mig_ObjId(pObj)) > 0 ); + } +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Mig_ManSuppSize_rec( Mig_Obj_t * pObj ) +{ + if ( pObj == NULL ) + return 0; + if ( Mig_ObjIsTravIdCurrent(pObj) ) + return 0; + Mig_ObjSetTravIdCurrent(pObj); + if ( Mig_ObjIsCi(pObj) ) + return 1; + assert( Mig_ObjIsNode(pObj) ); + return Mig_ManSuppSize_rec( Mig_ObjFanin0(pObj) ) + + Mig_ManSuppSize_rec( Mig_ObjFanin1(pObj) ) + + Mig_ManSuppSize_rec( Mig_ObjFanin2(pObj) ); +} +int Mig_ManSuppSize2_rec( Mig_Man_t * p, int iObj ) +{ + Mig_Obj_t * pObj; + if ( iObj == MIG_NONE ) + return 0; + if ( Mig_ObjIsTravIdCurrentId(p, iObj) ) + return 0; + Mig_ObjSetTravIdCurrentId(p, iObj); + pObj = Mig_ManObj( p, iObj ); + if ( Mig_ObjIsCi(pObj) ) + return 1; + assert( Mig_ObjIsNode(pObj) ); + return Mig_ManSuppSize2_rec( p, Mig_ObjFaninId0(pObj) ) + + Mig_ManSuppSize2_rec( p, Mig_ObjFaninId1(pObj) ) + + Mig_ManSuppSize2_rec( p, Mig_ObjFaninId2(pObj) ); +} +int Mig_ManSuppSizeOne( Mig_Obj_t * pObj ) +{ + Mig_ObjIncrementTravId( pObj ); +// return Mig_ManSuppSize_rec( pObj ); + return Mig_ManSuppSize2_rec( Mig_ObjMan(pObj), Mig_ObjId(pObj) ); +} +int Mig_ManSuppSizeTest( Mig_Man_t * p ) +{ + Mig_Obj_t * pObj; + int Counter = 0; + abctime clk = Abc_Clock(); + Mig_ManForEachObj( p, pObj ) + if ( Mig_ObjIsNode(pObj) ) + Counter += (Mig_ManSuppSizeOne(pObj) <= 16); + printf( "Nodes with small support %d (out of %d)\n", Counter, Mig_ManNodeNum(p) ); + Abc_PrintTime( 1, "Time", Abc_Clock() - clk ); + return Counter; +} + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + + +ABC_NAMESPACE_IMPL_END + diff --git a/src/map/mpm/mpmMig.h b/src/map/mpm/mpmMig.h new file mode 100644 index 00000000..71b0f3ac --- /dev/null +++ b/src/map/mpm/mpmMig.h @@ -0,0 +1,353 @@ +/**CFile**************************************************************** + + FileName [mpmMig.h] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [Configurable technology mapper.] + + Synopsis [Internal declarations.] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 1, 2013.] + + Revision [$Id: mpmMig.h,v 1.00 2013/06/01 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#ifndef ABC__map__mpm__mig__h +#define ABC__map__mpm__mig__h + + +//////////////////////////////////////////////////////////////////////// +/// INCLUDES /// +//////////////////////////////////////////////////////////////////////// + +#include "misc/vec/vec.h" + +ABC_NAMESPACE_HEADER_START + +//////////////////////////////////////////////////////////////////////// +/// PARAMETERS /// +//////////////////////////////////////////////////////////////////////// + +//#define MIG_RUNTIME +#define MIG_NONE 0x7FFFFFFF +//#define MIG_MASK 0x0000FFFF +//#define MIG_BASE 16 +#define MIG_MASK 0x0000FFF +#define MIG_BASE 12 + +//////////////////////////////////////////////////////////////////////// +/// BASIC TYPES /// +//////////////////////////////////////////////////////////////////////// + +typedef struct Mig_Fan_t_ Mig_Fan_t; +struct Mig_Fan_t_ +{ + unsigned fCompl : 1; // the complemented attribute + unsigned Id : 31; // fanin ID +}; + +typedef struct Mig_Obj_t_ Mig_Obj_t; +struct Mig_Obj_t_ +{ + Mig_Fan_t pFans[4]; // fanins +}; + +typedef struct Mig_Man_t_ Mig_Man_t; +struct Mig_Man_t_ +{ + char * pName; // name + int nObjs; // number of objects + int nRegs; // number of flops + Vec_Ptr_t vPages; // memory pages + Vec_Int_t vCis; // CI IDs + Vec_Int_t vCos; // CO IDs + // object iterator + Mig_Obj_t * pPage; // current page + int iPage; // current page index + // attributes + int nTravIds; // traversal ID counter + Vec_Int_t vTravIds; // traversal IDs + Vec_Int_t vLevels; // levels + Vec_Int_t vSibls; // choice nodes + Vec_Int_t vRefs; // ref counters + Vec_Int_t vCopies; // copies + void * pMan; // mapping manager +}; + +/* + Usage of fanin atrributes + -------------------------------------------------------------------------------------------------------------- + Const0 Terminal CI CO Buf Node Node2 Node3 And2 XOR2 MUX MAJ Sentinel + -------------------------------------------------------------------------------------------------------------- + 0 - -/fanin0 - fanin0 fanin0 fanin0 fanin0 fanin0 fanin0 fanin1 fanin0 fanin1 - + 1 - - - - - fanin1 fanin1 fanin1 fanin1 fanin0 fanin1 fanin0 - + 2 - CIO ID CIO ID CIO ID - -/fanin2 - fanin2 - - fanin2 fanin2 - + 3 0 ID ID ID ID ID ID ID ID ID ID ID - + -------------------------------------------------------------------------------------------------------------- + + One memory page contain 2^MIG_BASE+2 16-byte objects. + - the first object contains the pointer to the manager (8 bytes) + - the next 2^MIG_BASE are potentially used as objects + - the last object is a sentinel to signal the end of the page +*/ + +static inline int Mig_IdPage( int v ) { return v >> MIG_BASE; } +static inline int Mig_IdCell( int v ) { return v & MIG_MASK; } + +static inline char * Mig_ManName( Mig_Man_t * p ) { return p->pName; } +static inline int Mig_ManCiNum( Mig_Man_t * p ) { return Vec_IntSize(&p->vCis); } +static inline int Mig_ManCoNum( Mig_Man_t * p ) { return Vec_IntSize(&p->vCos); } +static inline int Mig_ManPiNum( Mig_Man_t * p ) { return Vec_IntSize(&p->vCis) - p->nRegs; } +static inline int Mig_ManPoNum( Mig_Man_t * p ) { return Vec_IntSize(&p->vCos) - p->nRegs; } +static inline int Mig_ManRegNum( Mig_Man_t * p ) { return p->nRegs; } +static inline int Mig_ManObjNum( Mig_Man_t * p ) { return p->nObjs; } +static inline int Mig_ManNodeNum( Mig_Man_t * p ) { return p->nObjs - Vec_IntSize(&p->vCis) - Vec_IntSize(&p->vCos) - 1; } +static inline int Mig_ManCandNum( Mig_Man_t * p ) { return Mig_ManCiNum(p) + Mig_ManNodeNum(p); } +static inline void Mig_ManSetRegNum( Mig_Man_t * p, int v ) { p->nRegs = v; } + +static inline Mig_Obj_t * Mig_ManPage( Mig_Man_t * p, int v ) { return (Mig_Obj_t *)Vec_PtrEntry(&p->vPages, Mig_IdPage(v)); } +static inline Mig_Obj_t * Mig_ManObj( Mig_Man_t * p, int v ) { assert(v >= 0 && v < p->nObjs); return Mig_ManPage(p, v) + Mig_IdCell(v); } +static inline Mig_Obj_t * Mig_ManCi( Mig_Man_t * p, int v ) { return Mig_ManObj( p, Vec_IntEntry(&p->vCis,v) ); } +static inline Mig_Obj_t * Mig_ManCo( Mig_Man_t * p, int v ) { return Mig_ManObj( p, Vec_IntEntry(&p->vCos,v) ); } +static inline Mig_Obj_t * Mig_ManPi( Mig_Man_t * p, int v ) { assert( v < Mig_ManPiNum(p) ); return Mig_ManCi( p, v ); } +static inline Mig_Obj_t * Mig_ManPo( Mig_Man_t * p, int v ) { assert( v < Mig_ManPoNum(p) ); return Mig_ManCo( p, v ); } +static inline Mig_Obj_t * Mig_ManRo( Mig_Man_t * p, int v ) { assert( v < Mig_ManRegNum(p) ); return Mig_ManCi( p, Mig_ManPiNum(p)+v ); } +static inline Mig_Obj_t * Mig_ManRi( Mig_Man_t * p, int v ) { assert( v < Mig_ManRegNum(p) ); return Mig_ManCo( p, Mig_ManPoNum(p)+v ); } +static inline Mig_Obj_t * Mig_ManConst0( Mig_Man_t * p ) { return Mig_ManObj(p, 0); } + +static inline int Mig_FanCompl( Mig_Obj_t * p, int i ) { return p->pFans[i].fCompl; } +static inline int Mig_FanId( Mig_Obj_t * p, int i ) { return p->pFans[i].Id; } +static inline int Mig_FanIsNone( Mig_Obj_t * p, int i ) { return p->pFans[i].Id == MIG_NONE; } +static inline int Mig_FanSetCompl( Mig_Obj_t * p, int i, int v ) { assert( !(v >> 1) ); return p->pFans[i].fCompl = v; } +static inline int Mig_FanSetId( Mig_Obj_t * p, int i, int v ) { assert(v >= 0 && v < MIG_NONE); return p->pFans[i].Id = v; } + +static inline int Mig_ObjIsNone( Mig_Obj_t * p ) { return Mig_FanIsNone( p, 3 ); } +static inline int Mig_ObjIsConst0( Mig_Obj_t * p ) { return Mig_FanId( p, 3 ) == 0; } +static inline int Mig_ObjIsTerm( Mig_Obj_t * p ) { return Mig_FanIsNone( p, 1 ) && !Mig_FanIsNone( p, 2 ); } +static inline int Mig_ObjIsCi( Mig_Obj_t * p ) { return Mig_ObjIsTerm(p) && Mig_FanIsNone( p, 0 ); } +static inline int Mig_ObjIsCo( Mig_Obj_t * p ) { return Mig_ObjIsTerm(p) && !Mig_FanIsNone( p, 0 ); } +static inline int Mig_ObjIsBuf( Mig_Obj_t * p ) { return Mig_FanIsNone( p, 1 ) && Mig_FanIsNone( p, 2 ) && !Mig_FanIsNone( p, 0 ); } +static inline int Mig_ObjIsNode( Mig_Obj_t * p ) { return!Mig_FanIsNone( p, 1 ); } +static inline int Mig_ObjIsNode2( Mig_Obj_t * p ) { return Mig_ObjIsNode( p ) && Mig_FanIsNone( p, 2 ); } +static inline int Mig_ObjIsNode3( Mig_Obj_t * p ) { return Mig_ObjIsNode( p ) && !Mig_FanIsNone( p, 2 ); } +static inline int Mig_ObjIsAnd( Mig_Obj_t * p ) { return Mig_ObjIsNode2( p ) && Mig_FanId(p, 0) < Mig_FanId(p, 1); } +static inline int Mig_ObjIsXor( Mig_Obj_t * p ) { return Mig_ObjIsNode2( p ) && Mig_FanId(p, 0) > Mig_FanId(p, 1); } +static inline int Mig_ObjIsMux( Mig_Obj_t * p ) { return Mig_ObjIsNode3( p ); } +static inline int Mig_ObjIsCand( Mig_Obj_t * p ) { return Mig_ObjIsNode(p) || Mig_ObjIsCi(p); } + +static inline int Mig_ObjId( Mig_Obj_t * p ) { return Mig_FanId( p, 3 ); } +static inline void Mig_ObjSetId( Mig_Obj_t * p, int v ) { Mig_FanSetId( p, 3, v ); } +static inline int Mig_ObjCioId( Mig_Obj_t * p ) { assert( Mig_ObjIsTerm(p) ); return Mig_FanId( p, 2 ); } +static inline void Mig_ObjSetCioId( Mig_Obj_t * p, int v ) { assert( Mig_FanIsNone(p, 1) ); Mig_FanSetId( p, 2, v ); } +static inline int Mig_ObjPhase( Mig_Obj_t * p ) { return Mig_FanCompl( p, 3 ); } +static inline void Mig_ObjSetPhase( Mig_Obj_t * p, int v ) { Mig_FanSetCompl( p, 3, 1 ); } + +static inline Mig_Man_t * Mig_ObjMan( Mig_Obj_t * p ) { return *((Mig_Man_t**)(p - Mig_IdCell(Mig_ObjId(p)) - 1)); } +//static inline Mig_Obj_t ** Mig_ObjPageP( Mig_Obj_t * p ) { return *((Mig_Obj_t***)(p - Mig_IdCell(Mig_ObjId(p))) - 1);} +static inline Mig_Obj_t * Mig_ObjObj( Mig_Obj_t * p, int i ) { return Mig_ManObj( Mig_ObjMan(p), i ); } + +static inline int Mig_ManIdToCioId( Mig_Man_t * p, int Id ) { return Mig_ObjCioId( Mig_ManObj(p, Id) ); } +static inline int Mig_ManCiIdToId( Mig_Man_t * p, int CiId ) { return Mig_ObjId( Mig_ManCi(p, CiId) ); } +static inline int Mig_ManCoIdToId( Mig_Man_t * p, int CoId ) { return Mig_ObjId( Mig_ManCo(p, CoId) ); } + +static inline int Mig_ObjIsPi( Mig_Obj_t * p ) { return Mig_ObjIsCi(p) && Mig_ObjCioId(p) < Mig_ManPiNum(Mig_ObjMan(p)); } +static inline int Mig_ObjIsPo( Mig_Obj_t * p ) { return Mig_ObjIsCo(p) && Mig_ObjCioId(p) < Mig_ManPoNum(Mig_ObjMan(p)); } +static inline int Mig_ObjIsRo( Mig_Obj_t * p ) { return Mig_ObjIsCi(p) && Mig_ObjCioId(p) >= Mig_ManPiNum(Mig_ObjMan(p)); } +static inline int Mig_ObjIsRi( Mig_Obj_t * p ) { return Mig_ObjIsCo(p) && Mig_ObjCioId(p) >= Mig_ManPoNum(Mig_ObjMan(p)); } + +static inline Mig_Obj_t * Mig_ObjRoToRi( Mig_Obj_t * p ) { Mig_Man_t * pMan = Mig_ObjMan(p); assert( Mig_ObjIsRo(p) ); return Mig_ManCo(pMan, Mig_ManCoNum(pMan) - Mig_ManCiNum(pMan) + Mig_ObjCioId(p)); } +static inline Mig_Obj_t * Mig_ObjRiToRo( Mig_Obj_t * p ) { Mig_Man_t * pMan = Mig_ObjMan(p); assert( Mig_ObjIsRi(p) ); return Mig_ManCi(pMan, Mig_ManCiNum(pMan) - Mig_ManCoNum(pMan) + Mig_ObjCioId(p)); } + +static inline int Mig_ObjHasFanin( Mig_Obj_t * p, int i ) { return i < 3 && Mig_FanId(p, i) != MIG_NONE; } +static inline int Mig_ObjFaninId( Mig_Obj_t * p, int i ) { assert( i < 3 && Mig_FanId(p, i) < Mig_ObjId(p) ); return Mig_FanId( p, i ); } +static inline int Mig_ObjFaninId0( Mig_Obj_t * p ) { return Mig_FanId( p, 0 ); } +static inline int Mig_ObjFaninId1( Mig_Obj_t * p ) { return Mig_FanId( p, 1 ); } +static inline int Mig_ObjFaninId2( Mig_Obj_t * p ) { return Mig_FanId( p, 2 ); } +static inline Mig_Obj_t * Mig_ObjFanin( Mig_Obj_t * p, int i ) { return Mig_ManObj( Mig_ObjMan(p), Mig_ObjFaninId(p, i) ); } +//static inline Mig_Obj_t * Mig_ObjFanin( Mig_Obj_t * p, int i ) { return Mig_ObjPageP(p)[Mig_IdPage(Mig_ObjFaninId(p, i))] + Mig_IdCell(Mig_ObjFaninId(p, i)); } +static inline Mig_Obj_t * Mig_ObjFanin0( Mig_Obj_t * p ) { return Mig_FanIsNone(p, 0) ? NULL: Mig_ObjFanin(p, 0); } +static inline Mig_Obj_t * Mig_ObjFanin1( Mig_Obj_t * p ) { return Mig_FanIsNone(p, 1) ? NULL: Mig_ObjFanin(p, 1); } +static inline Mig_Obj_t * Mig_ObjFanin2( Mig_Obj_t * p ) { return Mig_FanIsNone(p, 2) ? NULL: Mig_ObjFanin(p, 2); } +static inline int Mig_ObjFaninC( Mig_Obj_t * p, int i ) { assert( i < 3 ); return Mig_FanCompl(p, i); } +static inline int Mig_ObjFaninC0( Mig_Obj_t * p ) { return Mig_FanCompl(p, 0); } +static inline int Mig_ObjFaninC1( Mig_Obj_t * p ) { return Mig_FanCompl(p, 1); } +static inline int Mig_ObjFaninC2( Mig_Obj_t * p ) { return Mig_FanCompl(p, 2); } +static inline int Mig_ObjFaninLit( Mig_Obj_t * p, int i ) { return Abc_Var2Lit( Mig_FanId(p, i), Mig_FanCompl(p, i) ); } +static inline void Mig_ObjFlipFaninC( Mig_Obj_t * p, int i ) { Mig_FanSetCompl( p, i, !Mig_FanCompl(p, i) ); } +static inline int Mig_ObjWhatFanin( Mig_Obj_t * p, int i ) { if (Mig_FanId(p, 0) == i) return 0; if (Mig_FanId(p, 1) == i) return 1; if (Mig_FanId(p, 2) == i) return 2; return -1; } +static inline void Mig_ObjSetFaninLit( Mig_Obj_t * p, int i, int l ) { assert( l >= 0 && (l >> 1) < Mig_ObjId(p) ); Mig_FanSetId(p, i, Abc_Lit2Var(l)); Mig_FanSetCompl(p, i, Abc_LitIsCompl(l)); } + +static inline int Mig_ObjSiblId( Mig_Obj_t * p ) { return Vec_IntSize(&Mig_ObjMan(p)->vSibls) == 0 ? 0: Vec_IntEntry(&Mig_ObjMan(p)->vSibls, Mig_ObjId(p)); } +static inline Mig_Obj_t * Mig_ObjSibl( Mig_Obj_t * p ) { return Mig_ObjSiblId(p) == 0 ? NULL: Mig_ObjObj(p, Mig_ObjSiblId(p)); } +static inline int Mig_ObjRefNum( Mig_Obj_t * p ) { return Vec_IntEntry(&Mig_ObjMan(p)->vRefs, Mig_ObjId(p)); } + +static inline void Mig_ManCleanCopy( Mig_Man_t * p ) { if ( p->vCopies.pArray == NULL ) Vec_IntFill( &p->vCopies, Mig_ManObjNum(p), -1 ); } +static inline int Mig_ObjCopy( Mig_Obj_t * p ) { return Vec_IntSize(&Mig_ObjMan(p)->vCopies) == 0 ? -1: Vec_IntEntry(&Mig_ObjMan(p)->vCopies, Mig_ObjId(p)); } +static inline void Mig_ObjSetCopy( Mig_Obj_t * p, int i ) { assert( Vec_IntSize(&Mig_ObjMan(p)->vCopies) != 0 ); Vec_IntWriteEntry(&Mig_ObjMan(p)->vCopies, Mig_ObjId(p), i); } + +static inline void Mig_ManIncrementTravId( Mig_Man_t * p ) { if ( p->vTravIds.pArray == NULL ) Vec_IntFill( &p->vTravIds, Mig_ManObjNum(p)+500, 0 ); p->nTravIds++; } +static inline void Mig_ObjIncrementTravId( Mig_Obj_t * p ) { if ( Mig_ObjMan(p)->vTravIds.pArray == NULL ) Vec_IntFill( &Mig_ObjMan(p)->vTravIds, Mig_ManObjNum(Mig_ObjMan(p))+500, 0 ); Mig_ObjMan(p)->nTravIds++; } +static inline void Mig_ObjSetTravIdCurrent( Mig_Obj_t * p ) { Vec_IntSetEntry(&Mig_ObjMan(p)->vTravIds, Mig_ObjId(p), Mig_ObjMan(p)->nTravIds ); } +static inline void Mig_ObjSetTravIdPrevious( Mig_Obj_t * p ) { Vec_IntSetEntry(&Mig_ObjMan(p)->vTravIds, Mig_ObjId(p), Mig_ObjMan(p)->nTravIds-1 ); } +static inline int Mig_ObjIsTravIdCurrent( Mig_Obj_t * p ) { return (Vec_IntGetEntry(&Mig_ObjMan(p)->vTravIds, Mig_ObjId(p)) == Mig_ObjMan(p)->nTravIds); } +static inline int Mig_ObjIsTravIdPrevious( Mig_Obj_t * p ) { return (Vec_IntGetEntry(&Mig_ObjMan(p)->vTravIds, Mig_ObjId(p)) == Mig_ObjMan(p)->nTravIds-1); } +static inline void Mig_ObjSetTravIdCurrentId( Mig_Man_t * p, int Id ) { Vec_IntSetEntry(&p->vTravIds, Id, p->nTravIds ); } +static inline int Mig_ObjIsTravIdCurrentId( Mig_Man_t * p, int Id ) { return (Vec_IntGetEntry(&p->vTravIds, Id) == p->nTravIds); } + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline Mig_Obj_t * Mig_ManAppendObj( Mig_Man_t * p ) +{ + Mig_Obj_t * pObj; + assert( p->nObjs < MIG_NONE ); + if ( p->nObjs >= (Vec_PtrSize(&p->vPages) << MIG_BASE) ) + { + Mig_Obj_t * pPage;// int i; + assert( p->nObjs == (Vec_PtrSize(&p->vPages) << MIG_BASE) ); + pPage = ABC_FALLOC( Mig_Obj_t, MIG_MASK + 3 ); // 1 for mask, 1 for prefix, 1 for sentinel + *((void **)pPage) = p; +// *((void ***)(pPage + 1) - 1) = Vec_PtrArray(&p->vPages); + Vec_PtrPush( &p->vPages, pPage + 1 ); +// if ( *((void ***)(pPage + 1) - 1) != Vec_PtrArray(&p->vPages) ) +// Vec_PtrForEachEntry( Mig_Obj_t *, &p->vPages, pPage, i ) +// *((void ***)pPage - 1) = Vec_PtrArray(&p->vPages); + } + pObj = Mig_ManObj( p, p->nObjs++ ); + assert( Mig_ObjIsNone(pObj) ); + Mig_ObjSetId( pObj, p->nObjs-1 ); + return pObj; +} +static inline int Mig_ManAppendCi( Mig_Man_t * p ) +{ + Mig_Obj_t * pObj = Mig_ManAppendObj( p ); + Mig_ObjSetCioId( pObj, Vec_IntSize(&p->vCis) ); + Vec_IntPush( &p->vCis, Mig_ObjId(pObj) ); + return Mig_ObjId(pObj) << 1; +} +static inline int Mig_ManAppendCo( Mig_Man_t * p, int iLit0 ) +{ + Mig_Obj_t * pObj; + assert( !Mig_ObjIsCo(Mig_ManObj(p, Abc_Lit2Var(iLit0))) ); + pObj = Mig_ManAppendObj( p ); + Mig_ObjSetFaninLit( pObj, 0, iLit0 ); + Mig_ObjSetCioId( pObj, Vec_IntSize(&p->vCos) ); + Vec_IntPush( &p->vCos, Mig_ObjId(pObj) ); + return Mig_ObjId( pObj ) << 1; +} +static inline int Mig_ManAppendBuf( Mig_Man_t * p, int iLit0 ) +{ + Mig_Obj_t * pObj; + pObj = Mig_ManAppendObj( p ); + Mig_ObjSetFaninLit( pObj, 0, iLit0 ); + return Mig_ObjId( pObj ) << 1; +} +static inline int Mig_ManAppendAnd( Mig_Man_t * p, int iLit0, int iLit1 ) +{ + Mig_Obj_t * pObj = Mig_ManAppendObj( p ); + assert( iLit0 != iLit1 ); + Mig_ObjSetFaninLit( pObj, 0, iLit0 < iLit1 ? iLit0 : iLit1 ); + Mig_ObjSetFaninLit( pObj, 1, iLit0 < iLit1 ? iLit1 : iLit0 ); + return Mig_ObjId( pObj ) << 1; +} +static inline int Mig_ManAppendXor( Mig_Man_t * p, int iLit0, int iLit1 ) +{ + Mig_Obj_t * pObj = Mig_ManAppendObj( p ); + assert( iLit0 != iLit1 ); + assert( !Abc_LitIsCompl(iLit0) && !Abc_LitIsCompl(iLit1) ); + Mig_ObjSetFaninLit( pObj, 0, iLit0 < iLit1 ? iLit1 : iLit0 ); + Mig_ObjSetFaninLit( pObj, 1, iLit0 < iLit1 ? iLit0 : iLit1 ); + return Mig_ObjId( pObj ) << 1; +} +static inline int Mig_ManAppendMux( Mig_Man_t * p, int iLit0, int iLit1, int iCtrl ) +{ + Mig_Obj_t * pObj = Mig_ManAppendObj( p ); + assert( iLit0 != iLit1 && iLit0 != iCtrl && iLit1 != iCtrl ); + assert( !Abc_LitIsCompl(iLit0) || !Abc_LitIsCompl(iLit1) ); + Mig_ObjSetFaninLit( pObj, 0, iLit0 < iLit1 ? iLit0 : iLit1 ); + Mig_ObjSetFaninLit( pObj, 1, iLit0 < iLit1 ? iLit1 : iLit0 ); + Mig_ObjSetFaninLit( pObj, 2, iLit0 < iLit1 ? iCtrl : Abc_LitNot(iCtrl) ); + return Mig_ObjId( pObj ) << 1; +} +static inline int Mig_ManAppendMaj( Mig_Man_t * p, int iLit0, int iLit1, int iLit2 ) +{ + Mig_Obj_t * pObj = Mig_ManAppendObj( p ); + assert( iLit0 != iLit1 && iLit0 != iLit2 && iLit1 != iLit2 ); + Mig_ObjSetFaninLit( pObj, 0, iLit0 < iLit1 ? iLit1 : iLit0 ); + Mig_ObjSetFaninLit( pObj, 1, iLit0 < iLit1 ? iLit0 : iLit1 ); + Mig_ObjSetFaninLit( pObj, 2, iLit2 ); + return Mig_ObjId( pObj ) << 1; +} + +//////////////////////////////////////////////////////////////////////// +/// MACRO DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + +// iterators over objects +#define Mig_ManForEachObj( p, pObj ) \ + for ( p->iPage = 0; p->iPage < Vec_PtrSize(&p->vPages) && \ + ((p->pPage) = (Mig_Obj_t *)Vec_PtrEntry(&p->vPages, p->iPage)); p->iPage++ ) \ + for ( pObj = p->pPage; !Mig_ObjIsNone(pObj); pObj++ ) +#define Mig_ManForEachObj1( p, pObj ) \ + for ( p->iPage = 0; p->iPage < Vec_PtrSize(&p->vPages) && \ + ((p->pPage) = (Mig_Obj_t *)Vec_PtrEntry(&p->vPages, p->iPage)); p->iPage++ ) \ + for ( pObj = p->pPage + (p->iPage == 0); !Mig_ObjIsNone(pObj); pObj++ ) +#define Mig_ManForEachObjReverse( p, pObj ) \ + for ( p->iPage = Vec_PtrSize(&p->vPages) - 1; p->iPage >= 0 && \ + ((p->pPage) = (Mig_Obj_t *)Vec_PtrEntry(&p->vPages, p->iPage)); p->iPage-- ) \ + for ( pObj = (p->iPage == Vec_PtrSize(&p->vPages) - 1) ? \ + Mig_ManObj(p, Mig_ManObjNum(p)-1) : p->pPage + MIG_MASK; \ + pObj - p->pPage >= 0; pObj-- ) + +#define Mig_ManForEachObjVec( vVec, p, pObj, i ) \ + for ( i = 0; (i < Vec_IntSize(vVec)) && ((pObj) = Mig_ManObj(p, Vec_IntEntry(vVec,i))); i++ ) + +#define Mig_ManForEachNode( p, pObj ) \ + Mig_ManForEachObj( p, pObj ) if ( !Mig_ObjIsNode(pObj) ) {} else +#define Mig_ManForEachCand( p, pObj ) \ + Mig_ManForEachObj( p, pObj ) if ( !Mig_ObjIsCand(pObj) ) {} else + +#define Mig_ManForEachCi( p, pObj, i ) \ + for ( i = 0; (i < Vec_IntSize(&p->vCis)) && ((pObj) = Mig_ManCi(p, i)); i++ ) +#define Mig_ManForEachCo( p, pObj, i ) \ + for ( i = 0; (i < Vec_IntSize(&p->vCos)) && ((pObj) = Mig_ManCo(p, i)); i++ ) + +// iterators over fanins +#define Mig_ObjForEachFaninId( p, iFanin, i ) \ + for ( i = 0; Mig_ObjHasFanin(p, i) && ((iFanin) = Mig_ObjFaninId(p, i)); i++ ) +#define Mig_ObjForEachFanin( p, pFanin, i ) \ + for ( i = 0; Mig_ObjHasFanin(p, i) && ((pFanin) = Mig_ObjFanin(p, i)); i++ ) + + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + +/*=== mpmMig.c ===========================================================*/ +extern Mig_Man_t * Mig_ManStart(); +extern void Mig_ManStop( Mig_Man_t * p ); +extern void Mig_ManSetRefs( Mig_Man_t * p, int fSkipCos ); + + +ABC_NAMESPACE_HEADER_END + +#endif + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + diff --git a/src/map/mpm/mpmPre.c b/src/map/mpm/mpmPre.c new file mode 100644 index 00000000..e070c71a --- /dev/null +++ b/src/map/mpm/mpmPre.c @@ -0,0 +1,885 @@ +/**CFile**************************************************************** + + FileName [mpmPre.c] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [Configurable technology mapper.] + + Synopsis [DSD-related precomputations.] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 1, 2013.] + + Revision [$Id: mpmPre.c,v 1.00 2013/06/01 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#include <stdio.h> +#include <stdlib.h> +#include <string.h> +#include <assert.h> + +#include "misc/vec/vec.h" +#include "misc/vec/vecHsh.h" +#include "misc/extra/extra.h" + +ABC_NAMESPACE_IMPL_START + + +//////////////////////////////////////////////////////////////////////// +/// DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + +typedef struct Ifd_Obj_t_ Ifd_Obj_t; +struct Ifd_Obj_t_ +{ + unsigned nFreq : 24; // frequency + unsigned nSupp : 5; // support size + unsigned Type : 2; // type + unsigned fWay : 1; // transparent edge + unsigned pFans[3]; // fanins +}; + +typedef struct Ifd_Man_t_ Ifd_Man_t; +struct Ifd_Man_t_ +{ + Ifd_Obj_t * pObjs; + int nObjs; + int nObjsAlloc; + // hashing operations + Vec_Int_t * vArgs; // iDsd1 op iDsdC + Vec_Int_t * vRes; // result of operation + Vec_Int_t * vOffs; // offsets in the array of permutations + Vec_Str_t * vPerms; // storage for permutations + Hsh_IntMan_t * vHash; // hash table + Vec_Int_t * vMarks; // marks where given N begins + Vec_Wrd_t * vTruths; // truth tables + // other data + Vec_Int_t * vSuper; + +}; + +static inline int Ifd_ObjIsVar( Ifd_Obj_t * p ) { return p->Type == 0; } +static inline int Ifd_ObjIsAnd( Ifd_Obj_t * p ) { return p->Type == 1; } +static inline int Ifd_ObjIsXor( Ifd_Obj_t * p ) { return p->Type == 2; } +static inline int Ifd_ObjIsMux( Ifd_Obj_t * p ) { return p->Type == 3; } + +static inline Ifd_Obj_t * Ifd_ManObj( Ifd_Man_t * p, int i ) { assert( i >= 0 && i < p->nObjs ); return p->pObjs + i; } +static inline Ifd_Obj_t * Ifd_ManObjFromLit( Ifd_Man_t * p, int iLit ) { return Ifd_ManObj( p, Abc_Lit2Var(iLit) ); } +static inline int Ifd_ObjId( Ifd_Man_t * p, Ifd_Obj_t * pObj ) { assert( pObj - p->pObjs >= 0 && pObj - p->pObjs < p->nObjs ); return pObj - p->pObjs; } +static inline int Ifd_LitSuppSize( Ifd_Man_t * p, int iLit ) { return iLit > 0 ? Ifd_ManObjFromLit(p, iLit)->nSupp : 0; } + +#define Ifd_ManForEachNodeWithSupp( p, nVars, pLeaf, i ) \ + for ( i = Vec_IntEntry(p->vMarks, nVars); (i < Vec_IntEntry(p->vMarks, nVars+1)) && (pLeaf = Ifd_ManObj(p, i)); i++ ) + + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Ifd_Man_t * Ifd_ManStart() +{ + Ifd_Man_t * p; + p = ABC_CALLOC( Ifd_Man_t, 1 ); + p->nObjsAlloc = Abc_PrimeCudd( 50000000 ); + p->nObjs = 2; + p->pObjs = ABC_CALLOC( Ifd_Obj_t, p->nObjsAlloc ); + memset( p->pObjs, 0xFF, sizeof(Ifd_Obj_t) ); // const node + (p->pObjs + 1)->nSupp = 1; // variable + (p->pObjs + 1)->fWay = 1; // variable + // hashing operations + p->vArgs = Vec_IntAlloc( 4000 ); + p->vRes = Vec_IntAlloc( 1000 ); +// p->vOffs = Vec_IntAlloc( 1000 ); +// p->vPerms = Vec_StrAlloc( 1000 ); + p->vHash = Hsh_IntManStart( p->vArgs, 4, 1000 ); + p->vMarks = Vec_IntAlloc( 100 ); + Vec_IntPush( p->vMarks, 0 ); + Vec_IntPush( p->vMarks, 1 ); + Vec_IntPush( p->vMarks, p->nObjs ); + // other data + p->vSuper = Vec_IntAlloc( 1000 ); + p->vTruths = Vec_WrdAlloc( 1000 ); + return p; +} +void Ifd_ManStop( Ifd_Man_t * p ) +{ + int i, This, Prev = 0; + Vec_IntForEachEntryStart( p->vMarks, This, i, 1 ) + { + printf( "%d(%d:%d) ", i-1, This, This - Prev ); + Prev = This; + } + printf( "\n" ); + + Vec_IntFreeP( &p->vArgs ); + Vec_IntFreeP( &p->vRes ); +// Vec_IntFree( p->vOffs ); +// Vec_StrFree( p->vPerms ); + Vec_WrdFreeP( &p->vTruths ); + Vec_IntFreeP( &p->vMarks ); + Hsh_IntManStop( p->vHash ); + Vec_IntFreeP( &p->vSuper ); + ABC_FREE( p->pObjs ); + ABC_FREE( p ); +} + +/**Function************************************************************* + + Synopsis [Printing structures.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Ifd_ObjPrint_rec( Ifd_Man_t * p, int iLit, int * pCounter, int DiffType ) +{ + char Symb[2][4] = { {'?','(','[','<'}, {'?',')',']','>'} }; + Ifd_Obj_t * pDsd; + if ( Abc_LitIsCompl(iLit) ) + printf( "!" ), iLit = Abc_LitNot(iLit); + if ( iLit == 2 ) + { printf( "%c", 'a' + (*pCounter)++ ); return; } + pDsd = Ifd_ManObjFromLit( p, iLit ); + if ( DiffType ) + printf( "%c", Symb[0][pDsd->Type] ); + Ifd_ObjPrint_rec( p, pDsd->pFans[0], pCounter, pDsd->Type == 3 || Abc_LitIsCompl(pDsd->pFans[0]) || pDsd->Type != Ifd_ManObjFromLit(p, pDsd->pFans[0])->Type ); + Ifd_ObjPrint_rec( p, pDsd->pFans[1], pCounter, pDsd->Type == 3 || Abc_LitIsCompl(pDsd->pFans[1]) || pDsd->Type != Ifd_ManObjFromLit(p, pDsd->pFans[1])->Type ); + if ( pDsd->pFans[2] != -1 ) + Ifd_ObjPrint_rec( p, pDsd->pFans[2], pCounter, pDsd->Type == 3 || Abc_LitIsCompl(pDsd->pFans[2]) || pDsd->Type != Ifd_ManObjFromLit(p, pDsd->pFans[2])->Type ); + if ( DiffType ) + printf( "%c", Symb[1][pDsd->Type] ); +} +void Ifd_ObjPrint( Ifd_Man_t * p, int iLit ) +{ + int Counter = 0; + if ( iLit == 0 ) + { printf( "0\n" ); return; } + if ( iLit == 1 ) + { printf( "1\n" ); return; } + Ifd_ObjPrint_rec( p, iLit, &Counter, 1 ); + printf( "\n" ); +} +void Ifd_ManPrint( Ifd_Man_t * p ) +{ + int i; + for ( i = 0; i < p->nObjs; i++ ) + { + printf( "%4d : ", i ); + Ifd_ObjPrint( p, Abc_Var2Lit( i, 0 ) ); + } +} + + +/**Function************************************************************* + + Synopsis [Computing truth tables.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +word Ifd_ObjTruth_rec( Ifd_Man_t * p, int iLit, int * pCounter ) +{ + static word s_Truths6[6] = { + ABC_CONST(0xAAAAAAAAAAAAAAAA), + ABC_CONST(0xCCCCCCCCCCCCCCCC), + ABC_CONST(0xF0F0F0F0F0F0F0F0), + ABC_CONST(0xFF00FF00FF00FF00), + ABC_CONST(0xFFFF0000FFFF0000), + ABC_CONST(0xFFFFFFFF00000000) + }; + Ifd_Obj_t * pDsd; + word Fun0, Fun1, Fun2; + assert( !Abc_LitIsCompl(iLit) ); + if ( iLit == 2 ) + return s_Truths6[(*pCounter)++]; + pDsd = Ifd_ManObjFromLit( p, iLit ); + + Fun0 = Ifd_ObjTruth_rec( p, Abc_LitRegular(pDsd->pFans[0]), pCounter ); + Fun1 = Ifd_ObjTruth_rec( p, Abc_LitRegular(pDsd->pFans[1]), pCounter ); + if ( pDsd->pFans[2] != -1 ) + Fun2 = Ifd_ObjTruth_rec( p, Abc_LitRegular(pDsd->pFans[2]), pCounter ); + + Fun0 = Abc_LitIsCompl(pDsd->pFans[0]) ? ~Fun0 : Fun0; + Fun1 = Abc_LitIsCompl(pDsd->pFans[1]) ? ~Fun1 : Fun1; + if ( pDsd->pFans[2] != -1 ) + Fun2 = Abc_LitIsCompl(pDsd->pFans[2]) ? ~Fun2 : Fun2; + + if ( pDsd->Type == 1 ) + return Fun0 & Fun1; + if ( pDsd->Type == 2 ) + return Fun0 ^ Fun1; + if ( pDsd->Type == 3 ) + return (Fun2 & Fun1) | (~Fun2 & Fun0); + assert( 0 ); + return -1; +} +word Ifd_ObjTruth( Ifd_Man_t * p, int iLit ) +{ + word Fun; + int Counter = 0; + if ( iLit == 0 ) + return 0; + if ( iLit == 1 ) + return ~(word)0; + Fun = Ifd_ObjTruth_rec( p, Abc_LitRegular(iLit), &Counter ); + return Abc_LitIsCompl(iLit) ? ~Fun : Fun; +} +void Ifd_ManTruthAll( Ifd_Man_t * p ) +{ + word Fun; + int i; + assert( Vec_WrdSize(p->vTruths) == 0 ); + for ( i = 0; i < p->nObjs; i++ ) + { + Fun = Ifd_ObjTruth( p, Abc_Var2Lit( i, 0 ) ); + Vec_WrdPush( p->vTruths, Fun ); +// Extra_PrintHex( stdout, (unsigned *)&Fun, 6 ); printf( " " ); +// Kit_DsdPrintFromTruth( (unsigned *)&Fun, 6 ); printf( "\n" ); + } +} + +/**Function************************************************************* + + Synopsis [Canonicizing DSD structures.] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Ifd_ManHashLookup( Ifd_Man_t * p, int iDsd0, int iDsd1, int iDsdC, int Type ) +{ + int pData[4]; + assert( iDsdC != -1 || iDsd0 >= iDsd1 ); + assert( iDsdC == -1 || !Abc_LitIsCompl(iDsd1) ); + pData[0] = iDsd0; + pData[1] = iDsd1; + pData[2] = iDsdC; + pData[3] = Type; + return *Hsh_IntManLookup( p->vHash, pData ); +} +void Ifd_ManHashInsert( Ifd_Man_t * p, int iDsd0, int iDsd1, int iDsdC, int Type, int Res ) +{ + int iObj; + assert( iDsdC != -1 || iDsd0 >= iDsd1 ); + assert( iDsdC == -1 || !Abc_LitIsCompl(iDsd1) ); + Vec_IntPush( p->vArgs, iDsd0 ); + Vec_IntPush( p->vArgs, iDsd1 ); + Vec_IntPush( p->vArgs, iDsdC ); + Vec_IntPush( p->vArgs, Type ); + iObj = Hsh_IntManAdd( p->vHash, Vec_IntSize(p->vRes) ); + assert( iObj == Vec_IntSize(p->vRes) ); + Vec_IntPush( p->vRes, Res ); + assert( 4 * Vec_IntSize(p->vRes) == Vec_IntSize(p->vArgs) ); +} +int Ifd_ManHashFindOrAdd( Ifd_Man_t * p, int iDsd0, int iDsd1, int iDsdC, int Type ) +{ + Ifd_Obj_t * pObj; + int iObj, Value; + assert( iDsdC != -1 || iDsd0 >= iDsd1 ); + assert( iDsdC == -1 || !Abc_LitIsCompl(iDsd1) ); + Vec_IntPush( p->vArgs, iDsd0 ); + Vec_IntPush( p->vArgs, iDsd1 ); + Vec_IntPush( p->vArgs, iDsdC ); + Vec_IntPush( p->vArgs, Type ); + Value = Hsh_IntManAdd( p->vHash, Vec_IntSize(p->vRes) ); + if ( Value < Vec_IntSize(p->vRes) ) + { + iObj = Vec_IntEntry(p->vRes, Value); + Vec_IntShrink( p->vArgs, Vec_IntSize(p->vArgs) - 4 ); + pObj = Ifd_ManObj( p, iObj ); + pObj->nFreq++; + assert( (int)pObj->Type == Type ); + assert( (int)pObj->nSupp == Ifd_LitSuppSize(p, iDsd0) + Ifd_LitSuppSize(p, iDsd1) + Ifd_LitSuppSize(p, iDsdC) ); + } + else + { + if ( p->nObjs == p->nObjsAlloc ) + printf( "The number of nodes is more than %d\n", p->nObjs ); + assert( p->nObjs < p->nObjsAlloc ); + iObj = p->nObjs; + pObj = Ifd_ManObj( p, p->nObjs++ ); + pObj->nFreq = 1; + pObj->nSupp = Ifd_LitSuppSize(p, iDsd0) + Ifd_LitSuppSize(p, iDsd1) + Ifd_LitSuppSize(p, iDsdC); + pObj->Type = Type; + if ( Type == 1 ) + pObj->fWay = 0; + else if ( Type == 2 ) + pObj->fWay = Ifd_ManObjFromLit(p, iDsd0)->fWay || Ifd_ManObjFromLit(p, iDsd1)->fWay; + else if ( Type == 3 ) +// pObj->fWay = (Ifd_ManObjFromLit(p, iDsd0)->fWay && Ifd_ManObjFromLit(p, iDsd1)->fWay) || (Abc_Lit2Var(iDsd0) == Abc_Lit2Var(iDsd1) && Ifd_ManObjFromLit(p, iDsdC)->fWay); + pObj->fWay = (Ifd_ManObjFromLit(p, iDsd0)->fWay && Ifd_ManObjFromLit(p, iDsd1)->fWay) || (iDsd0 == Abc_LitNot(iDsd1) && Ifd_ManObjFromLit(p, iDsdC)->fWay); + else assert( 0 ); + pObj->pFans[0] = iDsd0; + pObj->pFans[1] = iDsd1; + pObj->pFans[2] = iDsdC; + Vec_IntPush( p->vRes, iObj ); + } + assert( 4 * Vec_IntSize(p->vRes) == Vec_IntSize(p->vArgs) ); + return iObj; +} +void Ifd_ManOperSuper_rec( Ifd_Man_t * p, int iLit, int Type, Vec_Int_t * vObjs ) +{ + Ifd_Obj_t * pDsd = Ifd_ManObjFromLit( p, iLit ); + if ( Abc_LitIsCompl(iLit) || (int)pDsd->Type != Type ) + Vec_IntPush( vObjs, iLit ); + else + { + Ifd_ManOperSuper_rec( p, pDsd->pFans[0], Type, vObjs ); + Ifd_ManOperSuper_rec( p, pDsd->pFans[1], Type, vObjs ); + } +} +int Ifd_ManOper( Ifd_Man_t * p, int iDsd0, int iDsd1, int iDsdC, int Type ) +{ + int i, iLit0, iLit1, iThis, fCompl = 0; + if ( Type == 1 ) // AND + { + if ( iDsd0 == 0 || iDsd1 == 0 ) + return 0; + if ( iDsd0 == 1 || iDsd1 == 1 ) + return (iDsd0 == 1) ? iDsd1 : iDsd0; + } + else if ( Type == 2 ) // XOR + { + if ( iDsd0 < 2 ) + return Abc_LitNotCond( iDsd1, iDsd0 ); + if ( iDsd1 < 2 ) + return Abc_LitNotCond( iDsd0, iDsd1 ); + if ( Abc_LitIsCompl(iDsd0) ) + fCompl ^= 1, iDsd0 = Abc_LitNot(iDsd0); + if ( Abc_LitIsCompl(iDsd1) ) + fCompl ^= 1, iDsd1 = Abc_LitNot(iDsd1); + } + else if ( Type == 3 ) + { + if ( Abc_LitIsCompl(iDsdC) ) + { + ABC_SWAP( int, iDsd0, iDsd1 ); + iDsdC = Abc_LitNot(iDsdC); + } + if ( Abc_LitIsCompl(iDsd1) ) + fCompl ^= 1, iDsd0 = Abc_LitNot(iDsd0), iDsd1 = Abc_LitNot(iDsd1); + } + assert( iDsd0 > 1 && iDsd1 > 1 && Type >= 1 && Type <= 3 ); +/* + // check cache + iThis = Ifd_ManHashLookup( p, iDsd0, iDsd1, iDsdC, Type ); + if ( iThis != -1 ) + return Abc_Var2Lit( iThis, fCompl ); +*/ + // create new entry + if ( Type == 3 ) + { + iThis = Ifd_ManHashFindOrAdd( p, iDsd0, iDsd1, iDsdC, Type ); + return Abc_Var2Lit( iThis, fCompl ); + } + assert( iDsdC == -1 ); + Vec_IntClear( p->vSuper ); + Ifd_ManOperSuper_rec( p, iDsd0, Type, p->vSuper ); + Ifd_ManOperSuper_rec( p, iDsd1, Type, p->vSuper ); + Vec_IntSort( p->vSuper, 1 ); + iLit0 = Vec_IntEntry( p->vSuper, 0 ); + Vec_IntForEachEntryStart( p->vSuper, iLit1, i, 1 ) + iLit0 = Abc_Var2Lit( Ifd_ManHashFindOrAdd(p, iLit0, iLit1, -1, Type), 0 ); + assert( !Abc_LitIsCompl(iLit0) ); + // insert into cache +// if ( Vec_IntSize(p->vSuper) > 2 ) +// Ifd_ManHashInsert( p, iDsd0, iDsd1, iDsdC, Type, iLit0 ); + return Abc_LitNotCond( iLit0, fCompl ); +} + + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Ifd_ManFindDsd_rec( Ifd_Man_t * pMan, char * pStr, char ** p, int * pMatches ) +{ + int fCompl = 0; + if ( **p == '!' ) + (*p)++, fCompl = 1; + if ( **p >= 'a' && **p <= 'f' ) // var + { + assert( **p - 'a' >= 0 && **p - 'a' < 6 ); + return Abc_Var2Lit( 1, fCompl ); + } + if ( **p == '(' ) // and/or + { + char * q = pStr + pMatches[ *p - pStr ]; + int Lit, Res = 1; + assert( **p == '(' && *q == ')' ); + for ( (*p)++; *p < q; (*p)++ ) + { + Lit = Ifd_ManFindDsd_rec( pMan, pStr, p, pMatches ); + Res = Ifd_ManOper( pMan, Res, Lit, 0, 1 ); + } + assert( *p == q ); + return Abc_LitNotCond( Res, fCompl ); + } + if ( **p == '[' ) // xor + { + char * q = pStr + pMatches[ *p - pStr ]; + int Lit, Res = 0; + assert( **p == '[' && *q == ']' ); + for ( (*p)++; *p < q; (*p)++ ) + { + Lit = Ifd_ManFindDsd_rec( pMan, pStr, p, pMatches ); + Res = Ifd_ManOper( pMan, Res, Lit, 0, 2 ); + } + assert( *p == q ); + return Abc_LitNotCond( Res, fCompl ); + } + if ( **p == '<' ) // mux + { + int Temp[3], * pTemp = Temp, Res; + char * pOld = *p; + char * q = pStr + pMatches[ *p - pStr ]; + assert( **p == '<' && *q == '>' ); + // derive MAX components + for ( (*p)++; *p < q; (*p)++ ) + *pTemp++ = Ifd_ManFindDsd_rec( pMan, pStr, p, pMatches ); + assert( pTemp == Temp + 3 ); + assert( *p == q ); +// Res = (Temp[0] & Temp[1]) | (~Temp[0] & Temp[2]); + Res = Ifd_ManOper( pMan, Temp[2], Temp[1], Temp[0], 3 ); + return Abc_LitNotCond( Res, fCompl ); + } + assert( 0 ); + return 0; +} +#define IFM_MAX_STR 100 +#define IFM_MAX_VAR 16 +int * Ifd_ManComputeMatches( char * p ) +{ + static int pMatches[IFM_MAX_STR]; + int pNested[IFM_MAX_VAR]; + int v, nNested = 0; + for ( v = 0; p[v]; v++ ) + { + assert( v < IFM_MAX_STR ); + pMatches[v] = 0; + if ( p[v] == '(' || p[v] == '[' || p[v] == '<' || p[v] == '{' ) + pNested[nNested++] = v; + else if ( p[v] == ')' || p[v] == ']' || p[v] == '>' || p[v] == '}' ) + pMatches[pNested[--nNested]] = v; + assert( nNested < IFM_MAX_VAR ); + } + assert( nNested == 0 ); + return pMatches; +} +int Ifd_ManFindDsd( Ifd_Man_t * pMan, char * p ) +{ + int Res; + if ( *p == '0' && *(p+1) == 0 ) + Res = 0; + else if ( *p == '1' && *(p+1) == 0 ) + Res = 1; + else + Res = Ifd_ManFindDsd_rec( pMan, p, &p, Ifd_ManComputeMatches(p) ); + assert( *++p == 0 ); + return Res; +} + + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Ifd_ManDsdTest2() +{ + char * p = "(abc)"; + char * q = "(a[bc])"; + char * r = "[<abc>(def)]"; + Ifd_Man_t * pMan = Ifd_ManStart(); + int iLit = Ifd_ManFindDsd( pMan, p ); + Ifd_ObjPrint( pMan, iLit ); + Ifd_ManStop( pMan ); +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +Vec_Wrd_t * Ifd_ManDsdTruths( int nVars ) +{ + int fUseMux = 1; + Vec_Wrd_t * vTruths; + Ifd_Man_t * pMan = Ifd_ManStart(); + Ifd_Obj_t * pLeaf0, * pLeaf1, * pLeaf2; + int v, i, j, k, c0, c1, c2; + for ( v = 2; v <= nVars; v++ ) + { + // create ANDs/XORs + for ( i = 1; i < v; i++ ) + for ( j = 1; j < v; j++ ) + if ( i + j == v ) + { + Ifd_ManForEachNodeWithSupp( pMan, i, pLeaf0, c0 ) + Ifd_ManForEachNodeWithSupp( pMan, j, pLeaf1, c1 ) + { + assert( (int)pLeaf0->nSupp == i ); + assert( (int)pLeaf1->nSupp == j ); + Ifd_ManOper( pMan, Abc_Var2Lit(c0, 0), Abc_Var2Lit(c1, 0), -1, 1 ); + if ( !pLeaf1->fWay ) + Ifd_ManOper( pMan, Abc_Var2Lit(c0, 0), Abc_Var2Lit(c1, 1), -1, 1 ); + if ( !pLeaf0->fWay ) + Ifd_ManOper( pMan, Abc_Var2Lit(c0, 1), Abc_Var2Lit(c1, 0), -1, 1 ); + if ( !pLeaf0->fWay && !pLeaf1->fWay ) + Ifd_ManOper( pMan, Abc_Var2Lit(c0, 1), Abc_Var2Lit(c1, 1), -1, 1 ); + Ifd_ManOper( pMan, Abc_Var2Lit(c0, 0), Abc_Var2Lit(c1, 0), -1, 2 ); + } + } + // create MUX + if ( fUseMux ) + for ( i = 1; i < v-1; i++ ) + for ( j = 1; j < v-1; j++ ) + for ( k = 1; k < v-1; k++ ) + if ( i + j + k == v ) + { + Ifd_ManForEachNodeWithSupp( pMan, i, pLeaf0, c0 ) + Ifd_ManForEachNodeWithSupp( pMan, j, pLeaf1, c1 ) + Ifd_ManForEachNodeWithSupp( pMan, k, pLeaf2, c2 ) + { + assert( (int)pLeaf0->nSupp == i ); + assert( (int)pLeaf1->nSupp == j ); + assert( (int)pLeaf2->nSupp == k ); +//printf( "%d %d %d ", i, j, k ); +//printf( "%d %d %d\n", Ifd_ObjId(pMan, pLeaf0), Ifd_ObjId(pMan, pLeaf1), Ifd_ObjId(pMan, pLeaf2) ); + if ( pLeaf2->fWay && c0 < c1 ) + continue; + Ifd_ManOper( pMan, Abc_Var2Lit(c0, 0), Abc_Var2Lit(c1, 0), Abc_Var2Lit(c2, 0), 3 ); + if ( !pLeaf0->fWay && !pLeaf1->fWay ) + Ifd_ManOper( pMan, Abc_Var2Lit(c0, 1), Abc_Var2Lit(c1, 0), Abc_Var2Lit(c2, 0), 3 ); + } + } + // bookmark + Vec_IntPush( pMan->vMarks, pMan->nObjs ); + } +// Ifd_ManPrint( pMan ); + Ifd_ManTruthAll( pMan ); + vTruths = pMan->vTruths; pMan->vTruths = NULL; + Ifd_ManStop( pMan ); + return vTruths; +} + + +/**Function************************************************************* + + Synopsis [Generating the guided array for minimal permutations.] + + Description [http://icodesnip.com/search/johnson%20trotter/] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +void Ifd_ManDsdPermPrint( int * perm, int size ) +{ + int i; + for ( i = 0; i < size; i++ ) + printf( "%d", perm[i] ); + printf( "\n" ); +} +Vec_Int_t * Ifd_ManDsdPermJT( int n ) +{ + Vec_Int_t * vGuide = Vec_IntAlloc( 100 ); + int *array, *dir, tmp, tmp2, i, max; + array = (int*)malloc(sizeof(int) * n); + dir = (int*)calloc(n, sizeof(int)); + for (i = 0; i < n; i++) + array[i] = i; + max = n - 1; + if (n != 1) + do + { +// Ifd_ManDsdPermPrint(array, n); + tmp = array[max]; + tmp2 = dir[max]; + i = !dir[max] ? max - 1 : max + 1; + array[max] = array[i]; + array[i] = tmp; + Vec_IntPush( vGuide, Abc_MinInt(max, i) ); + dir[max] = dir[i]; + dir[i] = tmp2; + for (i = 0; i < n; i++) + if (array[i] > tmp) + dir[i] = !dir[i]; + max = n; + for (i = 0; i < n; i++) + if (((!dir[i] && i != 0 && array[i] > array[i-1]) || (dir[i] && i != n-1 && array[i] > array[i+1])) && (array[i] > array[max] || max == n)) + max = i; + } + while (max < n); +// Ifd_ManDsdPermPrint(array,n); + Vec_IntPush( vGuide, 0 ); + free(dir); + free(array); + return vGuide; +} +int Ifd_ManDsdTest4() +{ + int pPerm[6] = { 0, 1, 2, 3, 4, 5 }; + Vec_Int_t * vGuide = Ifd_ManDsdPermJT( 6 ); + int i, Entry; + Vec_IntForEachEntry( vGuide, Entry, i ) + { + ABC_SWAP( int, pPerm[Entry], pPerm[Entry+1] ); + Ifd_ManDsdPermPrint( pPerm, 6 ); + } + Vec_IntFree( vGuide ); + return 1; +} + + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +static inline word Extra_Truth6SwapAdjacent( word t, int iVar ) +{ + // variable swapping code + static word PMasks[5][3] = { + { ABC_CONST(0x9999999999999999), ABC_CONST(0x2222222222222222), ABC_CONST(0x4444444444444444) }, + { ABC_CONST(0xC3C3C3C3C3C3C3C3), ABC_CONST(0x0C0C0C0C0C0C0C0C), ABC_CONST(0x3030303030303030) }, + { ABC_CONST(0xF00FF00FF00FF00F), ABC_CONST(0x00F000F000F000F0), ABC_CONST(0x0F000F000F000F00) }, + { ABC_CONST(0xFF0000FFFF0000FF), ABC_CONST(0x0000FF000000FF00), ABC_CONST(0x00FF000000FF0000) }, + { ABC_CONST(0xFFFF00000000FFFF), ABC_CONST(0x00000000FFFF0000), ABC_CONST(0x0000FFFF00000000) } + }; + assert( iVar < 5 ); + return (t & PMasks[iVar][0]) | ((t & PMasks[iVar][1]) << (1 << iVar)) | ((t & PMasks[iVar][2]) >> (1 << iVar)); +} +static inline word Extra_Truth6ChangePhase( word t, int iVar) +{ + // elementary truth tables + static word Truth6[6] = { + ABC_CONST(0xAAAAAAAAAAAAAAAA), + ABC_CONST(0xCCCCCCCCCCCCCCCC), + ABC_CONST(0xF0F0F0F0F0F0F0F0), + ABC_CONST(0xFF00FF00FF00FF00), + ABC_CONST(0xFFFF0000FFFF0000), + ABC_CONST(0xFFFFFFFF00000000) + }; + assert( iVar < 6 ); + return ((t & ~Truth6[iVar]) << (1 << iVar)) | ((t & Truth6[iVar]) >> (1 << iVar)); +} +Vec_Wrd_t * Extra_Truth6AllConfigs2( word t, int * pComp, int * pPerm, int nVars ) +{ + int nPerms = Extra_Factorial( nVars ); + int nSwaps = (1 << nVars); + Vec_Wrd_t * vTruths = Vec_WrdStart( nPerms * (1 << (nVars+1)) ); + word tCur, tTemp1, tTemp2; + int i, p, c; + for ( i = 0; i < 2; i++ ) + { + tCur = i ? t : ~t; + tTemp1 = tCur; + for ( p = 0; p < nPerms; p++ ) + { + tTemp2 = tCur; + for ( c = 0; c < nSwaps; c++ ) + { + Vec_WrdWriteEntry( vTruths, (p << (nVars+1))|(i << nVars)|c, tCur ); + tCur = Extra_Truth6ChangePhase( tCur, pComp[c] ); + } + assert( tTemp2 == tCur ); + tCur = Extra_Truth6SwapAdjacent( tCur, pPerm[p] ); + } + assert( tTemp1 == tCur ); + } + if ( t ) + { + int i; + word Truth; + Vec_WrdForEachEntry( vTruths, Truth, i ) + assert( Truth ); + } + return vTruths; +} +Vec_Wrd_t * Extra_Truth6AllConfigs( word t, int * pComp, int * pPerm, int nVars ) +{ + int nPerms = Extra_Factorial( nVars ); + int nSwaps = (1 << nVars); + Vec_Wrd_t * vTruths = Vec_WrdStart( nPerms * nSwaps ); + word tCur, tTemp1, tTemp2; + int i, p, c; + for ( i = 1; i < 2; i++ ) + { + tCur = i ? ~t : t; + tTemp1 = tCur; + for ( p = 0; p < nPerms; p++ ) + { + tTemp2 = tCur; + for ( c = 0; c < nSwaps; c++ ) + { + Vec_WrdWriteEntry( vTruths, (p << (nVars))|c, tCur ); + tCur = Extra_Truth6ChangePhase( tCur, pComp[c] ); + } + assert( tTemp2 == tCur ); + tCur = Extra_Truth6SwapAdjacent( tCur, pPerm[p] ); + } + assert( tTemp1 == tCur ); + } + if ( t ) + { + int i; + word Truth; + Vec_WrdForEachEntry( vTruths, Truth, i ) + assert( Truth ); + } + return vTruths; +} + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ +int Ifd_ManDsdTest33() +{ + int nVars = 6; + FILE * pFile; + char pFileName[32]; + Vec_Wrd_t * vTruths = Ifd_ManDsdTruths( nVars ); + Vec_Wrd_t * vVariants; + Vec_Int_t * vUniques; + Vec_Wrd_t * vTruthRes = Vec_WrdAlloc( 4000000 ); + Vec_Int_t * vConfgRes = Vec_IntAlloc( 4000000 ); + int * pComp, * pPerm; + word Truth, Variant; + int i, k, Uniq, Runner, Counter = 0; + assert( nVars >= 3 && nVars <= 6 ); + assert( Vec_WrdSize(vTruths) < (1<<10) ); + pComp = Extra_GreyCodeSchedule( nVars ); + pPerm = Extra_PermSchedule( nVars ); + Vec_WrdForEachEntry( vTruths, Truth, i ) + { + vVariants = Extra_Truth6AllConfigs( Truth, pComp, pPerm, nVars ); + vUniques = Hsh_WrdManHashArray( vVariants, 1 ); + Runner = 0; + Vec_IntForEachEntry( vUniques, Uniq, k ) + if ( Runner == Uniq ) + { + Variant = Vec_WrdEntry(vVariants, k); + Vec_WrdPush( vTruthRes, Variant ); + Vec_IntPush( vConfgRes, (Extra_TruthSupportSize((unsigned *)&Variant, 6)<<26)|(i << 16)|k ); + Runner++; + } + Vec_IntUniqify( vUniques ); + assert( Runner == Vec_IntSize(vUniques) ); + Counter += Vec_IntSize(vUniques); +//printf( "%5d : ", i ); Kit_DsdPrintFromTruth( &Truth, nVars ), printf( " " ), Vec_IntPrint( vUniques ), printf( "\n" ); + Vec_IntFree( vUniques ); + Vec_WrdFree( vVariants ); + } + Vec_WrdFree( vTruths ); + ABC_FREE( pPerm ); + ABC_FREE( pComp ); + printf( "Total = %d.\n", Counter ); + assert( Vec_WrdSize(vTruthRes) == Counter ); + // write the data into a file + sprintf( pFileName, "dsdfuncs%d.dat", nVars ); + pFile = fopen( pFileName, "wb" ); + fwrite( Vec_WrdArray(vTruthRes), sizeof(word), Vec_WrdSize(vTruthRes), pFile ); + fwrite( Vec_IntArray(vConfgRes), sizeof(int), Vec_IntSize(vConfgRes), pFile ); + fclose( pFile ); + printf( "File \"%s\" with %d 6-input functions has been written out.\n", pFileName, Vec_IntSize(vConfgRes) ); + Vec_WrdFree( vTruthRes ); + Vec_IntFree( vConfgRes ); + return 1; +} + +int Ifd_ManDsdTest() +{ + abctime clk = Abc_Clock(); + FILE * pFile; + char * pFileName = "dsdfuncs6.dat"; + int size = Extra_FileSize( pFileName ) / 12; // 3504275 + Vec_Wrd_t * vTruthRes = Vec_WrdAlloc( size + 1 ); + Vec_Int_t * vConfgRes = Vec_IntAlloc( size ); + Hsh_IntMan_t * pHash; + + pFile = fopen( pFileName, "rb" ); + fread( Vec_WrdArray(vTruthRes), sizeof(word), size, pFile ); + fread( Vec_IntArray(vConfgRes), sizeof(int), size, pFile ); + vTruthRes->nSize = size; + vConfgRes->nSize = size; + // create hash table + pHash = Hsh_WrdManHashArrayStart( vTruthRes, 1 ); + // experiment with functions + + // cleanup + Hsh_IntManStop( pHash ); + Vec_WrdFree( vTruthRes ); + Vec_IntFree( vConfgRes ); + Abc_PrintTime( 1, "Reading file", Abc_Clock() - clk ); + return 1; +} + + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + + +ABC_NAMESPACE_IMPL_END + diff --git a/src/map/mpm/mpmTruth.c b/src/map/mpm/mpmTruth.c new file mode 100644 index 00000000..0f9e877f --- /dev/null +++ b/src/map/mpm/mpmTruth.c @@ -0,0 +1,52 @@ +/**CFile**************************************************************** + + FileName [mpmTruth.c] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [Configurable technology mapper.] + + Synopsis [Truth table manipulation.] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 1, 2013.] + + Revision [$Id: mpmTruth.c,v 1.00 2013/06/01 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#include "mpmInt.h" + +ABC_NAMESPACE_IMPL_START + + +//////////////////////////////////////////////////////////////////////// +/// DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + + +ABC_NAMESPACE_IMPL_END + diff --git a/src/map/mpm/mpmUtil.c b/src/map/mpm/mpmUtil.c new file mode 100644 index 00000000..223d9ec1 --- /dev/null +++ b/src/map/mpm/mpmUtil.c @@ -0,0 +1,52 @@ +/**CFile**************************************************************** + + FileName [mpmUtil.c] + + SystemName [ABC: Logic synthesis and verification system.] + + PackageName [Configurable technology mapper.] + + Synopsis [Various utilities.] + + Author [Alan Mishchenko] + + Affiliation [UC Berkeley] + + Date [Ver. 1.0. Started - June 1, 2013.] + + Revision [$Id: mpmUtil.c,v 1.00 2013/06/01 00:00:00 alanmi Exp $] + +***********************************************************************/ + +#include "mpmInt.h" + +ABC_NAMESPACE_IMPL_START + + +//////////////////////////////////////////////////////////////////////// +/// DECLARATIONS /// +//////////////////////////////////////////////////////////////////////// + +//////////////////////////////////////////////////////////////////////// +/// FUNCTION DEFINITIONS /// +//////////////////////////////////////////////////////////////////////// + +/**Function************************************************************* + + Synopsis [] + + Description [] + + SideEffects [] + + SeeAlso [] + +***********************************************************************/ + +//////////////////////////////////////////////////////////////////////// +/// END OF FILE /// +//////////////////////////////////////////////////////////////////////// + + +ABC_NAMESPACE_IMPL_END + |