summaryrefslogtreecommitdiffstats
path: root/src
diff options
context:
space:
mode:
Diffstat (limited to 'src')
-rw-r--r--src/base/abci/abc.c12
-rw-r--r--src/opt/sfm/module.make1
-rw-r--r--src/opt/sfm/sfmDec.c358
-rw-r--r--src/opt/sfm/sfmLib.c102
4 files changed, 278 insertions, 195 deletions
diff --git a/src/base/abci/abc.c b/src/base/abci/abc.c
index d1c86e62..f2b436f8 100644
--- a/src/base/abci/abc.c
+++ b/src/base/abci/abc.c
@@ -10820,11 +10820,11 @@ int Abc_CommandTestColor( Abc_Frame_t * pAbc, int argc, char ** argv )
***********************************************************************/
int Abc_CommandTest( Abc_Frame_t * pAbc, int argc, char ** argv )
{
-// Abc_Ntk_t * pNtk = Abc_FrameReadNtk(pAbc);
+ Abc_Ntk_t * pNtk = Abc_FrameReadNtk(pAbc);
int nCutMax = 1;
int nLeafMax = 4;
int nDivMax = 2;
- int nDecMax = 20;
+ int nDecMax = 70;
int nNumOnes = 4;
int fNewAlgo = 0;
int fNewOrder = 0;
@@ -10909,13 +10909,13 @@ int Abc_CommandTest( Abc_Frame_t * pAbc, int argc, char ** argv )
goto usage;
}
}
-/*
+
if ( pNtk == NULL )
{
Abc_Print( -1, "Empty network.\n" );
return 1;
}
-
+/*
if ( Abc_NtkIsStrash(pNtk) )
{
Abc_Print( -1, "This command works only for logic networks.\n" );
@@ -11029,9 +11029,11 @@ int Abc_CommandTest( Abc_Frame_t * pAbc, int argc, char ** argv )
}
{
extern void Tab_DecomposeTest();
+ extern void Sfm_DecTestBench( Abc_Ntk_t * pNtk, int iNode );
//Tab_DecomposeTest();
extern void Cnf_AddCardinConstrTest();
- Cnf_AddCardinConstrTest();
+ //Cnf_AddCardinConstrTest();
+ Sfm_DecTestBench( pNtk, nDecMax );
}
return 0;
usage:
diff --git a/src/opt/sfm/module.make b/src/opt/sfm/module.make
index c2401559..d9306418 100644
--- a/src/opt/sfm/module.make
+++ b/src/opt/sfm/module.make
@@ -1,6 +1,7 @@
SRC += src/opt/sfm/sfmCnf.c \
src/opt/sfm/sfmCore.c \
src/opt/sfm/sfmDec.c \
+ src/opt/sfm/sfmLib.c \
src/opt/sfm/sfmNtk.c \
src/opt/sfm/sfmSat.c \
src/opt/sfm/sfmWin.c
diff --git a/src/opt/sfm/sfmDec.c b/src/opt/sfm/sfmDec.c
index c93c2be5..b4376718 100644
--- a/src/opt/sfm/sfmDec.c
+++ b/src/opt/sfm/sfmDec.c
@@ -19,7 +19,8 @@
***********************************************************************/
#include "sfmInt.h"
-#include "bool/kit/kit.h"
+#include "misc/st/st.h"
+#include "map/mio/mio.h"
#include "base/abc/abc.h"
ABC_NAMESPACE_IMPL_START
@@ -40,6 +41,11 @@ struct Sfm_Dec_t_
Vec_Int_t vGateSizes; // fanin counts
Vec_Wrd_t vGateFuncs; // gate truth tables
Vec_Wec_t vGateCnfs; // gate CNFs
+ Vec_Ptr_t vGateHands; // gate handles
+ int GateConst0; // special gates
+ int GateConst1; // special gates
+ int GateBuffer; // special gates
+ int GateInvert; // special gates
// objects
int iTarget; // target node
Vec_Int_t vObjTypes; // PI (1), PO (2)
@@ -49,6 +55,7 @@ struct Sfm_Dec_t_
sat_solver * pSat; // reusable solver
Vec_Wec_t vClauses; // CNF clauses for the node
Vec_Int_t vPols[2]; // onset/offset polarity
+ Vec_Int_t vTaken[2]; // onset/offset implied nodes
Vec_Int_t vImpls[2]; // onset/offset implications
Vec_Wrd_t vSets[2]; // onset/offset patterns
int nPats[3];
@@ -88,6 +95,7 @@ void Sfm_DecStop( Sfm_Dec_t * p )
Vec_IntErase( &p->vGateSizes );
Vec_WrdErase( &p->vGateFuncs );
Vec_WecErase( &p->vGateCnfs );
+ Vec_PtrErase( &p->vGateHands );
// objects
Vec_IntErase( &p->vObjTypes );
Vec_IntErase( &p->vObjGates );
@@ -97,6 +105,8 @@ void Sfm_DecStop( Sfm_Dec_t * p )
Vec_WecErase( &p->vClauses );
Vec_IntErase( &p->vPols[0] );
Vec_IntErase( &p->vPols[1] );
+ Vec_IntErase( &p->vTaken[0] );
+ Vec_IntErase( &p->vTaken[1] );
Vec_IntErase( &p->vImpls[0] );
Vec_IntErase( &p->vImpls[1] );
Vec_WrdErase( &p->vSets[0] );
@@ -118,123 +128,38 @@ void Sfm_DecStop( Sfm_Dec_t * p )
SeeAlso []
***********************************************************************/
-void Sfm_DecCreateCnf( Sfm_Dec_t * p )
-{
- Vec_Str_t * vCnf, * vCnfBase;
- Vec_Int_t * vCover;
- word uTruth;
- int i, nCubes;
- vCnf = Vec_StrAlloc( 100 );
- vCover = Vec_IntAlloc( 100 );
- Vec_WecInit( &p->vGateCnfs, Vec_IntSize(&p->vGateSizes) );
- Vec_WrdForEachEntry( &p->vGateFuncs, uTruth, i )
- {
- nCubes = Sfm_TruthToCnf( uTruth, Vec_IntEntry(&p->vGateSizes, i), vCover, vCnf );
- vCnfBase = (Vec_Str_t *)Vec_WecEntry( &p->vGateCnfs, i );
- Vec_StrGrow( vCnfBase, Vec_StrSize(vCnf) );
- memcpy( Vec_StrArray(vCnfBase), Vec_StrArray(vCnf), Vec_StrSize(vCnf) );
- vCnfBase->nSize = Vec_StrSize(vCnf);
- }
- Vec_IntFree( vCover );
- Vec_StrFree( vCnf );
-}
-
-/**Function*************************************************************
-
- Synopsis []
-
- Description []
-
- SideEffects []
-
- SeeAlso []
-
-***********************************************************************/
-void Sfm_DecCreateAigLibrary( Sfm_Dec_t * p )
-{
- // const0
- Vec_IntPush( &p->vGateSizes, 0 );
- Vec_WrdPush( &p->vGateFuncs, 0 );
- // const1
- Vec_IntPush( &p->vGateSizes, 0 );
- Vec_WrdPush( &p->vGateFuncs, ~(word)0 );
- // buffer
- Vec_IntPush( &p->vGateSizes, 1 );
- Vec_WrdPush( &p->vGateFuncs, ABC_CONST(0xAAAAAAAAAAAAAAAA) );
- // inverter
- Vec_IntPush( &p->vGateSizes, 1 );
- Vec_WrdPush( &p->vGateFuncs, ABC_CONST(0x5555555555555555) );
- // and00
- Vec_IntPush( &p->vGateSizes, 2 );
- Vec_WrdPush( &p->vGateFuncs, ABC_CONST(0xCCCCCCCCCCCCCCCC) & ABC_CONST(0xAAAAAAAAAAAAAAAA) );
- // and01
- Vec_IntPush( &p->vGateSizes, 2 );
- Vec_WrdPush( &p->vGateFuncs, ABC_CONST(0xCCCCCCCCCCCCCCCC) &~ABC_CONST(0xAAAAAAAAAAAAAAAA) );
- // and10
- Vec_IntPush( &p->vGateSizes, 2 );
- Vec_WrdPush( &p->vGateFuncs,~ABC_CONST(0xCCCCCCCCCCCCCCCC) & ABC_CONST(0xAAAAAAAAAAAAAAAA) );
- // and11
- Vec_IntPush( &p->vGateSizes, 2 );
- Vec_WrdPush( &p->vGateFuncs,~ABC_CONST(0xCCCCCCCCCCCCCCCC) &~ABC_CONST(0xAAAAAAAAAAAAAAAA) );
-/*
- // xor
- Vec_IntPush( &p->vGateSizes, 2 );
- Vec_WrdPush( &p->vGateFuncs, ABC_CONST(0xCCCCCCCCCCCCCCCC) ^ ABC_CONST(0xAAAAAAAAAAAAAAAA) );
- // xnor
- Vec_IntPush( &p->vGateSizes, 2 );
- Vec_WrdPush( &p->vGateFuncs, ABC_CONST(0xCCCCCCCCCCCCCCCC) ^~ABC_CONST(0xAAAAAAAAAAAAAAAA) );
- // mux
- Vec_IntPush( &p->vGateSizes, 3 );
- Vec_WrdPush( &p->vGateFuncs, (ABC_CONST(0xF0F0F0F0F0F0F0F0) & ABC_CONST(0xCCCCCCCCCCCCCCCC)) | (ABC_CONST(0x0F0F0F0F0F0F0F0F) & ABC_CONST(0xAAAAAAAAAAAAAAAA)) );
-*/
- // derive CNF for these functions
- Sfm_DecCreateCnf( p );
-}
-
-void Vec_IntLift( Vec_Int_t * p, int Amount )
-{
- int i;
- for ( i = 0; i < p->nSize; i++ )
- p->pArray[i] += Amount;
-}
-
-/**Function*************************************************************
-
- Synopsis []
-
- Description []
-
- SideEffects []
-
- SeeAlso []
-
-***********************************************************************/
int Sfm_DecPrepareSolver( Sfm_Dec_t * p )
{
abctime clk = Abc_Clock();
+ Vec_Int_t * vRoots = &p->vTemp;
+ Vec_Int_t * vFaninVars = &p->vTemp2;
Vec_Int_t * vLevel, * vClause;
int i, k, Type, Gate, iObj, RetValue;
- int nSatVars = 2 * Vec_IntSize(&p->vObjTypes) - p->iTarget - 1;
- assert( Vec_IntSize(&p->vObjTypes) == Vec_IntSize(&p->vObjGates) );
- assert( p->iTarget < Vec_IntSize(&p->vObjTypes) );
+ int nTfiSize = p->iTarget + 1; // including node
+ int nWinSize = Vec_IntSize(&p->vObjTypes);
+ int nSatVars = 2 * nWinSize - nTfiSize;
+ assert( nWinSize == Vec_IntSize(&p->vObjGates) );
+ assert( p->iTarget < nWinSize );
// collect variables of root nodes
- Vec_IntClear( &p->vTemp );
+ Vec_IntClear( vRoots );
Vec_IntForEachEntryStart( &p->vObjTypes, Type, i, p->iTarget )
if ( Type == 2 )
- Vec_IntPush( &p->vTemp, i );
- assert( Vec_IntSize(&p->vTemp) > 0 );
+ Vec_IntPush( vRoots, i );
+ assert( Vec_IntSize(vRoots) > 0 );
// create SAT solver
sat_solver_restart( p->pSat );
- sat_solver_setnvars( p->pSat, nSatVars + Vec_IntSize(&p->vTemp) );
+ sat_solver_setnvars( p->pSat, nSatVars + Vec_IntSize(vRoots) );
// add CNF clauses for the TFI
- Vec_IntForEachEntryStop( &p->vObjTypes, Type, i, p->iTarget + 1 )
+ Vec_IntForEachEntryStop( &p->vObjTypes, Type, i, nTfiSize )
{
if ( Type == 1 )
continue;
+ vLevel = Vec_WecEntry( &p->vObjFanins, i );
// generate CNF
Gate = Vec_IntEntry( &p->vObjGates, i );
- vLevel = Vec_WecEntry( &p->vObjFanins, i );
+ Vec_IntPush( vLevel, i );
Sfm_TranslateCnf( &p->vClauses, (Vec_Str_t *)Vec_WecEntry(&p->vGateCnfs, Gate), vLevel, -1 );
+ Vec_IntPop( vLevel );
// add clauses
Vec_WecForEachLevel( &p->vClauses, vClause, k )
{
@@ -246,15 +171,17 @@ int Sfm_DecPrepareSolver( Sfm_Dec_t * p )
}
}
// add CNF clauses for the TFO
- Vec_IntForEachEntryStart( &p->vObjTypes, Type, i, p->iTarget + 1 )
+ Vec_IntForEachEntryStart( &p->vObjTypes, Type, i, nTfiSize )
{
assert( Type != 1 );
- // generate CNF
- Gate = Vec_IntEntry( &p->vObjGates, i );
vLevel = Vec_WecEntry( &p->vObjFanins, i );
- Vec_IntLift( vLevel, Vec_IntSize(&p->vObjTypes) );
- Sfm_TranslateCnf( &p->vClauses, (Vec_Str_t *)Vec_WecEntry(&p->vGateCnfs, Gate), vLevel, p->iTarget );
- Vec_IntLift( vLevel, Vec_IntSize(&p->vObjTypes) );
+ Vec_IntClear( vFaninVars );
+ Vec_IntForEachEntry( vLevel, iObj, k )
+ Vec_IntPush( vFaninVars, iObj <= p->iTarget ? iObj : iObj + nWinSize - nTfiSize );
+ Vec_IntPush( vFaninVars, i + nWinSize - nTfiSize );
+ // generate CNF
+ Gate = Vec_IntEntry( &p->vObjGates, i );
+ Sfm_TranslateCnf( &p->vClauses, (Vec_Str_t *)Vec_WecEntry(&p->vGateCnfs, Gate), vFaninVars, p->iTarget );
// add clauses
Vec_WecForEachLevel( &p->vClauses, vClause, k )
{
@@ -265,21 +192,21 @@ int Sfm_DecPrepareSolver( Sfm_Dec_t * p )
return 0;
}
}
- if ( p->iTarget + 1 < Vec_IntSize(&p->vObjTypes) )
+ if ( p->iTarget + 1 < nWinSize )
{
// create XOR clauses for the roots
- Vec_IntForEachEntry( &p->vTemp, iObj, i )
+ Vec_IntForEachEntry( vRoots, iObj, i )
{
- sat_solver_add_xor( p->pSat, iObj, 2*iObj + Vec_IntSize(&p->vObjTypes) - p->iTarget - 1, nSatVars++, 0 );
- Vec_IntWriteEntry( &p->vTemp, i, Abc_Var2Lit(nSatVars-1, 0) );
+ sat_solver_add_xor( p->pSat, iObj, iObj + nWinSize - nTfiSize, nSatVars++, 0 );
+ Vec_IntWriteEntry( vRoots, i, Abc_Var2Lit(nSatVars-1, 0) );
}
// make OR clause for the last nRoots variables
- RetValue = sat_solver_addclause( p->pSat, Vec_IntArray(&p->vTemp), Vec_IntLimit(&p->vTemp) );
+ RetValue = sat_solver_addclause( p->pSat, Vec_IntArray(vRoots), Vec_IntLimit(vRoots) );
if ( RetValue == 0 )
return 0;
assert( nSatVars == sat_solver_nvars(p->pSat) );
}
- else assert( Vec_IntSize(&p->vTemp) == 1 );
+ else assert( Vec_IntSize(vRoots) == 1 );
// finalize
RetValue = sat_solver_simplify( p->pSat );
p->timeCnf += Abc_Clock() - clk;
@@ -302,7 +229,7 @@ int Sfm_DecPeformDec( Sfm_Dec_t * p )
int fVerbose = 1;
int nBTLimit = 0;
abctime clk = Abc_Clock();
- int i, k, c, status, Lits[2];
+ int i, j, k, c, n, Pol, Pol2, Entry, Entry2, status, Lits[3];
// check stuck-at-0/1 (on/off-set empty)
p->nPats[0] = p->nPats[1] = 0;
for ( c = 0; c < 2; c++ )
@@ -314,18 +241,20 @@ int Sfm_DecPeformDec( Sfm_Dec_t * p )
if ( status == l_False )
{
Vec_IntPush( &p->vObjTypes, 0 );
- Vec_IntPush( &p->vObjGates, c );
+ Vec_IntPush( &p->vObjGates, c ? p->GateConst1 : p->GateConst0 );
Vec_WecPushLevel( &p->vObjFanins );
return 1;
}
assert( status == l_True );
// record this status
- for ( i = 0; i < p->iTarget; i++ )
+ for ( i = 0; i <= p->iTarget; i++ )
{
Vec_IntPush( &p->vPols[c], sat_solver_var_value(p->pSat, i) );
Vec_WrdPush( &p->vSets[c], 0 );
}
p->nPats[c]++;
+ Vec_IntClear( &p->vImpls[c] );
+ Vec_IntFill( &p->vTaken[c], p->iTarget, 0 );
}
// proceed checking divisors based on their values
for ( c = 0; c < 2; c++ )
@@ -335,42 +264,101 @@ int Sfm_DecPeformDec( Sfm_Dec_t * p )
{
if ( Vec_WrdEntry(&p->vSets[c], i) ) // diff value is possible
continue;
- Lits[1] = Abc_Var2Lit( i, Vec_IntEntry(&p->vPols[c], i) );
+ Pol = Vec_IntEntry(&p->vPols[c], i);
+ Lits[1] = Abc_Var2Lit( i, Pol );
status = sat_solver_solve( p->pSat, Lits, Lits + 2, nBTLimit, 0, 0, 0 );
if ( status == l_Undef )
return 0;
if ( status == l_False )
{
- Vec_IntPush( &p->vImpls[c], i );
+ Vec_IntWriteEntry( &p->vTaken[c], i, 1 );
+ Vec_IntPushTwo( &p->vImpls[c], Abc_Var2Lit(i, Pol), -1 );
continue;
}
assert( status == l_True );
+ if ( p->nPats[c] == 64 )
+ continue;
// record this status
- for ( i = 0; i < p->iTarget; i++ )
- if ( sat_solver_var_value(p->pSat, i) ^ Vec_IntEntry(&p->vPols[c], i) )
- *Vec_WrdEntryP(&p->vSets[c], i) |= ((word)1 << p->nPats[c]);
+ for ( k = 0; k <= p->iTarget; k++ )
+ if ( sat_solver_var_value(p->pSat, k) ^ Vec_IntEntry(&p->vPols[c], k) )
+ *Vec_WrdEntryP(&p->vSets[c], k) |= ((word)1 << p->nPats[c]);
p->nPats[c]++;
}
}
+ // proceed checking divisor pairs
+ for ( c = 0; c < 2; c++ )
+ {
+ Lits[0] = Abc_Var2Lit( p->iTarget, c );
+ for ( i = 0; i < p->iTarget; i++ )
+ if ( !Vec_IntEntry(&p->vTaken[c], i) )
+ for ( j = 0; j < i; j++ )
+ if ( !Vec_IntEntry(&p->vTaken[c], j) )
+ {
+ word SignI = Vec_WrdEntry(&p->vSets[c], i);
+ word SignJ = Vec_WrdEntry(&p->vSets[c], j);
+ for ( n = 0; n < 3; n++ )
+ {
+ if ( ((n&1) ? ~SignI : SignI) & ((n>>1) ? ~SignJ : SignJ) ) // diff value is possible
+ continue;
+ Pol = Vec_IntEntry(&p->vPols[c], i) ^ (n&1);
+ Pol2 = Vec_IntEntry(&p->vPols[c], j) ^ (n>>1);
+ Lits[1] = Abc_Var2Lit( i, Pol );
+ Lits[2] = Abc_Var2Lit( j, Pol2 );
+ status = sat_solver_solve( p->pSat, Lits, Lits + 3, nBTLimit, 0, 0, 0 );
+ if ( status == l_Undef )
+ return 0;
+ if ( status == l_False )
+ {
+ Vec_IntPushTwo( &p->vImpls[c], Abc_Var2Lit(i, Pol), Abc_Var2Lit(j, Pol2) );
+ continue;
+ }
+ assert( status == l_True );
+ if ( p->nPats[c] == 64 )
+ continue;
+ // record this status
+ for ( k = 0; k <= p->iTarget; k++ )
+ if ( sat_solver_var_value(p->pSat, k) ^ Vec_IntEntry(&p->vPols[c], k) )
+ *Vec_WrdEntryP(&p->vSets[c], k) |= ((word)1 << p->nPats[c]);
+ p->nPats[c]++;
+ }
+ }
+ }
+
// print the results
if ( fVerbose )
for ( c = 0; c < 2; c++ )
{
- printf( "\nON-SET reference vertex:\n" );
- for ( i = 0; i < p->iTarget; i++ )
- printf( "%d", Vec_IntEntry(&p->vPols[c], i) );
+ Vec_Int_t * vLevel = Vec_WecEntry( &p->vObjFanins, p->iTarget );
+ printf( "\n%s-SET of object %d with gate \"%s\" and fanins: ", c ? "OFF": "ON", p->iTarget, Mio_GateReadName((Mio_Gate_t *)Vec_PtrEntry(&p->vGateHands, Vec_IntEntry(&p->vObjGates,p->iTarget))) );
+ Vec_IntForEachEntry( vLevel, Entry, i )
+ printf( "%d ", Entry );
+ printf( "\n" );
+
+ printf( "Implications: " );
+ Vec_IntForEachEntryDouble( &p->vImpls[c], Entry, Entry2, i )
+ {
+ if ( Entry2 == -1 )
+ printf( "%s%d ", Abc_LitIsCompl(Entry)? "!":"", Abc_Lit2Var(Entry) );
+ else
+ printf( "%s%d:%s%d ", Abc_LitIsCompl(Entry)? "!":"", Abc_Lit2Var(Entry), Abc_LitIsCompl(Entry2)? "!":"", Abc_Lit2Var(Entry2) );
+ }
printf( "\n" );
printf( " " );
- for ( i = 0; i < p->iTarget; i++ )
+ for ( i = 0; i <= p->iTarget; i++ )
+ printf( "%d", Vec_IntEntry(&p->vPols[c], i) );
+ printf( "\n\n" );
+ printf( " " );
+ for ( i = 0; i <= p->iTarget; i++ )
printf( "%d", i % 10 );
printf( "\n" );
for ( k = 0; k < p->nPats[c]; k++ )
{
printf( "%2d : ", k );
- for ( i = 0; i < p->iTarget; i++ )
+ for ( i = 0; i <= p->iTarget; i++ )
printf( "%d", (int)((Vec_WrdEntry(&p->vSets[c], i) >> k) & 1) );
printf( "\n" );
}
+ printf( "\n" );
}
p->timeSat += Abc_Clock() - clk;
return 1;
@@ -387,7 +375,7 @@ int Sfm_DecPeformDec( Sfm_Dec_t * p )
SeeAlso []
***********************************************************************/
-void Abc_NtkDfsReverseOne_rec( Abc_Obj_t * pNode, Vec_Int_t * vNodes )
+void Abc_NtkDfsReverseOne_rec( Abc_Obj_t * pNode, Vec_Int_t * vTfo )
{
Abc_Obj_t * pFanout; int i;
if ( Abc_NodeIsTravIdCurrent( pNode ) )
@@ -395,15 +383,15 @@ void Abc_NtkDfsReverseOne_rec( Abc_Obj_t * pNode, Vec_Int_t * vNodes )
Abc_NodeSetTravIdCurrent( pNode );
if ( Abc_ObjIsCo(pNode) )
{
- Vec_IntPush( vNodes, Abc_ObjId(pNode) );
+ Vec_IntPush( vTfo, Abc_ObjId(pNode) );
return;
}
assert( Abc_ObjIsNode( pNode ) );
Abc_ObjForEachFanout( pNode, pFanout, i )
- Abc_NtkDfsReverseOne_rec( pFanout, vNodes );
- Vec_IntPush( vNodes, Abc_ObjId(pNode) );
+ Abc_NtkDfsReverseOne_rec( pFanout, vTfo );
+ Vec_IntPush( vTfo, Abc_ObjId(pNode) );
}
-void Abc_NtkDfsOne_rec( Abc_Obj_t * pNode, Vec_Int_t * vMap, Vec_Int_t * vTypes )
+void Abc_NtkDfsOne_rec( Abc_Obj_t * pNode, Vec_Int_t * vTfi, Vec_Int_t * vTypes )
{
Abc_Obj_t * pFanin; int i;
if ( Abc_NodeIsTravIdCurrent( pNode ) )
@@ -411,31 +399,32 @@ void Abc_NtkDfsOne_rec( Abc_Obj_t * pNode, Vec_Int_t * vMap, Vec_Int_t * vTypes
Abc_NodeSetTravIdCurrent( pNode );
if ( Abc_ObjIsCi(pNode) )
{
- pNode->iTemp = Vec_IntSize(vMap);
- Vec_IntPush( vMap, Abc_ObjId(pNode) );
+ pNode->iTemp = Vec_IntSize(vTfi);
+ Vec_IntPush( vTfi, Abc_ObjId(pNode) );
Vec_IntPush( vTypes, 1 );
return;
}
assert( Abc_ObjIsNode(pNode) );
Abc_ObjForEachFanin( pNode, pFanin, i )
- Abc_NtkDfsOne_rec( pFanin, vMap, vTypes );
- pNode->iTemp = Vec_IntSize(vMap);
- Vec_IntPush( vMap, Abc_ObjId(pNode) );
+ Abc_NtkDfsOne_rec( pFanin, vTfi, vTypes );
+ pNode->iTemp = Vec_IntSize(vTfi);
+ Vec_IntPush( vTfi, Abc_ObjId(pNode) );
Vec_IntPush( vTypes, 0 );
}
-int Sfm_DecExtract( Abc_Ntk_t * pNtk, int iNode, Vec_Int_t * vTypes, Vec_Int_t * vGates, Vec_Wec_t * vFanins, Vec_Int_t * vMap, Vec_Int_t * vTemp )
+int Sfm_DecExtract( Abc_Ntk_t * pNtk, Abc_Obj_t * pNode, Vec_Int_t * vTypes, Vec_Int_t * vGates, Vec_Wec_t * vFanins, Vec_Int_t * vMap, Vec_Int_t * vTfo )
{
- Abc_Obj_t * pNode = Abc_NtkObj( pNtk, iNode );
Vec_Int_t * vLevel;
- int i, iObj, iTarget;
+ Abc_Obj_t * pFanin;
+ int i, k, iObj, iTarget;
assert( Abc_ObjIsNode(pNode) );
- // collect transitive fanout
- Vec_IntClear( vTemp );
+ // collect transitive fanout including COs
+ Vec_IntClear( vTfo );
Abc_NtkIncrementTravId( pNtk );
- Abc_NtkDfsReverseOne_rec( pNode, vTemp );
+ Abc_NtkDfsReverseOne_rec( pNode, vTfo );
// collect transitive fanin
Vec_IntClear( vMap );
Vec_IntClear( vTypes );
+ Abc_NtkIncrementTravId( pNtk );
Abc_NtkDfsOne_rec( pNode, vMap, vTypes );
Vec_IntPop( vMap );
Vec_IntPop( vTypes );
@@ -443,12 +432,12 @@ int Sfm_DecExtract( Abc_Ntk_t * pNtk, int iNode, Vec_Int_t * vTypes, Vec_Int_t *
// remember target node
iTarget = Vec_IntSize( vMap );
// add transitive fanout
- Vec_IntForEachEntryReverse( vTemp, iObj, i )
+ Vec_IntForEachEntryReverse( vTfo, iObj, i )
{
pNode = Abc_NtkObj( pNtk, iObj );
if ( Abc_ObjIsCo(pNode) )
{
- assert( Vec_IntEntry(vTypes, Abc_ObjFanin0(pNode)->iTemp) == 0 );
+ assert( Vec_IntEntry(vTypes, Abc_ObjFanin0(pNode)->iTemp) == 0 ); // CO points to a unique node
Vec_IntWriteEntry( vTypes, Abc_ObjFanin0(pNode)->iTemp, 2 );
continue;
}
@@ -469,74 +458,63 @@ int Sfm_DecExtract( Abc_Ntk_t * pNtk, int iNode, Vec_Int_t * vTypes, Vec_Int_t *
Vec_IntPush( vGates, -1 );
continue;
}
- assert( Abc_ObjFaninNum(pNode) == 2 );
- if ( !Abc_ObjFaninC0(pNode) && !Abc_ObjFaninC1(pNode) )
- Vec_IntPush( vGates, 4 );
- else if ( !Abc_ObjFaninC0(pNode) && Abc_ObjFaninC1(pNode) )
- Vec_IntPush( vGates, 5 );
- else if ( Abc_ObjFaninC0(pNode) && !Abc_ObjFaninC1(pNode) )
- Vec_IntPush( vGates, 6 );
- else //if ( Abc_ObjFaninC0(pNode) && Abc_ObjFaninC1(pNode) )
- Vec_IntPush( vGates, 7 );
- Vec_IntPush( vLevel, Abc_ObjFanin0(pNode)->iTemp );
- Vec_IntPush( vLevel, Abc_ObjFanin1(pNode)->iTemp );
+ Abc_ObjForEachFanin( pNode, pFanin, k )
+ Vec_IntPush( vLevel, pFanin->iTemp );
+ Vec_IntPush( vGates, Mio_GateReadValue((Mio_Gate_t *)pNode->pData) );
}
return iTarget;
}
-void Sfm_DecInsert( Abc_Ntk_t * pNtk, int iNode, int Limit, Vec_Int_t * vTypes, Vec_Int_t * vGates, Vec_Wec_t * vFanins, Vec_Int_t * vMap )
+void Sfm_DecInsert( Abc_Ntk_t * pNtk, int iNode, int Limit, Vec_Int_t * vTypes, Vec_Int_t * vGates, Vec_Wec_t * vFanins, Vec_Int_t * vMap, Vec_Ptr_t * vGateHandles )
{
Abc_Obj_t * pTarget = Abc_NtkObj( pNtk, iNode );
- Vec_Int_t * vLevel;
Abc_Obj_t * pObjNew = NULL;
int i, k, iObj, Gate;
+ // assuming that new gates are appended at the end
assert( Limit < Vec_IntSize(vTypes) );
+ // introduce new gates
Vec_IntForEachEntryStart( vGates, Gate, i, Limit )
{
- assert( Gate >= 0 && Gate <= 7 );
- vLevel = Vec_WecEntry( vFanins, i );
- if ( Gate == 0 )
- pObjNew = Abc_NtkCreateNodeConst0( pNtk );
- else if ( Gate == 1 )
- pObjNew = Abc_NtkCreateNodeConst1( pNtk );
- else if ( Gate == 2 )
- pObjNew = Abc_NtkCreateNodeBuf( pNtk, Abc_NtkObj(pNtk, Vec_IntEntry(vMap, Vec_IntEntry(vLevel,0))) );
- else if ( Gate == 3 )
- pObjNew = Abc_NtkCreateNodeInv( pNtk, Abc_NtkObj(pNtk, Vec_IntEntry(vMap, Vec_IntEntry(vLevel,0))) );
- else // if ( Gate >= 4 )
- {
- pObjNew = Abc_NtkCreateNode( pNtk );
- Vec_IntForEachEntry( vLevel, iObj, k )
- Abc_ObjAddFanin( pObjNew, Abc_NtkObj(pNtk, Vec_IntEntry(vMap, iObj)) );
- pObjNew->pData = NULL; // SELECTION FUNCTION
- }
- // transfer the fanout
- Abc_ObjTransferFanout( pTarget, pObjNew );
- assert( Abc_ObjFanoutNum(pTarget) == 0 );
- Abc_NtkDeleteObj_rec( pTarget, 1 );
+ Vec_Int_t * vLevel = Vec_WecEntry( vFanins, i );
+ pObjNew = Abc_NtkCreateNode( pNtk );
+ Vec_IntForEachEntry( vLevel, iObj, k )
+ Abc_ObjAddFanin( pObjNew, Abc_NtkObj(pNtk, Vec_IntEntry(vMap, iObj)) );
+ pObjNew->pData = Vec_PtrEntry( vGateHandles, Gate );
}
+ // transfer the fanout
+ Abc_ObjTransferFanout( pTarget, pObjNew );
+ assert( Abc_ObjFanoutNum(pTarget) == 0 );
+ Abc_NtkDeleteObj_rec( pTarget, 1 );
}
-void Sfm_DecTestBench( Abc_Ntk_t * pNtk )
+void Sfm_DecTestBench( Abc_Ntk_t * pNtk, int iNode )
{
- Vec_Int_t * vMap, * vTemp;
- Abc_Obj_t * pObj; int i, Limit;
+ extern void Sfm_LibPreprocess( Mio_Library_t * pLib, Vec_Int_t * vGateSizes, Vec_Wrd_t * vGateFuncs, Vec_Wec_t * vGateCnfs, Vec_Ptr_t * vGateHands );
+ Mio_Library_t * pLib = (Mio_Library_t *)pNtk->pManFunc;
Sfm_Dec_t * p = Sfm_DecStart();
- Sfm_DecCreateAigLibrary( p );
- assert( Abc_NtkIsSopLogic(pNtk) );
- assert( Abc_NtkGetFaninMax(pNtk) <= 2 );
- vMap = Vec_IntAlloc( Abc_NtkObjNumMax(pNtk) ); // Sfm->Ntk
- vTemp = Vec_IntAlloc( Abc_NtkObjNumMax(pNtk) );
- Abc_NtkForEachNode( pNtk, pObj, i )
+ Vec_Int_t * vMap = Vec_IntAlloc( Abc_NtkObjNumMax(pNtk) ); // Sfm->Ntk
+ Abc_Obj_t * pObj;
+ int i, Limit;
+ // enter library
+ assert( Abc_NtkIsMappedLogic(pNtk) );
+ Sfm_LibPreprocess( pLib, &p->vGateSizes, &p->vGateFuncs, &p->vGateCnfs, &p->vGateHands );
+ p->GateConst0 = Mio_GateReadValue( Mio_LibraryReadConst0(pLib) );
+ p->GateConst1 = Mio_GateReadValue( Mio_LibraryReadConst1(pLib) );
+ p->GateBuffer = Mio_GateReadValue( Mio_LibraryReadBuf(pLib) );
+ p->GateInvert = Mio_GateReadValue( Mio_LibraryReadInv(pLib) );
+ // iterate over nodes
+// Abc_NtkForEachNode( pNtk, pObj, i )
+ for ( ; pObj = Abc_NtkObj(pNtk, iNode); )
{
- p->iTarget = Sfm_DecExtract( pNtk, i, &p->vObjTypes, &p->vObjGates, &p->vObjFanins, vMap, vTemp );
+ p->iTarget = Sfm_DecExtract( pNtk, pObj, &p->vObjTypes, &p->vObjGates, &p->vObjFanins, vMap, &p->vTemp );
Limit = Vec_IntSize( &p->vObjTypes );
if ( !Sfm_DecPrepareSolver( p ) )
continue;
if ( !Sfm_DecPeformDec( p ) )
continue;
- Sfm_DecInsert( pNtk, p->iTarget, Limit, &p->vObjTypes, &p->vObjGates, &p->vObjFanins, vMap );
+// Sfm_DecInsert( pNtk, p->iTarget, Limit, &p->vObjTypes, &p->vObjGates, &p->vObjFanins, vMap, vGateHandles );
+
+ break;
}
Vec_IntFree( vMap );
- Vec_IntFree( vTemp );
Sfm_DecStop( p );
}
diff --git a/src/opt/sfm/sfmLib.c b/src/opt/sfm/sfmLib.c
new file mode 100644
index 00000000..fefa21bb
--- /dev/null
+++ b/src/opt/sfm/sfmLib.c
@@ -0,0 +1,102 @@
+/**CFile****************************************************************
+
+ FileName [sfmLib.c]
+
+ SystemName [ABC: Logic synthesis and verification system.]
+
+ PackageName [SAT-based optimization using internal don't-cares.]
+
+ Synopsis [Preprocessing genlib library.]
+
+ Author [Alan Mishchenko]
+
+ Affiliation [UC Berkeley]
+
+ Date [Ver. 1.0. Started - June 20, 2005.]
+
+ Revision [$Id: sfmLib.c,v 1.00 2005/06/20 00:00:00 alanmi Exp $]
+
+***********************************************************************/
+
+#include "sfmInt.h"
+#include "misc/st/st.h"
+#include "map/mio/mio.h"
+
+ABC_NAMESPACE_IMPL_START
+
+
+////////////////////////////////////////////////////////////////////////
+/// DECLARATIONS ///
+////////////////////////////////////////////////////////////////////////
+
+////////////////////////////////////////////////////////////////////////
+/// FUNCTION DEFINITIONS ///
+////////////////////////////////////////////////////////////////////////
+
+/**Function*************************************************************
+
+ Synopsis []
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+void Sfm_DecCreateCnf( Vec_Int_t * vGateSizes, Vec_Wrd_t * vGateFuncs, Vec_Wec_t * vGateCnfs )
+{
+ Vec_Str_t * vCnf, * vCnfBase;
+ Vec_Int_t * vCover;
+ word uTruth;
+ int i, nCubes;
+ vCnf = Vec_StrAlloc( 100 );
+ vCover = Vec_IntAlloc( 100 );
+ Vec_WrdForEachEntry( vGateFuncs, uTruth, i )
+ {
+ nCubes = Sfm_TruthToCnf( uTruth, Vec_IntEntry(vGateSizes, i), vCover, vCnf );
+ vCnfBase = (Vec_Str_t *)Vec_WecEntry( vGateCnfs, i );
+ Vec_StrGrow( vCnfBase, Vec_StrSize(vCnf) );
+ memcpy( Vec_StrArray(vCnfBase), Vec_StrArray(vCnf), Vec_StrSize(vCnf) );
+ vCnfBase->nSize = Vec_StrSize(vCnf);
+ }
+ Vec_IntFree( vCover );
+ Vec_StrFree( vCnf );
+}
+
+/**Function*************************************************************
+
+ Synopsis [Preprocess the library.]
+
+ Description []
+
+ SideEffects []
+
+ SeeAlso []
+
+***********************************************************************/
+void Sfm_LibPreprocess( Mio_Library_t * pLib, Vec_Int_t * vGateSizes, Vec_Wrd_t * vGateFuncs, Vec_Wec_t * vGateCnfs, Vec_Ptr_t * vGateHands )
+{
+ Mio_Gate_t * pGate;
+ int nGates = Mio_LibraryReadGateNum(pLib);
+ Vec_IntGrow( vGateSizes, nGates );
+ Vec_WrdGrow( vGateFuncs, nGates );
+ Vec_WecInit( vGateCnfs, nGates );
+ Vec_PtrGrow( vGateHands, nGates );
+ Mio_LibraryForEachGate( pLib, pGate )
+ {
+ Vec_IntPush( vGateSizes, Mio_GateReadPinNum(pGate) );
+ Vec_WrdPush( vGateFuncs, Mio_GateReadTruth(pGate) );
+ Mio_GateSetValue( pGate, Vec_PtrSize(vGateHands) );
+ Vec_PtrPush( vGateHands, pGate );
+ }
+ Sfm_DecCreateCnf( vGateSizes, vGateFuncs, vGateCnfs );
+}
+
+////////////////////////////////////////////////////////////////////////
+/// END OF FILE ///
+////////////////////////////////////////////////////////////////////////
+
+
+ABC_NAMESPACE_IMPL_END
+